From ac6a656f62f6aa521e0a5e9fd6fb7c81de0e1599 Mon Sep 17 00:00:00 2001
From: Hebilicious <xsh4k3@gmail.com>
Date: Thu, 19 Feb 2026 23:40:42 +0700
Subject: [PATCH 1/4] chore: migrate deno workspace to moon/proto node setup

---
 .agents/skills/cssforge                       |     1 +
 .agents/skills/moon/SKILL.md                  |   325 +
 .agents/skills/moon/examples/ci-workflow.yml  |   186 +
 .agents/skills/moon/examples/moon.yml         |   178 +
 .agents/skills/moon/examples/workspace.yml    |    67 +
 .../skills/moon/references/cli-reference.md   |   222 +
 .agents/skills/moon/references/task-config.md |   743 +
 .../skills/moon/references/v2-migration.md    |   258 +
 .../moon/references/workspace-config.md       |   281 +
 .agents/skills/proto/SKILL.md                 |   349 +
 .../proto/examples/prototools-full.toml       |    84 +
 .agents/skills/proto/references/commands.md   |   235 +
 .agents/skills/proto/references/config.md     |   195 +
 .agents/skills/using-git-worktrees/SKILL.md   |   218 +
 .claude/skills/cssforge                       |     1 +
 .claude/skills/using-git-worktrees            |     1 +
 .github/workflows/ci.yaml                     |    46 +-
 .github/workflows/release.yaml                |    34 +-
 .gitignore                                    |     6 +-
 .moon/tasks/node.yml                          |    23 +
 .moon/toolchains.yml                          |    11 +
 .moon/workspace.yml                           |    15 +
 .prototools                                   |     8 +
 AGENTS.md                                     |    13 +-
 CLAUDE.md                                     |     1 +
 README.md                                     |   254 +-
 biome.json                                    |    11 +
 deno.json                                     |    35 -
 deno.lock                                     |   713 -
 docs/migration-plan-node-moon-proto.md        |   102 +
 example/basic/cssforge.config.ts              |     2 +-
 example/basic/generate-css.ts                 |    19 +-
 example/tailwind-nextjs/.gitignore            |    45 +
 example/tailwind-nextjs/README.md             |    35 +
 example/tailwind-nextjs/app/favicon.ico       |   Bin 0 -> 25931 bytes
 example/tailwind-nextjs/app/globals.css       |     7 +
 example/tailwind-nextjs/app/layout.tsx        |    32 +
 example/tailwind-nextjs/app/page.tsx          |    18 +
 example/tailwind-nextjs/cssforge.config.ts    |    46 +
 example/tailwind-nextjs/eslint.config.mjs     |    18 +
 example/tailwind-nextjs/moon.yml              |    78 +
 example/tailwind-nextjs/next.config.ts        |     7 +
 example/tailwind-nextjs/package.json          |    23 +
 example/tailwind-nextjs/playwright.config.ts  |    25 +
 example/tailwind-nextjs/postcss.config.mjs    |     7 +
 example/tailwind-nextjs/public/file.svg       |     1 +
 example/tailwind-nextjs/public/globe.svg      |     1 +
 example/tailwind-nextjs/public/next.svg       |     1 +
 example/tailwind-nextjs/public/vercel.svg     |     1 +
 example/tailwind-nextjs/public/window.svg     |     1 +
 example/tailwind-nextjs/tests/e2e.spec.ts     |    34 +
 example/tailwind-nextjs/tsconfig.json         |    47 +
 example/tailwind-nuxt/.gitignore              |    28 +
 example/tailwind-nuxt/README.md               |    35 +
 example/tailwind-nuxt/app/app.vue             |    16 +
 example/tailwind-nuxt/app/assets/css/main.css |     7 +
 example/tailwind-nuxt/cssforge.config.ts      |    46 +
 example/tailwind-nuxt/moon.yml                |    89 +
 example/tailwind-nuxt/nuxt.config.ts          |    10 +
 example/tailwind-nuxt/package.json            |    17 +
 example/tailwind-nuxt/playwright.config.ts    |    25 +
 example/tailwind-nuxt/public/favicon.ico      |   Bin 0 -> 4286 bytes
 example/tailwind-nuxt/public/robots.txt       |     2 +
 example/tailwind-nuxt/tests/e2e.spec.ts       |    34 +
 example/tailwind-nuxt/tsconfig.json           |    18 +
 example/tailwind-solidstart/.gitignore        |    32 +
 example/tailwind-solidstart/README.md         |    36 +
 example/tailwind-solidstart/app.config.ts     |     8 +
 .../tailwind-solidstart/cssforge.config.ts    |    46 +
 example/tailwind-solidstart/moon.yml          |    73 +
 example/tailwind-solidstart/package.json      |    20 +
 .../tailwind-solidstart/playwright.config.ts  |    25 +
 .../tailwind-solidstart/public/favicon.ico    |   Bin 0 -> 664 bytes
 example/tailwind-solidstart/src/app.css       |     7 +
 example/tailwind-solidstart/src/app.tsx       |    12 +
 .../src/components/Counter.tsx                |    13 +
 .../src/components/Nav.tsx                    |    19 +
 .../tailwind-solidstart/src/entry-client.tsx  |     4 +
 .../tailwind-solidstart/src/entry-server.tsx  |    21 +
 example/tailwind-solidstart/src/global.d.ts   |     1 +
 .../src/routes/[...404].tsx                   |    25 +
 .../tailwind-solidstart/src/routes/about.tsx  |    25 +
 .../tailwind-solidstart/src/routes/index.tsx  |    18 +
 example/tailwind-solidstart/tests/e2e.spec.ts |    34 +
 example/tailwind-solidstart/tsconfig.json     |    19 +
 example/tailwind-sveltekit/.gitignore         |    27 +
 example/tailwind-sveltekit/.npmrc             |     1 +
 example/tailwind-sveltekit/README.md          |    36 +
 example/tailwind-sveltekit/cssforge.config.ts |    46 +
 example/tailwind-sveltekit/moon.yml           |    96 +
 example/tailwind-sveltekit/package.json       |    20 +
 .../tailwind-sveltekit/playwright.config.ts   |    25 +
 example/tailwind-sveltekit/src/app.css        |     7 +
 example/tailwind-sveltekit/src/app.d.ts       |    13 +
 example/tailwind-sveltekit/src/app.html       |    11 +
 .../src/lib/assets/favicon.svg                |     1 +
 example/tailwind-sveltekit/src/lib/index.ts   |     1 +
 .../src/routes/+layout.svelte                 |     7 +
 .../src/routes/+page.svelte                   |    14 +
 example/tailwind-sveltekit/static/robots.txt  |     3 +
 example/tailwind-sveltekit/svelte.config.js   |    13 +
 example/tailwind-sveltekit/tests/e2e.spec.ts  |    34 +
 example/tailwind-sveltekit/tsconfig.json      |    20 +
 example/tailwind-sveltekit/vite.config.ts     |     7 +
 example/vanilla-react-css/.gitignore          |    28 +
 example/vanilla-react-css/README.md           |    34 +
 example/vanilla-react-css/cssforge.config.ts  |    46 +
 example/vanilla-react-css/eslint.config.js    |    23 +
 example/vanilla-react-css/index.html          |    13 +
 example/vanilla-react-css/moon.yml            |    76 +
 example/vanilla-react-css/package.json        |    27 +
 .../vanilla-react-css/playwright.config.ts    |    25 +
 example/vanilla-react-css/public/vite.svg     |     1 +
 example/vanilla-react-css/src/App.css         |    14 +
 example/vanilla-react-css/src/App.tsx         |    17 +
 .../vanilla-react-css/src/assets/react.svg    |     1 +
 example/vanilla-react-css/src/index.css       |    16 +
 example/vanilla-react-css/src/main.tsx        |    10 +
 example/vanilla-react-css/tests/e2e.spec.ts   |    34 +
 example/vanilla-react-css/tsconfig.app.json   |    28 +
 example/vanilla-react-css/tsconfig.json       |    14 +
 example/vanilla-react-css/tsconfig.node.json  |    26 +
 example/vanilla-react-css/vite.config.ts      |     7 +
 example/vanilla-solid-css/.gitignore          |    28 +
 example/vanilla-solid-css/README.md           |    34 +
 example/vanilla-solid-css/cssforge.config.ts  |    46 +
 example/vanilla-solid-css/index.html          |    13 +
 example/vanilla-solid-css/moon.yml            |    71 +
 example/vanilla-solid-css/package.json        |    18 +
 .../vanilla-solid-css/playwright.config.ts    |    25 +
 example/vanilla-solid-css/public/vite.svg     |     1 +
 example/vanilla-solid-css/src/App.css         |    14 +
 example/vanilla-solid-css/src/App.tsx         |    17 +
 .../vanilla-solid-css/src/assets/solid.svg    |     1 +
 example/vanilla-solid-css/src/index.css       |    16 +
 example/vanilla-solid-css/src/index.tsx       |     8 +
 example/vanilla-solid-css/tests/e2e.spec.ts   |    34 +
 example/vanilla-solid-css/tsconfig.app.json   |    29 +
 example/vanilla-solid-css/tsconfig.json       |     7 +
 example/vanilla-solid-css/tsconfig.node.json  |    26 +
 example/vanilla-solid-css/vite.config.ts      |     6 +
 example/vanilla-svelte-css/.gitignore         |    28 +
 .../.vscode/extensions.json                   |     3 +
 example/vanilla-svelte-css/README.md          |    34 +
 example/vanilla-svelte-css/cssforge.config.ts |    46 +
 example/vanilla-svelte-css/index.html         |    13 +
 example/vanilla-svelte-css/moon.yml           |    76 +
 example/vanilla-svelte-css/package.json       |    18 +
 .../vanilla-svelte-css/playwright.config.ts   |    25 +
 example/vanilla-svelte-css/public/vite.svg    |     1 +
 example/vanilla-svelte-css/src/App.svelte     |     9 +
 example/vanilla-svelte-css/src/app.css        |    31 +
 .../vanilla-svelte-css/src/assets/svelte.svg  |     1 +
 .../vanilla-svelte-css/src/lib/Counter.svelte |    10 +
 example/vanilla-svelte-css/src/main.ts        |     9 +
 example/vanilla-svelte-css/svelte.config.js   |     8 +
 example/vanilla-svelte-css/tests/e2e.spec.ts  |    34 +
 example/vanilla-svelte-css/tsconfig.app.json  |    21 +
 example/vanilla-svelte-css/tsconfig.json      |     7 +
 example/vanilla-svelte-css/tsconfig.node.json |    26 +
 example/vanilla-svelte-css/vite.config.ts     |     7 +
 example/vanilla-vue-css/.gitignore            |    28 +
 .../vanilla-vue-css/.vscode/extensions.json   |     3 +
 example/vanilla-vue-css/README.md             |    34 +
 example/vanilla-vue-css/cssforge.config.ts    |    46 +
 example/vanilla-vue-css/index.html            |    13 +
 example/vanilla-vue-css/moon.yml              |    71 +
 example/vanilla-vue-css/package.json          |    20 +
 example/vanilla-vue-css/playwright.config.ts  |    25 +
 example/vanilla-vue-css/public/vite.svg       |     1 +
 example/vanilla-vue-css/src/App.vue           |    11 +
 example/vanilla-vue-css/src/assets/vue.svg    |     1 +
 .../src/components/HelloWorld.vue             |    41 +
 example/vanilla-vue-css/src/main.ts           |     5 +
 example/vanilla-vue-css/src/style.css         |    31 +
 example/vanilla-vue-css/tests/e2e.spec.ts     |    34 +
 example/vanilla-vue-css/tsconfig.app.json     |    16 +
 example/vanilla-vue-css/tsconfig.json         |     7 +
 example/vanilla-vue-css/tsconfig.node.json    |    26 +
 example/vanilla-vue-css/vite.config.ts        |     7 +
 package.json                                  |    13 +-
 .../cssforge/CHANGELOG.md                     |     0
 packages/cssforge/README.md                   |  1089 ++
 packages/cssforge/deno.json                   |    18 +
 packages/cssforge/moon.yml                    |   112 +
 packages/cssforge/package.json                |    39 +
 packages/cssforge/scripts/sync-version.js     |    16 +
 packages/cssforge/scripts/update-readme.ts    |   156 +
 packages/cssforge/src/cli.ts                  |   218 +
 {src => packages/cssforge/src}/config.ts      |    34 +-
 packages/cssforge/src/generator.ts            |   230 +
 packages/cssforge/src/helpers.ts              |    53 +
 packages/cssforge/src/lib.ts                  |   147 +
 packages/cssforge/src/mod.ts                  |    59 +
 packages/cssforge/src/modules/colors.ts       |   423 +
 packages/cssforge/src/modules/primitive.ts    |   138 +
 packages/cssforge/src/modules/spacing.ts      |   128 +
 packages/cssforge/src/modules/typography.ts   |   123 +
 .../tests/__snapshots__/colors.test.ts.snap   |   460 +
 .../__snapshots__/primitive.test.ts.snap      |   180 +
 .../tests/__snapshots__/spacing.test.ts.snap  |   293 +
 .../__snapshots__/typography.test.ts.snap     |   274 +
 packages/cssforge/tests/colors.test.ts        |   589 +
 {tests => packages/cssforge/tests}/helpers.ts |     6 +-
 packages/cssforge/tests/primitive.test.ts     |   231 +
 packages/cssforge/tests/spacing.test.ts       |   207 +
 packages/cssforge/tests/typography.test.ts    |   162 +
 packages/cssforge/tests/vitest-compat.ts      |    18 +
 packages/cssforge/tsconfig.json               |    13 +
 packages/cssforge/tsup.config.ts              |    14 +
 packages/cssforge/vitest.config.ts            |     7 +
 packages/repo-tools/moon.yml                  |    15 +
 pnpm-lock.yaml                                | 13227 ++++++++++++++++
 pnpm-workspace.yaml                           |     3 +
 scripts/sync-version.js                       |    15 -
 scripts/update-readme.ts                      |   193 -
 skills/cssforge/SKILL.md                      |    52 +
 .../assets/config-templates/minimal.ts        |    29 +
 .../assets/config-templates/tailwind.ts       |    46 +
 .../assets/config-templates/vanilla-css.ts    |    26 +
 .../assets/snippets/css-import-tailwind.css   |     2 +
 .../assets/snippets/css-import-vanilla.css    |     1 +
 skills/cssforge/references/cli-reference.md   |    27 +
 skills/cssforge/references/docs-index.md      |    31 +
 .../cssforge/references/source-schema-map.md  |    28 +
 skills/cssforge/references/token-patterns.md  |    31 +
 skills/cssforge/references/troubleshooting.md |    29 +
 skills/moon                                   |     1 +
 skills/proto                                  |     1 +
 src/cli.ts                                    |   202 -
 src/generator.ts                              |   218 -
 src/helpers.ts                                |    55 -
 src/lib.ts                                    |   144 -
 src/mod.ts                                    |    59 -
 src/modules/colors.ts                         |   429 -
 src/modules/primitive.ts                      |   147 -
 src/modules/spacing.ts                        |   128 -
 src/modules/typography.ts                     |   123 -
 tests/__snapshots__/colors.test.ts.snap       |   460 -
 tests/__snapshots__/primitive.test.ts.snap    |   180 -
 tests/__snapshots__/spacing.test.ts.snap      |   293 -
 tests/__snapshots__/typography.test.ts.snap   |   274 -
 tests/colors.test.ts                          |   624 -
 tests/primitive.test.ts                       |   232 -
 tests/spacing.test.ts                         |   204 -
 tests/typography.test.ts                      |   187 -
 tsconfig.base.json                            |    14 +
 247 files changed, 25928 insertions(+), 5124 deletions(-)
 create mode 120000 .agents/skills/cssforge
 create mode 100644 .agents/skills/moon/SKILL.md
 create mode 100644 .agents/skills/moon/examples/ci-workflow.yml
 create mode 100644 .agents/skills/moon/examples/moon.yml
 create mode 100644 .agents/skills/moon/examples/workspace.yml
 create mode 100644 .agents/skills/moon/references/cli-reference.md
 create mode 100644 .agents/skills/moon/references/task-config.md
 create mode 100644 .agents/skills/moon/references/v2-migration.md
 create mode 100644 .agents/skills/moon/references/workspace-config.md
 create mode 100644 .agents/skills/proto/SKILL.md
 create mode 100644 .agents/skills/proto/examples/prototools-full.toml
 create mode 100644 .agents/skills/proto/references/commands.md
 create mode 100644 .agents/skills/proto/references/config.md
 create mode 100644 .agents/skills/using-git-worktrees/SKILL.md
 create mode 120000 .claude/skills/cssforge
 create mode 120000 .claude/skills/using-git-worktrees
 create mode 100644 .moon/tasks/node.yml
 create mode 100644 .moon/toolchains.yml
 create mode 100644 .moon/workspace.yml
 create mode 100644 .prototools
 create mode 100644 CLAUDE.md
 create mode 100644 biome.json
 delete mode 100644 deno.json
 delete mode 100644 deno.lock
 create mode 100644 docs/migration-plan-node-moon-proto.md
 create mode 100644 example/tailwind-nextjs/.gitignore
 create mode 100644 example/tailwind-nextjs/README.md
 create mode 100644 example/tailwind-nextjs/app/favicon.ico
 create mode 100644 example/tailwind-nextjs/app/globals.css
 create mode 100644 example/tailwind-nextjs/app/layout.tsx
 create mode 100644 example/tailwind-nextjs/app/page.tsx
 create mode 100644 example/tailwind-nextjs/cssforge.config.ts
 create mode 100644 example/tailwind-nextjs/eslint.config.mjs
 create mode 100644 example/tailwind-nextjs/moon.yml
 create mode 100644 example/tailwind-nextjs/next.config.ts
 create mode 100644 example/tailwind-nextjs/package.json
 create mode 100644 example/tailwind-nextjs/playwright.config.ts
 create mode 100644 example/tailwind-nextjs/postcss.config.mjs
 create mode 100644 example/tailwind-nextjs/public/file.svg
 create mode 100644 example/tailwind-nextjs/public/globe.svg
 create mode 100644 example/tailwind-nextjs/public/next.svg
 create mode 100644 example/tailwind-nextjs/public/vercel.svg
 create mode 100644 example/tailwind-nextjs/public/window.svg
 create mode 100644 example/tailwind-nextjs/tests/e2e.spec.ts
 create mode 100644 example/tailwind-nextjs/tsconfig.json
 create mode 100644 example/tailwind-nuxt/.gitignore
 create mode 100644 example/tailwind-nuxt/README.md
 create mode 100644 example/tailwind-nuxt/app/app.vue
 create mode 100644 example/tailwind-nuxt/app/assets/css/main.css
 create mode 100644 example/tailwind-nuxt/cssforge.config.ts
 create mode 100644 example/tailwind-nuxt/moon.yml
 create mode 100644 example/tailwind-nuxt/nuxt.config.ts
 create mode 100644 example/tailwind-nuxt/package.json
 create mode 100644 example/tailwind-nuxt/playwright.config.ts
 create mode 100644 example/tailwind-nuxt/public/favicon.ico
 create mode 100644 example/tailwind-nuxt/public/robots.txt
 create mode 100644 example/tailwind-nuxt/tests/e2e.spec.ts
 create mode 100644 example/tailwind-nuxt/tsconfig.json
 create mode 100644 example/tailwind-solidstart/.gitignore
 create mode 100644 example/tailwind-solidstart/README.md
 create mode 100644 example/tailwind-solidstart/app.config.ts
 create mode 100644 example/tailwind-solidstart/cssforge.config.ts
 create mode 100644 example/tailwind-solidstart/moon.yml
 create mode 100644 example/tailwind-solidstart/package.json
 create mode 100644 example/tailwind-solidstart/playwright.config.ts
 create mode 100644 example/tailwind-solidstart/public/favicon.ico
 create mode 100644 example/tailwind-solidstart/src/app.css
 create mode 100644 example/tailwind-solidstart/src/app.tsx
 create mode 100644 example/tailwind-solidstart/src/components/Counter.tsx
 create mode 100644 example/tailwind-solidstart/src/components/Nav.tsx
 create mode 100644 example/tailwind-solidstart/src/entry-client.tsx
 create mode 100644 example/tailwind-solidstart/src/entry-server.tsx
 create mode 100644 example/tailwind-solidstart/src/global.d.ts
 create mode 100644 example/tailwind-solidstart/src/routes/[...404].tsx
 create mode 100644 example/tailwind-solidstart/src/routes/about.tsx
 create mode 100644 example/tailwind-solidstart/src/routes/index.tsx
 create mode 100644 example/tailwind-solidstart/tests/e2e.spec.ts
 create mode 100644 example/tailwind-solidstart/tsconfig.json
 create mode 100644 example/tailwind-sveltekit/.gitignore
 create mode 100644 example/tailwind-sveltekit/.npmrc
 create mode 100644 example/tailwind-sveltekit/README.md
 create mode 100644 example/tailwind-sveltekit/cssforge.config.ts
 create mode 100644 example/tailwind-sveltekit/moon.yml
 create mode 100644 example/tailwind-sveltekit/package.json
 create mode 100644 example/tailwind-sveltekit/playwright.config.ts
 create mode 100644 example/tailwind-sveltekit/src/app.css
 create mode 100644 example/tailwind-sveltekit/src/app.d.ts
 create mode 100644 example/tailwind-sveltekit/src/app.html
 create mode 100644 example/tailwind-sveltekit/src/lib/assets/favicon.svg
 create mode 100644 example/tailwind-sveltekit/src/lib/index.ts
 create mode 100644 example/tailwind-sveltekit/src/routes/+layout.svelte
 create mode 100644 example/tailwind-sveltekit/src/routes/+page.svelte
 create mode 100644 example/tailwind-sveltekit/static/robots.txt
 create mode 100644 example/tailwind-sveltekit/svelte.config.js
 create mode 100644 example/tailwind-sveltekit/tests/e2e.spec.ts
 create mode 100644 example/tailwind-sveltekit/tsconfig.json
 create mode 100644 example/tailwind-sveltekit/vite.config.ts
 create mode 100644 example/vanilla-react-css/.gitignore
 create mode 100644 example/vanilla-react-css/README.md
 create mode 100644 example/vanilla-react-css/cssforge.config.ts
 create mode 100644 example/vanilla-react-css/eslint.config.js
 create mode 100644 example/vanilla-react-css/index.html
 create mode 100644 example/vanilla-react-css/moon.yml
 create mode 100644 example/vanilla-react-css/package.json
 create mode 100644 example/vanilla-react-css/playwright.config.ts
 create mode 100644 example/vanilla-react-css/public/vite.svg
 create mode 100644 example/vanilla-react-css/src/App.css
 create mode 100644 example/vanilla-react-css/src/App.tsx
 create mode 100644 example/vanilla-react-css/src/assets/react.svg
 create mode 100644 example/vanilla-react-css/src/index.css
 create mode 100644 example/vanilla-react-css/src/main.tsx
 create mode 100644 example/vanilla-react-css/tests/e2e.spec.ts
 create mode 100644 example/vanilla-react-css/tsconfig.app.json
 create mode 100644 example/vanilla-react-css/tsconfig.json
 create mode 100644 example/vanilla-react-css/tsconfig.node.json
 create mode 100644 example/vanilla-react-css/vite.config.ts
 create mode 100644 example/vanilla-solid-css/.gitignore
 create mode 100644 example/vanilla-solid-css/README.md
 create mode 100644 example/vanilla-solid-css/cssforge.config.ts
 create mode 100644 example/vanilla-solid-css/index.html
 create mode 100644 example/vanilla-solid-css/moon.yml
 create mode 100644 example/vanilla-solid-css/package.json
 create mode 100644 example/vanilla-solid-css/playwright.config.ts
 create mode 100644 example/vanilla-solid-css/public/vite.svg
 create mode 100644 example/vanilla-solid-css/src/App.css
 create mode 100644 example/vanilla-solid-css/src/App.tsx
 create mode 100644 example/vanilla-solid-css/src/assets/solid.svg
 create mode 100644 example/vanilla-solid-css/src/index.css
 create mode 100644 example/vanilla-solid-css/src/index.tsx
 create mode 100644 example/vanilla-solid-css/tests/e2e.spec.ts
 create mode 100644 example/vanilla-solid-css/tsconfig.app.json
 create mode 100644 example/vanilla-solid-css/tsconfig.json
 create mode 100644 example/vanilla-solid-css/tsconfig.node.json
 create mode 100644 example/vanilla-solid-css/vite.config.ts
 create mode 100644 example/vanilla-svelte-css/.gitignore
 create mode 100644 example/vanilla-svelte-css/.vscode/extensions.json
 create mode 100644 example/vanilla-svelte-css/README.md
 create mode 100644 example/vanilla-svelte-css/cssforge.config.ts
 create mode 100644 example/vanilla-svelte-css/index.html
 create mode 100644 example/vanilla-svelte-css/moon.yml
 create mode 100644 example/vanilla-svelte-css/package.json
 create mode 100644 example/vanilla-svelte-css/playwright.config.ts
 create mode 100644 example/vanilla-svelte-css/public/vite.svg
 create mode 100644 example/vanilla-svelte-css/src/App.svelte
 create mode 100644 example/vanilla-svelte-css/src/app.css
 create mode 100644 example/vanilla-svelte-css/src/assets/svelte.svg
 create mode 100644 example/vanilla-svelte-css/src/lib/Counter.svelte
 create mode 100644 example/vanilla-svelte-css/src/main.ts
 create mode 100644 example/vanilla-svelte-css/svelte.config.js
 create mode 100644 example/vanilla-svelte-css/tests/e2e.spec.ts
 create mode 100644 example/vanilla-svelte-css/tsconfig.app.json
 create mode 100644 example/vanilla-svelte-css/tsconfig.json
 create mode 100644 example/vanilla-svelte-css/tsconfig.node.json
 create mode 100644 example/vanilla-svelte-css/vite.config.ts
 create mode 100644 example/vanilla-vue-css/.gitignore
 create mode 100644 example/vanilla-vue-css/.vscode/extensions.json
 create mode 100644 example/vanilla-vue-css/README.md
 create mode 100644 example/vanilla-vue-css/cssforge.config.ts
 create mode 100644 example/vanilla-vue-css/index.html
 create mode 100644 example/vanilla-vue-css/moon.yml
 create mode 100644 example/vanilla-vue-css/package.json
 create mode 100644 example/vanilla-vue-css/playwright.config.ts
 create mode 100644 example/vanilla-vue-css/public/vite.svg
 create mode 100644 example/vanilla-vue-css/src/App.vue
 create mode 100644 example/vanilla-vue-css/src/assets/vue.svg
 create mode 100644 example/vanilla-vue-css/src/components/HelloWorld.vue
 create mode 100644 example/vanilla-vue-css/src/main.ts
 create mode 100644 example/vanilla-vue-css/src/style.css
 create mode 100644 example/vanilla-vue-css/tests/e2e.spec.ts
 create mode 100644 example/vanilla-vue-css/tsconfig.app.json
 create mode 100644 example/vanilla-vue-css/tsconfig.json
 create mode 100644 example/vanilla-vue-css/tsconfig.node.json
 create mode 100644 example/vanilla-vue-css/vite.config.ts
 rename CHANGELOG.md => packages/cssforge/CHANGELOG.md (100%)
 create mode 100644 packages/cssforge/README.md
 create mode 100644 packages/cssforge/deno.json
 create mode 100644 packages/cssforge/moon.yml
 create mode 100644 packages/cssforge/package.json
 create mode 100644 packages/cssforge/scripts/sync-version.js
 create mode 100644 packages/cssforge/scripts/update-readme.ts
 create mode 100644 packages/cssforge/src/cli.ts
 rename {src => packages/cssforge/src}/config.ts (77%)
 create mode 100644 packages/cssforge/src/generator.ts
 create mode 100644 packages/cssforge/src/helpers.ts
 create mode 100644 packages/cssforge/src/lib.ts
 create mode 100644 packages/cssforge/src/mod.ts
 create mode 100644 packages/cssforge/src/modules/colors.ts
 create mode 100644 packages/cssforge/src/modules/primitive.ts
 create mode 100644 packages/cssforge/src/modules/spacing.ts
 create mode 100644 packages/cssforge/src/modules/typography.ts
 create mode 100644 packages/cssforge/tests/__snapshots__/colors.test.ts.snap
 create mode 100644 packages/cssforge/tests/__snapshots__/primitive.test.ts.snap
 create mode 100644 packages/cssforge/tests/__snapshots__/spacing.test.ts.snap
 create mode 100644 packages/cssforge/tests/__snapshots__/typography.test.ts.snap
 create mode 100644 packages/cssforge/tests/colors.test.ts
 rename {tests => packages/cssforge/tests}/helpers.ts (55%)
 create mode 100644 packages/cssforge/tests/primitive.test.ts
 create mode 100644 packages/cssforge/tests/spacing.test.ts
 create mode 100644 packages/cssforge/tests/typography.test.ts
 create mode 100644 packages/cssforge/tests/vitest-compat.ts
 create mode 100644 packages/cssforge/tsconfig.json
 create mode 100644 packages/cssforge/tsup.config.ts
 create mode 100644 packages/cssforge/vitest.config.ts
 create mode 100644 packages/repo-tools/moon.yml
 create mode 100644 pnpm-lock.yaml
 create mode 100644 pnpm-workspace.yaml
 delete mode 100644 scripts/sync-version.js
 delete mode 100644 scripts/update-readme.ts
 create mode 100644 skills/cssforge/SKILL.md
 create mode 100644 skills/cssforge/assets/config-templates/minimal.ts
 create mode 100644 skills/cssforge/assets/config-templates/tailwind.ts
 create mode 100644 skills/cssforge/assets/config-templates/vanilla-css.ts
 create mode 100644 skills/cssforge/assets/snippets/css-import-tailwind.css
 create mode 100644 skills/cssforge/assets/snippets/css-import-vanilla.css
 create mode 100644 skills/cssforge/references/cli-reference.md
 create mode 100644 skills/cssforge/references/docs-index.md
 create mode 100644 skills/cssforge/references/source-schema-map.md
 create mode 100644 skills/cssforge/references/token-patterns.md
 create mode 100644 skills/cssforge/references/troubleshooting.md
 create mode 120000 skills/moon
 create mode 120000 skills/proto
 delete mode 100644 src/cli.ts
 delete mode 100644 src/generator.ts
 delete mode 100644 src/helpers.ts
 delete mode 100644 src/lib.ts
 delete mode 100644 src/mod.ts
 delete mode 100644 src/modules/colors.ts
 delete mode 100644 src/modules/primitive.ts
 delete mode 100644 src/modules/spacing.ts
 delete mode 100644 src/modules/typography.ts
 delete mode 100644 tests/__snapshots__/colors.test.ts.snap
 delete mode 100644 tests/__snapshots__/primitive.test.ts.snap
 delete mode 100644 tests/__snapshots__/spacing.test.ts.snap
 delete mode 100644 tests/__snapshots__/typography.test.ts.snap
 delete mode 100644 tests/colors.test.ts
 delete mode 100644 tests/primitive.test.ts
 delete mode 100644 tests/spacing.test.ts
 delete mode 100644 tests/typography.test.ts
 create mode 100644 tsconfig.base.json

diff --git a/.agents/skills/cssforge b/.agents/skills/cssforge
new file mode 120000
index 0000000..2e01389
--- /dev/null
+++ b/.agents/skills/cssforge
@@ -0,0 +1 @@
+../../skills/cssforge
\ No newline at end of file
diff --git a/.agents/skills/moon/SKILL.md b/.agents/skills/moon/SKILL.md
new file mode 100644
index 0000000..04ced25
--- /dev/null
+++ b/.agents/skills/moon/SKILL.md
@@ -0,0 +1,325 @@
+---
+name: moon
+description: This skill should be used when the user asks to "configure moon", "set up moonrepo", "create moon tasks", "run moon commands", "configure moon workspace", "add moon project", "moon ci setup", "moon docker", "moon query", "migrate to moon v2", or mentions moon.yml, .moon/workspace.yml, .moon/toolchains.yml, moon run, moon ci, or moonrepo in general.
+---
+
+# moon - Polyglot Monorepo Build System
+
+moon is a Rust-based repository management, task orchestration, and build system for polyglot monorepos. It provides smart caching, dependency-aware task execution, and unified toolchain management.
+
+> **moon v2 is now available.** Run `moon migrate v2` to migrate. See `references/v2-migration.md` for breaking changes.
+
+## When to Use moon
+
+- Managing monorepos with multiple projects/packages
+- Orchestrating tasks across projects with dependencies
+- Caching build outputs for faster CI/local builds
+- Managing toolchain versions (Node.js, Rust, Python, Go, etc.)
+- Generating project and action graphs
+
+## Quick Reference
+
+### Core Commands
+
+```bash
+moon run <target>          # Run task(s)
+moon run :lint             # Run in all projects
+moon run '#tag:test'       # Run by tag
+moon ci                    # CI-optimized execution
+moon check --all           # Run all build/test tasks
+moon query projects        # List projects
+moon project-graph         # Visualize dependencies
+```
+
+### Target Syntax
+
+| Pattern        | Description                     |
+| -------------- | ------------------------------- |
+| `project:task` | Specific project and task       |
+| `:task`        | All projects with this task     |
+| `#tag:task`    | Projects with tag               |
+| `^:task`       | Upstream dependencies (in deps) |
+| `~:task`       | Current project (in configs)    |
+
+### Configuration Files
+
+| File                   | Purpose                                  |
+| ---------------------- | ---------------------------------------- |
+| `.moon/workspace.yml`  | Workspace settings, project discovery    |
+| `.moon/toolchains.yml` | Language versions, package managers (v2) |
+| `.moon/tasks/*.yml`    | Global inherited tasks (v2)              |
+| `moon.yml`             | Project-level config and tasks           |
+
+> **v2 Note:** `.moon/toolchain.yml` → `.moon/toolchains.yml` (plural), `.moon/tasks.yml` → `.moon/tasks/*.yml`
+
+## Workspace Configuration
+
+```yaml
+# .moon/workspace.yml
+$schema: "https://moonrepo.dev/schemas/workspace.json"
+
+projects:
+  - "apps/*"
+  - "packages/*"
+
+vcs:
+  client: "git"
+  defaultBranch: "main"
+
+pipeline:
+  archivableTargets:
+    - ":build"
+  cacheLifetime: "7 days"
+```
+
+## Project Configuration
+
+```yaml
+# moon.yml
+$schema: "https://moonrepo.dev/schemas/project.json"
+
+language: "typescript"
+layer: "application" # v2: 'type' renamed to 'layer'
+stack: "frontend"
+tags: ["react", "graphql"]
+
+dependsOn:
+  - "shared-utils"
+  - id: "api-client"
+    scope: "production"
+
+fileGroups:
+  sources:
+    - "src/**/*"
+  tests:
+    - "tests/**/*"
+
+tasks:
+  build:
+    command: "vite build"
+    inputs:
+      - "@group(sources)"
+    outputs:
+      - "dist"
+    deps:
+      - "^:build"
+
+  dev:
+    command: "vite dev"
+    preset: "server"
+
+  # v2: Use 'script' for shell features (pipes, redirects)
+  lint:
+    script: "eslint . && prettier --check ."
+
+  test:
+    command: "vitest run"
+    inputs:
+      - "@group(sources)"
+      - "@group(tests)"
+```
+
+### Layer Types (v2)
+
+| Layer           | Description           |
+| --------------- | --------------------- |
+| `application`   | Apps, services        |
+| `library`       | Shareable code        |
+| `tool`          | CLIs, scripts         |
+| `automation`    | E2E/integration tests |
+| `scaffolding`   | Templates, generators |
+| `configuration` | Infra, config         |
+
+## Task Configuration
+
+### Task Fields
+
+| Field     | Description                          |
+| --------- | ------------------------------------ |
+| `command` | Command to execute (string or array) |
+| `args`    | Additional arguments                 |
+| `deps`    | Task dependencies                    |
+| `inputs`  | Files for cache hashing              |
+| `outputs` | Files to cache                       |
+| `env`     | Environment variables                |
+| `extends` | Inherit from another task            |
+| `preset`  | `server` or `utility`                |
+
+### Task Inheritance
+
+Tasks can be inherited globally via `.moon/tasks/*.yml`:
+
+```yaml
+# .moon/tasks/node.yml
+inheritedBy:
+  toolchains: ["javascript", "typescript"]
+
+fileGroups:
+  sources: ["src/**/*"]
+
+tasks:
+  lint:
+    command: "eslint ."
+    inputs: ["@group(sources)"]
+```
+
+Projects control inheritance:
+
+```yaml
+# moon.yml
+workspace:
+  inheritedTasks:
+    include: ["lint", "test"]
+    exclude: ["deploy"]
+    rename:
+      buildApp: "build"
+```
+
+### Task Options
+
+```yaml
+tasks:
+  example:
+    command: "cmd"
+    options:
+      cache: true # Enable caching
+      runInCI: "affected" # affected, always, only, false
+      persistent: true # Long-running process
+      retryCount: 2 # Retry on failure
+      timeout: 300 # Seconds
+      mutex: "resource" # Exclusive lock
+      priority: "high" # critical, high, normal, low
+```
+
+### Input Tokens
+
+```yaml
+inputs:
+  - "@group(sources)" # File group
+  - "@globs(tests)" # Glob patterns
+  - "/tsconfig.base.json" # Workspace root file
+  - "$NODE_ENV" # Environment variable
+```
+
+## Toolchain Configuration
+
+```yaml
+# .moon/toolchains.yml (v2: plural)
+$schema: "https://moonrepo.dev/schemas/toolchains.json"
+
+# JavaScript ecosystem (v2: required for node/bun/deno)
+javascript:
+  packageManager: "pnpm"
+  inferTasksFromScripts: false
+
+node:
+  version: "20.10.0"
+
+pnpm:
+  version: "8.12.0"
+
+# Alternative runtimes
+bun:
+  version: "1.0.0"
+
+deno:
+  version: "1.40.0"
+
+typescript:
+  syncProjectReferences: true
+  routeOutDirToCache: true
+
+rust:
+  version: "1.75.0"
+  bins: ["cargo-nextest", "cargo-llvm-cov"]
+
+go:
+  version: "1.21.0"
+
+python:
+  version: "3.12.0"
+```
+
+### Toolchain Tiers
+
+| Tier | Description            | Examples                             |
+| ---- | ---------------------- | ------------------------------------ |
+| 3    | Full management        | Node.js, Bun, Deno, Rust, Go, Python |
+| 2    | Ecosystem integration  | PHP, Ruby                            |
+| 1    | Project categorization | Bash, Batch                          |
+| 0    | System execution       | Custom tools                         |
+
+## CI Integration
+
+```yaml
+# GitHub Actions
+- uses: actions/checkout@v4
+  with:
+    fetch-depth: 0 # Required for affected detection
+
+- uses: moonrepo/setup-toolchain@v0
+  with:
+    auto-install: true
+
+- run: moon ci :build :test
+
+- uses: moonrepo/run-report-action@v1
+  if: success() || failure()
+  with:
+    access-token: ${{ secrets.GITHUB_TOKEN }}
+```
+
+### Parallelization with Matrix
+
+```yaml
+strategy:
+  matrix:
+    shard: [0, 1, 2, 3]
+
+steps:
+  - run: moon ci --job ${{ matrix.shard }} --job-total 4
+```
+
+### Affected Detection
+
+```bash
+moon run :test --affected             # Only affected projects
+moon run :lint --affected --status staged  # Only staged files
+moon ci :test --base origin/main      # Compare against base
+moon query changed-files              # v2: renamed from touched-files
+```
+
+## Docker Support
+
+```bash
+moon docker scaffold <project>     # Generate Docker layers
+moon docker setup                  # Install toolchain in Docker
+moon docker prune                  # Prune for production
+moon docker file <project>         # Generate Dockerfile
+```
+
+## Moon Query Language (MQL)
+
+```bash
+# Filter projects
+moon query projects "language=typescript && projectType=library"
+moon run :build --query "tag=react"
+
+# Operators: =, !=, ~, !~, &&, ||
+# Fields: project, language, stack, tag, task, taskType
+```
+
+## Additional Resources
+
+For detailed configuration options, consult:
+
+- **`references/workspace-config.md`** - Complete workspace.yml reference
+- **`references/task-config.md`** - Task configuration and inheritance patterns
+- **`references/v2-migration.md`** - v1 to v2 migration guide
+- **`references/cli-reference.md`** - Full CLI command reference
+
+### Examples
+
+- **`examples/workspace.yml`** - Complete workspace configuration
+- **`examples/moon.yml`** - Full project configuration
+- **`examples/ci-workflow.yml`** - GitHub Actions CI workflow
diff --git a/.agents/skills/moon/examples/ci-workflow.yml b/.agents/skills/moon/examples/ci-workflow.yml
new file mode 100644
index 0000000..dc8f68b
--- /dev/null
+++ b/.agents/skills/moon/examples/ci-workflow.yml
@@ -0,0 +1,186 @@
+# .github/workflows/ci.yml
+# Complete moon CI workflow with matrix parallelization and run reports
+
+name: CI Pipeline
+
+on:
+  push:
+    branches: ['main', 'develop']
+  pull_request:
+    types: [opened, synchronize, reopened]
+
+concurrency:
+  group: ${{ github.workflow }}-${{ github.ref }}
+  cancel-in-progress: true
+
+jobs:
+  ci:
+    name: 'CI (${{ matrix.shard }})'
+    runs-on: 'ubuntu-latest'
+    strategy:
+      fail-fast: false
+      matrix:
+        shard: [0, 1, 2, 3]
+
+    steps:
+      - name: Checkout
+        uses: actions/checkout@v4
+        with:
+          fetch-depth: 0  # Required for affected detection
+
+      - name: Setup Toolchain
+        uses: moonrepo/setup-toolchain@v0
+        with:
+          auto-install: true
+
+      - name: Run CI
+        run: moon ci --job ${{ matrix.shard }} --job-total 4
+
+      - name: Report Results
+        uses: moonrepo/run-report-action@v1
+        if: success() || failure()
+        with:
+          access-token: ${{ secrets.GITHUB_TOKEN }}
+          matrix: ${{ toJSON(matrix) }}
+
+---
+
+# Alternative: Split by task type
+# .github/workflows/ci-split.yml
+
+name: CI Pipeline (Split)
+
+on:
+  push:
+    branches: ['main']
+  pull_request:
+
+jobs:
+  build:
+    name: Build
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v4
+        with:
+          fetch-depth: 0
+      - uses: moonrepo/setup-toolchain@v0
+        with:
+          auto-install: true
+      - run: moon ci :build
+
+  lint:
+    name: Lint & Format
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v4
+        with:
+          fetch-depth: 0
+      - uses: moonrepo/setup-toolchain@v0
+        with:
+          auto-install: true
+      - run: moon ci :lint :format
+
+  test:
+    name: Test
+    runs-on: ubuntu-latest
+    needs: [build]
+    steps:
+      - uses: actions/checkout@v4
+        with:
+          fetch-depth: 0
+      - uses: moonrepo/setup-toolchain@v0
+        with:
+          auto-install: true
+      - run: moon ci :test
+
+---
+
+# Open source multi-platform testing
+# .github/workflows/ci-matrix.yml
+
+name: CI Matrix
+
+on:
+  push:
+    branches: ['main']
+  pull_request:
+
+jobs:
+  ci:
+    name: 'CI (Node ${{ matrix.node }}, ${{ matrix.os }})'
+    runs-on: ${{ matrix.os }}
+    strategy:
+      fail-fast: false
+      matrix:
+        os: [ubuntu-latest, windows-latest, macos-latest]
+        node: [18, 20, 22]
+
+    env:
+      MOON_NODE_VERSION: ${{ matrix.node }}
+
+    steps:
+      - uses: actions/checkout@v4
+        with:
+          fetch-depth: 0
+
+      - uses: actions/setup-node@v4
+        with:
+          node-version: ${{ matrix.node }}
+
+      - uses: moonrepo/setup-toolchain@v0
+        with:
+          auto-install: true
+
+      - run: moon ci
+
+      - uses: moonrepo/run-report-action@v1
+        if: success() || failure()
+        with:
+          access-token: ${{ secrets.GITHUB_TOKEN }}
+          matrix: ${{ toJSON(matrix) }}
+
+---
+
+# CircleCI configuration
+# .circleci/config.yml
+
+version: 2.1
+orbs:
+  node: circleci/node@5.0.2
+
+jobs:
+  ci:
+    docker:
+      - image: cimg/base:stable
+    parallelism: 10
+    steps:
+      - checkout
+      - node/install:
+          install-yarn: true
+          node-version: '20'
+      - node/install-packages:
+          check-cache: always
+          pkg-manager: yarn-berry
+      - run: |
+          curl -fsSL https://moonrepo.dev/install/proto.sh | bash
+          export PATH="$HOME/.proto/bin:$PATH"
+          moon ci --job $CIRCLE_NODE_INDEX --job-total $CIRCLE_NODE_TOTAL
+
+workflows:
+  ci:
+    jobs:
+      - ci
+
+---
+
+# Buildkite configuration
+# .buildkite/pipeline.yml
+
+steps:
+  - label: 'CI'
+    parallelism: 10
+    commands:
+      - curl -fsSL https://moonrepo.dev/install/proto.sh | bash
+      - export PATH="$HOME/.proto/bin:$PATH"
+      - proto install
+      - moon ci --job $$BUILDKITE_PARALLEL_JOB --job-total $$BUILDKITE_PARALLEL_JOB_COUNT
diff --git a/.agents/skills/moon/examples/moon.yml b/.agents/skills/moon/examples/moon.yml
new file mode 100644
index 0000000..ecc330e
--- /dev/null
+++ b/.agents/skills/moon/examples/moon.yml
@@ -0,0 +1,178 @@
+# moon.yml - Complete project configuration example
+$schema: 'https://moonrepo.dev/schemas/project.json'
+
+# Project classification
+language: 'typescript'
+layer: 'application'
+stack: 'frontend'
+
+# Metadata
+project:
+  name: 'Web Application'
+  description: 'Main customer-facing web application'
+  owner: 'frontend-team'
+  maintainers:
+    - 'alice'
+    - 'bob'
+  channel: '#web-app'
+  metadata:
+    tier: 1
+    public: true
+
+# Tags for querying and constraints
+tags:
+  - 'react'
+  - 'next'
+  - 'customer-facing'
+
+# Explicit project dependencies
+dependsOn:
+  - 'ui-components'
+  - 'shared-utils'
+  - id: 'api-client'
+    scope: 'production'
+  - id: 'test-fixtures'
+    scope: 'development'
+
+# Environment variables for all tasks
+env:
+  NEXT_PUBLIC_API_URL: 'https://api.example.com'
+  NODE_ENV: 'production'
+
+# Per-project toolchain overrides
+toolchain:
+  default: 'node'
+  node:
+    version: '20.10.0'
+  typescript:
+    includeProjectReferenceSources: true
+    routeOutDirToCache: true
+
+# File groups for reuse in tasks
+fileGroups:
+  sources:
+    - 'src/**/*'
+    - 'app/**/*'
+    - 'components/**/*'
+  tests:
+    - 'tests/**/*'
+    - '**/*.test.{ts,tsx}'
+    - '**/__tests__/**/*'
+  configs:
+    - 'next.config.js'
+    - 'tailwind.config.js'
+    - 'tsconfig.json'
+    - 'postcss.config.js'
+  assets:
+    - 'public/**/*'
+
+# Control task inheritance
+workspace:
+  inheritedTasks:
+    exclude:
+      - 'deploy-staging'
+    rename:
+      buildApp: 'build'
+
+# Task definitions
+tasks:
+  build:
+    command: 'next build'
+    inputs:
+      - '@group(sources)'
+      - '@group(configs)'
+      - '@group(assets)'
+    outputs:
+      - '.next'
+    deps:
+      - 'ui-components:build'
+      - 'api-client:build'
+    env:
+      NODE_ENV: 'production'
+    options:
+      cache: true
+      priority: 'high'
+
+  dev:
+    command: 'next dev'
+    preset: 'server'
+    deps:
+      - '~:codegen'
+    env:
+      NODE_ENV: 'development'
+
+  start:
+    command: 'next start'
+    preset: 'server'
+    deps:
+      - '~:build'
+
+  test:
+    command: 'vitest run'
+    inputs:
+      - '@group(sources)'
+      - '@group(tests)'
+    deps:
+      - '^:build'
+    options:
+      retryCount: 2
+      runInCI: 'affected'
+
+  test-watch:
+    command: 'vitest'
+    preset: 'watcher'
+
+  lint:
+    command: 'eslint'
+    args:
+      - '.'
+      - '--ext'
+      - '.ts,.tsx'
+    inputs:
+      - '@group(sources)'
+      - '.eslintrc.js'
+
+  lint-fix:
+    extends: 'lint'
+    args: '--fix'
+    options:
+      runInCI: false
+
+  typecheck:
+    command: 'tsc --noEmit'
+    inputs:
+      - '@group(sources)'
+      - '@group(configs)'
+
+  codegen:
+    command: 'graphql-codegen'
+    outputs:
+      - 'src/generated/'
+    options:
+      internal: true
+      cache: 'local'
+
+  e2e:
+    command: 'playwright test'
+    inputs:
+      - 'e2e/**/*'
+      - 'playwright.config.ts'
+    deps:
+      - target: '~:build'
+        env:
+          NODE_ENV: 'test'
+    options:
+      interactive: true
+      runInCI: 'always'
+      timeout: 600
+      retryCount: 2
+
+  deploy:
+    command: './scripts/deploy.sh'
+    deps:
+      - '~:build'
+      - '~:test'
+      - '~:e2e'
+    options:
+      runInCI: 'only'
+      mutex: 'deployment'
diff --git a/.agents/skills/moon/examples/workspace.yml b/.agents/skills/moon/examples/workspace.yml
new file mode 100644
index 0000000..69d6df4
--- /dev/null
+++ b/.agents/skills/moon/examples/workspace.yml
@@ -0,0 +1,67 @@
+# .moon/workspace.yml - Complete example (v2 format)
+$schema: 'https://moonrepo.dev/schemas/workspace.json'
+
+# Project discovery
+projects:
+  - 'apps/*'
+  - 'packages/*'
+  - 'tools/*'
+
+# Version control
+vcs:
+  client: 'git' # v2: 'manager' renamed to 'client'
+  provider: 'github'
+  defaultBranch: 'main'
+  remoteCandidates:
+    - 'origin'
+    - 'upstream'
+  hooks:
+    pre-commit:
+      - 'moon run :lint --affected --status staged'
+    pre-push:
+      - 'moon run :test --affected'
+
+# Task pipeline (v2: 'runner' renamed to 'pipeline')
+pipeline:
+  archivableTargets:
+    - ':build'
+    - ':test'
+  cacheLifetime: '7 days'
+  inheritColorsForPipedTasks: true
+  logRunningCommand: true
+  autoCleanCache: true
+
+# Hashing
+hasher:
+  optimization: 'performance'
+  walkStrategy: 'vcs'
+
+# Code ownership
+codeowners:
+  globalPaths:
+    '/*': ['@platform-team']
+  orderBy: 'project-source'
+  sync: true # v2: 'syncOnRun' renamed to 'sync'
+
+# Constraints
+constraints:
+  enforceProjectTypeRelationships: true
+  tagRelationships:
+    frontend:
+      requires: ['shared']
+    backend:
+      requires: ['shared']
+
+# Code generation
+generator:
+  templates:
+    - './templates'
+
+# Remote caching (optional)
+# remote:  # v2: 'unstable_remote' renamed to 'remote'
+#   host: 'grpcs://cache.example.com'
+#   auth:
+#     token: 'CACHE_TOKEN'
+
+# Telemetry
+telemetry: true
diff --git a/.agents/skills/moon/references/cli-reference.md b/.agents/skills/moon/references/cli-reference.md
new file mode 100644
index 0000000..5e03886
--- /dev/null
+++ b/.agents/skills/moon/references/cli-reference.md
@@ -0,0 +1,222 @@
+# Moon CLI Reference
+
+Complete reference for all moon CLI commands.
+
+## Task Execution
+
+### moon run
+
+Execute targets and their dependencies.
+
+```bash
+moon run <target>... [-- <args>]
+```
+
+**Options:**
+
+| Flag                   | Description                     |
+| ---------------------- | ------------------------------- |
+| `--affected`           | Only run if affected by changes |
+| `--dependents`         | Also run downstream dependents  |
+| `--force`              | Bypass cache                    |
+| `--interactive`, `-i`  | Interactive task selection      |
+| `--no-bail`            | Continue on failure             |
+| `--query <mql>`        | Filter with MQL                 |
+| `--remote`             | Compare against remote          |
+| `--status <type>`      | Filter by status                |
+| `--summary`            | Show execution summary          |
+| `--update-cache`, `-u` | Force cache update              |
+
+**Examples:**
+
+```bash
+moon run app:build
+moon run :lint --affected
+moon run '#frontend:test'
+moon run app:test -- --coverage
+moon run :build --query "language=typescript"
+```
+
+### moon check
+
+Run all build/test tasks for projects.
+
+```bash
+moon check [project...]
+moon check --all
+```
+
+### moon ci
+
+CI-optimized task execution with job distribution.
+
+```bash
+moon ci [target...]
+```
+
+**Options:**
+
+| Flag                  | Description             |
+| --------------------- | ----------------------- |
+| `--base <rev>`        | Base to compare against |
+| `--head <rev>`        | Head revision           |
+| `--job <index>`       | Job index (0-based)     |
+| `--job-total <count>` | Total parallel jobs     |
+
+**Examples:**
+
+```bash
+moon ci :build :test
+moon ci :test --job 0 --job-total 4
+moon ci --base origin/main --head HEAD
+```
+
+## Query Commands
+
+### moon query projects
+
+```bash
+moon query projects [mql]
+moon query projects --affected
+moon query projects --tags frontend
+moon query projects "language=typescript"
+```
+
+### moon query tasks
+
+```bash
+moon query tasks [mql]
+moon query tasks --affected
+moon query tasks "task~dev-*"
+```
+
+### moon query touched-files
+
+```bash
+moon query touched-files
+moon query touched-files --status modified,staged
+moon query touched-files --base main --head HEAD
+```
+
+### moon query hash
+
+```bash
+moon query hash <hash>
+moon query hash-diff <left> <right>
+```
+
+## Graph Visualization
+
+### moon project-graph
+
+```bash
+moon project-graph [project]
+moon project-graph --dot > graph.dot
+moon project-graph app --dependents
+```
+
+### moon action-graph
+
+```bash
+moon action-graph [target]
+moon action-graph app:build --dot
+```
+
+## Workspace Management
+
+### moon init
+
+```bash
+moon init
+moon init node
+moon init --minimal
+moon init --to ./app
+```
+
+### moon sync
+
+```bash
+moon sync projects     # Sync all projects
+moon sync hooks        # Sync VCS hooks
+```
+
+### moon setup
+
+```bash
+moon setup             # Install toolchain
+```
+
+### moon generate
+
+```bash
+moon generate <template> [dest] [-- vars]
+moon generate npm-package ./packages/foo -- --name "@company/foo"
+moon templates         # List available templates
+```
+
+## Docker Commands
+
+```bash
+moon docker scaffold <project>   # Generate Docker layers
+moon docker setup                # Install in Docker
+moon docker prune                # Prune for production
+moon docker file <project>       # Generate Dockerfile
+```
+
+## Toolchain Commands
+
+```bash
+moon bin <tool>                  # Get tool binary path
+moon toolchain add <name>        # Add toolchain
+moon upgrade                     # Upgrade moon
+```
+
+## Extension Commands
+
+```bash
+moon ext <id> [-- args]          # Run extension
+moon ext migrate-nx              # Migrate from Nx
+moon ext migrate-turborepo       # Migrate from Turborepo
+```
+
+## Utility Commands
+
+```bash
+moon completions [--shell <shell>]  # Generate completions
+```
+
+## Global Flags
+
+| Flag                | Description                                     |
+| ------------------- | ----------------------------------------------- |
+| `--color`           | Force color output                              |
+| `--log <level>`     | Log level: off, error, warn, info, debug, trace |
+| `--concurrency <n>` | Limit parallel execution                        |
+| `--profile <type>`  | Generate profile (cpu, heap)                    |
+
+## Moon Query Language (MQL)
+
+### Operators
+
+| Operator     | Description |
+| ------------ | ----------- |
+| `=`          | Equals      |
+| `!=`         | Not equals  |
+| `~`          | Like (glob) |
+| `!~`         | Not like    |
+| `&&`, `AND`  | Logical AND |
+| `\|\|`, `OR` | Logical OR  |
+
+### Fields
+
+**Projects:** project, projectAlias, projectSource, projectType, language, layer, stack, tag
+
+**Tasks:** task, taskCommand, taskType, taskToolchain
+
+### Examples
+
+```bash
+moon query projects "language=typescript && projectType=library"
+moon run :build --query "tag=react"
+moon query projects "projectSource~packages/*"
+```
diff --git a/.agents/skills/moon/references/task-config.md b/.agents/skills/moon/references/task-config.md
new file mode 100644
index 0000000..e972397
--- /dev/null
+++ b/.agents/skills/moon/references/task-config.md
@@ -0,0 +1,743 @@
+# Moon Task Configuration Reference
+
+Complete reference for task configuration in moon.yml and .moon/tasks.yml.
+
+## Global Task Inheritance
+
+### Configuration Hierarchy
+
+```
+.moon/tasks.yml              # Inherited by ALL projects (legacy)
+.moon/tasks/*.yml            # Conditional inheritance based on conditions
+└── moon.yml                 # Project-level tasks (override/merge)
+```
+
+### Global Tasks File Structure
+
+```yaml
+# .moon/tasks/node.yml
+$schema: "https://moonrepo.dev/schemas/tasks.json"
+
+# External configuration to extend
+extends: "https://raw.githubusercontent.com/org/repo/main/.moon/tasks/base.yml"
+
+# Conditions for which projects inherit these tasks
+inheritedBy:
+  toolchains:
+    or: ["javascript", "typescript"]
+  stacks: ["frontend", "backend"]
+  layers: ["application", "library"]
+
+# File groups inherited by matching projects
+fileGroups:
+  configs:
+    - "*.config.{js,cjs,mjs,ts}"
+    - "tsconfig*.json"
+  sources:
+    - "src/**/*"
+    - "types/**/*"
+  tests:
+    - "tests/**/*"
+    - "**/__tests__/**/*"
+    - "**/*.test.{ts,tsx}"
+
+# Default options for all tasks in this file
+taskOptions:
+  cache: true
+  runInCI: "affected"
+
+# Implicit dependencies added to ALL tasks
+implicitDeps:
+  - "^:build" # Run upstream builds first
+
+# Implicit inputs added to ALL tasks
+implicitInputs:
+  - "package.json"
+  - "/tsconfig.base.json"
+
+# Tasks inherited by matching projects
+tasks:
+  lint:
+    command: "eslint ."
+    inputs:
+      - "@group(sources)"
+
+  test:
+    command: "vitest run"
+    inputs:
+      - "@group(sources)"
+      - "@group(tests)"
+```
+
+### Inheritance Conditions
+
+Projects inherit tasks when ALL specified conditions match (AND logic between condition types):
+
+| Condition    | Description                 | Example                              |
+| ------------ | --------------------------- | ------------------------------------ |
+| `toolchains` | Project toolchain           | `['javascript', 'typescript']`       |
+| `stacks`     | Project stack               | `['frontend', 'backend']`            |
+| `layers`     | Project layer               | `['application', 'library', 'tool']` |
+| `tags`       | Project tags                | `['react', 'graphql']`               |
+| `languages`  | Project language            | `['python', 'go']`                   |
+| `files`      | Files that exist in project | `['Cargo.toml']`                     |
+
+#### Condition Operators
+
+```yaml
+inheritedBy:
+  # Simple array (OR within condition)
+  stacks: ["frontend", "backend"]
+
+  # With operators (tags and toolchains support this)
+  toolchains:
+    or: ["javascript", "typescript"] # Match any
+    not: ["ruby"] # Exclude
+
+  tags:
+    and: ["react", "typescript"] # Match all
+    or: ["web", "mobile"] # Match any
+    not: ["deprecated"] # Exclude
+```
+
+#### Scoped Task Files
+
+Convention-based file names for automatic inheritance:
+
+| File                                  | Inherits When          |
+| ------------------------------------- | ---------------------- |
+| `.moon/tasks/all.yml`                 | All projects           |
+| `.moon/tasks/node.yml`                | `toolchain: node`      |
+| `.moon/tasks/typescript.yml`          | `language: typescript` |
+| `.moon/tasks/frontend.yml`            | `stack: frontend`      |
+| `.moon/tasks/library.yml`             | `layer: library`       |
+| `.moon/tasks/tag-react.yml`           | `tags: ['react']`      |
+| `.moon/tasks/typescript-frontend.yml` | Both conditions        |
+
+## Task Definition
+
+```yaml
+tasks:
+  build:
+    # Command to execute (string or array)
+    command: 'webpack build --mode production'
+    # OR
+    command:
+      - 'webpack'
+      - 'build'
+      - '--mode'
+      - 'production'
+
+    # Additional arguments
+    args:
+      - '--color'
+      - '--progress'
+
+    # Alternative: shell script (supports pipes, redirects)
+    script: 'rm -rf dist && webpack build > build.log'
+
+    # Environment variables
+    env:
+      NODE_ENV: 'production'
+      API_URL: '${BACKEND_URL}/api'
+
+    # Task dependencies
+    deps:
+      - 'shared:build'        # Specific project
+      - '~:codegen'           # Same project
+      - '^:build'             # All upstream deps
+      - target: 'optional:task'
+        optional: true        # Don't fail if missing
+
+    # Input files for hash calculation
+    inputs:
+      - 'src/**/*'
+      - '@group(sources)'     # File group
+      - '/tsconfig.base.json' # Workspace root
+      - '$NODE_ENV'           # Env variable
+
+    # Output files to cache
+    outputs:
+      - 'dist'
+      - 'build/**/*.js'
+
+    # Inherit from another task
+    extends: 'base-build'
+
+    # Task preset (server, watcher)
+    preset: 'server'
+
+    # Toolchain override
+    toolchain: 'node'
+
+    # Task options
+    options:
+      cache: true
+      runInCI: 'affected'
+```
+
+## Task Options Reference
+
+### Caching
+
+| Option          | Type                             | Default | Description                       |
+| --------------- | -------------------------------- | ------- | --------------------------------- |
+| `cache`         | `boolean \| 'local' \| 'remote'` | `true`  | Enable/configure caching          |
+| `cacheKey`      | `string`                         | -       | Custom cache invalidation key     |
+| `cacheLifetime` | `string`                         | -       | Cache expiration (e.g., '7 days') |
+
+### Execution
+
+| Option                 | Type                                        | Default      | Description                   |
+| ---------------------- | ------------------------------------------- | ------------ | ----------------------------- |
+| `persistent`           | `boolean`                                   | `false`      | Long-running task (servers)   |
+| `runInCI`              | `'affected' \| 'always' \| 'only' \| false` | `'affected'` | CI behavior                   |
+| `runFromWorkspaceRoot` | `boolean`                                   | `false`      | Execute from workspace root   |
+| `runDepsInParallel`    | `boolean`                                   | `true`       | Parallel dependency execution |
+| `timeout`              | `number`                                    | -            | Max runtime in seconds        |
+| `retryCount`           | `number`                                    | `0`          | Retry attempts on failure     |
+| `priority`             | `'critical' \| 'high' \| 'normal' \| 'low'` | `'normal'`   | Queue priority                |
+
+### Shell
+
+| Option      | Type      | Default | Description                      |
+| ----------- | --------- | ------- | -------------------------------- |
+| `shell`     | `boolean` | varies  | Run in shell                     |
+| `unixShell` | `string`  | -       | Shell: bash, zsh, fish, nu, etc. |
+
+### Environment
+
+| Option    | Type                            | Description       |
+| --------- | ------------------------------- | ----------------- |
+| `envFile` | `boolean \| string \| string[]` | Load .env file(s) |
+
+### Output
+
+| Option        | Type                                                                | Description    |
+| ------------- | ------------------------------------------------------------------- | -------------- |
+| `outputStyle` | `'buffer' \| 'buffer-only-failure' \| 'hash' \| 'none' \| 'stream'` | Output display |
+
+### Special Modes
+
+| Option         | Type                 | Default | Description                           |
+| -------------- | -------------------- | ------- | ------------------------------------- |
+| `internal`     | `boolean`            | `false` | Only run as dependency                |
+| `interactive`  | `boolean`            | `false` | Requires stdin                        |
+| `allowFailure` | `boolean`            | `false` | Can fail without failing pipeline     |
+| `os`           | `string \| string[]` | -       | OS restriction: linux, macos, windows |
+| `mutex`        | `string`             | -       | Exclusive resource lock               |
+| `inferInputs`  | `boolean`            | `true`  | Auto-infer from @group tokens         |
+
+### Merge Strategies
+
+| Option         | Values                                          | Default    |
+| -------------- | ----------------------------------------------- | ---------- |
+| `mergeArgs`    | `'append' \| 'prepend' \| 'replace'`            | `'append'` |
+| `mergeDeps`    | `'append' \| 'prepend' \| 'replace'`            | `'append'` |
+| `mergeEnv`     | `'append' \| 'prepend' \| 'replace' \| 'union'` | `'append'` |
+| `mergeInputs`  | `'append' \| 'prepend' \| 'replace'`            | `'append'` |
+| `mergeOutputs` | `'append' \| 'prepend' \| 'replace'`            | `'append'` |
+
+## Token Variables
+
+### Project Variables
+
+| Variable         | Description                  |
+| ---------------- | ---------------------------- |
+| `$project`       | Project ID                   |
+| `$projectRoot`   | Absolute path to project     |
+| `$projectSource` | Relative path from workspace |
+| `$projectName`   | Human-readable name          |
+| `$language`      | Project language             |
+
+### Environment Variables
+
+| Variable         | Description                              |
+| ---------------- | ---------------------------------------- |
+| `$arch`          | Host architecture (aarch64, x86_64)      |
+| `$os`            | Operating system (linux, macos, windows) |
+| `$osFamily`      | OS family (unix, windows)                |
+| `$workspaceRoot` | Workspace root path                      |
+| `$workingDir`    | Current working directory                |
+
+## Task Extension (extends)
+
+The `extends` field allows tasks to inherit from sibling tasks or globally inherited tasks.
+
+### Basic Extension
+
+```yaml
+tasks:
+  # Base task
+  lint:
+    command: "eslint ."
+    inputs:
+      - "@group(sources)"
+    options:
+      cache: true
+
+  # Extended task - inherits all settings from lint
+  lint-fix:
+    extends: "lint"
+    args: "--fix"
+    preset: "utility" # Disable cache, enable interactive
+```
+
+### Extension with Overrides
+
+```yaml
+tasks:
+  build:
+    command: "vite build"
+    inputs:
+      - "@group(sources)"
+      - "@group(configs)"
+    outputs:
+      - "dist"
+    env:
+      NODE_ENV: "production"
+    options:
+      cache: true
+
+  # Development build - overrides specific settings
+  build-dev:
+    extends: "build"
+    args: "--mode development"
+    env:
+      NODE_ENV: "development"
+    options:
+      cache: false
+      mergeArgs: "replace" # Don't append, replace args
+```
+
+### Extending Inherited Tasks
+
+Project tasks can extend globally inherited tasks:
+
+```yaml
+# .moon/tasks/node.yml (global)
+tasks:
+  test:
+    command: 'vitest run'
+    inputs: ['@group(sources)', '@group(tests)']
+
+# apps/web/moon.yml (project)
+tasks:
+  test-e2e:
+    extends: 'test'           # Extends the inherited 'test' task
+    args: '--project=e2e'
+    options:
+      timeout: 600
+```
+
+## Task Presets
+
+Presets are predefined option sets for common task patterns.
+
+### Available Presets
+
+| Preset    | cache   | outputStyle | persistent | interactive | runInCI |
+| --------- | ------- | ----------- | ---------- | ----------- | ------- |
+| `server`  | `false` | `stream`    | `true`     | -           | `false` |
+| `utility` | `false` | `stream`    | `false`    | `true`      | `skip`  |
+
+### Auto-Applied Presets
+
+Tasks named `dev`, `start`, or `serve` automatically get the `server` preset.
+
+### Preset Usage
+
+```yaml
+tasks:
+  # Long-running development server
+  dev:
+    command: "vite dev"
+    preset: "server" # No cache, streams output, persistent
+
+  # Interactive utility command
+  migrate:
+    command: "prisma migrate dev"
+    preset: "utility" # No cache, streams output, interactive
+
+  # Override preset defaults
+  watch:
+    command: "tsc --watch"
+    preset: "server"
+    options:
+      runInCI: "skip" # Override the preset's runInCI: false
+```
+
+## Controlling Inherited Tasks
+
+Projects can filter, exclude, or rename inherited tasks.
+
+### Include (Allowlist)
+
+```yaml
+# moon.yml
+workspace:
+  inheritedTasks:
+    include:
+      - "lint"
+      - "test"
+    # Only these tasks are inherited; all others excluded
+```
+
+### Exclude (Blocklist)
+
+```yaml
+workspace:
+  inheritedTasks:
+    exclude:
+      - "deploy"
+      - "publish"
+    # All tasks inherited except these
+```
+
+### Rename
+
+```yaml
+workspace:
+  inheritedTasks:
+    rename:
+      buildApplication: "build" # Use shorter name locally
+      testUnit: "test"
+```
+
+### Combined Example
+
+```yaml
+# moon.yml
+workspace:
+  inheritedTasks:
+    include: ["lint", "test", "build", "buildApplication"]
+    exclude: ["test"] # Applied after include
+    rename:
+      buildApplication: "build" # Applied last
+# Result: only 'lint' and 'build' tasks inherited
+```
+
+### Processing Order
+
+1. **Include** - Filter to only specified tasks
+2. **Exclude** - Remove specific tasks from the filtered set
+3. **Rename** - Apply name mappings to remaining tasks
+
+## File Groups
+
+File groups organize related files for reuse across tasks.
+
+### Defining File Groups
+
+```yaml
+fileGroups:
+  # Source files
+  sources:
+    - "src/**/*"
+    - "lib/**/*"
+
+  # Test files
+  tests:
+    - "tests/**/*"
+    - "**/__tests__/**/*"
+    - "**/*.test.{ts,tsx,js,jsx}"
+    - "**/*.spec.{ts,tsx,js,jsx}"
+
+  # Configuration files
+  configs:
+    - "*.config.{js,cjs,mjs,ts}"
+    - "tsconfig*.json"
+    - "package.json"
+
+  # Static assets
+  assets:
+    - "public/**/*"
+    - "static/**/*"
+
+  # Everything lintable
+  lintable:
+    - "@group(sources)"
+    - "@group(tests)"
+    - "@group(configs)"
+
+  # Negation patterns
+  production:
+    - "src/**/*"
+    - "!src/**/*.test.*"
+    - "!src/**/__mocks__/**"
+```
+
+### Using File Groups
+
+```yaml
+tasks:
+  lint:
+    command: "eslint"
+    args:
+      - "@globs(lintable)" # Glob patterns as arguments
+    inputs:
+      - "@group(lintable)" # For cache hashing
+
+  typecheck:
+    command: "tsc --noEmit"
+    inputs:
+      - "@group(sources)"
+      - "@group(configs)"
+
+  test:
+    command: "vitest run"
+    args:
+      - "@files(tests)" # Expanded file paths
+    inputs:
+      - "@group(sources)"
+      - "@group(tests)"
+```
+
+### Token Functions for File Groups
+
+| Token          | Description         | Use Case       |
+| -------------- | ------------------- | -------------- |
+| `@group(name)` | All items in group  | Inputs/outputs |
+| `@globs(name)` | Glob patterns       | Command args   |
+| `@files(name)` | Expanded file paths | Command args   |
+| `@dirs(name)`  | Directory paths     | Command args   |
+
+### File Group Inheritance
+
+File groups defined in `.moon/tasks/*.yml` are inherited by matching projects. Project-level groups override inherited groups of the same name.
+
+```yaml
+# .moon/tasks/node.yml
+fileGroups:
+  sources:
+    - 'src/**/*'
+
+# apps/api/moon.yml - overrides inherited 'sources'
+fileGroups:
+  sources:
+    - 'src/**/*'
+    - 'generated/**/*'   # Project-specific addition
+```
+
+## Merge Strategies
+
+Control how inherited and extended task values combine.
+
+### Strategy Options
+
+| Strategy  | Behavior                                     |
+| --------- | -------------------------------------------- |
+| `append`  | Local values added after inherited (default) |
+| `prepend` | Local values added before inherited          |
+| `replace` | Local values completely override inherited   |
+
+### Configuring Merge Strategies
+
+```yaml
+tasks:
+  build:
+    command: "webpack"
+    args: ["--mode", "production"]
+    deps: ["codegen"]
+    inputs: ["src/**/*"]
+    options:
+      mergeArgs: "replace" # Completely replace inherited args
+      mergeDeps: "prepend" # Run local deps before inherited
+      mergeEnv: "append" # Add to inherited env vars
+      mergeInputs: "append" # Combine with inherited inputs
+      mergeOutputs: "replace" # Override inherited outputs
+```
+
+### Merge Fields
+
+| Option            | Applies To         |
+| ----------------- | ------------------ |
+| `mergeArgs`       | `args` array       |
+| `mergeDeps`       | `deps` array       |
+| `mergeEnv`        | `env` map          |
+| `mergeInputs`     | `inputs` array     |
+| `mergeOutputs`    | `outputs` array    |
+| `mergeToolchains` | `toolchains` array |
+
+### Example: Merge Behavior
+
+```yaml
+# Inherited task
+tasks:
+  test:
+    command: 'vitest'
+    args: ['run']
+    deps: ['^:build']
+    inputs: ['src/**/*']
+
+# Project task with mergeArgs: 'append' (default)
+tasks:
+  test:
+    args: ['--coverage']
+    # Result: ['run', '--coverage']
+
+# Project task with mergeArgs: 'prepend'
+tasks:
+  test:
+    args: ['--coverage']
+    options:
+      mergeArgs: 'prepend'
+    # Result: ['--coverage', 'run']
+
+# Project task with mergeArgs: 'replace'
+tasks:
+  test:
+    args: ['--coverage']
+    options:
+      mergeArgs: 'replace'
+    # Result: ['--coverage']
+```
+
+## Implicit Dependencies and Inputs
+
+Always inherited regardless of merge settings.
+
+### implicitDeps
+
+Dependencies added to ALL inherited tasks:
+
+```yaml
+# .moon/tasks/node.yml
+implicitDeps:
+  - "^:build" # Always build dependencies first
+  - "~:codegen" # Always run codegen in same project
+```
+
+### implicitInputs
+
+Input files added to ALL inherited tasks:
+
+```yaml
+# .moon/tasks/node.yml
+implicitInputs:
+  - "package.json"
+  - "/tsconfig.base.json" # Workspace root
+  - "/.moon/toolchains.yml" # Workspace config (v2: plural)
+```
+
+## External Configuration (extends)
+
+### Extending Remote Configuration
+
+```yaml
+# .moon/tasks/node.yml
+extends: "https://raw.githubusercontent.com/company/configs/main/.moon/tasks/base.yml"
+
+# Local overrides and additions
+tasks:
+  custom:
+    command: "custom-tool"
+```
+
+### Extending Local Configuration
+
+```yaml
+extends: "../shared/base-tasks.yml"
+```
+
+### Versioning Remote Configs
+
+```yaml
+# Pin to specific commit for stability
+extends: 'https://raw.githubusercontent.com/company/configs/abc1234/.moon/tasks/base.yml'
+
+# Or use versioned filenames
+extends: 'https://raw.githubusercontent.com/company/configs/main/tasks-v2.yml'
+```
+
+### Merge Behavior
+
+When extending, local values take precedence. Map entries (fileGroups, tasks) merge at the top level only.
+
+```yaml
+# Remote base.yml
+fileGroups:
+  sources:
+    - 'src/**/*'
+tasks:
+  lint:
+    command: 'eslint'
+
+# Local override
+fileGroups:
+  sources:         # Completely replaces remote 'sources'
+    - 'lib/**/*'
+  tests:           # Added (not in remote)
+    - 'tests/**/*'
+tasks:
+  lint:            # Completely replaces remote 'lint'
+    command: 'biome lint'
+  test:            # Added (not in remote)
+    command: 'vitest'
+```
+
+## runInCI Values
+
+| Value                 | Description                    |
+| --------------------- | ------------------------------ |
+| `'affected'` / `true` | Run if affected (default)      |
+| `'always'`            | Always run in CI               |
+| `false`               | Never run in CI                |
+| `'only'`              | Only in CI, not locally        |
+| `'skip'`              | Skip in CI, keep relationships |
+
+## Common Patterns
+
+### Build with Dependencies
+
+```yaml
+tasks:
+  build:
+    command: "tsc"
+    deps:
+      - "^:build" # Build all dependencies first
+    inputs:
+      - "@group(sources)"
+    outputs:
+      - "dist"
+```
+
+### Development Server
+
+```yaml
+tasks:
+  dev:
+    command: "vite dev"
+    preset: "server" # Sets persistent, no cache, no CI
+```
+
+### Serial Dependencies
+
+```yaml
+tasks:
+  deploy:
+    command: "./deploy.sh"
+    deps:
+      - "clean"
+      - "build"
+      - "test"
+    options:
+      runDepsInParallel: false # Run in order
+```
+
+### Conditional Execution
+
+```yaml
+tasks:
+  build-linux:
+    command: "./build-linux.sh"
+    options:
+      os: "linux"
+
+  e2e:
+    command: "playwright test"
+    options:
+      runInCI: "always"
+      timeout: 600
+      retryCount: 2
+```
diff --git a/.agents/skills/moon/references/v2-migration.md b/.agents/skills/moon/references/v2-migration.md
new file mode 100644
index 0000000..b187908
--- /dev/null
+++ b/.agents/skills/moon/references/v2-migration.md
@@ -0,0 +1,258 @@
+# Moon v2 Migration Reference
+
+Complete guide for migrating from moon v1 to v2.
+
+## Migration Command
+
+```bash
+moon migrate v2
+```
+
+This automates applicable configuration changes.
+
+## Breaking Changes Summary
+
+### Configuration File Renames
+
+| v1                       | v2                              |
+| ------------------------ | ------------------------------- |
+| `.moon/toolchain.yml`    | `.moon/toolchains.yml` (plural) |
+| `.moon/tasks.yml`        | `.moon/tasks/all.yml`           |
+| `.moon/docker/workspace` | `.moon/docker/configs`          |
+
+### Workspace Settings (`.moon/workspace.yml`)
+
+| v1                     | v2                |
+| ---------------------- | ----------------- |
+| `runner`               | `pipeline`        |
+| `codeowners.syncOnRun` | `codeowners.sync` |
+| `vcs.manager`          | `vcs.client`      |
+| `unstable_remote`      | `remote`          |
+| `hasher.batchSize`     | Removed           |
+| `experiments`          | Removed           |
+
+### Project Settings (`moon.yml`)
+
+| v1                                    | v2                            |
+| ------------------------------------- | ----------------------------- |
+| `type`                                | `layer`                       |
+| `project.name`                        | `project.title`               |
+| `platform`                            | `toolchains.default`          |
+| `project.metadata`                    | Removed (use root fields)     |
+| `toolchain.typescript.disabled: true` | `toolchains.typescript: null` |
+
+### Task Settings
+
+| v1                           | v2                                            |
+| ---------------------------- | --------------------------------------------- |
+| `tasks.*.local`              | `tasks.*.preset: server`                      |
+| `tasks.*.platform`           | `tasks.*.toolchains`                          |
+| `options.affectedPassInputs` | `options.affectedFiles.passInputsWhenNoMatch` |
+
+### Token Variables
+
+| v1              | v2               |
+| --------------- | ---------------- |
+| `$projectName`  | `$projectTitle`  |
+| `$projectType`  | `$projectLayer`  |
+| `$taskPlatform` | `$taskToolchain` |
+
+## Script vs Command
+
+Complex shell operations now require `script` instead of `command`:
+
+```yaml
+# v1 - command with pipes (worked)
+tasks:
+  example:
+    command: 'echo "foo" | grep "f"'
+
+# v2 - must use script for shell features
+tasks:
+  example:
+    script: 'echo "foo" | grep "f"'
+```
+
+**When to use script:**
+
+- Pipes (`|`)
+- Redirects (`>`, `<`, `>>`)
+- Chaining (`&&`, `||`, `;`)
+- Shell globbing
+- Environment expansion in complex expressions
+
+**When to use command:**
+
+- Simple commands without shell features
+- Commands with arguments
+
+## Shell Enabled by Default
+
+Tasks now run in shells (Bash on Unix, pwsh on Windows). To disable:
+
+```yaml
+tasks:
+  example:
+    command: "tool"
+    options:
+      shell: false
+```
+
+## Project Layers (Formerly Type)
+
+New categorization system:
+
+| Layer           | Description                   |
+| --------------- | ----------------------------- |
+| `application`   | Any kind of application       |
+| `automation`    | E2E/integration/visual tests  |
+| `configuration` | Infrastructure and config     |
+| `library`       | Shareable, publishable code   |
+| `scaffolding`   | Templates or generators       |
+| `tool`          | Internal tools, CLIs, scripts |
+| `unknown`       | Default when unconfigured     |
+
+## Default Project
+
+Configure fallback project when running tasks without scope:
+
+```yaml
+# .moon/workspace.yml
+defaultProject: "core-app"
+```
+
+Usage:
+
+- `:task` without project scope runs on default project
+- `~:task` runs on closest project (previous behavior)
+
+## Toolchain Configuration Changes
+
+### v1 Structure (Nested)
+
+```yaml
+# .moon/toolchain.yml (v1)
+node:
+  version: "20.10.0"
+  packageManager: "pnpm"
+  pnpm:
+    version: "8.0.0"
+```
+
+### v2 Structure (Flat)
+
+```yaml
+# .moon/toolchains.yml (v2)
+javascript:
+  packageManager: "pnpm"
+  inferTasksFromScripts: true
+
+node:
+  version: "20.10.0"
+
+pnpm:
+  version: "8.0.0"
+```
+
+**Critical**: `bun`, `deno`, and `node` toolchains require `javascript` to be enabled:
+
+```yaml
+javascript: {} # Required!
+
+bun:
+  version: "1.0.0"
+```
+
+## WASM Extensions
+
+Built-in extensions must be explicitly enabled:
+
+```yaml
+# .moon/extensions.yml
+download: {}
+migrate-nx: {}
+migrate-turborepo: {}
+unpack: {}
+```
+
+## VCS Hooks Location
+
+Hooks now write to `.moon/hooks` instead of `.git/hooks`.
+
+## Remote Caching
+
+`unstable_remote` is now `remote`:
+
+```yaml
+# v1
+unstable_remote:
+  host: "grpcs://cache.example.com"
+
+# v2
+remote:
+  host: "grpcs://cache.example.com"
+```
+
+## CLI Changes
+
+| v1                          | v2                               |
+| --------------------------- | -------------------------------- |
+| `--logLevel`                | `--log-level` (kebab-case)       |
+| `--platform`                | `--toolchain`                    |
+| `moon node`                 | Removed                          |
+| `moon query hash`           | `moon hash`                      |
+| `moon query touched-files`  | `moon query changed-files`       |
+| `moon run --profile`        | Removed                          |
+| `moon generate <id> <dest>` | `moon generate <id> --to <dest>` |
+| `moon init --tool`          | `moon toolchain add`             |
+
+## Environment Variable Changes
+
+- `MOON_AFFECTED_FILES` now uses OS path separator (`:` Unix, `;` Windows) instead of comma
+
+## Removed Features
+
+- `x86_64-apple-darwin` (Apple Intel) - Only Apple Silicon supported
+- `moon node` command
+- `project.metadata` setting
+- `hasher.batchSize` setting
+- `experiments` section
+- Nested package manager config under `node`
+
+## MCP Protocol Changes
+
+- Updated protocol version to 2025-11-25
+- `get_projects` returns project fragments (not full objects)
+- `get_tasks` returns task fragments (not full objects)
+- No more `includeTasks` option
+
+## Deep Merge Behavior
+
+Tasks now undergo deep merging (sequential) rather than shallow merging:
+
+```yaml
+# Base task
+lint:
+  command: 'eslint'
+  args: ['--cache']
+  inputs: ['src/**/*']
+
+# Extended task - v2 merges deeply
+lint:
+  args: ['--fix']  # Results in ['--cache', '--fix']
+```
+
+## Migration Checklist
+
+- [ ] Rename `.moon/toolchain.yml` to `.moon/toolchains.yml`
+- [ ] Move `.moon/tasks.yml` to `.moon/tasks/all.yml`
+- [ ] Update `runner` to `pipeline` in workspace.yml
+- [ ] Update `type` to `layer` in project moon.yml files
+- [ ] Update `local: true` to `preset: server`
+- [ ] Update `platform` to `toolchains` in tasks
+- [ ] Add `javascript: {}` if using node/bun/deno
+- [ ] Update `unstable_remote` to `remote`
+- [ ] Convert complex commands to use `script`
+- [ ] Update CLI flags to kebab-case
+- [ ] Enable required extensions in `.moon/extensions.yml`
+- [ ] Run `moon migrate v2` to automate applicable changes
diff --git a/.agents/skills/moon/references/workspace-config.md b/.agents/skills/moon/references/workspace-config.md
new file mode 100644
index 0000000..015d171
--- /dev/null
+++ b/.agents/skills/moon/references/workspace-config.md
@@ -0,0 +1,281 @@
+# Moon Workspace Configuration Reference
+
+Complete reference for `.moon/workspace.yml` configuration.
+
+## Schema
+
+```yaml
+$schema: "https://moonrepo.dev/schemas/workspace.json"
+```
+
+## Projects
+
+### Glob Patterns
+
+```yaml
+projects:
+  - "apps/*"
+  - "packages/*"
+  - "tools/*"
+  - "!packages/deprecated-*" # Exclusion
+```
+
+### Explicit Mapping
+
+```yaml
+projects:
+  sources:
+    app: "apps/web"
+    api: "apps/api"
+  globs:
+    - "packages/*"
+```
+
+## VCS Configuration
+
+```yaml
+vcs:
+  client: "git" # v2: 'manager' renamed to 'client'
+  provider: "github" # github, gitlab, bitbucket, other
+  defaultBranch: "main"
+  remoteCandidates:
+    - "origin"
+    - "upstream"
+  hooks:
+    pre-commit:
+      - "moon run :lint --affected --status staged"
+    pre-push:
+      - "moon run :test --affected"
+```
+
+> Note: In v2, VCS hooks write to `.moon/hooks` instead of `.git/hooks`.
+
+## Pipeline Configuration (v2)
+
+> Note: In v2, `runner` was renamed to `pipeline`.
+
+```yaml
+pipeline:
+  # Targets to archive for caching
+  archivableTargets:
+    - ":build"
+    - ":test"
+
+  # Cache settings
+  cacheLifetime: "7 days"
+  autoCleanCache: true
+
+  # Output settings
+  inheritColorsForPipedTasks: true
+  logRunningCommand: true
+
+  # Execution
+  concurrency: 8 # Parallel task limit
+
+  # Dependency management
+  installDependencies: true
+  syncProjects: true
+  syncWorkspace: true
+
+  # Process control
+  killProcessThreshold: 3
+```
+
+## Default Project (v2)
+
+```yaml
+# When running :task without project scope, use this project
+defaultProject: "website"
+```
+
+## Hasher Configuration
+
+```yaml
+hasher:
+  # Optimization mode
+  optimization: "performance" # accuracy, performance
+
+  # Walk strategy
+  walkStrategy: "vcs" # glob, vcs
+
+  # Ignore patterns
+  ignoredPatterns:
+    - "**/.git/**"
+    - "**/node_modules/**"
+
+  # Batch size for hashing
+  batchSize: 2500
+```
+
+## Code Owners
+
+```yaml
+codeowners:
+  globalPaths:
+    "/*": ["@platform-team"]
+    "/apps/*": ["@product-team"]
+    "/packages/*": ["@library-team"]
+  orderBy: "project-source"
+  sync: true # v2: 'syncOnRun' renamed to 'sync'
+```
+
+## Constraints
+
+```yaml
+constraints:
+  # Enforce layer relationships
+  enforceProjectTypeRelationships: true
+
+  # Tag-based dependency rules
+  tagRelationships:
+    frontend:
+      requires: ["shared"]
+      conflicts: ["backend-only"]
+    backend:
+      requires: ["shared"]
+```
+
+## Generator
+
+```yaml
+generator:
+  templates:
+    - "./templates"
+    - "npm:@company/templates"
+```
+
+## Extensions
+
+```yaml
+extensions:
+  migrate-nx:
+    plugin: "https://example.com/migrate-nx.wasm"
+  custom:
+    plugin: "file://./extensions/custom.wasm"
+```
+
+## Remote Caching
+
+> Note: In v2, `unstable_remote` is now `remote`.
+
+```yaml
+remote:
+  host: "grpcs://cache.example.com"
+  auth:
+    token: "CACHE_TOKEN"
+    headers:
+      "X-Custom-Header": "value"
+  cache:
+    compression: "zstd"
+    verifyIntegrity: true
+    localReadOnly: false # Download only, no uploads (for dev)
+```
+
+### Self-Hosted with bazel-remote
+
+```yaml
+remote:
+  host: "grpc://your-server:9092"
+```
+
+Run bazel-remote:
+
+```bash
+bazel-remote --dir /path/to/moon-cache --max_size 10 \
+  --storage_mode zstd --grpc_address 0.0.0.0:9092
+```
+
+### TLS/mTLS Configuration
+
+```yaml
+remote:
+  host: 'grpcs://your-host.com:9092'
+  tls:
+    cert: 'certs/ca.pem'
+    domain: 'your-host.com'
+
+# Or mTLS
+remote:
+  host: 'grpcs://your-host.com:9092'
+  mtls:
+    caCert: 'certs/ca.pem'
+    clientCert: 'certs/client.pem'
+    clientKey: 'certs/client.key'
+    domain: 'your-host.com'
+```
+
+### Third-Party Providers
+
+```yaml
+# Depot
+remote:
+  host: "grpcs://cache.depot.dev"
+  auth:
+    token: "DEPOT_TOKEN"
+    headers:
+      "X-Depot-Org": "<org-id>"
+      "X-Depot-Project": "<project-id>"
+```
+
+## Notifier
+
+```yaml
+notifier:
+  webhookUrl: "https://hooks.slack.com/..."
+```
+
+## Telemetry
+
+```yaml
+telemetry: true # Enable usage telemetry
+```
+
+## Complete Example
+
+```yaml
+$schema: "https://moonrepo.dev/schemas/workspace.json"
+
+projects:
+  - "apps/*"
+  - "packages/*"
+  - "tools/*"
+
+vcs:
+  client: "git" # v2: 'manager' renamed to 'client'
+  provider: "github"
+  defaultBranch: "main"
+  hooks:
+    pre-commit:
+      - "moon run :lint --affected --status staged"
+
+pipeline: # v2: 'runner' renamed to 'pipeline'
+  archivableTargets:
+    - ":build"
+  cacheLifetime: "7 days"
+  inheritColorsForPipedTasks: true
+  logRunningCommand: true
+  autoCleanCache: true
+
+hasher:
+  optimization: "performance"
+  walkStrategy: "vcs"
+
+codeowners:
+  globalPaths:
+    "/*": ["@platform-team"]
+  sync: true # v2: 'syncOnRun' renamed to 'sync'
+
+constraints:
+  enforceProjectTypeRelationships: true
+  tagRelationships:
+    frontend:
+      requires: ["shared"]
+    backend:
+      requires: ["shared"]
+
+generator:
+  templates:
+    - "./templates"
+
+telemetry: true
+```
diff --git a/.agents/skills/proto/SKILL.md b/.agents/skills/proto/SKILL.md
new file mode 100644
index 0000000..df60531
--- /dev/null
+++ b/.agents/skills/proto/SKILL.md
@@ -0,0 +1,349 @@
+---
+name: proto
+description: This skill should be used when the user asks to "install proto", "configure proto", "manage tool versions", "pin versions", "set up .prototools", "install node version", "install rust version", "install python version", "proto plugins", or mentions proto commands, .prototools file, or multi-language version management.
+---
+
+# proto - Pluggable Multi-Language Version Manager
+
+proto is a next-generation version manager for multiple programming languages. It provides a unified interface for managing Node.js, npm, pnpm, yarn, Bun, Deno, Rust, Go, Python, and 800+ tools via plugins.
+
+## When to Use proto
+
+- Managing language/tool versions across projects
+- Pinning versions in `.prototools` for team consistency
+- Installing and running tools without global pollution
+- Replacing nvm, pyenv, rustup, gvm with a single tool
+
+## Installation
+
+```bash
+# Linux, macOS, WSL
+bash <(curl -fsSL https://moonrepo.dev/install/proto.sh)
+
+# Specific version, non-interactive
+bash <(curl -fsSL https://moonrepo.dev/install/proto.sh) 1.2.3 --yes
+```
+
+### Shell Setup
+
+```bash
+# Add to shell profile
+eval "$(proto activate bash)"   # Bash
+eval "$(proto activate zsh)"    # Zsh
+```
+
+## Quick Reference
+
+### Core Commands
+
+```bash
+proto install <tool>           # Install tool
+proto install node 20.10.0     # Install specific version
+proto install node --build     # Build from source (v0.45+)
+proto run <tool>               # Run with detected version
+proto exec node pnpm -- cmd    # Bootstrap multi-tool env (v0.53+)
+proto pin <tool> <version>     # Pin version locally
+proto pin <tool> --global      # Pin globally
+proto versions <tool>          # List available versions
+proto outdated                 # Check for updates
+proto clean                    # Remove unused tools
+proto upgrade                  # Upgrade proto itself
+proto diagnose                 # Identify installation issues
+proto debug config             # List all .prototools files
+proto debug env                # Show environment info
+```
+
+## Configuration: .prototools
+
+```toml
+# .prototools
+node = "20.10.0"
+npm = "10.2.0"
+pnpm = "8.12.0"
+yarn = "4.0.0"
+bun = "1.0.0"
+deno = "1.40.0"
+rust = "1.75.0"
+go = "1.21.0"
+python = "3.12.0"
+
+[plugins]
+my-tool = "https://example.com/plugin.wasm"
+
+[settings]
+auto-install = true
+auto-clean = true
+detect-strategy = "prefer-prototools"
+
+[env]
+NODE_ENV = "development"
+```
+
+### Version Specifiers
+
+| Format | Example     | Description             |
+| ------ | ----------- | ----------------------- |
+| Exact  | `"20.10.0"` | Exact version           |
+| Major  | `"20"`      | Latest 20.x.x           |
+| Tilde  | `"~20.10"`  | Patch updates only      |
+| Alias  | `"stable"`  | Language-specific alias |
+
+## Supported Tools (Built-in)
+
+### JavaScript/TypeScript
+
+```bash
+proto install node     # Node.js runtime
+proto install npm      # npm package manager
+proto install pnpm     # pnpm package manager
+proto install yarn     # Yarn package manager
+proto install bun      # Bun runtime
+proto install deno     # Deno runtime
+```
+
+### Systems Languages
+
+```bash
+proto install rust     # Rust (includes cargo)
+proto install go       # Go
+```
+
+### Other
+
+```bash
+proto install python   # Python (includes pip)
+```
+
+## Version Detection Order
+
+1. CLI argument: `proto run node 18.0.0`
+2. Environment variable: `PROTO_NODE_VERSION=18.0.0`
+3. Local `.prototools` (current + parent dirs)
+4. Ecosystem files: `.nvmrc`, `.node-version`, `package.json` engines
+5. Global `.prototools`: `~/.proto/.prototools`
+
+## Common Workflows
+
+### Pin Versions for Team
+
+```bash
+# Pin to local .prototools
+proto pin node 20.10.0
+proto pin pnpm 8.12.0
+
+# Pin globally (user default)
+proto pin node 20 --global
+```
+
+### Install All Tools
+
+```bash
+# Install everything from .prototools
+proto install
+```
+
+### Check for Updates
+
+```bash
+proto outdated                    # Check for updates
+proto outdated --update --latest  # Update .prototools
+```
+
+### Run with Specific Version
+
+```bash
+proto run node 18 -- script.js    # Override version
+PROTO_NODE_VERSION=18 proto run node  # Via env var
+```
+
+### Proto Exec (v0.53+)
+
+Bootstrap an environment with multiple tools:
+
+```bash
+# Run command with multiple tools
+proto exec node@24 pnpm@10 ruby@3.4 -- pnpm run app:start
+
+# Load tools from config
+proto exec --tools-from-config -- npm test
+
+# Interactive shell with activated tools
+proto exec node pnpm -- bash
+```
+
+### Build From Source (v0.45+)
+
+Compile tools from source (useful when pre-built binaries unavailable):
+
+```bash
+proto install ruby --build
+proto install node --build
+proto install python --build
+```
+
+Supported: Deno, Go, Moon, Node, Python, Ruby.
+
+```toml
+# .prototools
+[settings.build]
+install-system-packages = true
+write-log-file = true
+```
+
+## Plugins
+
+### Add Third-Party Plugin
+
+```bash
+proto plugin add atlas "https://raw.githubusercontent.com/.../plugin.toml"
+proto install atlas
+```
+
+### List Plugins
+
+```bash
+proto plugin list           # Show all plugins
+proto plugin list --versions  # With version info
+```
+
+### Plugin Sources
+
+```toml
+[plugins]
+# Remote TOML plugin
+atlas = "https://example.com/atlas/plugin.toml"
+
+# Remote WASM plugin
+custom = "https://example.com/plugin.wasm"
+
+# GitHub releases (recommended for distribution)
+my-tool = "github://org/repo"
+
+# Local development (WASM)
+local = "file://./target/wasm32-wasip1/release/plugin.wasm"
+```
+
+### WASM Plugin Development
+
+Build plugins with `proto_pdk` crate targeting `wasm32-wasip1`:
+
+```bash
+# Build plugin
+cargo build --target wasm32-wasip1 --release
+
+# Test locally
+proto install my-tool --log trace
+```
+
+Test configuration for local development:
+
+```toml
+# .prototools
+[settings]
+unstable-lockfile = true  # Create .protolock for consistency
+
+[plugins.tools]
+my-tool = "file://./target/wasm32-wasip1/release/my_tool.wasm"
+```
+
+Required WASM functions:
+
+- `register_tool` - Metadata (name, type)
+- `download_prebuilt` - Configure download/install
+- `locate_executables` - Define executable paths
+- `load_versions` - Fetch available versions
+
+Optional: `native_install`, `detect_version_files`, `parse_version_file`
+
+## Settings
+
+```toml
+[settings]
+# Auto-install missing tools
+auto-install = true
+
+# Auto-clean unused tools
+auto-clean = true
+
+# Version detection strategy
+# first-available, prefer-prototools, only-prototools
+detect-strategy = "prefer-prototools"
+
+# Pin "latest" alias to local or global config
+pin-latest = "local"
+
+# Create .protolock for reproducible installs
+unstable-lockfile = true
+
+# Disable telemetry
+telemetry = false
+
+[settings.http]
+# Configure proxies
+proxies = ["https://internal.proxy"]
+root-cert = "/path/to/cert.pem"
+
+[settings.offline]
+timeout = 500  # ms
+```
+
+## Environment Variables
+
+| Variable                     | Description                                  |
+| ---------------------------- | -------------------------------------------- |
+| `PROTO_HOME`                 | Installation directory (default: `~/.proto`) |
+| `PROTO_LOG`                  | Log level (trace, debug, info, warn, error)  |
+| `PROTO_*_VERSION`            | Override version for tool                    |
+| `PROTO_ENV`                  | Environment for config lookup                |
+| `PROTO_BYPASS_VERSION_CHECK` | Skip version validation                      |
+
+### Development/Testing Variables
+
+| Variable                     | Description                           |
+| ---------------------------- | ------------------------------------- |
+| `PROTO_TEST`                 | Enable test mode (loads test plugins) |
+| `PROTO_DEBUG_COMMAND`        | Show detailed command execution       |
+| `PROTO_DEBUG_WASM`           | Enable WASM plugin debugging          |
+| `WASMTIME_BACKTRACE_DETAILS` | Detailed WASM backtraces              |
+
+## Integration with moon
+
+proto is the toolchain backend for moon. Configure in `.moon/toolchains.yml` (v2):
+
+```yaml
+# .moon/toolchains.yml
+javascript:
+  packageManager: "pnpm"
+
+node:
+  version: "20.10.0"
+```
+
+Or pin moon itself via proto:
+
+```toml
+# .prototools
+moon = "1.31.0"
+```
+
+## CI/CD Integration
+
+```yaml
+# GitHub Actions
+- uses: moonrepo/setup-toolchain@v0
+  with:
+    auto-install: true
+```
+
+## Additional Resources
+
+For detailed configuration, consult:
+
+- **`references/config.md`** - Complete .prototools reference
+- **`references/plugins.md`** - Plugin development guide
+- **`references/commands.md`** - Full CLI reference
+
+### Examples
+
+- **`examples/prototools-full.toml`** - Complete configuration
+- **`examples/plugin.toml`** - TOML plugin example
diff --git a/.agents/skills/proto/examples/prototools-full.toml b/.agents/skills/proto/examples/prototools-full.toml
new file mode 100644
index 0000000..bdc5d77
--- /dev/null
+++ b/.agents/skills/proto/examples/prototools-full.toml
@@ -0,0 +1,84 @@
+# .prototools - Complete configuration example
+
+# Core language versions
+node = "20.10.0"
+npm = "10.2.0"
+pnpm = "8.12.0"
+yarn = "4.0.0"
+bun = "1.0.18"
+deno = "1.40.0"
+rust = "1.75.0"
+go = "1.21.5"
+python = "3.12.0"
+
+# Pin proto itself
+proto = "0.51.0"
+
+# Pin moon (if using)
+moon = "1.31.0"
+
+# Third-party plugins
+[plugins]
+# Database tools
+atlas = "https://raw.githubusercontent.com/crashdump/proto-tools/main/toml-plugins/atlas/plugin.toml"
+
+# Configuration language
+pkl = "https://raw.githubusercontent.com/milesj/proto-plugins/master/pkl.toml"
+
+# CLI tools
+jira = "https://raw.githubusercontent.com/Phault/proto-toml-plugins/main/jira/plugin.toml"
+
+# Global settings
+[settings]
+# Automatically install missing tools when running
+auto-install = true
+
+# Automatically clean unused tools in background
+auto-clean = true
+
+# Disable telemetry collection
+telemetry = false
+
+# How to detect versions
+# first-available: Use first version found (default)
+# prefer-prototools: Prefer .prototools over ecosystem files
+# only-prototools: Only use .prototools
+detect-strategy = "prefer-prototools"
+
+# HTTP/Network settings
+[settings.http]
+# Corporate proxy
+proxies = ["https://corporate.proxy:8080"]
+
+# Proxies to treat as secure even if HTTP
+secure-proxies = ["http://internal.proxy"]
+
+# Custom root certificate for SSL
+# root-cert = "/path/to/corporate-ca.pem"
+
+# Offline mode settings
+[settings.offline]
+# Timeout for connectivity check (ms)
+timeout = 750
+
+# Global environment variables
+[env]
+# Development defaults
+NODE_ENV = "development"
+RUST_BACKTRACE = "1"
+
+# Variable substitution
+# API_BASE = "${COMPANY_API_HOST}/v1"
+
+# Per-tool configuration
+[tools.node]
+# Custom aliases
+aliases = { work = "18.19.0", personal = "21.0.0" }
+
+[tools.node.env]
+# Node-specific environment
+NODE_OPTIONS = "--max-old-space-size=4096"
+
+[tools.python.env]
+# Python-specific environment
+PYTHONDONTWRITEBYTECODE = "1"
diff --git a/.agents/skills/proto/references/commands.md b/.agents/skills/proto/references/commands.md
new file mode 100644
index 0000000..ebec77a
--- /dev/null
+++ b/.agents/skills/proto/references/commands.md
@@ -0,0 +1,235 @@
+# Proto CLI Reference
+
+Complete reference for all proto commands.
+
+## Installation Commands
+
+### proto install
+
+Install tools from `.prototools` or specific versions.
+
+```bash
+proto install                    # Install all from .prototools
+proto install node               # Install node (latest or pinned)
+proto install node 20.10.0       # Install specific version
+proto install node --pin         # Install and pin locally
+proto install node --pin global  # Install and pin globally
+proto install --config-mode all  # Include global config
+```
+
+### proto uninstall
+
+Remove installed tool versions.
+
+```bash
+proto uninstall node 20.10.0
+proto uninstall node --all       # Remove all versions
+```
+
+## Execution Commands
+
+### proto run
+
+Execute a tool with the detected version.
+
+```bash
+proto run node                   # Run with detected version
+proto run node 18                # Run specific version
+proto run node -- script.js      # Pass arguments
+PROTO_NODE_VERSION=18 proto run node  # Via env var
+```
+
+### proto use
+
+Switch to a pinned version in current shell.
+
+```bash
+proto use node 20
+proto use node latest
+```
+
+## Version Management
+
+### proto pin
+
+Pin a version to `.prototools`.
+
+```bash
+proto pin node 20.10.0           # Pin locally
+proto pin node 20 --global       # Pin globally
+proto pin node 20 --to user      # Pin to ~/.prototools
+```
+
+### proto unpin
+
+Remove a pinned version.
+
+```bash
+proto unpin node
+proto unpin node --global
+```
+
+### proto versions
+
+List available versions for a tool.
+
+```bash
+proto versions node              # All versions (installed marked)
+```
+
+### proto outdated
+
+Check for version updates.
+
+```bash
+proto outdated                   # Check all tools
+proto outdated --config-mode all # Include global
+proto outdated --update          # Update .prototools
+proto outdated --update --latest # Update to latest
+proto outdated --json            # JSON output
+```
+
+## Plugin Commands
+
+### proto plugin add
+
+Register a plugin.
+
+```bash
+proto plugin add <name> <source>
+proto plugin add atlas "https://example.com/atlas/plugin.toml"
+```
+
+### proto plugin remove
+
+Unregister a plugin.
+
+```bash
+proto plugin remove atlas
+```
+
+### proto plugin list
+
+List registered plugins.
+
+```bash
+proto plugin list                # All plugins
+proto plugin list --versions     # With version info
+proto plugin list node npm       # Specific plugins
+```
+
+### proto plugin info
+
+Show plugin details.
+
+```bash
+proto plugin info node
+```
+
+## Alias Commands
+
+### proto alias
+
+Create a version alias.
+
+```bash
+proto alias node work 18.0.0     # Create 'work' alias
+proto alias node lts 20.10.0     # Override 'lts'
+```
+
+### proto unalias
+
+Remove an alias.
+
+```bash
+proto unalias node work
+```
+
+## Maintenance Commands
+
+### proto clean
+
+Remove unused tools and cache.
+
+```bash
+proto clean                      # Clean stale tools (30+ days unused)
+proto clean plugins              # Clean plugins only
+proto clean --days 7             # Custom threshold
+```
+
+### proto upgrade
+
+Upgrade proto itself.
+
+```bash
+proto upgrade                    # Upgrade to latest
+proto upgrade --check            # Check only
+proto upgrade 0.50.0             # Specific version
+```
+
+### proto setup
+
+Initialize proto in current shell.
+
+```bash
+proto setup                      # Configure shell
+proto setup bash                 # Specific shell
+proto setup --no-modify-profile  # Don't modify profile
+```
+
+## Debug Commands
+
+### proto debug env
+
+Show environment and configuration.
+
+```bash
+proto debug env
+```
+
+Output includes:
+
+- Store paths (root, bins, shims, plugins, tools, temp)
+- Proto version
+- OS and architecture
+- Config sources
+- Virtual paths
+- Environment variables
+
+### proto debug config
+
+Show resolved configuration.
+
+```bash
+proto debug config
+proto debug config --json
+```
+
+## Activate Command
+
+### proto activate
+
+Generate shell activation script.
+
+```bash
+eval "$(proto activate bash)"    # Bash
+eval "$(proto activate zsh)"     # Zsh
+source (proto activate fish | psub)  # Fish
+```
+
+## Common Options
+
+| Flag            | Description                                |
+| --------------- | ------------------------------------------ |
+| `--log <level>` | Log level: trace, debug, info, warn, error |
+| `--json`        | JSON output (where supported)              |
+| `--yes`, `-y`   | Skip confirmations                         |
+
+## Environment Variables
+
+| Variable          | Description                   |
+| ----------------- | ----------------------------- |
+| `PROTO_HOME`      | Installation directory        |
+| `PROTO_LOG`       | Default log level             |
+| `PROTO_*_VERSION` | Override version for tool     |
+| `PROTO_ENV`       | Environment for config lookup |
diff --git a/.agents/skills/proto/references/config.md b/.agents/skills/proto/references/config.md
new file mode 100644
index 0000000..6aaecca
--- /dev/null
+++ b/.agents/skills/proto/references/config.md
@@ -0,0 +1,195 @@
+# Proto Configuration Reference
+
+Complete reference for `.prototools` configuration.
+
+## File Location
+
+Proto searches for `.prototools` in this order:
+
+1. Current directory
+2. Parent directories (up to filesystem root)
+3. User home: `~/.prototools`
+4. Proto store: `~/.proto/.prototools`
+
+## Version Pinning
+
+```toml
+# Exact versions (recommended for CI)
+node = "20.10.0"
+npm = "10.2.0"
+pnpm = "8.12.0"
+yarn = "4.0.0"
+bun = "1.0.18"
+deno = "1.40.0"
+rust = "1.75.0"
+go = "1.21.5"
+python = "3.12.0"
+
+# Pin proto itself
+proto = "0.51.0"
+
+# Partial versions (resolves to latest patch)
+node = "20.10"
+node = "20"
+
+# Tilde (patch updates only)
+node = "~20.10"
+
+# Caret (minor updates)
+node = "^20"
+
+# Aliases
+rust = "stable"
+node = "lts"
+```
+
+## Plugin Configuration
+
+```toml
+[plugins]
+# Remote TOML plugin
+atlas = "https://raw.githubusercontent.com/example/plugin.toml"
+
+# Remote WASM plugin
+custom = "https://example.com/plugin.wasm"
+
+# Local file (development)
+dev-tool = "file://./target/wasm32-wasip1/debug/plugin.wasm"
+
+# From registry (when available)
+# tool = "source:tool-name"
+```
+
+## Settings
+
+```toml
+[settings]
+# Auto-install missing tools on `proto run`
+auto-install = true
+
+# Auto-clean unused tools
+auto-clean = true
+
+# Disable telemetry
+telemetry = false
+
+# Version detection strategy
+# first-available - Use first found (default)
+# prefer-prototools - Prefer .prototools over ecosystem files
+# only-prototools - Only use .prototools
+detect-strategy = "prefer-prototools"
+```
+
+## HTTP Settings
+
+```toml
+[settings.http]
+# Proxy configuration
+proxies = ["https://internal.proxy", "https://corp.net/proxy"]
+
+# Mark proxies as secure (bypass SSL checks)
+secure-proxies = ["http://internal.proxy"]
+
+# Custom root certificate
+root-cert = "/path/to/root/cert.pem"
+```
+
+## Offline Settings
+
+```toml
+[settings.offline]
+# Timeout for connectivity check (milliseconds)
+timeout = 500
+```
+
+## Environment Variables
+
+```toml
+[env]
+# Set environment variables
+DEBUG = "*"
+NODE_ENV = "development"
+
+# Variable substitution
+API_URL = "${BASE_URL}/api"
+
+# Unset a variable
+UNWANTED_VAR = false
+```
+
+## Environment-Specific Configuration
+
+Use `PROTO_ENV` for environment-specific configs:
+
+```bash
+PROTO_ENV=production proto run node
+```
+
+Lookup order with `PROTO_ENV=production`:
+
+1. `./.prototools.production`
+2. `./.prototools`
+3. `~/.prototools.production`
+4. `~/.prototools`
+5. `~/.proto/.prototools`
+
+## Per-Tool Settings
+
+```toml
+[tools.node]
+# Tool-specific configuration
+aliases = { lts = "20.10.0", current = "21.0.0" }
+
+[tools.node.env]
+# Environment variables for this tool only
+NODE_OPTIONS = "--max-old-space-size=4096"
+```
+
+## Environment Variables Reference
+
+| Variable                     | Description                                  |
+| ---------------------------- | -------------------------------------------- |
+| `PROTO_HOME`                 | Installation directory (default: `~/.proto`) |
+| `PROTO_LOG`                  | Log level (trace, debug, info, warn, error)  |
+| `PROTO_WASM_LOG`             | WASM plugin log level                        |
+| `PROTO_CACHE`                | Cache behavior (`off` to disable)            |
+| `PROTO_ENV`                  | Environment name for config lookup           |
+| `PROTO_*_VERSION`            | Override version for tool                    |
+| `PROTO_BYPASS_VERSION_CHECK` | Skip version validation                      |
+| `PROTO_OFFLINE_TIMEOUT`      | Connectivity check timeout                   |
+
+## Complete Example
+
+```toml
+# .prototools
+
+# Tool versions
+node = "20.10.0"
+npm = "10.2.0"
+pnpm = "8.12.0"
+rust = "1.75.0"
+python = "3.12.0"
+go = "1.21.5"
+proto = "0.51.0"
+
+# Third-party plugins
+[plugins]
+atlas = "https://raw.githubusercontent.com/crashdump/proto-tools/main/toml-plugins/atlas/plugin.toml"
+pkl = "https://raw.githubusercontent.com/milesj/proto-plugins/master/pkl.toml"
+
+# Global settings
+[settings]
+auto-install = true
+auto-clean = true
+detect-strategy = "prefer-prototools"
+telemetry = false
+
+# Network configuration
+[settings.http]
+proxies = ["https://corporate.proxy:8080"]
+
+# Environment variables
+[env]
+NODE_ENV = "development"
+RUST_BACKTRACE = "1"
+```
diff --git a/.agents/skills/using-git-worktrees/SKILL.md b/.agents/skills/using-git-worktrees/SKILL.md
new file mode 100644
index 0000000..e153843
--- /dev/null
+++ b/.agents/skills/using-git-worktrees/SKILL.md
@@ -0,0 +1,218 @@
+---
+name: using-git-worktrees
+description: Use when starting feature work that needs isolation from current workspace or before executing implementation plans - creates isolated git worktrees with smart directory selection and safety verification
+---
+
+# Using Git Worktrees
+
+## Overview
+
+Git worktrees create isolated workspaces sharing the same repository, allowing work on multiple branches simultaneously without switching.
+
+**Core principle:** Systematic directory selection + safety verification = reliable isolation.
+
+**Announce at start:** "I'm using the using-git-worktrees skill to set up an isolated workspace."
+
+## Directory Selection Process
+
+Follow this priority order:
+
+### 1. Check Existing Directories
+
+```bash
+# Check in priority order
+ls -d .worktrees 2>/dev/null     # Preferred (hidden)
+ls -d worktrees 2>/dev/null      # Alternative
+```
+
+**If found:** Use that directory. If both exist, `.worktrees` wins.
+
+### 2. Check CLAUDE.md
+
+```bash
+grep -i "worktree.*director" CLAUDE.md 2>/dev/null
+```
+
+**If preference specified:** Use it without asking.
+
+### 3. Ask User
+
+If no directory exists and no CLAUDE.md preference:
+
+```
+No worktree directory found. Where should I create worktrees?
+
+1. .worktrees/ (project-local, hidden)
+2. ~/.config/superpowers/worktrees/<project-name>/ (global location)
+
+Which would you prefer?
+```
+
+## Safety Verification
+
+### For Project-Local Directories (.worktrees or worktrees)
+
+**MUST verify directory is ignored before creating worktree:**
+
+```bash
+# Check if directory is ignored (respects local, global, and system gitignore)
+git check-ignore -q .worktrees 2>/dev/null || git check-ignore -q worktrees 2>/dev/null
+```
+
+**If NOT ignored:**
+
+Per Jesse's rule "Fix broken things immediately":
+1. Add appropriate line to .gitignore
+2. Commit the change
+3. Proceed with worktree creation
+
+**Why critical:** Prevents accidentally committing worktree contents to repository.
+
+### For Global Directory (~/.config/superpowers/worktrees)
+
+No .gitignore verification needed - outside project entirely.
+
+## Creation Steps
+
+### 1. Detect Project Name
+
+```bash
+project=$(basename "$(git rev-parse --show-toplevel)")
+```
+
+### 2. Create Worktree
+
+```bash
+# Determine full path
+case $LOCATION in
+  .worktrees|worktrees)
+    path="$LOCATION/$BRANCH_NAME"
+    ;;
+  ~/.config/superpowers/worktrees/*)
+    path="~/.config/superpowers/worktrees/$project/$BRANCH_NAME"
+    ;;
+esac
+
+# Create worktree with new branch
+git worktree add "$path" -b "$BRANCH_NAME"
+cd "$path"
+```
+
+### 3. Run Project Setup
+
+Auto-detect and run appropriate setup:
+
+```bash
+# Node.js
+if [ -f package.json ]; then npm install; fi
+
+# Rust
+if [ -f Cargo.toml ]; then cargo build; fi
+
+# Python
+if [ -f requirements.txt ]; then pip install -r requirements.txt; fi
+if [ -f pyproject.toml ]; then poetry install; fi
+
+# Go
+if [ -f go.mod ]; then go mod download; fi
+```
+
+### 4. Verify Clean Baseline
+
+Run tests to ensure worktree starts clean:
+
+```bash
+# Examples - use project-appropriate command
+npm test
+cargo test
+pytest
+go test ./...
+```
+
+**If tests fail:** Report failures, ask whether to proceed or investigate.
+
+**If tests pass:** Report ready.
+
+### 5. Report Location
+
+```
+Worktree ready at <full-path>
+Tests passing (<N> tests, 0 failures)
+Ready to implement <feature-name>
+```
+
+## Quick Reference
+
+| Situation | Action |
+|-----------|--------|
+| `.worktrees/` exists | Use it (verify ignored) |
+| `worktrees/` exists | Use it (verify ignored) |
+| Both exist | Use `.worktrees/` |
+| Neither exists | Check CLAUDE.md → Ask user |
+| Directory not ignored | Add to .gitignore + commit |
+| Tests fail during baseline | Report failures + ask |
+| No package.json/Cargo.toml | Skip dependency install |
+
+## Common Mistakes
+
+### Skipping ignore verification
+
+- **Problem:** Worktree contents get tracked, pollute git status
+- **Fix:** Always use `git check-ignore` before creating project-local worktree
+
+### Assuming directory location
+
+- **Problem:** Creates inconsistency, violates project conventions
+- **Fix:** Follow priority: existing > CLAUDE.md > ask
+
+### Proceeding with failing tests
+
+- **Problem:** Can't distinguish new bugs from pre-existing issues
+- **Fix:** Report failures, get explicit permission to proceed
+
+### Hardcoding setup commands
+
+- **Problem:** Breaks on projects using different tools
+- **Fix:** Auto-detect from project files (package.json, etc.)
+
+## Example Workflow
+
+```
+You: I'm using the using-git-worktrees skill to set up an isolated workspace.
+
+[Check .worktrees/ - exists]
+[Verify ignored - git check-ignore confirms .worktrees/ is ignored]
+[Create worktree: git worktree add .worktrees/auth -b feature/auth]
+[Run npm install]
+[Run npm test - 47 passing]
+
+Worktree ready at /Users/jesse/myproject/.worktrees/auth
+Tests passing (47 tests, 0 failures)
+Ready to implement auth feature
+```
+
+## Red Flags
+
+**Never:**
+- Create worktree without verifying it's ignored (project-local)
+- Skip baseline test verification
+- Proceed with failing tests without asking
+- Assume directory location when ambiguous
+- Skip CLAUDE.md check
+
+**Always:**
+- Follow directory priority: existing > CLAUDE.md > ask
+- Verify directory is ignored for project-local
+- Auto-detect and run project setup
+- Verify clean test baseline
+
+## Integration
+
+**Called by:**
+- **brainstorming** (Phase 4) - REQUIRED when design is approved and implementation follows
+- **subagent-driven-development** - REQUIRED before executing any tasks
+- **executing-plans** - REQUIRED before executing any tasks
+- Any skill needing isolated workspace
+
+**Pairs with:**
+- **finishing-a-development-branch** - REQUIRED for cleanup after work complete
diff --git a/.claude/skills/cssforge b/.claude/skills/cssforge
new file mode 120000
index 0000000..2e01389
--- /dev/null
+++ b/.claude/skills/cssforge
@@ -0,0 +1 @@
+../../skills/cssforge
\ No newline at end of file
diff --git a/.claude/skills/using-git-worktrees b/.claude/skills/using-git-worktrees
new file mode 120000
index 0000000..d49204a
--- /dev/null
+++ b/.claude/skills/using-git-worktrees
@@ -0,0 +1 @@
+../../.agents/skills/using-git-worktrees
\ No newline at end of file
diff --git a/.github/workflows/ci.yaml b/.github/workflows/ci.yaml
index 7015975..1b72840 100644
--- a/.github/workflows/ci.yaml
+++ b/.github/workflows/ci.yaml
@@ -1,49 +1,37 @@
-name: Format & Publish Dry Run
+name: CI
 
 on:
   push:
     branches:
       - main
-
   pull_request:
     branches:
       - main
 
 jobs:
-  format:
-    runs-on: ubuntu-latest
-    steps:
-      - uses: actions/checkout@v4
-
-      - uses: denoland/setup-deno@v2
-        with:
-          deno-version: v2.x
-
-      - name: Format
-        run: deno fmt --check
-
-  publish-dry-run:
+  quality:
     runs-on: ubuntu-latest
 
     steps:
       - uses: actions/checkout@v4
 
-      - uses: denoland/setup-deno@v2
-        with:
-          deno-version: v2.x
+      - name: Install proto
+        run: curl -fsSL https://moonrepo.dev/install/proto.sh | bash -s -- 0.55.2 --yes
 
-      - name: Publish dry run
-        run: deno publish --dry-run
+      - name: Add proto to PATH
+        run: echo "$HOME/.proto/bin" >> "$GITHUB_PATH"
 
-  test:
-    runs-on: ubuntu-latest
+      - name: Install toolchains from .prototools
+        run: proto install
 
-    steps:
-      - uses: actions/checkout@v4
+      - name: Install dependencies
+        run: proto run pnpm -- install --frozen-lockfile
+
+      - name: Format
+        run: moon run :format
 
-      - uses: denoland/setup-deno@v2
-        with:
-          deno-version: v2.x
+      - name: Test
+        run: moon run :test
 
-      - name: Run tests
-        run: deno test -A
+      - name: Typecheck
+        run: moon run :typecheck
diff --git a/.github/workflows/release.yaml b/.github/workflows/release.yaml
index 1961d0d..760f932 100644
--- a/.github/workflows/release.yaml
+++ b/.github/workflows/release.yaml
@@ -14,28 +14,42 @@ permissions:
 jobs:
   release:
     runs-on: ubuntu-latest
+
     steps:
       - name: Checkout
         uses: actions/checkout@v4
         with:
           fetch-depth: 0
 
-      - name: Setup Node.js
-        uses: actions/setup-node@v4
-        with:
-          node-version: 24
+      - name: Install proto
+        run: curl -fsSL https://moonrepo.dev/install/proto.sh | bash -s -- 0.55.2 --yes
+
+      - name: Add proto to PATH
+        run: echo "$HOME/.proto/bin" >> "$GITHUB_PATH"
+
+      - name: Install toolchains from .prototools
+        run: proto install
+
+      - name: Install dependencies
+        run: proto run pnpm -- install --frozen-lockfile
 
       - name: Create Release Pull Request
         id: changesets
         uses: changesets/action@v1
         with:
-          commit: "chore(release): update release & CHANGELOG.md"
-          title: "release: 📦 update packages version"
-          version: npm run version
-          publish: echo "This could be a publish to npm command"
+          commit: "chore(release): update release metadata"
+          title: "release: update packages"
+          version: moon run repo-tools:version
+          publish: echo "No npm publish step"
         env:
           GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
 
-      - name: Publish to jsr.io
+      - name: Setup Deno (JSR publish only)
+        if: steps.changesets.outputs.hasChangesets == 'false'
+        uses: denoland/setup-deno@v2
+        with:
+          deno-version: v2.x
+
+      - name: Publish to JSR
         if: steps.changesets.outputs.hasChangesets == 'false'
-        run: npx jsr publish
+        run: moon run cssforge:jsr-publish
diff --git a/.gitignore b/.gitignore
index 66d9451..327ba44 100644
--- a/.gitignore
+++ b/.gitignore
@@ -1,6 +1,10 @@
 node_modules
+package-lock.json
+.moon/cache
+dist
 generated
 convert.ts
 /cssforge.config.ts
 /.cssforge
-TODO.md
\ No newline at end of file
+TODO.md
+.worktrees
diff --git a/.moon/tasks/node.yml b/.moon/tasks/node.yml
new file mode 100644
index 0000000..98ba524
--- /dev/null
+++ b/.moon/tasks/node.yml
@@ -0,0 +1,23 @@
+$schema: "https://moonrepo.dev/schemas/tasks.json"
+
+inheritedBy:
+  toolchains:
+    or:
+      - "javascript"
+
+fileGroups:
+  sources:
+    - "src/**/*"
+  tests:
+    - "tests/**/*"
+  configs:
+    - "package.json"
+    - "tsconfig*.json"
+    - "vite.config.*"
+    - "next.config.*"
+    - "nuxt.config.*"
+    - "playwright.config.*"
+    - "svelte.config.*"
+    - "app.config.*"
+    - "eslint.config.*"
+    - "postcss.config.*"
diff --git a/.moon/toolchains.yml b/.moon/toolchains.yml
new file mode 100644
index 0000000..0484851
--- /dev/null
+++ b/.moon/toolchains.yml
@@ -0,0 +1,11 @@
+$schema: "https://moonrepo.dev/schemas/v2/toolchains.json"
+
+javascript:
+  packageManager: "pnpm"
+  inferTasksFromScripts: false
+
+node: {}
+
+pnpm: {}
+
+typescript: {}
diff --git a/.moon/workspace.yml b/.moon/workspace.yml
new file mode 100644
index 0000000..0352ecd
--- /dev/null
+++ b/.moon/workspace.yml
@@ -0,0 +1,15 @@
+$schema: "https://moonrepo.dev/schemas/workspace.json"
+
+defaultProject: "cssforge"
+
+projects:
+  - "packages/*"
+  - "example/*"
+  - "!example/basic"
+
+vcs:
+  client: "git"
+  defaultBranch: "main"
+
+pipeline:
+  cacheLifetime: "7 days"
diff --git a/.prototools b/.prototools
new file mode 100644
index 0000000..d66a808
--- /dev/null
+++ b/.prototools
@@ -0,0 +1,8 @@
+node = "24.13.1"
+pnpm = "10.30.0"
+moon = "2.0.0"
+proto = "0.55.2"
+
+[settings]
+auto-install = true
+detect-strategy = "prefer-prototools"
diff --git a/AGENTS.md b/AGENTS.md
index 7960d10..44c74b9 100644
--- a/AGENTS.md
+++ b/AGENTS.md
@@ -1,12 +1,12 @@
 # Css Forge Library
 
-This is a library for generating CSS variables from design tokens. This library uses Deno
-and TypeScript.
+This is a library for generating CSS variables from design tokens. The repository is a
+Node.js + pnpm workspace using moon v2 and proto.
 
 ## Creating new features and modules
 
-Make sure to follow the established conventions for modules in `src/modules`. Make sure to
-add tests following the pattern in the `tests` folder.
+Follow the established module conventions in `packages/cssforge/src/modules` and add tests
+following the pattern in `packages/cssforge/tests`.
 
 ## Dependencies
 
@@ -15,8 +15,9 @@ standard library or writing code from first principles.
 
 ## Updating the README.md
 
-To update the README, use the `deno task readme:update` command. There is a special syntax
-in the README that generates the codeblocks. For a comment like this:
+To update the README, run `moon run cssforge:readme-update` from the workspace root.
+There is a special syntax in the README that generates codeblocks. For a comment like
+this:
 
 <comment>
 <!-- md:generate defineConfig
diff --git a/CLAUDE.md b/CLAUDE.md
new file mode 100644
index 0000000..43c994c
--- /dev/null
+++ b/CLAUDE.md
@@ -0,0 +1 @@
+@AGENTS.md
diff --git a/README.md b/README.md
index 6d9fea7..aeb4c99 100644
--- a/README.md
+++ b/README.md
@@ -43,12 +43,12 @@ npx jsr add @hebilicious/cssforge
 pnpm i jsr:@hebilicious/cssforge
 ```
 
-Then to run CSS forge, add the following script to your `package.json` or `deno.json` :
+Then to run CSS forge, add the following script to your `package.json`:
 
 ```json
 {
   "scripts": {
-    "cssforge": "node node_modules/@hebilicious/cssforge/src/cli"
+    "cssforge": "tsx ./node_modules/@hebilicious/cssforge/src/cli.ts"
   }
 }
 ```
@@ -56,12 +56,22 @@ Then to run CSS forge, add the following script to your `package.json` or `deno.
 then run :
 
 ```bash
-#npm
-npm run cssforge
-#pnpm
 pnpm run cssforge
 ```
 
+## Contributing Workflow
+
+This repository is a pnpm workspace orchestrated with moon.
+
+```bash
+pnpm install
+moon run :format
+moon run cssforge:test
+moon run cssforge:typecheck
+moon run cssforge:build
+moon run cssforge:jsr-dry-run
+```
+
 ## Quick Start
 
 1. Create a configuration file (`cssforge.config.ts`):
@@ -124,42 +134,22 @@ export default defineConfig({
 
 2. Run CSS Forge with the CLI :
 
-If you're using a package.json, add the follwing to your scripts :
+If you're using a `package.json`, add the following to your scripts:
 
 ```json
 {
   "scripts": {
-    "cssforge": "node node_modules/@hebilicious/cssforge/src/cli"
+    "cssforge": "tsx ./node_modules/@hebilicious/cssforge/src/cli.ts"
   }
 }
 ```
 
-_In the future JSR will support using `npx @hebilicious/cssforge` directly._
-
 Then run the following command :
 
 ```bash
-npm run cssforge # Basic usage
-npm run cssforge --help # To see all options
-npm run cssforge --watch # To watch for changes
-```
-
-If you're using a deno.json :
-
-```json
-{
-  "tasks": {
-    "cssforge": "deno run -A jsr:@hebilicious/cssforge/cli"
-  }
-}
-```
-
-Then :
-
-```bash
-deno task cssforge # Basic usage
-deno task cssforge --help # To see all options
-deno task cssforge --watch # To watch for changes
+pnpm run cssforge # Basic usage
+pnpm run cssforge -- --help # To see all options
+pnpm run cssforge -- --watch # To watch for changes
 ```
 
 3. Use the generated variables in your CSS:
@@ -409,33 +399,29 @@ This will generate the following CSS :
 ```css
 /*____ CSSForge ____*/
 :root {
-  /*____ Colors ____*/
-  /* Palette */
-  /* simple */
-  --palette-simple-white: oklch(100% 0 0);
-  --palette-simple-black: oklch(0% 0 0);
-  --palette-simple-green: oklch(86.644% 0.29483 142.49535);
-  --palette-simple-blue: oklch(45.201% 0.31321 264.05202);
-  --palette-simple-violet: oklch(70% 0.2 270);
-  --palette-simple-red: oklch(62.796% 0.25768 29.23388);
-  /* Gradients */
-  /* white-green */
-  --gradients-white-green-primary: linear-gradient(
-    to right,
-    var(--palette-simple-white),
-    var(--palette-simple-green)
-  );
-  /* Themes */
-  /* Theme: light */
+/*____ Colors ____*/
+/* Palette */
+/* simple */
+--palette-simple-white: oklch(100% 0 0);
+--palette-simple-black: oklch(0% 0 0);
+--palette-simple-green: oklch(86.644% 0.29483 142.49535);
+--palette-simple-blue: oklch(45.201% 0.31321 264.05202);
+--palette-simple-violet: oklch(70% 0.2 270);
+--palette-simple-red: oklch(62.796% 0.25768 29.23388);
+/* Gradients */
+/* white-green */
+--gradients-white-green-primary: linear-gradient(to right, var(--palette-simple-white), var(--palette-simple-green));
+/* Themes */
+/* Theme: light */
+/* background */
+--primary: var(--palette-simple-white);
+--secondary: var(--gradients-white-green-primary);
+/* Theme: dark */
+@media (prefers-color-scheme: dark) {
   /* background */
-  --primary: var(--palette-simple-white);
-  --secondary: var(--gradients-white-green-primary);
-  /* Theme: dark */
-  @media (prefers-color-scheme: dark) {
-    /* background */
-    --primary: var(--palette-another-yellow);
-    --secondary: var(--palette-another-cyan);
-  }
+  --primary: var(--palette-another-yellow);
+  --secondary: var(--palette-another-cyan);
+}
 }
 /* another */
 .Another {
@@ -515,11 +501,11 @@ This will generate the following CSS :
 ```css
 /*____ CSSForge ____*/
 :root {
-  /*____ Spacing ____*/
-  --spacing-size-1: 0.25rem;
-  --spacing-size-2: 0.5rem;
-  --spacing-size-3: 0.75rem;
-  --spacing-size-4: 1rem;
+/*____ Spacing ____*/
+--spacing-size-1: 0.25rem;
+--spacing-size-2: 0.5rem;
+--spacing-size-3: 0.75rem;
+--spacing-size-4: 1rem;
 }
 ```
 
@@ -576,12 +562,12 @@ This will generate the following CSS :
 ```css
 /*____ CSSForge ____*/
 :root {
-  /*____ Spacing ____*/
-  --spacing_fluid-base-hi-xs: clamp(0rem, 0rem + 0vw, 0rem);
-  --spacing_fluid-base-hi-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
-  --spacing_fluid-base-hi-m: clamp(0.75rem, -0.5rem + 6.25vw, 4.5rem);
-  --spacing_fluid-base-hi-xs-s: clamp(0rem, -0.5rem + 2.5vw, 1.5rem);
-  --spacing_fluid-base-hi-s-m: clamp(0.25rem, -1.1667rem + 7.0833vw, 4.5rem);
+/*____ Spacing ____*/
+--spacing_fluid-base-hi-xs: clamp(0rem, 0rem + 0vw, 0rem);
+--spacing_fluid-base-hi-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
+--spacing_fluid-base-hi-m: clamp(0.75rem, -0.5rem + 6.25vw, 4.5rem);
+--spacing_fluid-base-hi-xs-s: clamp(0rem, -0.5rem + 2.5vw, 1.5rem);
+--spacing_fluid-base-hi-s-m: clamp(0.25rem, -1.1667rem + 7.0833vw, 4.5rem);
 }
 ```
 
@@ -644,26 +630,26 @@ This will generate the following CSS :
 ```css
 /*____ CSSForge ____*/
 :root {
-  /*____ Spacing ____*/
-  --spacing_fluid-base-smooth-3xs: clamp(0.0625rem, -0.0417rem + 0.5208vw, 0.375rem);
-  --spacing_fluid-base-smooth-2xs: clamp(0.125rem, -0.0833rem + 1.0417vw, 0.75rem);
-  --spacing_fluid-base-smooth-xs: clamp(0.1875rem, -0.125rem + 1.5625vw, 1.125rem);
-  --spacing_fluid-base-smooth-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
-  --spacing_fluid-base-smooth-m: clamp(0.375rem, -0.25rem + 3.125vw, 2.25rem);
-  --spacing_fluid-base-smooth-l: clamp(0.5rem, -0.3333rem + 4.1667vw, 3rem);
-  --spacing_fluid-base-smooth-xl: clamp(0.75rem, -0.5rem + 6.25vw, 4.5rem);
-  --spacing_fluid-base-smooth-2xl: clamp(1rem, -0.6667rem + 8.3333vw, 6rem);
-  --spacing_fluid-base-smooth-3xl: clamp(1.5rem, -1rem + 12.5vw, 9rem);
-  --spacing_fluid-base-smooth-3xs-2xs: clamp(0.0625rem, -0.1667rem + 1.1458vw, 0.75rem);
-  --spacing_fluid-base-smooth-2xs-xs: clamp(0.125rem, -0.2083rem + 1.6667vw, 1.125rem);
-  --spacing_fluid-base-smooth-xs-s: clamp(0.1875rem, -0.25rem + 2.1875vw, 1.5rem);
-  --spacing_fluid-base-smooth-s-m: clamp(0.25rem, -0.4167rem + 3.3333vw, 2.25rem);
-  --spacing_fluid-base-smooth-m-l: clamp(0.375rem, -0.5rem + 4.375vw, 3rem);
-  --spacing_fluid-base-smooth-l-xl: clamp(0.5rem, -0.8333rem + 6.6667vw, 4.5rem);
-  --spacing_fluid-base-smooth-xl-2xl: clamp(0.75rem, -1rem + 8.75vw, 6rem);
-  --spacing_fluid-base-smooth-2xl-3xl: clamp(1rem, -1.6667rem + 13.3333vw, 9rem);
-  --spacing-gap-1: 0.25rem;
-  --spacing-gap-2: 0.5rem;
+/*____ Spacing ____*/
+--spacing_fluid-base-smooth-3xs: clamp(0.0625rem, -0.0417rem + 0.5208vw, 0.375rem);
+--spacing_fluid-base-smooth-2xs: clamp(0.125rem, -0.0833rem + 1.0417vw, 0.75rem);
+--spacing_fluid-base-smooth-xs: clamp(0.1875rem, -0.125rem + 1.5625vw, 1.125rem);
+--spacing_fluid-base-smooth-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
+--spacing_fluid-base-smooth-m: clamp(0.375rem, -0.25rem + 3.125vw, 2.25rem);
+--spacing_fluid-base-smooth-l: clamp(0.5rem, -0.3333rem + 4.1667vw, 3rem);
+--spacing_fluid-base-smooth-xl: clamp(0.75rem, -0.5rem + 6.25vw, 4.5rem);
+--spacing_fluid-base-smooth-2xl: clamp(1rem, -0.6667rem + 8.3333vw, 6rem);
+--spacing_fluid-base-smooth-3xl: clamp(1.5rem, -1rem + 12.5vw, 9rem);
+--spacing_fluid-base-smooth-3xs-2xs: clamp(0.0625rem, -0.1667rem + 1.1458vw, 0.75rem);
+--spacing_fluid-base-smooth-2xs-xs: clamp(0.125rem, -0.2083rem + 1.6667vw, 1.125rem);
+--spacing_fluid-base-smooth-xs-s: clamp(0.1875rem, -0.25rem + 2.1875vw, 1.5rem);
+--spacing_fluid-base-smooth-s-m: clamp(0.25rem, -0.4167rem + 3.3333vw, 2.25rem);
+--spacing_fluid-base-smooth-m-l: clamp(0.375rem, -0.5rem + 4.375vw, 3rem);
+--spacing_fluid-base-smooth-l-xl: clamp(0.5rem, -0.8333rem + 6.6667vw, 4.5rem);
+--spacing_fluid-base-smooth-xl-2xl: clamp(0.75rem, -1rem + 8.75vw, 6rem);
+--spacing_fluid-base-smooth-2xl-3xl: clamp(1rem, -1.6667rem + 13.3333vw, 9rem);
+--spacing-gap-1: 0.25rem;
+--spacing-gap-2: 0.5rem;
 }
 ```
 
@@ -735,17 +721,17 @@ This will generate the following CSS :
 ```css
 /*____ CSSForge ____*/
 :root {
-  /*____ Typography ____*/
-  --typography_fluid-arial-4xl: clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem);
-  --typography_fluid-arial-3xl: clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem);
-  --typography_fluid-arial-2xl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);
-  --typography_fluid-arial-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);
-  --typography_fluid-arial-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);
-  --typography_fluid-arial-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);
-  --typography_fluid-arial-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);
-  --typography_fluid-arial-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);
-  --typography_fluid-arial-2xs: clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem);
-  --typography-weight-arial-regular: 600;
+/*____ Typography ____*/
+--typography_fluid-arial-4xl: clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem);
+--typography_fluid-arial-3xl: clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem);
+--typography_fluid-arial-2xl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);
+--typography_fluid-arial-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);
+--typography_fluid-arial-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);
+--typography_fluid-arial-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);
+--typography_fluid-arial-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);
+--typography_fluid-arial-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);
+--typography_fluid-arial-2xs: clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem);
+--typography-weight-arial-regular: 600;
 }
 ```
 
@@ -823,12 +809,12 @@ This will generate the following CSS :
 ```css
 /*____ CSSForge ____*/
 :root {
-  /*____ Typography ____*/
-  --typography_fluid-comicsans-text-e: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);
-  --typography_fluid-comicsans-text-d: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);
-  --typography_fluid-comicsans-text-c: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);
-  --typography_fluid-comicsans-text-b: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);
-  --typography_fluid-comicsans-text-a: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);
+/*____ Typography ____*/
+--typography_fluid-comicsans-text-e: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);
+--typography_fluid-comicsans-text-d: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);
+--typography_fluid-comicsans-text-c: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);
+--typography_fluid-comicsans-text-b: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);
+--typography_fluid-comicsans-text-a: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);
 }
 ```
 
@@ -947,26 +933,26 @@ This will generate the following CSS :
 ```css
 /*____ CSSForge ____*/
 :root {
-  /*____ Spacing ____*/
-  --spacing-size-2: 0.5rem;
-  --spacing-size-3: 0.75rem;
-  /*____ Typography ____*/
-  --typography_fluid-arial-4xl: clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem);
-  --typography_fluid-arial-3xl: clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem);
-  --typography_fluid-arial-2xl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);
-  --typography_fluid-arial-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);
-  --typography_fluid-arial-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);
-  --typography_fluid-arial-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);
-  --typography_fluid-arial-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);
-  --typography_fluid-arial-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);
-  --typography_fluid-arial-2xs: clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem);
-  /*____ Primitives ____*/
-  /* button */
-  --button-small-width: 7.5rem;
-  --button-small-height: 2.5rem;
-  --button-small-fontSize: var(--typography_fluid-arial-m);
-  --button-small-radius: 0.5rem;
-  --button-small-padding: var(--spacing-size-2) var(--spacing-size-3);
+/*____ Spacing ____*/
+--spacing-size-2: 0.5rem;
+--spacing-size-3: 0.75rem;
+/*____ Typography ____*/
+--typography_fluid-arial-4xl: clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem);
+--typography_fluid-arial-3xl: clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem);
+--typography_fluid-arial-2xl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);
+--typography_fluid-arial-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);
+--typography_fluid-arial-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);
+--typography_fluid-arial-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);
+--typography_fluid-arial-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);
+--typography_fluid-arial-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);
+--typography_fluid-arial-2xs: clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem);
+/*____ Primitives ____*/
+/* button */
+--button-small-width: 7.5rem;
+--button-small-height: 2.5rem;
+--button-small-fontSize: var(--typography_fluid-arial-m);
+--button-small-radius: 0.5rem;
+--button-small-padding: var(--spacing-size-2) var(--spacing-size-3);
 }
 ```
 
@@ -1036,13 +1022,13 @@ Assuming you have added the script to your `package.json`, you can run CSS Forge
 
 ```bash
 # Basic usage
-npm run cssforge
+pnpm run cssforge
 
 # Watch mode
-npm run cssforge -- --watch
+pnpm run cssforge -- --watch
 
 # Custom paths and output 
-npm run cssforge --config ./foo/bar/custom-path.ts --css ./dist/design-tokens.css --ts ./dist/design-tokens.ts --json ./dist/design-tokens.json --mode all
+pnpm run cssforge -- --config ./foo/bar/custom-path.ts --css ./dist/design-tokens.css --ts ./dist/design-tokens.ts --json ./dist/design-tokens.json --mode all
 ```
 
 ## Programmatic Usage
@@ -1075,8 +1061,18 @@ For most agents, this syntax works
 
 Check out our examples:
 
-- [Basic Setup](./example/basic)
-- [ ] Tailwind
+- Basic
+  - [Basic Setup](./example/basic)
+- Tailwind Integrations
+  - [Next.js](./example/tailwind-nextjs)
+  - [Nuxt](./example/tailwind-nuxt)
+  - [SolidStart](./example/tailwind-solidstart)
+  - [SvelteKit](./example/tailwind-sveltekit)
+- Vanilla CSS Integrations
+  - [React (Vite)](./example/vanilla-react-css)
+  - [Vue (Vite)](./example/vanilla-vue-css)
+  - [Svelte (Vite)](./example/vanilla-svelte-css)
+  - [Solid (Vite)](./example/vanilla-solid-css)
 
 ## TODO
 
diff --git a/biome.json b/biome.json
new file mode 100644
index 0000000..a6c4bc2
--- /dev/null
+++ b/biome.json
@@ -0,0 +1,11 @@
+{
+  "$schema": "https://biomejs.dev/schemas/2.4.2/schema.json",
+  "formatter": {
+    "lineWidth": 90
+  },
+  "linter": {
+    "rules": {
+      "recommended": true
+    }
+  }
+}
diff --git a/deno.json b/deno.json
deleted file mode 100644
index 69e9e28..0000000
--- a/deno.json
+++ /dev/null
@@ -1,35 +0,0 @@
-{
-  "name": "@hebilicious/cssforge",
-  "version": "0.4.1",
-  "license": "MIT",
-  "exports": {
-    ".": "./src/mod.ts",
-    "./cli": "./src/cli.ts"
-  },
-  "fmt": {
-    "lineWidth": 90
-  },
-  "nodeModulesDir": "none",
-  "imports": {
-    "citty": "npm:citty@0.1.6",
-    "chokidar": "npm:chokidar@4.0.3",
-    "@std/collections": "jsr:@std/collections@^1.1.3",
-    "@std/assert": "jsr:@std/assert@^1.0.14",
-    "@std/testing": "jsr:@std/testing@^1.0.14",
-    "colorjs.io": "npm:colorjs.io@0.5.2",
-    "utopia-core": "npm:utopia-core@1.6.0",
-    "mdbox": "npm:mdbox@0.1.1"
-  },
-  "publish": {
-    "include": [
-      "src/**/*.ts",
-      "README.md"
-    ]
-  },
-  "tasks": {
-    "cli": "deno run -A ./src/cli.ts",
-    "example:cli": "deno run -A ./src/cli.ts --prefix ./example/basic --mode css",
-    "readme:update": "deno run -A ./scripts/update-readme.ts",
-    "update:snapshot": "deno test -A -- --update"
-  }
-}
diff --git a/deno.lock b/deno.lock
deleted file mode 100644
index b741530..0000000
--- a/deno.lock
+++ /dev/null
@@ -1,713 +0,0 @@
-{
-  "version": "5",
-  "specifiers": {
-    "jsr:@std/assert@*": "1.0.9",
-    "jsr:@std/assert@^1.0.14": "1.0.15",
-    "jsr:@std/assert@^1.0.15": "1.0.15",
-    "jsr:@std/async@^1.0.15": "1.0.15",
-    "jsr:@std/collections@^1.1.3": "1.1.3",
-    "jsr:@std/data-structures@^1.0.9": "1.0.9",
-    "jsr:@std/fs@1": "1.0.19",
-    "jsr:@std/fs@^1.0.19": "1.0.19",
-    "jsr:@std/internal@^1.0.10": "1.0.12",
-    "jsr:@std/internal@^1.0.12": "1.0.12",
-    "jsr:@std/internal@^1.0.5": "1.0.5",
-    "jsr:@std/internal@^1.0.9": "1.0.10",
-    "jsr:@std/path@1": "1.1.2",
-    "jsr:@std/path@^1.1.1": "1.1.2",
-    "jsr:@std/path@^1.1.2": "1.1.2",
-    "jsr:@std/testing@^1.0.14": "1.0.16",
-    "npm:@changesets/cli@*": "2.29.6",
-    "npm:@types/node@*": "24.2.0",
-    "npm:chokidar@4.0.3": "4.0.3",
-    "npm:citty@0.1.6": "0.1.6",
-    "npm:colorjs.io@0.5.2": "0.5.2",
-    "npm:mdbox@0.1.1": "0.1.1",
-    "npm:utopia-core@1.6.0": "1.6.0"
-  },
-  "jsr": {
-    "@std/assert@1.0.9": {
-      "integrity": "a9f0c611a869cc791b26f523eec54c7e187aab7932c2c8e8bea0622d13680dcd",
-      "dependencies": [
-        "jsr:@std/internal@^1.0.5"
-      ]
-    },
-    "@std/assert@1.0.14": {
-      "integrity": "68d0d4a43b365abc927f45a9b85c639ea18a9fab96ad92281e493e4ed84abaa4",
-      "dependencies": [
-        "jsr:@std/internal@^1.0.10"
-      ]
-    },
-    "@std/assert@1.0.15": {
-      "integrity": "d64018e951dbdfab9777335ecdb000c0b4e3df036984083be219ce5941e4703b",
-      "dependencies": [
-        "jsr:@std/internal@^1.0.12"
-      ]
-    },
-    "@std/async@1.0.15": {
-      "integrity": "55d1d9d04f99403fe5730ab16bdcc3c47f658a6bf054cafb38a50f046238116e"
-    },
-    "@std/collections@1.1.3": {
-      "integrity": "bf8b0818886df6a32b64c7d3b037a425111f28278d69fd0995aeb62777c986b0"
-    },
-    "@std/data-structures@1.0.9": {
-      "integrity": "033d6e17e64bf1f84a614e647c1b015fa2576ae3312305821e1a4cb20674bb4d"
-    },
-    "@std/fs@1.0.19": {
-      "integrity": "051968c2b1eae4d2ea9f79a08a3845740ef6af10356aff43d3e2ef11ed09fb06",
-      "dependencies": [
-        "jsr:@std/internal@^1.0.9",
-        "jsr:@std/path@^1.1.1"
-      ]
-    },
-    "@std/internal@1.0.5": {
-      "integrity": "54a546004f769c1ac9e025abd15a76b6671ddc9687e2313b67376125650dc7ba"
-    },
-    "@std/internal@1.0.10": {
-      "integrity": "e3be62ce42cab0e177c27698e5d9800122f67b766a0bea6ca4867886cbde8cf7"
-    },
-    "@std/internal@1.0.12": {
-      "integrity": "972a634fd5bc34b242024402972cd5143eac68d8dffaca5eaa4dba30ce17b027"
-    },
-    "@std/path@1.0.8": {
-      "integrity": "548fa456bb6a04d3c1a1e7477986b6cffbce95102d0bb447c67c4ee70e0364be"
-    },
-    "@std/path@1.1.2": {
-      "integrity": "c0b13b97dfe06546d5e16bf3966b1cadf92e1cc83e56ba5476ad8b498d9e3038",
-      "dependencies": [
-        "jsr:@std/internal@^1.0.10"
-      ]
-    },
-    "@std/testing@1.0.16": {
-      "integrity": "a917ffdeb5924c9be436dc78bc32e511760e14d3a96e49c607fc5ecca86d0092",
-      "dependencies": [
-        "jsr:@std/assert@^1.0.15",
-        "jsr:@std/async",
-        "jsr:@std/data-structures",
-        "jsr:@std/fs@^1.0.19",
-        "jsr:@std/internal@^1.0.12",
-        "jsr:@std/path@^1.1.2"
-      ]
-    }
-  },
-  "npm": {
-    "@babel/runtime@7.28.4": {
-      "integrity": "sha512-Q/N6JNWvIvPnLDvjlE1OUBLPQHH6l3CltCEsHIujp45zQUSSh8K+gHnaEX45yAT1nyngnINhvWtzN+Nb9D8RAQ=="
-    },
-    "@changesets/apply-release-plan@7.0.12": {
-      "integrity": "sha512-EaET7As5CeuhTzvXTQCRZeBUcisoYPDDcXvgTE/2jmmypKp0RC7LxKj/yzqeh/1qFTZI7oDGFcL1PHRuQuketQ==",
-      "dependencies": [
-        "@changesets/config",
-        "@changesets/get-version-range-type",
-        "@changesets/git",
-        "@changesets/should-skip-package",
-        "@changesets/types@6.1.0",
-        "@manypkg/get-packages",
-        "detect-indent",
-        "fs-extra@7.0.1",
-        "lodash.startcase",
-        "outdent",
-        "prettier",
-        "resolve-from",
-        "semver"
-      ]
-    },
-    "@changesets/assemble-release-plan@6.0.9": {
-      "integrity": "sha512-tPgeeqCHIwNo8sypKlS3gOPmsS3wP0zHt67JDuL20P4QcXiw/O4Hl7oXiuLnP9yg+rXLQ2sScdV1Kkzde61iSQ==",
-      "dependencies": [
-        "@changesets/errors",
-        "@changesets/get-dependents-graph",
-        "@changesets/should-skip-package",
-        "@changesets/types@6.1.0",
-        "@manypkg/get-packages",
-        "semver"
-      ]
-    },
-    "@changesets/changelog-git@0.2.1": {
-      "integrity": "sha512-x/xEleCFLH28c3bQeQIyeZf8lFXyDFVn1SgcBiR2Tw/r4IAWlk1fzxCEZ6NxQAjF2Nwtczoen3OA2qR+UawQ8Q==",
-      "dependencies": [
-        "@changesets/types@6.1.0"
-      ]
-    },
-    "@changesets/cli@2.29.6": {
-      "integrity": "sha512-6qCcVsIG1KQLhpQ5zE8N0PckIx4+9QlHK3z6/lwKnw7Tir71Bjw8BeOZaxA/4Jt00pcgCnCSWZnyuZf5Il05QQ==",
-      "dependencies": [
-        "@changesets/apply-release-plan",
-        "@changesets/assemble-release-plan",
-        "@changesets/changelog-git",
-        "@changesets/config",
-        "@changesets/errors",
-        "@changesets/get-dependents-graph",
-        "@changesets/get-release-plan",
-        "@changesets/git",
-        "@changesets/logger",
-        "@changesets/pre",
-        "@changesets/read",
-        "@changesets/should-skip-package",
-        "@changesets/types@6.1.0",
-        "@changesets/write",
-        "@inquirer/external-editor",
-        "@manypkg/get-packages",
-        "ansi-colors",
-        "ci-info",
-        "enquirer",
-        "fs-extra@7.0.1",
-        "mri",
-        "p-limit",
-        "package-manager-detector",
-        "picocolors",
-        "resolve-from",
-        "semver",
-        "spawndamnit",
-        "term-size"
-      ],
-      "bin": true
-    },
-    "@changesets/config@3.1.1": {
-      "integrity": "sha512-bd+3Ap2TKXxljCggI0mKPfzCQKeV/TU4yO2h2C6vAihIo8tzseAn2e7klSuiyYYXvgu53zMN1OeYMIQkaQoWnA==",
-      "dependencies": [
-        "@changesets/errors",
-        "@changesets/get-dependents-graph",
-        "@changesets/logger",
-        "@changesets/types@6.1.0",
-        "@manypkg/get-packages",
-        "fs-extra@7.0.1",
-        "micromatch"
-      ]
-    },
-    "@changesets/errors@0.2.0": {
-      "integrity": "sha512-6BLOQUscTpZeGljvyQXlWOItQyU71kCdGz7Pi8H8zdw6BI0g3m43iL4xKUVPWtG+qrrL9DTjpdn8eYuCQSRpow==",
-      "dependencies": [
-        "extendable-error"
-      ]
-    },
-    "@changesets/get-dependents-graph@2.1.3": {
-      "integrity": "sha512-gphr+v0mv2I3Oxt19VdWRRUxq3sseyUpX9DaHpTUmLj92Y10AGy+XOtV+kbM6L/fDcpx7/ISDFK6T8A/P3lOdQ==",
-      "dependencies": [
-        "@changesets/types@6.1.0",
-        "@manypkg/get-packages",
-        "picocolors",
-        "semver"
-      ]
-    },
-    "@changesets/get-release-plan@4.0.13": {
-      "integrity": "sha512-DWG1pus72FcNeXkM12tx+xtExyH/c9I1z+2aXlObH3i9YA7+WZEVaiHzHl03thpvAgWTRaH64MpfHxozfF7Dvg==",
-      "dependencies": [
-        "@changesets/assemble-release-plan",
-        "@changesets/config",
-        "@changesets/pre",
-        "@changesets/read",
-        "@changesets/types@6.1.0",
-        "@manypkg/get-packages"
-      ]
-    },
-    "@changesets/get-version-range-type@0.4.0": {
-      "integrity": "sha512-hwawtob9DryoGTpixy1D3ZXbGgJu1Rhr+ySH2PvTLHvkZuQ7sRT4oQwMh0hbqZH1weAooedEjRsbrWcGLCeyVQ=="
-    },
-    "@changesets/git@3.0.4": {
-      "integrity": "sha512-BXANzRFkX+XcC1q/d27NKvlJ1yf7PSAgi8JG6dt8EfbHFHi4neau7mufcSca5zRhwOL8j9s6EqsxmT+s+/E6Sw==",
-      "dependencies": [
-        "@changesets/errors",
-        "@manypkg/get-packages",
-        "is-subdir",
-        "micromatch",
-        "spawndamnit"
-      ]
-    },
-    "@changesets/logger@0.1.1": {
-      "integrity": "sha512-OQtR36ZlnuTxKqoW4Sv6x5YIhOmClRd5pWsjZsddYxpWs517R0HkyiefQPIytCVh4ZcC5x9XaG8KTdd5iRQUfg==",
-      "dependencies": [
-        "picocolors"
-      ]
-    },
-    "@changesets/parse@0.4.1": {
-      "integrity": "sha512-iwksMs5Bf/wUItfcg+OXrEpravm5rEd9Bf4oyIPL4kVTmJQ7PNDSd6MDYkpSJR1pn7tz/k8Zf2DhTCqX08Ou+Q==",
-      "dependencies": [
-        "@changesets/types@6.1.0",
-        "js-yaml"
-      ]
-    },
-    "@changesets/pre@2.0.2": {
-      "integrity": "sha512-HaL/gEyFVvkf9KFg6484wR9s0qjAXlZ8qWPDkTyKF6+zqjBe/I2mygg3MbpZ++hdi0ToqNUF8cjj7fBy0dg8Ug==",
-      "dependencies": [
-        "@changesets/errors",
-        "@changesets/types@6.1.0",
-        "@manypkg/get-packages",
-        "fs-extra@7.0.1"
-      ]
-    },
-    "@changesets/read@0.6.5": {
-      "integrity": "sha512-UPzNGhsSjHD3Veb0xO/MwvasGe8eMyNrR/sT9gR8Q3DhOQZirgKhhXv/8hVsI0QpPjR004Z9iFxoJU6in3uGMg==",
-      "dependencies": [
-        "@changesets/git",
-        "@changesets/logger",
-        "@changesets/parse",
-        "@changesets/types@6.1.0",
-        "fs-extra@7.0.1",
-        "p-filter",
-        "picocolors"
-      ]
-    },
-    "@changesets/should-skip-package@0.1.2": {
-      "integrity": "sha512-qAK/WrqWLNCP22UDdBTMPH5f41elVDlsNyat180A33dWxuUDyNpg6fPi/FyTZwRriVjg0L8gnjJn2F9XAoF0qw==",
-      "dependencies": [
-        "@changesets/types@6.1.0",
-        "@manypkg/get-packages"
-      ]
-    },
-    "@changesets/types@4.1.0": {
-      "integrity": "sha512-LDQvVDv5Kb50ny2s25Fhm3d9QSZimsoUGBsUioj6MC3qbMUCuC8GPIvk/M6IvXx3lYhAs0lwWUQLb+VIEUCECw=="
-    },
-    "@changesets/types@6.1.0": {
-      "integrity": "sha512-rKQcJ+o1nKNgeoYRHKOS07tAMNd3YSN0uHaJOZYjBAgxfV7TUE7JE+z4BzZdQwb5hKaYbayKN5KrYV7ODb2rAA=="
-    },
-    "@changesets/write@0.4.0": {
-      "integrity": "sha512-CdTLvIOPiCNuH71pyDu3rA+Q0n65cmAbXnwWH84rKGiFumFzkmHNT8KHTMEchcxN+Kl8I54xGUhJ7l3E7X396Q==",
-      "dependencies": [
-        "@changesets/types@6.1.0",
-        "fs-extra@7.0.1",
-        "human-id",
-        "prettier"
-      ]
-    },
-    "@inquirer/external-editor@1.0.1": {
-      "integrity": "sha512-Oau4yL24d2B5IL4ma4UpbQigkVhzPDXLoqy1ggK4gnHg/stmkffJE4oOXHXF3uz0UEpywG68KcyXsyYpA1Re/Q==",
-      "dependencies": [
-        "chardet",
-        "iconv-lite"
-      ]
-    },
-    "@manypkg/find-root@1.1.0": {
-      "integrity": "sha512-mki5uBvhHzO8kYYix/WRy2WX8S3B5wdVSc9D6KcU5lQNglP2yt58/VfLuAK49glRXChosY8ap2oJ1qgma3GUVA==",
-      "dependencies": [
-        "@babel/runtime",
-        "@types/node@12.20.55",
-        "find-up",
-        "fs-extra@8.1.0"
-      ]
-    },
-    "@manypkg/get-packages@1.1.3": {
-      "integrity": "sha512-fo+QhuU3qE/2TQMQmbVMqaQ6EWbMhi4ABWP+O4AM1NqPBuy0OrApV5LO6BrrgnhtAHS2NH6RrVk9OL181tTi8A==",
-      "dependencies": [
-        "@babel/runtime",
-        "@changesets/types@4.1.0",
-        "@manypkg/find-root",
-        "fs-extra@8.1.0",
-        "globby",
-        "read-yaml-file"
-      ]
-    },
-    "@nodelib/fs.scandir@2.1.5": {
-      "integrity": "sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g==",
-      "dependencies": [
-        "@nodelib/fs.stat",
-        "run-parallel"
-      ]
-    },
-    "@nodelib/fs.stat@2.0.5": {
-      "integrity": "sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A=="
-    },
-    "@nodelib/fs.walk@1.2.8": {
-      "integrity": "sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg==",
-      "dependencies": [
-        "@nodelib/fs.scandir",
-        "fastq"
-      ]
-    },
-    "@types/node@12.20.55": {
-      "integrity": "sha512-J8xLz7q2OFulZ2cyGTLE1TbbZcjpno7FaN6zdJNrgAdrJ+DZzh/uFR6YrTb4C+nXakvud8Q4+rbhoIWlYQbUFQ=="
-    },
-    "@types/node@24.2.0": {
-      "integrity": "sha512-3xyG3pMCq3oYCNg7/ZP+E1ooTaGB4cG8JWRsqqOYQdbWNY4zbaV0Ennrd7stjiJEFZCaybcIgpTjJWHRfBSIDw==",
-      "dependencies": [
-        "undici-types"
-      ]
-    },
-    "ansi-colors@4.1.3": {
-      "integrity": "sha512-/6w/C21Pm1A7aZitlI5Ni/2J6FFQN8i1Cvz3kHABAAbw93v/NlvKdVOqz7CCWz/3iv/JplRSEEZ83XION15ovw=="
-    },
-    "ansi-regex@5.0.1": {
-      "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ=="
-    },
-    "argparse@1.0.10": {
-      "integrity": "sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==",
-      "dependencies": [
-        "sprintf-js"
-      ]
-    },
-    "array-union@2.1.0": {
-      "integrity": "sha512-HGyxoOTYUyCM6stUe6EJgnd4EoewAI7zMdfqO+kGjnlZmBDz/cR5pf8r/cR4Wq60sL/p0IkcjUEEPwS3GFrIyw=="
-    },
-    "better-path-resolve@1.0.0": {
-      "integrity": "sha512-pbnl5XzGBdrFU/wT4jqmJVPn2B6UHPBOhzMQkY/SPUPB6QtUXtmBHBIwCbXJol93mOpGMnQyP/+BB19q04xj7g==",
-      "dependencies": [
-        "is-windows"
-      ]
-    },
-    "braces@3.0.3": {
-      "integrity": "sha512-yQbXgO/OSZVD2IsiLlro+7Hf6Q18EJrKSEsdoMzKePKXct3gvD8oLcOQdIzGupr5Fj+EDe8gO/lxc1BzfMpxvA==",
-      "dependencies": [
-        "fill-range"
-      ]
-    },
-    "chardet@2.1.0": {
-      "integrity": "sha512-bNFETTG/pM5ryzQ9Ad0lJOTa6HWD/YsScAR3EnCPZRPlQh77JocYktSHOUHelyhm8IARL+o4c4F1bP5KVOjiRA=="
-    },
-    "chokidar@4.0.3": {
-      "integrity": "sha512-Qgzu8kfBvo+cA4962jnP1KkS6Dop5NS6g7R5LFYJr4b8Ub94PPQXUksCw9PvXoeXPRRddRNC5C1JQUR2SMGtnA==",
-      "dependencies": [
-        "readdirp"
-      ]
-    },
-    "ci-info@3.9.0": {
-      "integrity": "sha512-NIxF55hv4nSqQswkAeiOi1r83xy8JldOFDTWiug55KBu9Jnblncd2U6ViHmYgHf01TPZS77NJBhBMKdWj9HQMQ=="
-    },
-    "citty@0.1.6": {
-      "integrity": "sha512-tskPPKEs8D2KPafUypv2gxwJP8h/OaJmC82QQGGDQcHvXX43xF2VDACcJVmZ0EuSxkpO9Kc4MlrA3q0+FG58AQ==",
-      "dependencies": [
-        "consola"
-      ]
-    },
-    "colorjs.io@0.5.2": {
-      "integrity": "sha512-twmVoizEW7ylZSN32OgKdXRmo1qg+wT5/6C3xu5b9QsWzSFAhHLn2xd8ro0diCsKfCj1RdaTP/nrcW+vAoQPIw=="
-    },
-    "consola@3.4.2": {
-      "integrity": "sha512-5IKcdX0nnYavi6G7TtOhwkYzyjfJlatbjMjuLSfE2kYT5pMDOilZ4OvMhi637CcDICTmz3wARPoyhqyX1Y+XvA=="
-    },
-    "cross-spawn@7.0.6": {
-      "integrity": "sha512-uV2QOWP2nWzsy2aMp8aRibhi9dlzF5Hgh5SHaB9OiTGEyDTiJJyx0uy51QXdyWbtAHNua4XJzUKca3OzKUd3vA==",
-      "dependencies": [
-        "path-key",
-        "shebang-command",
-        "which"
-      ]
-    },
-    "detect-indent@6.1.0": {
-      "integrity": "sha512-reYkTUJAZb9gUuZ2RvVCNhVHdg62RHnJ7WJl8ftMi4diZ6NWlciOzQN88pUhSELEwflJht4oQDv0F0BMlwaYtA=="
-    },
-    "dir-glob@3.0.1": {
-      "integrity": "sha512-WkrWp9GR4KXfKGYzOLmTuGVi1UWFfws377n9cc55/tb6DuqyF6pcQ5AbiHEshaDpY9v6oaSr2XCDidGmMwdzIA==",
-      "dependencies": [
-        "path-type"
-      ]
-    },
-    "enquirer@2.4.1": {
-      "integrity": "sha512-rRqJg/6gd538VHvR3PSrdRBb/1Vy2YfzHqzvbhGIQpDRKIa4FgV/54b5Q1xYSxOOwKvjXweS26E0Q+nAMwp2pQ==",
-      "dependencies": [
-        "ansi-colors",
-        "strip-ansi"
-      ]
-    },
-    "esprima@4.0.1": {
-      "integrity": "sha512-eGuFFw7Upda+g4p+QHvnW0RyTX/SVeJBDM/gCtMARO0cLuT2HcEKnTPvhjV6aGeqrCB/sbNop0Kszm0jsaWU4A==",
-      "bin": true
-    },
-    "extendable-error@0.1.7": {
-      "integrity": "sha512-UOiS2in6/Q0FK0R0q6UY9vYpQ21mr/Qn1KOnte7vsACuNJf514WvCCUHSRCPcgjPT2bAhNIJdlE6bVap1GKmeg=="
-    },
-    "fast-glob@3.3.3": {
-      "integrity": "sha512-7MptL8U0cqcFdzIzwOTHoilX9x5BrNqye7Z/LuC7kCMRio1EMSyqRK3BEAUD7sXRq4iT4AzTVuZdhgQ2TCvYLg==",
-      "dependencies": [
-        "@nodelib/fs.stat",
-        "@nodelib/fs.walk",
-        "glob-parent",
-        "merge2",
-        "micromatch"
-      ]
-    },
-    "fastq@1.18.0": {
-      "integrity": "sha512-QKHXPW0hD8g4UET03SdOdunzSouc9N4AuHdsX8XNcTsuz+yYFILVNIX4l9yHABMhiEI9Db0JTTIpu0wB+Y1QQw==",
-      "dependencies": [
-        "reusify"
-      ]
-    },
-    "fill-range@7.1.1": {
-      "integrity": "sha512-YsGpe3WHLK8ZYi4tWDg2Jy3ebRz2rXowDxnld4bkQB00cc/1Zw9AWnC0i9ztDJitivtQvaI9KaLyKrc+hBW0yg==",
-      "dependencies": [
-        "to-regex-range"
-      ]
-    },
-    "find-up@4.1.0": {
-      "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==",
-      "dependencies": [
-        "locate-path",
-        "path-exists"
-      ]
-    },
-    "fs-extra@7.0.1": {
-      "integrity": "sha512-YJDaCJZEnBmcbw13fvdAM9AwNOJwOzrE4pqMqBq5nFiEqXUqHwlK4B+3pUw6JNvfSPtX05xFHtYy/1ni01eGCw==",
-      "dependencies": [
-        "graceful-fs",
-        "jsonfile",
-        "universalify"
-      ]
-    },
-    "fs-extra@8.1.0": {
-      "integrity": "sha512-yhlQgA6mnOJUKOsRUFsgJdQCvkKhcz8tlZG5HBQfReYZy46OwLcY+Zia0mtdHsOo9y/hP+CxMN0TU9QxoOtG4g==",
-      "dependencies": [
-        "graceful-fs",
-        "jsonfile",
-        "universalify"
-      ]
-    },
-    "glob-parent@5.1.2": {
-      "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==",
-      "dependencies": [
-        "is-glob"
-      ]
-    },
-    "globby@11.1.0": {
-      "integrity": "sha512-jhIXaOzy1sb8IyocaruWSn1TjmnBVs8Ayhcy83rmxNJ8q2uWKCAj3CnJY+KpGSXCueAPc0i05kVvVKtP1t9S3g==",
-      "dependencies": [
-        "array-union",
-        "dir-glob",
-        "fast-glob",
-        "ignore",
-        "merge2",
-        "slash"
-      ]
-    },
-    "graceful-fs@4.2.11": {
-      "integrity": "sha512-RbJ5/jmFcNNCcDV5o9eTnBLJ/HszWV0P73bc+Ff4nS/rJj+YaS6IGyiOL0VoBYX+l1Wrl3k63h/KrH+nhJ0XvQ=="
-    },
-    "human-id@4.1.1": {
-      "integrity": "sha512-3gKm/gCSUipeLsRYZbbdA1BD83lBoWUkZ7G9VFrhWPAU76KwYo5KR8V28bpoPm/ygy0x5/GCbpRQdY7VLYCoIg==",
-      "bin": true
-    },
-    "iconv-lite@0.6.3": {
-      "integrity": "sha512-4fCk79wshMdzMp2rH06qWrJE4iolqLhCUH+OiuIgU++RB0+94NlDL81atO7GX55uUKueo0txHNtvEyI6D7WdMw==",
-      "dependencies": [
-        "safer-buffer"
-      ]
-    },
-    "ignore@5.3.2": {
-      "integrity": "sha512-hsBTNUqQTDwkWtcdYI2i06Y/nUBEsNEDJKjWdigLvegy8kDuJAS8uRlpkkcQpyEXL0Z/pjDy5HBmMjRCJ2gq+g=="
-    },
-    "is-extglob@2.1.1": {
-      "integrity": "sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ=="
-    },
-    "is-glob@4.0.3": {
-      "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==",
-      "dependencies": [
-        "is-extglob"
-      ]
-    },
-    "is-number@7.0.0": {
-      "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng=="
-    },
-    "is-subdir@1.2.0": {
-      "integrity": "sha512-2AT6j+gXe/1ueqbW6fLZJiIw3F8iXGJtt0yDrZaBhAZEG1raiTxKWU+IPqMCzQAXOUCKdA4UDMgacKH25XG2Cw==",
-      "dependencies": [
-        "better-path-resolve"
-      ]
-    },
-    "is-windows@1.0.2": {
-      "integrity": "sha512-eXK1UInq2bPmjyX6e3VHIzMLobc4J94i4AWn+Hpq3OU5KkrRC96OAcR3PRJ/pGu6m8TRnBHP9dkXQVsT/COVIA=="
-    },
-    "isexe@2.0.0": {
-      "integrity": "sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw=="
-    },
-    "js-yaml@3.14.1": {
-      "integrity": "sha512-okMH7OXXJ7YrN9Ok3/SXrnu4iX9yOk+25nqX4imS2npuvTYDmo/QEZoqwZkYaIDk3jVvBOTOIEgEhaLOynBS9g==",
-      "dependencies": [
-        "argparse",
-        "esprima"
-      ],
-      "bin": true
-    },
-    "jsonfile@4.0.0": {
-      "integrity": "sha512-m6F1R3z8jjlf2imQHS2Qez5sjKWQzbuuhuJ/FKYFRZvPE3PuHcSMVZzfsLhGVOkfd20obL5SWEBew5ShlquNxg==",
-      "optionalDependencies": [
-        "graceful-fs"
-      ]
-    },
-    "locate-path@5.0.0": {
-      "integrity": "sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g==",
-      "dependencies": [
-        "p-locate"
-      ]
-    },
-    "lodash.startcase@4.4.0": {
-      "integrity": "sha512-+WKqsK294HMSc2jEbNgpHpd0JfIBhp7rEV4aqXWqFr6AlXov+SlcgB1Fv01y2kGe3Gc8nMW7VA0SrGuSkRfIEg=="
-    },
-    "md4w@0.2.7": {
-      "integrity": "sha512-lFM7vwk3d4MzkV2mija7aPkK6OjKXZDQsH2beX+e2cvccBoqc6RraheMtAO0Wcr/gjj5L+WS5zhb+06AmuGZrg=="
-    },
-    "mdbox@0.1.1": {
-      "integrity": "sha512-jvLISenzbLRPWWamTG3THlhTcMbKWzJQNyTi61AVXhCBOC+gsldNTUfUNH8d3Vay83zGehFw3wZpF3xChzkTIQ==",
-      "dependencies": [
-        "md4w"
-      ]
-    },
-    "merge2@1.4.1": {
-      "integrity": "sha512-8q7VEgMJW4J8tcfVPy8g09NcQwZdbwFEqhe/WZkoIzjn/3TGDwtOCYtXGxA3O8tPzpczCCDgv+P2P5y00ZJOOg=="
-    },
-    "micromatch@4.0.8": {
-      "integrity": "sha512-PXwfBhYu0hBCPw8Dn0E+WDYb7af3dSLVWKi3HGv84IdF4TyFoC0ysxFd0Goxw7nSv4T/PzEJQxsYsEiFCKo2BA==",
-      "dependencies": [
-        "braces",
-        "picomatch"
-      ]
-    },
-    "mri@1.2.0": {
-      "integrity": "sha512-tzzskb3bG8LvYGFF/mDTpq3jpI6Q9wc3LEmBaghu+DdCssd1FakN7Bc0hVNmEyGq1bq3RgfkCb3cmQLpNPOroA=="
-    },
-    "outdent@0.5.0": {
-      "integrity": "sha512-/jHxFIzoMXdqPzTaCpFzAAWhpkSjZPF4Vsn6jAfNpmbH/ymsmd7Qc6VE9BGn0L6YMj6uwpQLxCECpus4ukKS9Q=="
-    },
-    "p-filter@2.1.0": {
-      "integrity": "sha512-ZBxxZ5sL2HghephhpGAQdoskxplTwr7ICaehZwLIlfL6acuVgZPm8yBNuRAFBGEqtD/hmUeq9eqLg2ys9Xr/yw==",
-      "dependencies": [
-        "p-map"
-      ]
-    },
-    "p-limit@2.3.0": {
-      "integrity": "sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w==",
-      "dependencies": [
-        "p-try"
-      ]
-    },
-    "p-locate@4.1.0": {
-      "integrity": "sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A==",
-      "dependencies": [
-        "p-limit"
-      ]
-    },
-    "p-map@2.1.0": {
-      "integrity": "sha512-y3b8Kpd8OAN444hxfBbFfj1FY/RjtTd8tzYwhUqNYXx0fXx2iX4maP4Qr6qhIKbQXI02wTLAda4fYUbDagTUFw=="
-    },
-    "p-try@2.2.0": {
-      "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ=="
-    },
-    "package-manager-detector@0.2.8": {
-      "integrity": "sha512-ts9KSdroZisdvKMWVAVCXiKqnqNfXz4+IbrBG8/BWx/TR5le+jfenvoBuIZ6UWM9nz47W7AbD9qYfAwfWMIwzA=="
-    },
-    "path-exists@4.0.0": {
-      "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w=="
-    },
-    "path-key@3.1.1": {
-      "integrity": "sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q=="
-    },
-    "path-type@4.0.0": {
-      "integrity": "sha512-gDKb8aZMDeD/tZWs9P6+q0J9Mwkdl6xMV8TjnGP3qJVJ06bdMgkbBlLU8IdfOsIsFz2BW1rNVT3XuNEl8zPAvw=="
-    },
-    "picocolors@1.1.1": {
-      "integrity": "sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA=="
-    },
-    "picomatch@2.3.1": {
-      "integrity": "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA=="
-    },
-    "pify@4.0.1": {
-      "integrity": "sha512-uB80kBFb/tfd68bVleG9T5GGsGPjJrLAUpR5PZIrhBnIaRTQRjqdJSsIKkOP6OAIFbj7GOrcudc5pNjZ+geV2g=="
-    },
-    "prettier@2.8.8": {
-      "integrity": "sha512-tdN8qQGvNjw4CHbY+XXk0JgCXn9QiF21a55rBe5LJAU+kDyC4WQn4+awm2Xfk2lQMk5fKup9XgzTZtGkjBdP9Q==",
-      "bin": true
-    },
-    "queue-microtask@1.2.3": {
-      "integrity": "sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A=="
-    },
-    "read-yaml-file@1.1.0": {
-      "integrity": "sha512-VIMnQi/Z4HT2Fxuwg5KrY174U1VdUIASQVWXXyqtNRtxSr9IYkn1rsI6Tb6HsrHCmB7gVpNwX6JxPTHcH6IoTA==",
-      "dependencies": [
-        "graceful-fs",
-        "js-yaml",
-        "pify",
-        "strip-bom"
-      ]
-    },
-    "readdirp@4.1.2": {
-      "integrity": "sha512-GDhwkLfywWL2s6vEjyhri+eXmfH6j1L7JE27WhqLeYzoh/A3DBaYGEj2H/HFZCn/kMfim73FXxEJTw06WtxQwg=="
-    },
-    "resolve-from@5.0.0": {
-      "integrity": "sha512-qYg9KP24dD5qka9J47d0aVky0N+b4fTU89LN9iDnjB5waksiC49rvMB0PrUJQGoTmH50XPiqOvAjDfaijGxYZw=="
-    },
-    "reusify@1.0.4": {
-      "integrity": "sha512-U9nH88a3fc/ekCF1l0/UP1IosiuIjyTh7hBvXVMHYgVcfGvt897Xguj2UOLDeI5BG2m7/uwyaLVT6fbtCwTyzw=="
-    },
-    "run-parallel@1.2.0": {
-      "integrity": "sha512-5l4VyZR86LZ/lDxZTR6jqL8AFE2S0IFLMP26AbjsLVADxHdhB/c0GUsH+y39UfCi3dzz8OlQuPmnaJOMoDHQBA==",
-      "dependencies": [
-        "queue-microtask"
-      ]
-    },
-    "safer-buffer@2.1.2": {
-      "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg=="
-    },
-    "semver@7.7.1": {
-      "integrity": "sha512-hlq8tAfn0m/61p4BVRcPzIGr6LKiMwo4VM6dGi6pt4qcRkmNzTcWq6eCEjEh+qXjkMDvPlOFFSGwQjoEa6gyMA==",
-      "bin": true
-    },
-    "shebang-command@2.0.0": {
-      "integrity": "sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==",
-      "dependencies": [
-        "shebang-regex"
-      ]
-    },
-    "shebang-regex@3.0.0": {
-      "integrity": "sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A=="
-    },
-    "signal-exit@4.1.0": {
-      "integrity": "sha512-bzyZ1e88w9O1iNJbKnOlvYTrWPDl46O1bG0D3XInv+9tkPrxrN8jUUTiFlDkkmKWgn1M6CfIA13SuGqOa9Korw=="
-    },
-    "slash@3.0.0": {
-      "integrity": "sha512-g9Q1haeby36OSStwb4ntCGGGaKsaVSjQ68fBxoQcutl5fS1vuY18H3wSt3jFyFtrkx+Kz0V1G85A4MyAdDMi2Q=="
-    },
-    "spawndamnit@3.0.1": {
-      "integrity": "sha512-MmnduQUuHCoFckZoWnXsTg7JaiLBJrKFj9UI2MbRPGaJeVpsLcVBu6P/IGZovziM/YBsellCmsprgNA+w0CzVg==",
-      "dependencies": [
-        "cross-spawn",
-        "signal-exit"
-      ]
-    },
-    "sprintf-js@1.0.3": {
-      "integrity": "sha512-D9cPgkvLlV3t3IzL0D0YLvGA9Ahk4PcvVwUbN0dSGr1aP0Nrt4AEnTUbuGvquEC0mA64Gqt1fzirlRs5ibXx8g=="
-    },
-    "strip-ansi@6.0.1": {
-      "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==",
-      "dependencies": [
-        "ansi-regex"
-      ]
-    },
-    "strip-bom@3.0.0": {
-      "integrity": "sha512-vavAMRXOgBVNF6nyEEmL3DBK19iRpDcoIwW+swQ+CbGiu7lju6t+JklA1MHweoWtadgt4ISVUsXLyDq34ddcwA=="
-    },
-    "term-size@2.2.1": {
-      "integrity": "sha512-wK0Ri4fOGjv/XPy8SBHZChl8CM7uMc5VML7SqiQ0zG7+J5Vr+RMQDoHa2CNT6KHUnTGIXH34UDMkPzAUyapBZg=="
-    },
-    "to-regex-range@5.0.1": {
-      "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==",
-      "dependencies": [
-        "is-number"
-      ]
-    },
-    "undici-types@7.10.0": {
-      "integrity": "sha512-t5Fy/nfn+14LuOc2KNYg75vZqClpAiqscVvMygNnlsHBFpSXdJaYtXMcdNLpl/Qvc3P2cB3s6lOV51nqsFq4ag=="
-    },
-    "universalify@0.1.2": {
-      "integrity": "sha512-rBJeI5CXAlmy1pV+617WB9J63U6XcazHHF2f2dbJix4XzpUF0RS3Zbj0FGIOCAva5P/d/GBOYaACQ1w+0azUkg=="
-    },
-    "utopia-core@1.6.0": {
-      "integrity": "sha512-1t74XWRugoMxwbPufCBlBRBfp4ebwXh9dLRoEEywAroO3prOQUyGykX4G4o5kHyX5PbfB3Zly1AjP2epeq6ycA=="
-    },
-    "which@2.0.2": {
-      "integrity": "sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==",
-      "dependencies": [
-        "isexe"
-      ],
-      "bin": true
-    }
-  },
-  "workspace": {
-    "dependencies": [
-      "jsr:@std/assert@^1.0.14",
-      "jsr:@std/collections@^1.1.3",
-      "jsr:@std/testing@^1.0.14",
-      "npm:chokidar@4.0.3",
-      "npm:citty@0.1.6",
-      "npm:colorjs.io@0.5.2",
-      "npm:mdbox@0.1.1",
-      "npm:utopia-core@1.6.0"
-    ]
-  }
-}
diff --git a/docs/migration-plan-node-moon-proto.md b/docs/migration-plan-node-moon-proto.md
new file mode 100644
index 0000000..3522655
--- /dev/null
+++ b/docs/migration-plan-node-moon-proto.md
@@ -0,0 +1,102 @@
+# Migration Plan: Deno -> Node + pnpm Workspace + moon v2 + proto (JSR retained)
+
+## Summary
+
+Refactor to a Node-first monorepo with `pnpm` workspaces + `moon v2` + `proto`, keep JSR publishing for `@hebilicious/cssforge`, move the publishable package to `packages/cssforge`, and keep Deno only where required for JSR publishing.
+
+## Locked decisions
+
+- Full repo migration.
+- Keep Deno only for JSR publishing.
+- Move library to `packages/cssforge`.
+- Moon-first CI.
+- Install moon/proto skills from `hyperb1iss/moonrepo-skill` via the skills CLI and
+  commit installed files.
+- pnpm-only examples/docs.
+- Vitest for tests.
+- Biome (latest) for formatting/linting.
+- Do not run example tests on CI.
+
+## Pinned versions
+
+- Node `24.13.1`
+- pnpm `10.30.0`
+- moon `2.0.0`
+- proto `0.55.2`
+- Biome `2.4.2`
+- Vitest `4.0.18`
+
+## Repo structure
+
+- Add `pnpm-workspace.yaml` with:
+  - `packages/*`
+  - `example/*`
+- Move library from root to `packages/cssforge`.
+- Keep examples under `example/*` as workspace packages.
+- Root `package.json` becomes private orchestration package.
+
+## Skills
+
+- Install:
+  - `npx skills add https://github.com/hyperb1iss/moonrepo-skill --skill moon`
+  - `npx skills add https://github.com/hyperb1iss/moonrepo-skill --skill proto`
+- Commit:
+  - `.agents/skills/moon`
+  - `.agents/skills/proto`
+
+## Tooling
+
+- Add `.prototools` with exact pins.
+- Add moon v2 config:
+  - `.moon/workspace.yml`
+  - `.moon/toolchains.yml`
+  - `.moon/tasks/*.yml`
+  - `moon.yml` per project (package + examples)
+
+## Tasks
+
+- Standard moon targets:
+  - `:format`, `:lint`, `:typecheck`, `:test`, `:build`
+- Package targets:
+  - `cssforge:jsr-dry-run`
+  - `cssforge:jsr-publish`
+- Example e2e tasks enabled locally, disabled in CI.
+
+## Package/API expectations
+
+- Preserve exports:
+  - `@hebilicious/cssforge`
+  - `@hebilicious/cssforge/cli`
+- Keep config schema/API behavior unchanged.
+- Change developer workflow from Deno tasks to moon+pnpm.
+
+## Test migration
+
+- Convert Deno tests to Vitest.
+- Port snapshots and assertions with behavior parity.
+- Keep example Playwright tests runnable locally via moon targets.
+
+## CI/release
+
+- CI runs moon targets only (`format`, `test`, `typecheck`).
+- No example e2e in CI.
+- Release keeps changesets flow and publishes to JSR from `packages/cssforge`.
+- Deno setup allowed only in JSR publish step if required.
+
+## Docs updates
+
+- Update root README to pnpm+moon-first workflow.
+- Remove Deno usage from normal contributor paths.
+- Update example READMEs to pnpm-only.
+- Update AGENTS/skills references to repo-local skills.
+
+## Acceptance criteria
+
+1. `pnpm install` produces one root `pnpm-lock.yaml`.
+2. No `package-lock.json` in repo.
+3. `moon run cssforge:test` passes Vitest suite.
+4. CLI generate tasks work from workspace.
+5. Example e2e runs locally; not run in CI.
+6. `moon run cssforge:jsr-dry-run` passes.
+7. JSR publish remains functional.
+8. Skills installed via the CLI in `.agents/skills`.
diff --git a/example/basic/cssforge.config.ts b/example/basic/cssforge.config.ts
index 67cd2b5..3b359b0 100644
--- a/example/basic/cssforge.config.ts
+++ b/example/basic/cssforge.config.ts
@@ -1,4 +1,4 @@
-import { defineConfig } from "../../src/mod.ts";
+import { defineConfig } from "../../packages/cssforge/src/mod.ts";
 
 export default defineConfig(
   {
diff --git a/example/basic/generate-css.ts b/example/basic/generate-css.ts
index 65fd3aa..4679a01 100644
--- a/example/basic/generate-css.ts
+++ b/example/basic/generate-css.ts
@@ -1,10 +1,13 @@
 /**
- * /!\ This script uses deno and is only for demonstration purposes.
- * Note that you can use the CLI instead of this script.
+ * This script demonstrates programmatic generation.
+ * For most workflows, prefer the CLI.
  */
 
-import type { CSSForgeConfig } from "../../src/config.ts";
-import { generateCSS } from "../../src/mod.ts";
+import { writeFile } from "node:fs/promises";
+import { dirname, join } from "node:path";
+import { fileURLToPath } from "node:url";
+import type { CSSForgeConfig } from "../../packages/cssforge/src/config.ts";
+import { generateCSS } from "../../packages/cssforge/src/mod.ts";
 import config from "./cssforge.config.ts";
 
 async function writeCSS(
@@ -12,10 +15,10 @@ async function writeCSS(
   outputPath: string,
 ): Promise<void> {
   const css = generateCSS(config);
-  await Deno.writeTextFile(outputPath, css);
+  await writeFile(outputPath, css, "utf8");
 }
 
-// Get the directory of the current file
-const currentFilePathname = new URL(".", import.meta.url).pathname;
+const currentFilePathname = fileURLToPath(import.meta.url);
+const currentDir = dirname(currentFilePathname);
 
-writeCSS(config, currentFilePathname + "cssforge.css");
+writeCSS(config, join(currentDir, "cssforge.css"));
diff --git a/example/tailwind-nextjs/.gitignore b/example/tailwind-nextjs/.gitignore
new file mode 100644
index 0000000..b6f2e89
--- /dev/null
+++ b/example/tailwind-nextjs/.gitignore
@@ -0,0 +1,45 @@
+# See https://help.github.com/articles/ignoring-files/ for more about ignoring files.
+
+# dependencies
+/node_modules
+/.pnp
+.pnp.*
+.yarn/*
+!.yarn/patches
+!.yarn/plugins
+!.yarn/releases
+!.yarn/versions
+
+# testing
+/coverage
+
+# next.js
+/.next/
+/out/
+
+# production
+/build
+
+# misc
+.DS_Store
+*.pem
+
+# debug
+npm-debug.log*
+yarn-debug.log*
+yarn-error.log*
+.pnpm-debug.log*
+
+# env files (can opt-in for committing if needed)
+.env*
+
+# vercel
+.vercel
+
+# typescript
+*.tsbuildinfo
+next-env.d.ts
+.cssforge
+playwright-report
+test-results
+.playwright
diff --git a/example/tailwind-nextjs/README.md b/example/tailwind-nextjs/README.md
new file mode 100644
index 0000000..899dd5a
--- /dev/null
+++ b/example/tailwind-nextjs/README.md
@@ -0,0 +1,35 @@
+# Tailwind + Next.js
+
+Node.js example that integrates CSS Forge tokens into a Next.js app styled with Tailwind.
+
+## Scaffold Source
+
+```bash
+pnpm create next-app@latest tailwind-nextjs --ts --eslint --tailwind --app --use-pnpm --skip-install --yes --disable-git
+```
+
+## Resolved Versions
+
+- `next@16.1.6`
+- `react@19.2.4`
+- `tailwindcss@4.2.0`
+- `@playwright/test@1.58.2`
+
+## Run Locally
+
+```bash
+pnpm install
+pnpm exec playwright install chromium
+pnpm run cssforge:build-local
+pnpm run cssforge:generate
+pnpm run dev
+```
+
+## E2E Test
+
+```bash
+pnpm run test:e2e
+```
+
+The Playwright test validates CSS Forge variables on `:root` and computed styles on
+`[data-testid="token-card"]`.
diff --git a/example/tailwind-nextjs/app/favicon.ico b/example/tailwind-nextjs/app/favicon.ico
new file mode 100644
index 0000000000000000000000000000000000000000..718d6fea4835ec2d246af9800eddb7ffb276240c
GIT binary patch
literal 25931
zcmeHv30#a{`}aL_*G&7qml|y<+KVaDM2m#dVr!KsA!#An?kSQM(q<_dDNCpjEux83
zLb9Z^XxbDl(w>%i@8hT6>)&Gu{h#Oeyszu?xtw#Zb1mO<?sK2}EE5RAKnxHU7lft+
zNRAPL3?T?25I&drAjl1ssi=G|D?(7bFsgtO(2o>{pgX9699l+Qppw7jXaYf~-84xW
z)w4x8?=youko|}Vr~(D$UX<xm7|19n6Hxvd5m6xx<*9a4%RmR{en}E&p$X-wy5A}T
zU0^dwXVA>IbiXABHh`p1?nn8Po~fxRJv}|0e(BPs|G`(TT%kKVJAdg5*Z|x0leQq0
zkdUBvb#>9F()jo|T~kx@OM8$9wzs~t2l;K=woNssA3l6|sx2r3+kdfVW@e^8e*E}v
zA1y5{bRi+3Z`uD3{F7LgFJDdvm;nJilkzDku>BwXH(8ItVCXk*-lSJnR?-2UN%<G)
zWdETe=&R39RaKR)udn|#TOgZ!e!yM=<=+`Uz{l^5UtkZ2fHDQ;UwMB}v%l$A-`~F-
z{Qr^x^CSUf63Sry{6y#+`<sMA?dPFvg)$lC_RkFRKnCi7&P<a6>hJ){&rlvg`CDTj
z)Bzo!3v7Ou#83zEDEFcKt(f1E0~=rqeEbTnMvWR#{+9pg%7G8y>u1OVRUSoox-ovF
z2Ydma(;=YuBY(eI|04{hXzZD6_f(v~H;C~y5=DhAC{MMS>2fm~1H_t2$56pc$NH8(
z5bH|<)71dV-_oCHIrzrT`2s-5w_+2CM0$95I6X8p^r!gHp+j_gd;9O<1~CEQQGS8)
zS9Qh3#p&JM-G8rHekNmKVewU;pJRcTAog68KYo^dRo}(M<!8cv(gkb9@A>>36U4Us
zfgYWSiHZL3;lpWT=<n~R&zm>zNAW>Dh#mB!_@Lg%$ms8N-;aPqMn+C2HqZgz&9~Eu
z4|Kp<`$q)Uw1R?y(~S>ePdonHxpV1#eSP1B;Ogo+-Pk}6#0GsZZ5!||ev2MGdh}_m
z{DeR7?0-1^zVs&`AV6<!ZvGbtU{7FdY&`9DeD(=q|M30$GCs(E?S0J1$e@G0#Z=wz
zl)*a>Vt;r3`I`OI_wgs*w=eO%_#7Kepl{B<UyBc9U%rn&@xFZ-e{%i>@xiyCANc(l
zzIyd4y|c6PXWq9-|KM8(zIk8LPk(>a)zyFWjhT!$HJ$qX1vo@d25W<<x-(q{Yn-pG
zKTz?fwGmh&&2-F3f57**)?Xk#p#S9h^DhK{VVKE&0KR^-_MMD9nf@pDACnmVll!kp
z3?Tha?LWW70P;AL{}cP~sW|?W|MbA09{7Kt2f!i(y>fvZQ2zUz5WRc(UnFMKHwe1|
zWmlB1qdbiA(C0jmnV<}GfbKtmcu^2*P^O?<jWWPHxu*D53Uq)j1!ZtH3Vi&#Nd^rV
zj`B>MBLZKt|As~ge8&AAO~2K@zbXelK|4T<{|y4`raF{=72kC2Kn(L4YyenWgrPiv
z@^mr$t{#X5VuIMeL!7Ab6_kG$&#&5p*Z{+?5U|TZ`B!7llpVmp@skYz&n^8QfPJzL
z0G6K_OJM9x+Wu2gfN45phANGt{7=C>i34CV{Xqlx(fWpeAoj^N0Biu`w+MVcCUyU*
zDZuzO0>4Z6fbu^T_arWW5n!E45vX8N=bxTVeFoep_G#VmNlQzAI_KTIc{6>c+04vr
zx@W}zE5JNSU>!THJ{J=cqjz+4{L4A{Ob9$ZJ*S1?Ggg3klFp!+Y1@K+pK1DqI|_gq
z5ZDXVpge8-cs!o|;K73#YXZ3AShj50wBvuq3NTOZ`M&qtjj#GOFfgExjg8Gn8>Vq5
z`85n+9|!iLCZF5$HJ$Iu($dm?8~-ofu}tEc+-pyke=3!im#6pk_Wo8IA|fJwD&~~F
zc16osQ)EBo58U7XDuMexaPRjU@h8tXe%S{fA0NH3vGJFhuyyO!Uyl2^&EOpX{9As0
zWj+P>{@}jxH)8|r;2HdupP!vie{sJ28b&bo!8`D^x}TE$%zXNb^X1p@0PJ86`dZyj
z%ce7*{^oo+6%&~I!8hQy-vQ7E)0t0ybH4l%KltWOo~8cO`T=157JqL(oq_rC%ea&4
z2NcTJe-HgFjNg-gZ$6!Y`SMHrlj}Etf7<Kk?_r;;``Uc^3+u}-v3@Q8<@$Nr`<F?K
z-%F>?r!zQTPPSv}{so2e>Fjs1{<qUF=hGRSFDG$<z3x<+@%{Vd%a`e+qodRP&D<om
zAEn>gzk~LGeesX%r(Lh6rbhSo_n)@@G-FTQy93;l#E)hgP@d_SGvyCp0~o(Y;Ee8{
zdVUDbHm5`2taPUOY^MAGOw*<R_VaVlPH<<CgYr!E->>=s7=Gst=D+p+2yON!0%Hk`
zz5mAhyT4lS*T3LS^WSxUy86q&GnoHxzQ6vm8)VS}_zuqG?+3td68_x;etQAdu@sc6
zQJ&5|4(I?~3d-QOAODHpZ=hlSg(lBZ!JZWCtHHSj`0Wh93-Uk)_S%zsJ~aD>{`A0~
z9{AG(e|q3g5B%wYKRxiL2Y$8(4w<boVrLOyLG9R$m+7N>6bzchKuloQW#e&S3n+P-
z8!ds-%f;TJ1>)v)##>gd{PdS2Oc3VaR`fr=`O8QIO(6(N!A?pr5C#6fc~Ge@N%Vvu
zaoAX2&(a6eWy_q&UwOhU)|P3J0Qc%OdhzW=F4D|pt0E4osw;%<%Dn58hAWD^XnZD=
z>9~H(3bmLtxpF?a7su6J7M*x1By7YSUbxGi)Ot0P77`}P<HJ;%@cvfCkvm6xcMjdY
zed_u6xK)F%|1Hy`)`e~K(f*MqTJ?92I+4lga{A5`-U@Cab35G6unNk<*dpB|Rtkp;
z?32o^yBlJsuA-^abQ~7;%<oa^k<DbKc{lOW2!yM#nEALvv)IhY7b|Wfg(UhtiurTM
zY-B6L26$JQo&Kt3nh3JTJ)garEgw^{uEM3__%b$U5{~+aMO*k)6R#grkER2`U6KS-
z=j1=QhCkuy%iiHWrqH8CeGNw*C?epTpl2Bo@ugUPKRFeiVHOpL7PHu-SAgX@qmTGH
z_%ePz1`io8XDfwLmip;Rn;1yo+3>3{)&5Un{KD?`-e?r21!4vTTnN(4Y6Lin?UkSM
z`MXCTC1@4A4~mvz%Rh2&EwY))LeoT=*`tMoqcEXI>TZU9WTP#l?uFv+@Dn~b(>xh2
z;>B?;Tz2SR&KVb>vGiBSB`@U7VIWFSo=LDSb9F{GF^DbmWAfpms8Sx9OX4CnBJca3
zlj9(x!dIjN?OG1X4l*imJNvRCk}F%!?SOfiOq5y^mZW)jFL@<gIi}tCXee1<sGV$i
z4r_`X#mEQbiDh!Efji0GjM9z-0bF}p0(*s(OzMJ|;K&OJBar<ARLp}T>a|r-@d#f7
z2gmU8L3IZq0ynIws=}~m^#@&C%J6QFo~Mo4V`>v7MI-_!EBMMtb%_M&kvAaN)@ZVw
z+`toz&WG#HkWDjnZE!6nk{e-oFdL^$YnbOCN}JC&{$#$O27@|Tn-skXr)2ml2~O!5
zX+gYoxhoc7qoU?C^3~&!U?kRFtnSEecWuH0B0OvLodgUAi}8p1<ZO0#U-k07ifx!>
zrO6RSXHH}D<I*>Mc$&|?D004<Y&c6)m74d`LOLU@ruR+Um4>DiOVMHV8kXCP@7NKB
zgaZq^^O<7PoKEp72kby@W0Z!Y*A<g|TlOeriuPP`vK2IntATvs?Iv|J14j&;NFSFo
zyJ+sca?G+8C%!b{Sq=6cJJqS>y{&vfg#C&gG@YVR9g?FEocMUi1gSN$+V+ayF45{a
zuDZDT<?u;)RfLQwg>N}mS|;BO%gEf}pjBfN2-gIrU#G5~cucA;dokXW89%>AyXJJI
z9X4Ul<x{xc_m~`mWBP0<g-{#wm}Vv~Ef3pKWC&N_<~88zSbEk;;+{DnJ9-u&Zc74s
zJ6TCQyl_^|5cY;wmDdrU@LTL-3v0H#Ui?8ICQV{imof1MHuM$`e*ux>IWA|ZYHgbI
z5?oFk@A=Ik7lrEQPDH!H+b`7_Y~aDb_qa=B2^Y&Ow41cU=4WDd40dp5(QS-WMN-=Y
z9g;6_-JdNU;|6cPwf$ak*aJIcwL@1n$#l~zi{c{EW?T;DaW*E8DYq?Umtz{nJ&w-M
zEMyT<MDk{HKbd#ckg5-pS_?QUVhZv?&Q-ioBS}$nvBd)nE7YO0deN~G(#zCJAbY$E
z!)g3Ytl=_NDUV%pykcE+Q<{EoZ_4FR@&#d<hqs%N>DrC&9K$d|kZe2#ws6)L=7K+{
zQw{XnV6UC$6-rW0emqm8wJoeZK)wJIcV?dST}Z;G0Arq{dVDu0&4kd%N!3F1*;*pW
zR&qUiFzK=@44#QGw7k1`3t_d8&*kBV->O##t|tonFc2YWrL7_eqg+=+k;!F-`^b8>
z#KWCE8%u4k@EprxqiV$VmmtiWxDLgnGu$Vs<8rppV5E<MCr+anDo)-{XRlCJ;D#M(
zT=3WgR02;Nm!54biUb^FtzPh8iGrf412epnki-k+G4mdkzC|lJqaRMbb0~Jjp-{}I
z5Do5afZi>ajBXL4nyyZM$SWVm!wnCj-B!Wjqj5-5dNXukI2$$|Bu3Lrw}z65Lc=1G
z^-#WuQOj$hwNGG?*CM_TO8Bg-1+qc>J7k5c51U8g?ZU5n?HYor;~JIjoWH-G>AoUP
ztrWWLbRNqIjW#RT*WqZgPJXU7C)VaW5}MiijYbABmzoru6EmQ*N8cVK7a3|aOB#O&
zBl8JY2WKfmj;h#Q!pN%9o@VNLv{OUL?rixHwOZuvX7{IJ{(EdPpuVFoQqIOa7gi<U
zTpbX&UCeYeNu>LVkBOKL@^smUA!tZ1CKRK}#SSM)iQHk)*R~?M!qkCruaS!#oIL1c
z<cK@1=jX>?J<BS8bpdt^R+}%A_DEhF^%o}8e!!lc`Y!qU>;U~&FfH#*98^G?i}pA{
z9Jg36t4=%6mhY(quYq*vSxptes9qy|7xSlH?G=S@>u>Ebe;|LVhs~@+06N<4CViBk
zUiY$thvX;>Tby6z9Y1e<Q<iIG*|o$r?OTFp`s)@_nHs4LeWbGvg7^}NK)>dAMQaiH
zm^r3v#$Q#2T=X>bsY#D%s!bhs^M9PMAcHbCc0FMHV{u-dwlL;a1eJ63v5U*?Q_8JO
zT#50!RD619#j_Uf))0ooADz~*9&lN!bBDRUgE>Vud-i5ck%vT=r^yD*^?Mp@Q^v+V
zG#-?gKlr}Eeqifb{|So?HM&g91<J5P5=Ly{?(NNY{6`O~L5r@sJe3rNZn06%SLk);
z9?hvE^Hr{!*G$<_doyzGn#*z*#}?)8dH=eYTgvc)T~}Jw!kCv68<+KL5{5?EXtDAZ
zWeNqp8%KIuBi&icn5s815Vho<+99VW1~m@L8l0=$c`t-L{q))~<!p*~vCdUcBcPz`
zyUi}!-k_`G{>P8|av8hQoCmQXkd?7wIJw<dY^{|7OQJUHKB~nksN_|Xy;DL?xjxU^
zbMa`WdfTBnr<wTd$mY&SgJ4U|X``k`#`gN@M+0x2W{YgC3kbLk<uYFJWglkx_)2#b
ztRiuA!EK9o)f`I2k)l;Of%E`ff91WlZh8yfRi6#N-mC`Ma(yr~U82SyAhc9B+ur!f
zP-3igg*KeYs9mGOAw@OaXYy9DnGjn0<m`JH&Q^h}^!h+uS9Ct*o-oEy(?iT6Yco>b
z_^v8bbg`<ZOL)a;i=IdfK0Zvw4nXsoC?eTOMpY)_ptiORm%J(1CD3dE0Z%Vy<2iHp
zcp>SAn{I*4bH$u(RZ6*x<DqKJ+5;a6Jq~=Y8V&c?Vsyq88!2nD?H?Eww58Mqt$7R8
z5BMjmKx>UhuA~hc=8czK8SHEKTzSxgbwi~9(OqJB&gwb^l4+m`k*Q;_?>Y-APi1{k
zAHQ)P)G)f|AyjSgcCFps)Fh6Bca*Xznq3<?y%xNvu0N78_R?~<RDFQx0ynlRG(E|j
zvEGN3bF<E_9p-I!UwQXFqcSGV#e^98tgFqLp+z9eP}y!jNA{)r*a+%M-_20xg?94<
zzmM{}syi0cd&P)zywMdS&Y_9k5JDtOM!L)b^2WP!+fHYGv>6!pV6Az&m{O8$wGFD?
zY&O*3*J0;_EqM#jh6^gMQKpXV?#1?>$ml1xvh8nSN>-?H=V;nJIwB07YX$e6vLxH(
zqYwQ>qxwR(i4f)DLd)-$P>T-no_c!LsN@)8`e;W@)-Hj0>nJ-}Kla4-ZdPJzI&Mce
zv)V_j;(3ERN3_@I$N<^|4Lf`B;8n+bX@bHbcZTopEmDI*Jfl)-pFDvo6svPRoo@(x
z);_{lY<;);XzT`dBFpRmGrr}z5u1=p<K1~3>C^<jVp}L(pzgMB_Vs-O?{Z?y$8M;)
zi@7zwpzV9#m72%En~(9@E)GWV^(~J*@^*K*TE0mynAnGJ5YSLCEnC42H-`tr4L=oW
zI}N{xQ$HT8Q6CVHf%RY&xw7!Zj(0xmg(K#UQ4u!ej95z7V4phlcTJ2&AR}$)zV-s!
zO7bqY6(=?1t+JCOW_z%HRE>S-{ce6iXQlLGcItwJ^mZx{m$&DA_oEZ)B{_bYPq-HA
zcH8WGoBG(aBU_j)vEy+_71T34@4dmSg!|M8Vf92Zj6WH7Q7t#OHQqWgFE3ARt+%!T
z?oLovLVlnf?2c7pTc)~cc^($_8nyKwsN`RA-23ed3sdj(ys%pjjM+9JrctL;dy8a(
z@en&CQmnV(()bu|Y%G1-4a(6x{aLytn$T-;(&{QIJB9vMox11U-1HpD@d(QkaJdEb
zG{)+6Dos_L+O3NpWo^=gR?evp|CqEG?L&Ut#D*KLaRFOgOEK(Kq1@!EGcTfo+%A&I
z=dLbB+d$u{sh?u)xP{PF8L%;YPPW53+@{>5W=Jt#wQpN;0_HYdw1{ksf_XhO4#2F=
zyPx6Lx2<92L-;L5PD`zn6zwIH`Jk(<gsVPionpJ-imI56$j4P0!br@ny3=!{x2TY^
zCD=)8_PgmN)E!^nczcDGc9Wm7oo5O3@fh=k=kh8J?_3KqEp7JHdv8z_iZ5#KmbiPt
z2Bt8Ro^p$7pS!xL3mtj<iN3f}#r6_&$Es0PnJTE?c;0#$%cGdu`T%~`gW;c^VD-S=
zrAatMf^%Lzr*wQ4kHSOb?WOUuEsJQ3xr{Imf1t{~iNmRwb_SP9!?FFN=b-E){!8P2
ztWCT~262O8`%?3<W4Wg+ovWY<re)?^kZ|Yi>$?Qw({erA$^bC;q33hv!d!>%wRhj#
zal^hk+WGNg;rJtb-EB(?czvOM=H7dl=vblBwAv>}%1@{}mnpUznfq1cE^sgsL0*4I
zJ##!*B?=vI_OEVis5o+_IwMIRrpQyT_Sq~ZU%oY7c5JMIADzpD!Upz9h@iWg_>>~j
zOLS;wp^i$-E?4<_cp?RiS%Rd?i;f*mOz=~(&3lo<=@(nR!_Rqiprh@weZlL!t#NCc
zO!QTcInq|%#>OVgobj{~ixEUec`E25zJ~*DofsQdzIa@5^nOXj2T;8O`l--(QyU<o
zeu8G~Z>^$t?TGY^7#&FQ+2SS3B#qK*k3`ye?8jUYSajE5iBbJls75CCc(m3dk{t?-
zopcER9{Z?TC)mk~gpi^kbbu>b-+a{m#8-y2^p$ka4n60w;Sc2}HMf<8JUvh<G@KZw
z+<GL!lpeahq2+nO{>CL0B&Btk)T`ctE$*qNW8L$`7!r^9T+>=<=2qaq-;ll2{`{Rg
zc5a0ZUI$oG&j-qVOuKa=*v4aY#IsoM+1|c4Z)<}lEDvy;5huB@1RJPquU2U*U-;gu
z=En2m+qjBzR#DEJDO`WU)hdd{Vj%^0V*KoyZ|5lzV87&g_j~NCjwv0uQVqXOb*QrQ
zy|Qn`hxx(58c<SELWpDAg~83oY-J_WoDiI6d7>70$E;L(X0uZZ72M1!6oeg)(cdKO
ze0gDaTz+ohR-#d)NbAH4x{I(21yjwvBQfmpLu$)|m{XolbgF!pmsqJ#D}(ylp6uC>
z{bqtcI#hT#HW=wl7>p!38sKsJ`r8}lt-q%Keqy%u(xk=yiIJiUw6|5IvkS+#?JTBl
z8H5(Q?l#wzazujH!8o>1xtn8#_w+397*<wp?Ryt$UFh41$qd}LyNJ7Oao(Aw2g|wy
zH_nZ+R#~EUME^#j4$@^5&>_cy8!pQGP%K(Ga3pAjsaTbbXJlQF_+m+-UpUUent@xM
zg%jqLUExj~o^vQ3Gl*>wh=_gOr2*|U64_iXb+-111a<qXXnUI&{l`dM&{4Gw)jZn;
zlj{VxW@#OcVE1Y%J*u^Z@H+XSqL6SwA|^jv2RU_+d;O!mk)dw7-m9B4{6*G1zRdR6
zQ}6v&Xt7R2h3Xp}EQk4nF2TULG{Ri=D|JC<a+K7dldN1}CY_f!vK#u}K3`g#TpO&W
z;!;64`0$d9raD!VbYP`kuFUasaMh!;&81y}LHS(SuGRxwEn4LZb4DS1j9iAq$MXd@
z(Ebka7_Gc(ljGaJqtI-OzmA@c@sYB$)Vg!RP4~``vaVyRq$rJXRjIPwtepN;(B%wy
zmU>H}$TjeajM+I20xw(((>fej-@CIz4S1pi$(#}P7`4({6QS2CaQS4NPENDp>sAqD
z$bH4KGzXGffkJ7R>V>)>tC)uax{UsN*dbeNC*v}#8Y#OWYwL4t$ePR?VTyIs!wea+
z5Urmc)X|^`MG~*dS6pGSbU+gPJoq*^a=_>$n4|P^w$sMBBy@f*Z^Jg6?n5?oId6f{
z$LW4M|4m502z0t7g<#Bx%X;9<=)smFolV&(V^(7Cv2-sxbxopQ!)*#ZRhTBpx1)Fc
zNm1T%bONzv6@#|dz(w02AH8OXe>kQ#1FMCzO}2J_mST)+ExmBr9cva-@?;wnmWMOk
z{3_~EX_xadgJGv&H@zK_8{(x84`}+c?oSBX*Ge3VdfTt&F}yCpFP?CpW+BE^cWY0^
zb&uBN!Ja3UzYHK-CTyA5=L<c0d<h!DNBIa<xax8W3(Ru8L0cVXQ18|Y^|*S%)R96z
zBT$(=zQ}2vmt6LzN~Oyf_Y92%P@QOx{7~}5!UIqCdfu?VwC0Nb!2@iiit8-5zUWFG
z*G&+GLIU#J;}hvowNJWnglvb^<2q~lS#?ixVtYT@(O3{TC|4kFJYLB*jni-4YZi0>
zEMW{l3Usky#ly=7px648W31UNV@K)&Ub&zP1c7%)`{);I4b0Q<)B}3;NMG2JH=X$U
zfIW4)4n9ZM`-yRj67I)YSLDK)qfUJ_ij}a#aZN~9EXrh8eZY2&=uY%2N0UFF7<~%M
zsB8=erOWZ>Ct_#^tHZ|*q`H;A)5;ycw*I<Cd*bZlOJ9YmRUK2<qXkpRR3nr6r~%Jz
z*(8tA&DYO)etdgVmoonqD{*<5Fog4ClIs-~_uhjuZOI}#Wy+ce${%#oyHloXelqfz
z8)?D3Y_>cmVxi8_0Xk}aJA^ath+E;xg!x+As(M#0=)3!NJR6H&9+zd#iP(m0PIW8$
z1Y^VX`>jm`W!=WpF*{ioM?C9`yOR>@0q=u7o>BP-eSHqCgMDj!2anwH?s%i2p+Q7D
zzszIf5XJpE)IG4;d_(La-xenmF(tgAxK`Y4sQ}BSJEPs6N_U2vI{8=0C_F?@7<(G;
zo$~G=8p+076G;`}>{MQ>t>7cm=zGtfbdDXm6||jUU|?X?CaE?(<6bKDYKeHlz}DA8
zXT={X=yp_R;HfJ9h%?eWvQ!dRgz&Su*JfNt!Wu>|XfU<MM~gB&J0gc}IH}?|B4WRK
zWPL0FhctFGdMucOFdhrVunIe5)4K^H9IjB#eA)p5w?c#v7kp8jx^~bxxJB{;hPFL9
zkR9Dbpj+T5ZMgHQg|oj*DS;x&jK}1rn&}Shp9sgOI*7puQD-w?3H*cg72;5H(_zW*
zApJBIM-p2~F;qWDj!n|Kd=5|T8OPkQ_G;ujgvKybr5@~eci2{8WAz+%NUSp-&eoG!
zOGLNLJewWl&1*NT467W3god~fYgX?!f0?NCFnjD$qE-fyQ)|Q_DLc*{olmXSVl$g_
z$vj}o?RatMy(o*j8?q1Mgw{OUOgVR6_qvS<Co*&!cR`ROi|*I`ajyG5s@L8agnX2J
zF=DLkMG`z{RP&996y0yAtvJcb<cba?TV#j4VYFPC>&68iRikRrHRW|ZxzRR^`eIGt
zIeiDgVS>IeExKVRWW8-=<xUfo0v~z=RA=cFWKXgcMECd}xHp7iqkBanH}TZ0h0rA=
zqxUZ>A=<k-RjTtwbJkkep{8z*173wY^e%-U0{Ue!n@wbg^2q)Vx5c(_RfvuR4}XXn
z+JE>yA`}`)ZkWBrZD`hpWIxBGkh&f#ijr449~m`j6{4jiJ*C!oVA8ZC?$1RM#K(_b
zL9TW)kN*Y4%^-qPpMP7d4)o?Nk#>aoYHT(*g)qmRUb?**F@pnNiy6Fv9rEiUqD(^O
zzyS?nBrX63BTRYduaG(0VVG2yJRe%o&rVrLjbxTaAFTd8s;<<@Qs>u(<193R8>}2_
zuwp{7;H2a*X7_jryzriZXMg?bTuegABb^87@SsKkr2)0Gyiax8KQWstw^v<oS3Xw7
zu51m`3~hoyxErcHymdFTZd#AO59{EkuFTcpAR33(3xc{zRnn1~1Ei(i*^HdCvM~;;
za&}Uip|u>#ix45EVrcEhr>!NMhprl<CqZuKa#zuI&@zymVzIicetS0bq#u?m(r_@S
zJ79bl%4EyHCQ3fK@en+A1@)e}HWLP|gr_zuoA{}Z<(-*53Zu@k+=^%~5F(z$EFLI;
z-TQTS8$W|GRbZq93Ha1?lu+`O;rn>$InQMzjSFH54x5k9qHc`@9uKQzvL4ihcq{^B
zPrVR=o_ic%Y>6&rMN)hTZsI7I<3&`#(nl+3y3ys9A~<Ao%ZuW})CJ)6^(aRV(gGxR
z89#(FDW;GZEAf;rI$+PU)rEV|rASrwP0_mr^Ldv)IuUf1M>&^=4?PL&nd8)`OfG#n
zwAMN$1&>K++c{^|7<<q5KGu)u(OEfEJJw2aEi(;x-i=Y=j3ram9H2n-Fuqv0dVlXJ
z&WgG5X({!vJFDrEbm+CWDca^zIe2@s1@a;;Y3!U9Q)&P0UXFmCP51_!wvTfAIyR^M
z7^R*O@yz1b-s4VC>4P=2y(B{jJsQ0a#U;HTo4ZmWZYvI{+s;Td{Yzem%0*k#)vjpB
zia;J&>}ICate44SFYY3vEelqStQWFihx%^vQ@Do(sOy7yR2@WNv7Y9I^yL=nZr3mb
zXKV5t@=?-Sk|b{XMhA7ZGB@2hqsx}4xwCW!in#C<kr{U&JG{9FhoZ<aTve_lLz39>
zI@}sc<h3gsW}hp-`WUywKA>Zlr3-NFJ@NFaJlhyfcw{k^vvtGl`N9xSo**rDW4S}i
zM9{fMPWo%4wYDG~BZ18BD+}h|GQKc-g^{++3MY>}W_uq7jGHx{mwE9fZiPCoxN$+7
zrODGGJrOkcPQUB(FD5aoS4g~7#6NR^ma7-!>mHuJfY5kTe6PpNNKC9GGRiu^L31uG
z$7v`*JknQHsYB!Tm_W{a32TM099djW%5e+j0Ve_ct}IM>XLF1Ap+YvcrLV=|CKo6S
zb+<Td{{5RWR}u2f(q<b(D$9JsF0OOzJ*+z0P5kc1t}CXlYgua%x*2lSgp|*WS3H-#
zdYr7?GQOL18zUS<2|;+vi4|4sQBM2Gs&WVS!D`q5Lz;XR@5rEfa{uG-!q?R8Ncz%(
z5K6~LQ@d2wp#)5q4u<ENlFbS)U4o1t9{-d>9Nl3_YdKP6%Cxy@6TxZ>;4&nTneadr
z_ES90ydCev)LV!dN=#(*f}|ZORFdvkYBni^aLbUk>BajeWIOcmHP#8S)*2U~QKI%S
zyrLmtPqb&TphJ;>yAxri#;{uyk`JJqODDw%(Z=2<VfJZemI(PFAD{6Sm|uE%BTbkl
zROsg*MOh20YgGs3H7?@pmQ>`1uc}br^V%>j!gS)D*q*f_-qf8&D;W1dJgQMlaH5er
zN2U<%Smb7==vE}dDI8K7cKz!vs^73o9f>2sgiTzWcwY|BMYHH5%Vn7#kiw&eItCqa
zIkR2~Q}>X=Ar8W|^Ms41Fm8o6IB2_j60eOeBB1Br!boW7JnoeX6Gs)?7rW0^5psc-
zjS16yb>dFn>KPOF;imD}e!enuIniFzv}n$m2#gCCv4jM#ArwlzZ$7@9&XkFxZ4n!V
zj3dyiwW4Ki2QG{@i>yuZXQizw_OkZI^-3otXC{!(lUpJF33gI60ak;Uqitp74|B6I
zgg{b=Iz}WkhCGj1M<xTd?60J5qsr1Cg7F~~U2N!(@lC<>=hu4#Aw173YxIVbISaoc
z-nLZC*6Tgivd5V`K%GxhBsp@SUU60-rfc$=wb>zdJzXS&-5(NRRodFk;Kxk!S(<ov
z$YXcI9;^grAyiJ4dWTv3b}K~Ww09(;mLY4+kj|$A?IMr}`7q?mIS1>O(a0e7oY=E(
zAyS;Ow?6Q&XA+cnkCb{28_1N8H#?J!*$MmIwLq^*T_9-z^&UE@A(z9oGYtFy6EZef
LrJugUA?W`A8`#=m

literal 0
HcmV?d00001

diff --git a/example/tailwind-nextjs/app/globals.css b/example/tailwind-nextjs/app/globals.css
new file mode 100644
index 0000000..22ceec5
--- /dev/null
+++ b/example/tailwind-nextjs/app/globals.css
@@ -0,0 +1,7 @@
+@import "../.cssforge/output.css" layer(cssforge);
+@import "tailwindcss";
+
+body {
+  margin: 0;
+  font-family: Arial, Helvetica, sans-serif;
+}
diff --git a/example/tailwind-nextjs/app/layout.tsx b/example/tailwind-nextjs/app/layout.tsx
new file mode 100644
index 0000000..33dbb50
--- /dev/null
+++ b/example/tailwind-nextjs/app/layout.tsx
@@ -0,0 +1,32 @@
+import type { Metadata } from "next";
+import { Geist, Geist_Mono } from "next/font/google";
+import "./globals.css";
+
+const geistSans = Geist({
+  variable: "--font-geist-sans",
+  subsets: ["latin"],
+});
+
+const geistMono = Geist_Mono({
+  variable: "--font-geist-mono",
+  subsets: ["latin"],
+});
+
+export const metadata: Metadata = {
+  title: "CSS Forge Tailwind Next.js Example",
+  description: "Playwright-verified Cssforge variables in Next.js + Tailwind",
+};
+
+export default function RootLayout({
+  children,
+}: Readonly<{
+  children: React.ReactNode;
+}>) {
+  return (
+    <html lang="en">
+      <body className={`${geistSans.variable} ${geistMono.variable} antialiased`}>
+        {children}
+      </body>
+    </html>
+  );
+}
diff --git a/example/tailwind-nextjs/app/page.tsx b/example/tailwind-nextjs/app/page.tsx
new file mode 100644
index 0000000..aed8ee0
--- /dev/null
+++ b/example/tailwind-nextjs/app/page.tsx
@@ -0,0 +1,18 @@
+export default function Home() {
+  return (
+    <main className="min-h-screen bg-[var(--palette-brand-surface)] p-[var(--spacing-size-4)] text-white">
+      <section
+        data-testid="token-card"
+        className="mx-auto max-w-xl rounded-[var(--spacing-size-2)] bg-[var(--palette-brand-primary)] p-[var(--spacing-size-4)] text-[var(--typography_fluid-base-text-m)] shadow-lg"
+      >
+        <h1 className="mb-[var(--spacing-size-2)] text-[var(--typography_fluid-base-text-l)] font-semibold">
+          CSS Forge + Next.js + Tailwind
+        </h1>
+        <p>
+          Tokens are generated from <code>cssforge.config.ts</code> and consumed as CSS
+          variables.
+        </p>
+      </section>
+    </main>
+  );
+}
diff --git a/example/tailwind-nextjs/cssforge.config.ts b/example/tailwind-nextjs/cssforge.config.ts
new file mode 100644
index 0000000..0b1e64f
--- /dev/null
+++ b/example/tailwind-nextjs/cssforge.config.ts
@@ -0,0 +1,46 @@
+import { defineConfig } from "/cssforge";
+
+export default defineConfig({
+  colors: {
+    palette: {
+      value: {
+        brand: {
+          value: {
+            primary: "#1d4ed8",
+            accent: "#f97316",
+            surface: "#0f172a",
+          },
+        },
+      },
+    },
+  },
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          1: "4px",
+          2: "8px",
+          3: "12px",
+          4: "16px",
+        },
+      },
+    },
+  },
+  typography: {
+    fluid: {
+      base: {
+        value: {
+          minWidth: 320,
+          minFontSize: 16,
+          minTypeScale: 1.2,
+          maxWidth: 1280,
+          maxFontSize: 18,
+          maxTypeScale: 1.25,
+          negativeSteps: 1,
+          positiveSteps: 2,
+          prefix: "text",
+        },
+      },
+    },
+  },
+});
diff --git a/example/tailwind-nextjs/eslint.config.mjs b/example/tailwind-nextjs/eslint.config.mjs
new file mode 100644
index 0000000..05e726d
--- /dev/null
+++ b/example/tailwind-nextjs/eslint.config.mjs
@@ -0,0 +1,18 @@
+import { defineConfig, globalIgnores } from "eslint/config";
+import nextVitals from "eslint-config-next/core-web-vitals";
+import nextTs from "eslint-config-next/typescript";
+
+const eslintConfig = defineConfig([
+  ...nextVitals,
+  ...nextTs,
+  // Override default ignores of eslint-config-next.
+  globalIgnores([
+    // Default ignores of eslint-config-next:
+    ".next/**",
+    "out/**",
+    "build/**",
+    "next-env.d.ts",
+  ]),
+]);
+
+export default eslintConfig;
diff --git a/example/tailwind-nextjs/moon.yml b/example/tailwind-nextjs/moon.yml
new file mode 100644
index 0000000..b7b2dde
--- /dev/null
+++ b/example/tailwind-nextjs/moon.yml
@@ -0,0 +1,78 @@
+$schema: "https://moonrepo.dev/schemas/project.json"
+
+language: "typescript"
+layer: "application"
+
+dependsOn:
+  - "cssforge"
+
+tasks:
+  build:
+    command: "next"
+    args: ["build"]
+    deps:
+      - "^:build"
+  dev:
+    command: "next"
+    args: ["dev"]
+    deps:
+      - "^:build"
+    preset: "server"
+    options:
+      runInCI: false
+  dev-e2e:
+    command: "next"
+    args: ["dev", "--hostname", "127.0.0.1", "--port", "4173"]
+    deps:
+      - "^:build"
+    preset: "server"
+    options:
+      runInCI: false
+  start:
+    command: "next"
+    args: ["start"]
+    deps:
+      - "~:build"
+    preset: "server"
+    options:
+      runInCI: false
+  lint:
+    command: "eslint"
+    args: ["."]
+    options:
+      runInCI: false
+  cssforge-generate:
+    command: "tsx"
+    args:
+      - "../../packages/cssforge/src/cli.ts"
+      - "--prefix"
+      - "."
+      - "--config"
+      - "./cssforge.config.ts"
+      - "--mode"
+      - "css"
+      - "--css"
+      - "./.cssforge/output.css"
+    deps:
+      - "^:build"
+    options:
+      runInCI: false
+  e2e:
+    command: "playwright"
+    args: ["test"]
+    deps:
+      - "~:cssforge-generate"
+    options:
+      runInCI: false
+  e2e-headed:
+    command: "playwright"
+    args: ["test", "--headed"]
+    deps:
+      - "~:cssforge-generate"
+    options:
+      runInCI: false
+  cssforge-build-local:
+    command: "moon"
+    args: ["run", "cssforge:jsr-dry-run"]
+    options:
+      runInCI: false
diff --git a/example/tailwind-nextjs/next.config.ts b/example/tailwind-nextjs/next.config.ts
new file mode 100644
index 0000000..e9ffa30
--- /dev/null
+++ b/example/tailwind-nextjs/next.config.ts
@@ -0,0 +1,7 @@
+import type { NextConfig } from "next";
+
+const nextConfig: NextConfig = {
+  /* config options here */
+};
+
+export default nextConfig;
diff --git a/example/tailwind-nextjs/package.json b/example/tailwind-nextjs/package.json
new file mode 100644
index 0000000..27cd2d2
--- /dev/null
+++ b/example/tailwind-nextjs/package.json
@@ -0,0 +1,23 @@
+{
+  "name": "tailwind-nextjs",
+  "version": "0.1.0",
+  "private": true,
+  "dependencies": {
+    "next": "16.1.6",
+    "react": "19.2.4",
+    "react-dom": "19.2.4"
+  },
+  "devDependencies": {
+    "@playwright/test": "1.58.2",
+    "@tailwindcss/postcss": "4.2.0",
+    "@types/node": "^20",
+    "@types/react": "^19",
+    "@types/react-dom": "^19",
+    "eslint": "^9",
+    "eslint-config-next": "16.1.6",
+    "tailwindcss": "4.2.0",
+    "typescript": "^5",
+    "@hebilicious/cssforge": "workspace:*",
+    "tsx": "^4.20.6"
+  }
+}
diff --git a/example/tailwind-nextjs/playwright.config.ts b/example/tailwind-nextjs/playwright.config.ts
new file mode 100644
index 0000000..a031502
--- /dev/null
+++ b/example/tailwind-nextjs/playwright.config.ts
@@ -0,0 +1,25 @@
+import { defineConfig, devices } from "@playwright/test";
+
+export default defineConfig({
+  testDir: "./tests",
+  timeout: 30_000,
+  fullyParallel: true,
+  use: {
+    baseURL: "http://127.0.0.1:4173",
+    trace: "on-first-retry",
+    screenshot: "only-on-failure",
+  },
+  projects: [
+    {
+      name: "chromium",
+      use: { ...devices["Desktop Chrome"] },
+    },
+  ],
+  webServer: {
+    command: "next dev --hostname 127.0.0.1 --port 4173",
+    url: "http://127.0.0.1:4173",
+    reuseExistingServer: !process.env.CI,
+    stdout: "pipe",
+    stderr: "pipe",
+  },
+});
diff --git a/example/tailwind-nextjs/postcss.config.mjs b/example/tailwind-nextjs/postcss.config.mjs
new file mode 100644
index 0000000..61e3684
--- /dev/null
+++ b/example/tailwind-nextjs/postcss.config.mjs
@@ -0,0 +1,7 @@
+const config = {
+  plugins: {
+    "@tailwindcss/postcss": {},
+  },
+};
+
+export default config;
diff --git a/example/tailwind-nextjs/public/file.svg b/example/tailwind-nextjs/public/file.svg
new file mode 100644
index 0000000..004145c
--- /dev/null
+++ b/example/tailwind-nextjs/public/file.svg
@@ -0,0 +1 @@
+<svg fill="none" viewBox="0 0 16 16" xmlns="http://www.w3.org/2000/svg"><path d="M14.5 13.5V5.41a1 1 0 0 0-.3-.7L9.8.29A1 1 0 0 0 9.08 0H1.5v13.5A2.5 2.5 0 0 0 4 16h8a2.5 2.5 0 0 0 2.5-2.5m-1.5 0v-7H8v-5H3v12a1 1 0 0 0 1 1h8a1 1 0 0 0 1-1M9.5 5V2.12L12.38 5zM5.13 5h-.62v1.25h2.12V5zm-.62 3h7.12v1.25H4.5zm.62 3h-.62v1.25h7.12V11z" clip-rule="evenodd" fill="#666" fill-rule="evenodd"/></svg>
\ No newline at end of file
diff --git a/example/tailwind-nextjs/public/globe.svg b/example/tailwind-nextjs/public/globe.svg
new file mode 100644
index 0000000..567f17b
--- /dev/null
+++ b/example/tailwind-nextjs/public/globe.svg
@@ -0,0 +1 @@
+<svg fill="none" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 16 16"><g clip-path="url(#a)"><path fill-rule="evenodd" clip-rule="evenodd" d="M10.27 14.1a6.5 6.5 0 0 0 3.67-3.45q-1.24.21-2.7.34-.31 1.83-.97 3.1M8 16A8 8 0 1 0 8 0a8 8 0 0 0 0 16m.48-1.52a7 7 0 0 1-.96 0H7.5a4 4 0 0 1-.84-1.32q-.38-.89-.63-2.08a40 40 0 0 0 3.92 0q-.25 1.2-.63 2.08a4 4 0 0 1-.84 1.31zm2.94-4.76q1.66-.15 2.95-.43a7 7 0 0 0 0-2.58q-1.3-.27-2.95-.43a18 18 0 0 1 0 3.44m-1.27-3.54a17 17 0 0 1 0 3.64 39 39 0 0 1-4.3 0 17 17 0 0 1 0-3.64 39 39 0 0 1 4.3 0m1.1-1.17q1.45.13 2.69.34a6.5 6.5 0 0 0-3.67-3.44q.65 1.26.98 3.1M8.48 1.5l.01.02q.41.37.84 1.31.38.89.63 2.08a40 40 0 0 0-3.92 0q.25-1.2.63-2.08a4 4 0 0 1 .85-1.32 7 7 0 0 1 .96 0m-2.75.4a6.5 6.5 0 0 0-3.67 3.44 29 29 0 0 1 2.7-.34q.31-1.83.97-3.1M4.58 6.28q-1.66.16-2.95.43a7 7 0 0 0 0 2.58q1.3.27 2.95.43a18 18 0 0 1 0-3.44m.17 4.71q-1.45-.12-2.69-.34a6.5 6.5 0 0 0 3.67 3.44q-.65-1.27-.98-3.1" fill="#666"/></g><defs><clipPath id="a"><path fill="#fff" d="M0 0h16v16H0z"/></clipPath></defs></svg>
\ No newline at end of file
diff --git a/example/tailwind-nextjs/public/next.svg b/example/tailwind-nextjs/public/next.svg
new file mode 100644
index 0000000..5174b28
--- /dev/null
+++ b/example/tailwind-nextjs/public/next.svg
@@ -0,0 +1 @@
+<svg xmlns="http://www.w3.org/2000/svg" fill="none" viewBox="0 0 394 80"><path fill="#000" d="M262 0h68.5v12.7h-27.2v66.6h-13.6V12.7H262V0ZM149 0v12.7H94v20.4h44.3v12.6H94v21h55v12.6H80.5V0h68.7zm34.3 0h-17.8l63.8 79.4h17.9l-32-39.7 32-39.6h-17.9l-23 28.6-23-28.6zm18.3 56.7-9-11-27.1 33.7h17.8l18.3-22.7z"/><path fill="#000" d="M81 79.3 17 0H0v79.3h13.6V17l50.2 62.3H81Zm252.6-.4c-1 0-1.8-.4-2.5-1s-1.1-1.6-1.1-2.6.3-1.8 1-2.5 1.6-1 2.6-1 1.8.3 2.5 1a3.4 3.4 0 0 1 .6 4.3 3.7 3.7 0 0 1-3 1.8zm23.2-33.5h6v23.3c0 2.1-.4 4-1.3 5.5a9.1 9.1 0 0 1-3.8 3.5c-1.6.8-3.5 1.3-5.7 1.3-2 0-3.7-.4-5.3-1s-2.8-1.8-3.7-3.2c-.9-1.3-1.4-3-1.4-5h6c.1.8.3 1.6.7 2.2s1 1.2 1.6 1.5c.7.4 1.5.5 2.4.5 1 0 1.8-.2 2.4-.6a4 4 0 0 0 1.6-1.8c.3-.8.5-1.8.5-3V45.5zm30.9 9.1a4.4 4.4 0 0 0-2-3.3 7.5 7.5 0 0 0-4.3-1.1c-1.3 0-2.4.2-3.3.5-.9.4-1.6 1-2 1.6a3.5 3.5 0 0 0-.3 4c.3.5.7.9 1.3 1.2l1.8 1 2 .5 3.2.8c1.3.3 2.5.7 3.7 1.2a13 13 0 0 1 3.2 1.8 8.1 8.1 0 0 1 3 6.5c0 2-.5 3.7-1.5 5.1a10 10 0 0 1-4.4 3.5c-1.8.8-4.1 1.2-6.8 1.2-2.6 0-4.9-.4-6.8-1.2-2-.8-3.4-2-4.5-3.5a10 10 0 0 1-1.7-5.6h6a5 5 0 0 0 3.5 4.6c1 .4 2.2.6 3.4.6 1.3 0 2.5-.2 3.5-.6 1-.4 1.8-1 2.4-1.7a4 4 0 0 0 .8-2.4c0-.9-.2-1.6-.7-2.2a11 11 0 0 0-2.1-1.4l-3.2-1-3.8-1c-2.8-.7-5-1.7-6.6-3.2a7.2 7.2 0 0 1-2.4-5.7 8 8 0 0 1 1.7-5 10 10 0 0 1 4.3-3.5c2-.8 4-1.2 6.4-1.2 2.3 0 4.4.4 6.2 1.2 1.8.8 3.2 2 4.3 3.4 1 1.4 1.5 3 1.5 5h-5.8z"/></svg>
\ No newline at end of file
diff --git a/example/tailwind-nextjs/public/vercel.svg b/example/tailwind-nextjs/public/vercel.svg
new file mode 100644
index 0000000..7705396
--- /dev/null
+++ b/example/tailwind-nextjs/public/vercel.svg
@@ -0,0 +1 @@
+<svg fill="none" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 1155 1000"><path d="m577.3 0 577.4 1000H0z" fill="#fff"/></svg>
\ No newline at end of file
diff --git a/example/tailwind-nextjs/public/window.svg b/example/tailwind-nextjs/public/window.svg
new file mode 100644
index 0000000..b2b2a44
--- /dev/null
+++ b/example/tailwind-nextjs/public/window.svg
@@ -0,0 +1 @@
+<svg fill="none" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 16 16"><path fill-rule="evenodd" clip-rule="evenodd" d="M1.5 2.5h13v10a1 1 0 0 1-1 1h-11a1 1 0 0 1-1-1zM0 1h16v11.5a2.5 2.5 0 0 1-2.5 2.5h-11A2.5 2.5 0 0 1 0 12.5zm3.75 4.5a.75.75 0 1 0 0-1.5.75.75 0 0 0 0 1.5M7 4.75a.75.75 0 1 1-1.5 0 .75.75 0 0 1 1.5 0m1.75.75a.75.75 0 1 0 0-1.5.75.75 0 0 0 0 1.5" fill="#666"/></svg>
\ No newline at end of file
diff --git a/example/tailwind-nextjs/tests/e2e.spec.ts b/example/tailwind-nextjs/tests/e2e.spec.ts
new file mode 100644
index 0000000..64bb4d9
--- /dev/null
+++ b/example/tailwind-nextjs/tests/e2e.spec.ts
@@ -0,0 +1,34 @@
+import { expect, test } from "@playwright/test";
+
+test("cssforge variables exist and are applied in the DOM", async ({ page }) => {
+  await page.goto("/");
+
+  const root = await page.evaluate(() => {
+    const css = getComputedStyle(document.documentElement);
+    return {
+      spacing: css.getPropertyValue("--spacing-size-4").trim(),
+      color: css.getPropertyValue("--palette-brand-primary").trim(),
+      type: css.getPropertyValue("--typography_fluid-base-text-m").trim(),
+    };
+  });
+
+  expect(root.spacing).not.toBe("");
+  expect(root.color).not.toBe("");
+  expect(root.type).not.toBe("");
+
+  const tokenCard = page.getByTestId("token-card");
+  await expect(tokenCard).toBeVisible();
+
+  const computed = await tokenCard.evaluate((el) => {
+    const css = getComputedStyle(el);
+    return {
+      paddingTop: css.paddingTop,
+      backgroundColor: css.backgroundColor,
+      fontSize: css.fontSize,
+    };
+  });
+
+  expect(parseFloat(computed.paddingTop)).toBeGreaterThan(0);
+  expect(computed.backgroundColor).not.toBe("rgba(0, 0, 0, 0)");
+  expect(parseFloat(computed.fontSize)).toBeGreaterThan(0);
+});
diff --git a/example/tailwind-nextjs/tsconfig.json b/example/tailwind-nextjs/tsconfig.json
new file mode 100644
index 0000000..2e2db4e
--- /dev/null
+++ b/example/tailwind-nextjs/tsconfig.json
@@ -0,0 +1,47 @@
+{
+  "compilerOptions": {
+    "target": "ES2017",
+    "lib": [
+      "dom",
+      "dom.iterable",
+      "esnext"
+    ],
+    "allowJs": true,
+    "skipLibCheck": true,
+    "strict": true,
+    "noEmit": true,
+    "esModuleInterop": true,
+    "module": "esnext",
+    "moduleResolution": "bundler",
+    "resolveJsonModule": true,
+    "isolatedModules": true,
+    "jsx": "react-jsx",
+    "incremental": true,
+    "plugins": [
+      {
+        "name": "next"
+      }
+    ],
+    "paths": {
+      "@/*": [
+        "./*"
+      ]
+    }
+  },
+  "include": [
+    "next-env.d.ts",
+    "**/*.ts",
+    "**/*.tsx",
+    ".next/types/**/*.ts",
+    ".next/dev/types/**/*.ts",
+    "**/*.mts"
+  ],
+  "exclude": [
+    "node_modules"
+  ],
+  "references": [
+    {
+      "path": "../../packages/cssforge"
+    }
+  ]
+}
diff --git a/example/tailwind-nuxt/.gitignore b/example/tailwind-nuxt/.gitignore
new file mode 100644
index 0000000..10fa51d
--- /dev/null
+++ b/example/tailwind-nuxt/.gitignore
@@ -0,0 +1,28 @@
+# Nuxt dev/build outputs
+.output
+.data
+.nuxt
+.nitro
+.cache
+dist
+
+# Node dependencies
+node_modules
+
+# Logs
+logs
+*.log
+
+# Misc
+.DS_Store
+.fleet
+.idea
+
+# Local env files
+.env
+.env.*
+!.env.example
+.cssforge
+playwright-report
+test-results
+.playwright
diff --git a/example/tailwind-nuxt/README.md b/example/tailwind-nuxt/README.md
new file mode 100644
index 0000000..f8f5fc1
--- /dev/null
+++ b/example/tailwind-nuxt/README.md
@@ -0,0 +1,35 @@
+# Tailwind + Nuxt
+
+Node.js example that integrates CSS Forge tokens into a Nuxt app styled with Tailwind.
+
+## Scaffold Source
+
+```bash
+pnpm dlx nuxi@latest init tailwind-nuxt --template minimal --packageManager pnpm --no-install --gitInit false --modules "" --force
+```
+
+## Resolved Versions
+
+- `nuxt@4.3.1`
+- `vue@3.5.28`
+- `tailwindcss@4.2.0`
+- `@playwright/test@1.58.2`
+
+## Run Locally
+
+```bash
+pnpm install
+pnpm exec playwright install chromium
+pnpm run cssforge:build-local
+pnpm run cssforge:generate
+pnpm run dev
+```
+
+## E2E Test
+
+```bash
+pnpm run test:e2e
+```
+
+The Playwright test validates CSS Forge variables on `:root` and computed styles on
+`[data-testid="token-card"]`.
diff --git a/example/tailwind-nuxt/app/app.vue b/example/tailwind-nuxt/app/app.vue
new file mode 100644
index 0000000..f5f91f6
--- /dev/null
+++ b/example/tailwind-nuxt/app/app.vue
@@ -0,0 +1,16 @@
+<template>
+  <main class="min-h-screen bg-[var(--palette-brand-surface)] p-[var(--spacing-size-4)] text-white">
+    <section
+      data-testid="token-card"
+      class="mx-auto max-w-xl rounded-[var(--spacing-size-2)] bg-[var(--palette-brand-primary)] p-[var(--spacing-size-4)] text-[var(--typography_fluid-base-text-m)] shadow-lg"
+    >
+      <h1 class="mb-[var(--spacing-size-2)] text-[var(--typography_fluid-base-text-l)] font-semibold">
+        CSS Forge + Nuxt + Tailwind
+      </h1>
+      <p>
+        Tokens are generated from <code>cssforge.config.ts</code> and consumed as CSS
+        variables.
+      </p>
+    </section>
+  </main>
+</template>
diff --git a/example/tailwind-nuxt/app/assets/css/main.css b/example/tailwind-nuxt/app/assets/css/main.css
new file mode 100644
index 0000000..f0f48ab
--- /dev/null
+++ b/example/tailwind-nuxt/app/assets/css/main.css
@@ -0,0 +1,7 @@
+@import "../../../.cssforge/output.css" layer(cssforge);
+@import "tailwindcss";
+
+body {
+  margin: 0;
+  font-family: Arial, Helvetica, sans-serif;
+}
diff --git a/example/tailwind-nuxt/cssforge.config.ts b/example/tailwind-nuxt/cssforge.config.ts
new file mode 100644
index 0000000..0b1e64f
--- /dev/null
+++ b/example/tailwind-nuxt/cssforge.config.ts
@@ -0,0 +1,46 @@
+import { defineConfig } from "/cssforge";
+
+export default defineConfig({
+  colors: {
+    palette: {
+      value: {
+        brand: {
+          value: {
+            primary: "#1d4ed8",
+            accent: "#f97316",
+            surface: "#0f172a",
+          },
+        },
+      },
+    },
+  },
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          1: "4px",
+          2: "8px",
+          3: "12px",
+          4: "16px",
+        },
+      },
+    },
+  },
+  typography: {
+    fluid: {
+      base: {
+        value: {
+          minWidth: 320,
+          minFontSize: 16,
+          minTypeScale: 1.2,
+          maxWidth: 1280,
+          maxFontSize: 18,
+          maxTypeScale: 1.25,
+          negativeSteps: 1,
+          positiveSteps: 2,
+          prefix: "text",
+        },
+      },
+    },
+  },
+});
diff --git a/example/tailwind-nuxt/moon.yml b/example/tailwind-nuxt/moon.yml
new file mode 100644
index 0000000..30ae9f2
--- /dev/null
+++ b/example/tailwind-nuxt/moon.yml
@@ -0,0 +1,89 @@
+$schema: "https://moonrepo.dev/schemas/project.json"
+
+language: "typescript"
+layer: "application"
+
+dependsOn:
+  - "cssforge"
+
+tasks:
+  prepare:
+    command: "nuxt"
+    args: ["prepare"]
+  build:
+    command: "nuxt"
+    args: ["build"]
+    deps:
+      - "^:build"
+      - "~:prepare"
+  dev:
+    command: "nuxt"
+    args: ["dev"]
+    deps:
+      - "^:build"
+      - "~:prepare"
+    preset: "server"
+    options:
+      runInCI: false
+  dev-e2e:
+    command: "nuxt"
+    args: ["dev", "--host", "127.0.0.1", "--port", "4174"]
+    deps:
+      - "^:build"
+      - "~:prepare"
+    preset: "server"
+    options:
+      runInCI: false
+  generate:
+    command: "nuxt"
+    args: ["generate"]
+    deps:
+      - "~:prepare"
+    options:
+      runInCI: false
+  preview:
+    command: "nuxt"
+    args: ["preview"]
+    deps:
+      - "~:build"
+      - "~:prepare"
+    preset: "server"
+    options:
+      runInCI: false
+  cssforge-generate:
+    command: "tsx"
+    args:
+      - "../../packages/cssforge/src/cli.ts"
+      - "--prefix"
+      - "."
+      - "--config"
+      - "./cssforge.config.ts"
+      - "--mode"
+      - "css"
+      - "--css"
+      - "./.cssforge/output.css"
+    deps:
+      - "^:build"
+    options:
+      runInCI: false
+  e2e:
+    command: "playwright"
+    args: ["test"]
+    deps:
+      - "~:cssforge-generate"
+      - "~:prepare"
+    options:
+      runInCI: false
+  e2e-headed:
+    command: "playwright"
+    args: ["test", "--headed"]
+    deps:
+      - "~:cssforge-generate"
+      - "~:prepare"
+    options:
+      runInCI: false
+  cssforge-build-local:
+    command: "moon"
+    args: ["run", "cssforge:jsr-dry-run"]
+    options:
+      runInCI: false
diff --git a/example/tailwind-nuxt/nuxt.config.ts b/example/tailwind-nuxt/nuxt.config.ts
new file mode 100644
index 0000000..ecf9215
--- /dev/null
+++ b/example/tailwind-nuxt/nuxt.config.ts
@@ -0,0 +1,10 @@
+import tailwindcss from "@tailwindcss/vite";
+
+export default defineNuxtConfig({
+  compatibilityDate: "2025-07-15",
+  devtools: { enabled: true },
+  css: ["~/assets/css/main.css"],
+  vite: {
+    plugins: [tailwindcss()],
+  },
+});
diff --git a/example/tailwind-nuxt/package.json b/example/tailwind-nuxt/package.json
new file mode 100644
index 0000000..9903a40
--- /dev/null
+++ b/example/tailwind-nuxt/package.json
@@ -0,0 +1,17 @@
+{
+  "name": "tailwind-nuxt",
+  "type": "module",
+  "private": true,
+  "dependencies": {
+    "nuxt": "4.3.1",
+    "vue": "3.5.28",
+    "vue-router": "4.6.4"
+  },
+  "devDependencies": {
+    "@playwright/test": "1.58.2",
+    "@tailwindcss/vite": "4.2.0",
+    "tailwindcss": "4.2.0",
+    "@hebilicious/cssforge": "workspace:*",
+    "tsx": "^4.20.6"
+  }
+}
diff --git a/example/tailwind-nuxt/playwright.config.ts b/example/tailwind-nuxt/playwright.config.ts
new file mode 100644
index 0000000..9a6d244
--- /dev/null
+++ b/example/tailwind-nuxt/playwright.config.ts
@@ -0,0 +1,25 @@
+import { defineConfig, devices } from "@playwright/test";
+
+export default defineConfig({
+  testDir: "./tests",
+  timeout: 30_000,
+  fullyParallel: true,
+  use: {
+    baseURL: "http://127.0.0.1:4174",
+    trace: "on-first-retry",
+    screenshot: "only-on-failure",
+  },
+  projects: [
+    {
+      name: "chromium",
+      use: { ...devices["Desktop Chrome"] },
+    },
+  ],
+  webServer: {
+    command: "nuxt dev --host 127.0.0.1 --port 4174",
+    url: "http://127.0.0.1:4174",
+    reuseExistingServer: !process.env.CI,
+    stdout: "pipe",
+    stderr: "pipe",
+  },
+});
diff --git a/example/tailwind-nuxt/public/favicon.ico b/example/tailwind-nuxt/public/favicon.ico
new file mode 100644
index 0000000000000000000000000000000000000000..18993ad91cfd43e03b074dd0b5cc3f37ab38e49c
GIT binary patch
literal 4286
zcmeHLOKuuL5PjK%MHWVi6lD<!mRb4$mdFuu1m7S&L72}0%nh7nb{xS*IY7K-1~WG>
zOGiR<sv2rs-P1h`ut*jRDypfj@9U}_3E&NVhC}c-e)fS606r6u2w#X;ZXeov|87fL
z!TI})z`sQxSz?%$m}Cpw?WF=YNnu;Mk#t%h*=w(2a7>EbCw`xmFozJ^aNatJY>w+g
ze6a2@u~m#^BZm@8wco9#Crlli0uLb^3E$t2-WIc^#(?t)*@`UpuofJ(Uyh@F>b3Ph
z$D^m8Xq~pTkGJ4Q`Q2)te3mgkWYZ^Ijq|hkiP^9`De={bQQ%heZC$QU2UpP(-tbl8
zPWD2abEew;oat@w`uP3J^YpsgT%~jT(Dk%oU}sa$7|n6hBjDj`+I;RX(>)%<Y^V1u
zxpEJLVzZ2NFGX+1TXChn89VxczG?Ja<o=SJ8n{y5$ezyw`8sz3-<3{&C8oX)|94kh
z+0M_EV^O^m@tH21JEPN_ux%Gy1GUw?U~8Zr)3xvGXUSPO+3I<5aAh6uT<iYgm~_ug
ziEA0#JM$)SV%(oc@>lm_7N{+B7Mu%H?422lE%MBJH!!YTN2oT7xr>>N-8OF$C&qU^
z>vLsa{$0X%q1fjOe3P1mCv#lN{xQ4_*HCSAZjTb1`}mlc+9rl8$B3OP%VT@mch_~G
z7Y+4b{r>9e=M+7vSI;BgB?ryZDY4m>&w<W+!o=%S{hjU42>cHSn81VH1N~`0gvwH{
z8dv#hG|OK`>1;j7tM#B)Z7zDN?{6=dUal}$e<J#b(FPcAa6L9y8G}E@q!eIA^eYgE
GM1KL3x?{8e

literal 0
HcmV?d00001

diff --git a/example/tailwind-nuxt/public/robots.txt b/example/tailwind-nuxt/public/robots.txt
new file mode 100644
index 0000000..0ad279c
--- /dev/null
+++ b/example/tailwind-nuxt/public/robots.txt
@@ -0,0 +1,2 @@
+User-Agent: *
+Disallow:
diff --git a/example/tailwind-nuxt/tests/e2e.spec.ts b/example/tailwind-nuxt/tests/e2e.spec.ts
new file mode 100644
index 0000000..64bb4d9
--- /dev/null
+++ b/example/tailwind-nuxt/tests/e2e.spec.ts
@@ -0,0 +1,34 @@
+import { expect, test } from "@playwright/test";
+
+test("cssforge variables exist and are applied in the DOM", async ({ page }) => {
+  await page.goto("/");
+
+  const root = await page.evaluate(() => {
+    const css = getComputedStyle(document.documentElement);
+    return {
+      spacing: css.getPropertyValue("--spacing-size-4").trim(),
+      color: css.getPropertyValue("--palette-brand-primary").trim(),
+      type: css.getPropertyValue("--typography_fluid-base-text-m").trim(),
+    };
+  });
+
+  expect(root.spacing).not.toBe("");
+  expect(root.color).not.toBe("");
+  expect(root.type).not.toBe("");
+
+  const tokenCard = page.getByTestId("token-card");
+  await expect(tokenCard).toBeVisible();
+
+  const computed = await tokenCard.evaluate((el) => {
+    const css = getComputedStyle(el);
+    return {
+      paddingTop: css.paddingTop,
+      backgroundColor: css.backgroundColor,
+      fontSize: css.fontSize,
+    };
+  });
+
+  expect(parseFloat(computed.paddingTop)).toBeGreaterThan(0);
+  expect(computed.backgroundColor).not.toBe("rgba(0, 0, 0, 0)");
+  expect(parseFloat(computed.fontSize)).toBeGreaterThan(0);
+});
diff --git a/example/tailwind-nuxt/tsconfig.json b/example/tailwind-nuxt/tsconfig.json
new file mode 100644
index 0000000..307b213
--- /dev/null
+++ b/example/tailwind-nuxt/tsconfig.json
@@ -0,0 +1,18 @@
+{
+  // https://nuxt.com/docs/guide/concepts/typescript
+  "files": [],
+  "references": [
+    {
+      "path": "./.nuxt/tsconfig.app.json"
+    },
+    {
+      "path": "./.nuxt/tsconfig.server.json"
+    },
+    {
+      "path": "./.nuxt/tsconfig.shared.json"
+    },
+    {
+      "path": "./.nuxt/tsconfig.node.json"
+    }
+  ]
+}
diff --git a/example/tailwind-solidstart/.gitignore b/example/tailwind-solidstart/.gitignore
new file mode 100644
index 0000000..f8bc921
--- /dev/null
+++ b/example/tailwind-solidstart/.gitignore
@@ -0,0 +1,32 @@
+dist
+.wrangler
+.output
+.vercel
+.netlify
+.vinxi
+app.config.timestamp_*.js
+
+# Environment
+.env
+.env*.local
+
+# dependencies
+/node_modules
+
+# IDEs and editors
+/.idea
+.project
+.classpath
+*.launch
+.settings/
+
+# Temp
+gitignore
+
+# System Files
+.DS_Store
+Thumbs.db
+.cssforge
+playwright-report
+test-results
+.playwright
diff --git a/example/tailwind-solidstart/README.md b/example/tailwind-solidstart/README.md
new file mode 100644
index 0000000..8444d03
--- /dev/null
+++ b/example/tailwind-solidstart/README.md
@@ -0,0 +1,36 @@
+# Tailwind + SolidStart
+
+Node.js example that integrates CSS Forge tokens into a SolidStart app styled with
+Tailwind.
+
+## Scaffold Source
+
+```bash
+pnpm create solid@latest tailwind-solidstart -- --solidstart --ts --template with-tailwindcss
+```
+
+## Resolved Versions
+
+- `@solidjs/start@1.2.1`
+- `solid-js@1.9.11`
+- `tailwindcss@4.2.0`
+- `@playwright/test@1.58.2`
+
+## Run Locally
+
+```bash
+pnpm install
+pnpm exec playwright install chromium
+pnpm run cssforge:build-local
+pnpm run cssforge:generate
+pnpm run dev
+```
+
+## E2E Test
+
+```bash
+pnpm run test:e2e
+```
+
+The Playwright test validates CSS Forge variables on `:root` and computed styles on
+`[data-testid="token-card"]`.
diff --git a/example/tailwind-solidstart/app.config.ts b/example/tailwind-solidstart/app.config.ts
new file mode 100644
index 0000000..69f5668
--- /dev/null
+++ b/example/tailwind-solidstart/app.config.ts
@@ -0,0 +1,8 @@
+import { defineConfig } from "@solidjs/start/config";
+import tailwindcss from "@tailwindcss/vite";
+
+export default defineConfig({
+  vite: {
+    plugins: [tailwindcss()]
+  }
+});
diff --git a/example/tailwind-solidstart/cssforge.config.ts b/example/tailwind-solidstart/cssforge.config.ts
new file mode 100644
index 0000000..0b1e64f
--- /dev/null
+++ b/example/tailwind-solidstart/cssforge.config.ts
@@ -0,0 +1,46 @@
+import { defineConfig } from "/cssforge";
+
+export default defineConfig({
+  colors: {
+    palette: {
+      value: {
+        brand: {
+          value: {
+            primary: "#1d4ed8",
+            accent: "#f97316",
+            surface: "#0f172a",
+          },
+        },
+      },
+    },
+  },
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          1: "4px",
+          2: "8px",
+          3: "12px",
+          4: "16px",
+        },
+      },
+    },
+  },
+  typography: {
+    fluid: {
+      base: {
+        value: {
+          minWidth: 320,
+          minFontSize: 16,
+          minTypeScale: 1.2,
+          maxWidth: 1280,
+          maxFontSize: 18,
+          maxTypeScale: 1.25,
+          negativeSteps: 1,
+          positiveSteps: 2,
+          prefix: "text",
+        },
+      },
+    },
+  },
+});
diff --git a/example/tailwind-solidstart/moon.yml b/example/tailwind-solidstart/moon.yml
new file mode 100644
index 0000000..630af3e
--- /dev/null
+++ b/example/tailwind-solidstart/moon.yml
@@ -0,0 +1,73 @@
+$schema: "https://moonrepo.dev/schemas/project.json"
+
+language: "typescript"
+layer: "application"
+
+dependsOn:
+  - "cssforge"
+
+tasks:
+  build:
+    command: "vinxi"
+    args: ["build"]
+    deps:
+      - "^:build"
+  dev:
+    command: "vinxi"
+    args: ["dev"]
+    deps:
+      - "^:build"
+    preset: "server"
+    options:
+      runInCI: false
+  dev-e2e:
+    command: "vinxi"
+    args: ["dev", "--host", "127.0.0.1", "--port", "4175"]
+    deps:
+      - "^:build"
+    preset: "server"
+    options:
+      runInCI: false
+  start:
+    command: "vinxi"
+    args: ["start"]
+    deps:
+      - "~:build"
+    preset: "server"
+    options:
+      runInCI: false
+  cssforge-generate:
+    command: "tsx"
+    args:
+      - "../../packages/cssforge/src/cli.ts"
+      - "--prefix"
+      - "."
+      - "--config"
+      - "./cssforge.config.ts"
+      - "--mode"
+      - "css"
+      - "--css"
+      - "./.cssforge/output.css"
+    deps:
+      - "^:build"
+    options:
+      runInCI: false
+  e2e:
+    command: "playwright"
+    args: ["test"]
+    deps:
+      - "~:cssforge-generate"
+    options:
+      runInCI: false
+  e2e-headed:
+    command: "playwright"
+    args: ["test", "--headed"]
+    deps:
+      - "~:cssforge-generate"
+    options:
+      runInCI: false
+  cssforge-build-local:
+    command: "moon"
+    args: ["run", "cssforge:jsr-dry-run"]
+    options:
+      runInCI: false
diff --git a/example/tailwind-solidstart/package.json b/example/tailwind-solidstart/package.json
new file mode 100644
index 0000000..582b264
--- /dev/null
+++ b/example/tailwind-solidstart/package.json
@@ -0,0 +1,20 @@
+{
+  "name": "tailwind-solidstart",
+  "type": "module",
+  "dependencies": {
+    "@solidjs/router": "0.15.4",
+    "@solidjs/start": "1.2.1",
+    "solid-js": "1.9.11",
+    "vinxi": "0.5.11"
+  },
+  "devDependencies": {
+    "@playwright/test": "1.58.2",
+    "@tailwindcss/vite": "4.2.0",
+    "tailwindcss": "4.2.0",
+    "@hebilicious/cssforge": "workspace:*",
+    "tsx": "^4.20.6"
+  },
+  "engines": {
+    "node": ">=22"
+  }
+}
diff --git a/example/tailwind-solidstart/playwright.config.ts b/example/tailwind-solidstart/playwright.config.ts
new file mode 100644
index 0000000..996f152
--- /dev/null
+++ b/example/tailwind-solidstart/playwright.config.ts
@@ -0,0 +1,25 @@
+import { defineConfig, devices } from "@playwright/test";
+
+export default defineConfig({
+  testDir: "./tests",
+  timeout: 30_000,
+  fullyParallel: true,
+  use: {
+    baseURL: "http://127.0.0.1:4175",
+    trace: "on-first-retry",
+    screenshot: "only-on-failure",
+  },
+  projects: [
+    {
+      name: "chromium",
+      use: { ...devices["Desktop Chrome"] },
+    },
+  ],
+  webServer: {
+    command: "vinxi dev --host 127.0.0.1 --port 4175",
+    url: "http://127.0.0.1:4175",
+    reuseExistingServer: !process.env.CI,
+    stdout: "pipe",
+    stderr: "pipe",
+  },
+});
diff --git a/example/tailwind-solidstart/public/favicon.ico b/example/tailwind-solidstart/public/favicon.ico
new file mode 100644
index 0000000000000000000000000000000000000000..fb282da0719ef6ab4c1732df93be6216b0d85520
GIT binary patch
literal 664
zcmV;J0%!e+P)<h;3K|Lk000e1NJLTq000mG000mO1^@s6AM^iV0007CNkl<ZcmZva
z1MD746vfZEv;O1RR{U(+Hp9o@*|zI8Zll_5P@7S0+xDlK+xd_!f18u*-5n4o;oota
z&QC&lki=Eisk06%y`AY)mwo%-`9&Os;5hymz2PbnJwbF+#g7X7?9~;(a8>m9ebk1R
zejT~~6f_`?;`cEd!+`7(hw@%%2<H?PFWZo-Sro166z{jUiZKC>;?RN8gX-L?z6cM(
zKoG@&w+0}f@Pfvwc+deid)qgE!L$ENKYjViZC_Zcr>L(`2oXUT8f0mRQ(6-=HN_Ai
zeBBEz3WP+1Cw`m!49Wf!MnZzp5bH8VkR~BcJ1s-j90TAS2Yo4j!J|KodxYR%3Numw
zA?gq6e`5@!W~F$_De3yt&uspo&2yLb$(NwcPPI-4LGc!}HdY%jfq@AFs8LiZ4k(p}
zZ!c9o+qbW<CO?In-x+*5McxWRc_j$U9mWVvXb|{8<0X*+N!U^aUfU~W`|_B7ADWQg
z1CsBGu!B(U6z@n-|6Nc4sny{s&db79?3vEG+tDDn<-MWTkbFmsc%#0dfO4S>Ys-Mg
zgdyTALzJX&7QXHdI_DPTFL33;w}88{e6Zk)MX0kN{3DX9uz#O_L58&XRH$Nvvu;fO
zf&)7@?C~$z1K<>j0ga$$MIg+5xN;eQ?1-CA=`^Y169@Ab6!vcaNP=hxfKN%@Ly^R*
zK1iv*s1Yl6_dVyz8>ZqYhz6J4|3fQ@2LQeX@^%W(B~8>=MoEmBEGGD1;gHXlpX>!W
ym)!leA2L@`cpb^hy)P75=I!`pBYxP7<2VfQ3j76qLgzIA0000<MNUMnLSTaaEIPaZ

literal 0
HcmV?d00001

diff --git a/example/tailwind-solidstart/src/app.css b/example/tailwind-solidstart/src/app.css
new file mode 100644
index 0000000..22ceec5
--- /dev/null
+++ b/example/tailwind-solidstart/src/app.css
@@ -0,0 +1,7 @@
+@import "../.cssforge/output.css" layer(cssforge);
+@import "tailwindcss";
+
+body {
+  margin: 0;
+  font-family: Arial, Helvetica, sans-serif;
+}
diff --git a/example/tailwind-solidstart/src/app.tsx b/example/tailwind-solidstart/src/app.tsx
new file mode 100644
index 0000000..8be32ea
--- /dev/null
+++ b/example/tailwind-solidstart/src/app.tsx
@@ -0,0 +1,12 @@
+import { Router } from "@solidjs/router";
+import { FileRoutes } from "@solidjs/start/router";
+import { Suspense } from "solid-js";
+import "./app.css";
+
+export default function App() {
+  return (
+    <Router root={(props) => <Suspense>{props.children}</Suspense>}>
+      <FileRoutes />
+    </Router>
+  );
+}
diff --git a/example/tailwind-solidstart/src/components/Counter.tsx b/example/tailwind-solidstart/src/components/Counter.tsx
new file mode 100644
index 0000000..c4c9912
--- /dev/null
+++ b/example/tailwind-solidstart/src/components/Counter.tsx
@@ -0,0 +1,13 @@
+import { createSignal } from "solid-js";
+
+export default function Counter() {
+  const [count, setCount] = createSignal(0);
+  return (
+    <button
+      class="w-[200px] rounded-full bg-gray-100 border-2 border-gray-300 focus:border-gray-400 active:border-gray-400 px-[2rem] py-[1rem]" 
+      onClick={() => setCount(count() + 1)}
+    >
+      Clicks: {count()}
+    </button>
+  );
+}
diff --git a/example/tailwind-solidstart/src/components/Nav.tsx b/example/tailwind-solidstart/src/components/Nav.tsx
new file mode 100644
index 0000000..5bd0a78
--- /dev/null
+++ b/example/tailwind-solidstart/src/components/Nav.tsx
@@ -0,0 +1,19 @@
+import { useLocation } from "@solidjs/router";
+
+export default function Nav() {
+  const location = useLocation();
+  const active = (path: string) =>
+    path == location.pathname ? "border-sky-600" : "border-transparent hover:border-sky-600";
+  return (
+    <nav class="bg-sky-800">
+      <ul class="container flex items-center p-3 text-gray-200">
+        <li class={`border-b-2 ${active("/")} mx-1.5 sm:mx-6`}>
+          <a href="/">Home</a>
+        </li>
+        <li class={`border-b-2 ${active("/about")} mx-1.5 sm:mx-6`}>
+          <a href="/about">About</a>
+        </li>
+      </ul>
+    </nav>
+  );
+}
diff --git a/example/tailwind-solidstart/src/entry-client.tsx b/example/tailwind-solidstart/src/entry-client.tsx
new file mode 100644
index 0000000..0ca4e3c
--- /dev/null
+++ b/example/tailwind-solidstart/src/entry-client.tsx
@@ -0,0 +1,4 @@
+// @refresh reload
+import { mount, StartClient } from "@solidjs/start/client";
+
+mount(() => <StartClient />, document.getElementById("app")!);
diff --git a/example/tailwind-solidstart/src/entry-server.tsx b/example/tailwind-solidstart/src/entry-server.tsx
new file mode 100644
index 0000000..401eff8
--- /dev/null
+++ b/example/tailwind-solidstart/src/entry-server.tsx
@@ -0,0 +1,21 @@
+// @refresh reload
+import { createHandler, StartServer } from "@solidjs/start/server";
+
+export default createHandler(() => (
+  <StartServer
+    document={({ assets, children, scripts }) => (
+      <html lang="en">
+        <head>
+          <meta charset="utf-8" />
+          <meta name="viewport" content="width=device-width, initial-scale=1" />
+          <link rel="icon" href="/favicon.ico" />
+          {assets}
+        </head>
+        <body>
+          <div id="app">{children}</div>
+          {scripts}
+        </body>
+      </html>
+    )}
+  />
+));
diff --git a/example/tailwind-solidstart/src/global.d.ts b/example/tailwind-solidstart/src/global.d.ts
new file mode 100644
index 0000000..dc6f10c
--- /dev/null
+++ b/example/tailwind-solidstart/src/global.d.ts
@@ -0,0 +1 @@
+/// <reference types="@solidjs/start/env" />
diff --git a/example/tailwind-solidstart/src/routes/[...404].tsx b/example/tailwind-solidstart/src/routes/[...404].tsx
new file mode 100644
index 0000000..03e9484
--- /dev/null
+++ b/example/tailwind-solidstart/src/routes/[...404].tsx
@@ -0,0 +1,25 @@
+import { A } from "@solidjs/router";
+
+export default function NotFound() {
+  return (
+    <main class="text-center mx-auto text-gray-700 p-4">
+      <h1 class="max-6-xs text-6xl text-sky-700 font-thin uppercase my-16">Not Found</h1>
+      <p class="mt-8">
+        Visit{" "}
+        <a href="https://solidjs.com" target="_blank" class="text-sky-600 hover:underline">
+          solidjs.com
+        </a>{" "}
+        to learn how to build Solid apps.
+      </p>
+      <p class="my-4">
+        <A href="/" class="text-sky-600 hover:underline">
+          Home
+        </A>
+        {" - "}
+        <A href="/about" class="text-sky-600 hover:underline">
+          About Page
+        </A>
+      </p>
+    </main>
+  );
+}
diff --git a/example/tailwind-solidstart/src/routes/about.tsx b/example/tailwind-solidstart/src/routes/about.tsx
new file mode 100644
index 0000000..1321ac3
--- /dev/null
+++ b/example/tailwind-solidstart/src/routes/about.tsx
@@ -0,0 +1,25 @@
+import { A } from "@solidjs/router";
+import Counter from "~/components/Counter";
+
+export default function About() {
+  return (
+    <main class="text-center mx-auto text-gray-700 p-4">
+      <h1 class="max-6-xs text-6xl text-sky-700 font-thin uppercase my-16">About Page</h1>
+      <Counter />
+      <p class="mt-8">
+        Visit{" "}
+        <a href="https://solidjs.com" target="_blank" class="text-sky-600 hover:underline">
+          solidjs.com
+        </a>{" "}
+        to learn how to build Solid apps.
+      </p>
+      <p class="my-4">
+        <A href="/" class="text-sky-600 hover:underline">
+          Home
+        </A>
+        {" - "}
+        <span>About Page</span>
+      </p>
+    </main>
+  );
+}
diff --git a/example/tailwind-solidstart/src/routes/index.tsx b/example/tailwind-solidstart/src/routes/index.tsx
new file mode 100644
index 0000000..8032bbe
--- /dev/null
+++ b/example/tailwind-solidstart/src/routes/index.tsx
@@ -0,0 +1,18 @@
+export default function Home() {
+  return (
+    <main class="min-h-screen bg-[var(--palette-brand-surface)] p-[var(--spacing-size-4)] text-white">
+      <section
+        data-testid="token-card"
+        class="mx-auto max-w-xl rounded-[var(--spacing-size-2)] bg-[var(--palette-brand-primary)] p-[var(--spacing-size-4)] text-[var(--typography_fluid-base-text-m)] shadow-lg"
+      >
+        <h1 class="mb-[var(--spacing-size-2)] text-[var(--typography_fluid-base-text-l)] font-semibold">
+          CSS Forge + SolidStart + Tailwind
+        </h1>
+        <p>
+          Tokens are generated from <code>cssforge.config.ts</code> and consumed as CSS
+          variables.
+        </p>
+      </section>
+    </main>
+  );
+}
diff --git a/example/tailwind-solidstart/tests/e2e.spec.ts b/example/tailwind-solidstart/tests/e2e.spec.ts
new file mode 100644
index 0000000..64bb4d9
--- /dev/null
+++ b/example/tailwind-solidstart/tests/e2e.spec.ts
@@ -0,0 +1,34 @@
+import { expect, test } from "@playwright/test";
+
+test("cssforge variables exist and are applied in the DOM", async ({ page }) => {
+  await page.goto("/");
+
+  const root = await page.evaluate(() => {
+    const css = getComputedStyle(document.documentElement);
+    return {
+      spacing: css.getPropertyValue("--spacing-size-4").trim(),
+      color: css.getPropertyValue("--palette-brand-primary").trim(),
+      type: css.getPropertyValue("--typography_fluid-base-text-m").trim(),
+    };
+  });
+
+  expect(root.spacing).not.toBe("");
+  expect(root.color).not.toBe("");
+  expect(root.type).not.toBe("");
+
+  const tokenCard = page.getByTestId("token-card");
+  await expect(tokenCard).toBeVisible();
+
+  const computed = await tokenCard.evaluate((el) => {
+    const css = getComputedStyle(el);
+    return {
+      paddingTop: css.paddingTop,
+      backgroundColor: css.backgroundColor,
+      fontSize: css.fontSize,
+    };
+  });
+
+  expect(parseFloat(computed.paddingTop)).toBeGreaterThan(0);
+  expect(computed.backgroundColor).not.toBe("rgba(0, 0, 0, 0)");
+  expect(parseFloat(computed.fontSize)).toBeGreaterThan(0);
+});
diff --git a/example/tailwind-solidstart/tsconfig.json b/example/tailwind-solidstart/tsconfig.json
new file mode 100644
index 0000000..3ad477f
--- /dev/null
+++ b/example/tailwind-solidstart/tsconfig.json
@@ -0,0 +1,19 @@
+{
+  "compilerOptions": {
+    "target": "ESNext",
+    "module": "ESNext",
+    "moduleResolution": "bundler",
+    "allowSyntheticDefaultImports": true,
+    "esModuleInterop": true,
+    "jsx": "preserve",
+    "jsxImportSource": "solid-js",
+    "allowJs": true,
+    "noEmit": true,
+    "strict": true,
+    "types": ["vinxi/types/client"],
+    "isolatedModules": true,
+    "paths": {
+      "~/*": ["./src/*"]
+    }
+  }
+}
diff --git a/example/tailwind-sveltekit/.gitignore b/example/tailwind-sveltekit/.gitignore
new file mode 100644
index 0000000..8f14965
--- /dev/null
+++ b/example/tailwind-sveltekit/.gitignore
@@ -0,0 +1,27 @@
+node_modules
+
+# Output
+.output
+.vercel
+.netlify
+.wrangler
+/.svelte-kit
+/build
+
+# OS
+.DS_Store
+Thumbs.db
+
+# Env
+.env
+.env.*
+!.env.example
+!.env.test
+
+# Vite
+vite.config.js.timestamp-*
+vite.config.ts.timestamp-*
+.cssforge
+playwright-report
+test-results
+.playwright
diff --git a/example/tailwind-sveltekit/.npmrc b/example/tailwind-sveltekit/.npmrc
new file mode 100644
index 0000000..c0c80ba
--- /dev/null
+++ b/example/tailwind-sveltekit/.npmrc
@@ -0,0 +1 @@
+engine-strict=false
diff --git a/example/tailwind-sveltekit/README.md b/example/tailwind-sveltekit/README.md
new file mode 100644
index 0000000..8a473c9
--- /dev/null
+++ b/example/tailwind-sveltekit/README.md
@@ -0,0 +1,36 @@
+# Tailwind + SvelteKit
+
+Node.js example that integrates CSS Forge tokens into a SvelteKit app styled with
+Tailwind.
+
+## Scaffold Source
+
+```bash
+pnpm dlx sv@latest create tailwind-sveltekit --template minimal --types ts --no-add-ons --no-install --no-dir-check --no-download-check
+```
+
+## Resolved Versions
+
+- `@sveltejs/kit@2.52.2`
+- `svelte@5.53.0`
+- `tailwindcss@4.2.0`
+- `@playwright/test@1.58.2`
+
+## Run Locally
+
+```bash
+pnpm install
+pnpm exec playwright install chromium
+pnpm run cssforge:build-local
+pnpm run cssforge:generate
+pnpm run dev
+```
+
+## E2E Test
+
+```bash
+pnpm run test:e2e
+```
+
+The Playwright test validates CSS Forge variables on `:root` and computed styles on
+`[data-testid="token-card"]`.
diff --git a/example/tailwind-sveltekit/cssforge.config.ts b/example/tailwind-sveltekit/cssforge.config.ts
new file mode 100644
index 0000000..0b1e64f
--- /dev/null
+++ b/example/tailwind-sveltekit/cssforge.config.ts
@@ -0,0 +1,46 @@
+import { defineConfig } from "/cssforge";
+
+export default defineConfig({
+  colors: {
+    palette: {
+      value: {
+        brand: {
+          value: {
+            primary: "#1d4ed8",
+            accent: "#f97316",
+            surface: "#0f172a",
+          },
+        },
+      },
+    },
+  },
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          1: "4px",
+          2: "8px",
+          3: "12px",
+          4: "16px",
+        },
+      },
+    },
+  },
+  typography: {
+    fluid: {
+      base: {
+        value: {
+          minWidth: 320,
+          minFontSize: 16,
+          minTypeScale: 1.2,
+          maxWidth: 1280,
+          maxFontSize: 18,
+          maxTypeScale: 1.25,
+          negativeSteps: 1,
+          positiveSteps: 2,
+          prefix: "text",
+        },
+      },
+    },
+  },
+});
diff --git a/example/tailwind-sveltekit/moon.yml b/example/tailwind-sveltekit/moon.yml
new file mode 100644
index 0000000..4816d05
--- /dev/null
+++ b/example/tailwind-sveltekit/moon.yml
@@ -0,0 +1,96 @@
+$schema: "https://moonrepo.dev/schemas/project.json"
+
+language: "typescript"
+layer: "application"
+
+dependsOn:
+  - "cssforge"
+
+tasks:
+  prepare:
+    script: "svelte-kit sync || echo ''"
+  build:
+    command: "vite"
+    args: ["build"]
+    deps:
+      - "^:build"
+      - "~:prepare"
+  dev:
+    command: "vite"
+    args: ["dev"]
+    deps:
+      - "^:build"
+      - "~:prepare"
+    preset: "server"
+    options:
+      runInCI: false
+  dev-e2e:
+    command: "vite"
+    args: ["dev", "--host", "127.0.0.1", "--port", "4176"]
+    deps:
+      - "^:build"
+      - "~:prepare"
+    preset: "server"
+    options:
+      runInCI: false
+  preview:
+    command: "vite"
+    args: ["preview"]
+    deps:
+      - "~:build"
+      - "~:prepare"
+    preset: "server"
+    options:
+      runInCI: false
+  check:
+    script: "svelte-kit sync && svelte-check --tsconfig ./tsconfig.json"
+    deps:
+      - "~:prepare"
+    options:
+      runInCI: false
+  check-watch:
+    script: "svelte-kit sync && svelte-check --tsconfig ./tsconfig.json --watch"
+    deps:
+      - "~:prepare"
+    options:
+      runInCI: false
+      persistent: true
+      cache: false
+      outputStyle: "stream"
+  cssforge-generate:
+    command: "tsx"
+    args:
+      - "../../packages/cssforge/src/cli.ts"
+      - "--prefix"
+      - "."
+      - "--config"
+      - "./cssforge.config.ts"
+      - "--mode"
+      - "css"
+      - "--css"
+      - "./.cssforge/output.css"
+    deps:
+      - "^:build"
+    options:
+      runInCI: false
+  e2e:
+    command: "playwright"
+    args: ["test"]
+    deps:
+      - "~:cssforge-generate"
+      - "~:prepare"
+    options:
+      runInCI: false
+  e2e-headed:
+    command: "playwright"
+    args: ["test", "--headed"]
+    deps:
+      - "~:cssforge-generate"
+      - "~:prepare"
+    options:
+      runInCI: false
+  cssforge-build-local:
+    command: "moon"
+    args: ["run", "cssforge:jsr-dry-run"]
+    options:
+      runInCI: false
diff --git a/example/tailwind-sveltekit/package.json b/example/tailwind-sveltekit/package.json
new file mode 100644
index 0000000..f485161
--- /dev/null
+++ b/example/tailwind-sveltekit/package.json
@@ -0,0 +1,20 @@
+{
+  "name": "tailwind-sveltekit",
+  "private": true,
+  "version": "0.0.1",
+  "type": "module",
+  "devDependencies": {
+    "@playwright/test": "1.58.2",
+    "@sveltejs/adapter-auto": "7.0.1",
+    "@sveltejs/kit": "2.52.2",
+    "@sveltejs/vite-plugin-svelte": "6.2.4",
+    "@tailwindcss/vite": "4.2.0",
+    "svelte": "5.53.0",
+    "svelte-check": "4.3.6",
+    "tailwindcss": "4.2.0",
+    "typescript": "5.9.3",
+    "vite": "7.3.1",
+    "@hebilicious/cssforge": "workspace:*",
+    "tsx": "^4.20.6"
+  }
+}
diff --git a/example/tailwind-sveltekit/playwright.config.ts b/example/tailwind-sveltekit/playwright.config.ts
new file mode 100644
index 0000000..ee2a55b
--- /dev/null
+++ b/example/tailwind-sveltekit/playwright.config.ts
@@ -0,0 +1,25 @@
+import { defineConfig, devices } from "@playwright/test";
+
+export default defineConfig({
+  testDir: "./tests",
+  timeout: 30_000,
+  fullyParallel: true,
+  use: {
+    baseURL: "http://127.0.0.1:4176",
+    trace: "on-first-retry",
+    screenshot: "only-on-failure",
+  },
+  projects: [
+    {
+      name: "chromium",
+      use: { ...devices["Desktop Chrome"] },
+    },
+  ],
+  webServer: {
+    command: "vite dev --host 127.0.0.1 --port 4176",
+    url: "http://127.0.0.1:4176",
+    reuseExistingServer: !process.env.CI,
+    stdout: "pipe",
+    stderr: "pipe",
+  },
+});
diff --git a/example/tailwind-sveltekit/src/app.css b/example/tailwind-sveltekit/src/app.css
new file mode 100644
index 0000000..22ceec5
--- /dev/null
+++ b/example/tailwind-sveltekit/src/app.css
@@ -0,0 +1,7 @@
+@import "../.cssforge/output.css" layer(cssforge);
+@import "tailwindcss";
+
+body {
+  margin: 0;
+  font-family: Arial, Helvetica, sans-serif;
+}
diff --git a/example/tailwind-sveltekit/src/app.d.ts b/example/tailwind-sveltekit/src/app.d.ts
new file mode 100644
index 0000000..da08e6d
--- /dev/null
+++ b/example/tailwind-sveltekit/src/app.d.ts
@@ -0,0 +1,13 @@
+// See https://svelte.dev/docs/kit/types#app.d.ts
+// for information about these interfaces
+declare global {
+	namespace App {
+		// interface Error {}
+		// interface Locals {}
+		// interface PageData {}
+		// interface PageState {}
+		// interface Platform {}
+	}
+}
+
+export {};
diff --git a/example/tailwind-sveltekit/src/app.html b/example/tailwind-sveltekit/src/app.html
new file mode 100644
index 0000000..f273cc5
--- /dev/null
+++ b/example/tailwind-sveltekit/src/app.html
@@ -0,0 +1,11 @@
+<!doctype html>
+<html lang="en">
+	<head>
+		<meta charset="utf-8" />
+		<meta name="viewport" content="width=device-width, initial-scale=1" />
+		%sveltekit.head%
+	</head>
+	<body data-sveltekit-preload-data="hover">
+		<div style="display: contents">%sveltekit.body%</div>
+	</body>
+</html>
diff --git a/example/tailwind-sveltekit/src/lib/assets/favicon.svg b/example/tailwind-sveltekit/src/lib/assets/favicon.svg
new file mode 100644
index 0000000..cc5dc66
--- /dev/null
+++ b/example/tailwind-sveltekit/src/lib/assets/favicon.svg
@@ -0,0 +1 @@
+<svg xmlns="http://www.w3.org/2000/svg" width="107" height="128" viewBox="0 0 107 128"><title>svelte-logo</title><path d="M94.157 22.819c-10.4-14.885-30.94-19.297-45.792-9.835L22.282 29.608A29.92 29.92 0 0 0 8.764 49.65a31.5 31.5 0 0 0 3.108 20.231 30 30 0 0 0-4.477 11.183 31.9 31.9 0 0 0 5.448 24.116c10.402 14.887 30.942 19.297 45.791 9.835l26.083-16.624A29.92 29.92 0 0 0 98.235 78.35a31.53 31.53 0 0 0-3.105-20.232 30 30 0 0 0 4.474-11.182 31.88 31.88 0 0 0-5.447-24.116" style="fill:#ff3e00"/><path d="M45.817 106.582a20.72 20.72 0 0 1-22.237-8.243 19.17 19.17 0 0 1-3.277-14.503 18 18 0 0 1 .624-2.435l.49-1.498 1.337.981a33.6 33.6 0 0 0 10.203 5.098l.97.294-.09.968a5.85 5.85 0 0 0 1.052 3.878 6.24 6.24 0 0 0 6.695 2.485 5.8 5.8 0 0 0 1.603-.704L69.27 76.28a5.43 5.43 0 0 0 2.45-3.631 5.8 5.8 0 0 0-.987-4.371 6.24 6.24 0 0 0-6.698-2.487 5.7 5.7 0 0 0-1.6.704l-9.953 6.345a19 19 0 0 1-5.296 2.326 20.72 20.72 0 0 1-22.237-8.243 19.17 19.17 0 0 1-3.277-14.502 17.99 17.99 0 0 1 8.13-12.052l26.081-16.623a19 19 0 0 1 5.3-2.329 20.72 20.72 0 0 1 22.237 8.243 19.17 19.17 0 0 1 3.277 14.503 18 18 0 0 1-.624 2.435l-.49 1.498-1.337-.98a33.6 33.6 0 0 0-10.203-5.1l-.97-.294.09-.968a5.86 5.86 0 0 0-1.052-3.878 6.24 6.24 0 0 0-6.696-2.485 5.8 5.8 0 0 0-1.602.704L37.73 51.72a5.42 5.42 0 0 0-2.449 3.63 5.79 5.79 0 0 0 .986 4.372 6.24 6.24 0 0 0 6.698 2.486 5.8 5.8 0 0 0 1.602-.704l9.952-6.342a19 19 0 0 1 5.295-2.328 20.72 20.72 0 0 1 22.237 8.242 19.17 19.17 0 0 1 3.277 14.503 18 18 0 0 1-8.13 12.053l-26.081 16.622a19 19 0 0 1-5.3 2.328" style="fill:#fff"/></svg>
\ No newline at end of file
diff --git a/example/tailwind-sveltekit/src/lib/index.ts b/example/tailwind-sveltekit/src/lib/index.ts
new file mode 100644
index 0000000..856f2b6
--- /dev/null
+++ b/example/tailwind-sveltekit/src/lib/index.ts
@@ -0,0 +1 @@
+// place files you want to import through the `$lib` alias in this folder.
diff --git a/example/tailwind-sveltekit/src/routes/+layout.svelte b/example/tailwind-sveltekit/src/routes/+layout.svelte
new file mode 100644
index 0000000..801be90
--- /dev/null
+++ b/example/tailwind-sveltekit/src/routes/+layout.svelte
@@ -0,0 +1,7 @@
+<script lang="ts">
+  import "../app.css";
+
+  let { children } = $props();
+</script>
+
+{@render children()}
diff --git a/example/tailwind-sveltekit/src/routes/+page.svelte b/example/tailwind-sveltekit/src/routes/+page.svelte
new file mode 100644
index 0000000..1ef0490
--- /dev/null
+++ b/example/tailwind-sveltekit/src/routes/+page.svelte
@@ -0,0 +1,14 @@
+<main class="min-h-screen bg-[var(--palette-brand-surface)] p-[var(--spacing-size-4)] text-white">
+  <section
+    data-testid="token-card"
+    class="mx-auto max-w-xl rounded-[var(--spacing-size-2)] bg-[var(--palette-brand-primary)] p-[var(--spacing-size-4)] text-[var(--typography_fluid-base-text-m)] shadow-lg"
+  >
+    <h1 class="mb-[var(--spacing-size-2)] text-[var(--typography_fluid-base-text-l)] font-semibold">
+      CSS Forge + SvelteKit + Tailwind
+    </h1>
+    <p>
+      Tokens are generated from <code>cssforge.config.ts</code> and consumed as CSS
+      variables.
+    </p>
+  </section>
+</main>
diff --git a/example/tailwind-sveltekit/static/robots.txt b/example/tailwind-sveltekit/static/robots.txt
new file mode 100644
index 0000000..b6dd667
--- /dev/null
+++ b/example/tailwind-sveltekit/static/robots.txt
@@ -0,0 +1,3 @@
+# allow crawling everything by default
+User-agent: *
+Disallow:
diff --git a/example/tailwind-sveltekit/svelte.config.js b/example/tailwind-sveltekit/svelte.config.js
new file mode 100644
index 0000000..10c4eeb
--- /dev/null
+++ b/example/tailwind-sveltekit/svelte.config.js
@@ -0,0 +1,13 @@
+import adapter from '@sveltejs/adapter-auto';
+
+/** @type {import('@sveltejs/kit').Config} */
+const config = {
+	kit: {
+		// adapter-auto only supports some environments, see https://svelte.dev/docs/kit/adapter-auto for a list.
+		// If your environment is not supported, or you settled on a specific environment, switch out the adapter.
+		// See https://svelte.dev/docs/kit/adapters for more information about adapters.
+		adapter: adapter()
+	}
+};
+
+export default config;
diff --git a/example/tailwind-sveltekit/tests/e2e.spec.ts b/example/tailwind-sveltekit/tests/e2e.spec.ts
new file mode 100644
index 0000000..64bb4d9
--- /dev/null
+++ b/example/tailwind-sveltekit/tests/e2e.spec.ts
@@ -0,0 +1,34 @@
+import { expect, test } from "@playwright/test";
+
+test("cssforge variables exist and are applied in the DOM", async ({ page }) => {
+  await page.goto("/");
+
+  const root = await page.evaluate(() => {
+    const css = getComputedStyle(document.documentElement);
+    return {
+      spacing: css.getPropertyValue("--spacing-size-4").trim(),
+      color: css.getPropertyValue("--palette-brand-primary").trim(),
+      type: css.getPropertyValue("--typography_fluid-base-text-m").trim(),
+    };
+  });
+
+  expect(root.spacing).not.toBe("");
+  expect(root.color).not.toBe("");
+  expect(root.type).not.toBe("");
+
+  const tokenCard = page.getByTestId("token-card");
+  await expect(tokenCard).toBeVisible();
+
+  const computed = await tokenCard.evaluate((el) => {
+    const css = getComputedStyle(el);
+    return {
+      paddingTop: css.paddingTop,
+      backgroundColor: css.backgroundColor,
+      fontSize: css.fontSize,
+    };
+  });
+
+  expect(parseFloat(computed.paddingTop)).toBeGreaterThan(0);
+  expect(computed.backgroundColor).not.toBe("rgba(0, 0, 0, 0)");
+  expect(parseFloat(computed.fontSize)).toBeGreaterThan(0);
+});
diff --git a/example/tailwind-sveltekit/tsconfig.json b/example/tailwind-sveltekit/tsconfig.json
new file mode 100644
index 0000000..2c2ed3c
--- /dev/null
+++ b/example/tailwind-sveltekit/tsconfig.json
@@ -0,0 +1,20 @@
+{
+	"extends": "./.svelte-kit/tsconfig.json",
+	"compilerOptions": {
+		"rewriteRelativeImportExtensions": true,
+		"allowJs": true,
+		"checkJs": true,
+		"esModuleInterop": true,
+		"forceConsistentCasingInFileNames": true,
+		"resolveJsonModule": true,
+		"skipLibCheck": true,
+		"sourceMap": true,
+		"strict": true,
+		"moduleResolution": "bundler"
+	}
+	// Path aliases are handled by https://svelte.dev/docs/kit/configuration#alias
+	// except $lib which is handled by https://svelte.dev/docs/kit/configuration#files
+	//
+	// To make changes to top-level options such as include and exclude, we recommend extending
+	// the generated config; see https://svelte.dev/docs/kit/configuration#typescript
+}
diff --git a/example/tailwind-sveltekit/vite.config.ts b/example/tailwind-sveltekit/vite.config.ts
new file mode 100644
index 0000000..8668317
--- /dev/null
+++ b/example/tailwind-sveltekit/vite.config.ts
@@ -0,0 +1,7 @@
+import tailwindcss from "@tailwindcss/vite";
+import { sveltekit } from "@sveltejs/kit/vite";
+import { defineConfig } from "vite";
+
+export default defineConfig({
+  plugins: [tailwindcss(), sveltekit()],
+});
diff --git a/example/vanilla-react-css/.gitignore b/example/vanilla-react-css/.gitignore
new file mode 100644
index 0000000..9f96471
--- /dev/null
+++ b/example/vanilla-react-css/.gitignore
@@ -0,0 +1,28 @@
+# Logs
+logs
+*.log
+npm-debug.log*
+yarn-debug.log*
+yarn-error.log*
+pnpm-debug.log*
+lerna-debug.log*
+
+node_modules
+dist
+dist-ssr
+*.local
+
+# Editor directories and files
+.vscode/*
+!.vscode/extensions.json
+.idea
+.DS_Store
+*.suo
+*.ntvs*
+*.njsproj
+*.sln
+*.sw?
+.cssforge
+playwright-report
+test-results
+.playwright
diff --git a/example/vanilla-react-css/README.md b/example/vanilla-react-css/README.md
new file mode 100644
index 0000000..6c1b7db
--- /dev/null
+++ b/example/vanilla-react-css/README.md
@@ -0,0 +1,34 @@
+# React + Vanilla CSS (Vite)
+
+Node.js example that integrates CSS Forge tokens into a React app using vanilla CSS.
+
+## Scaffold Source
+
+```bash
+pnpm create vite@latest vanilla-react-css -- --template react-ts --no-interactive
+```
+
+## Resolved Versions
+
+- `react@19.2.4`
+- `vite@7.3.1`
+- `@playwright/test@1.58.2`
+
+## Run Locally
+
+```bash
+pnpm install
+pnpm exec playwright install chromium
+pnpm run cssforge:build-local
+pnpm run cssforge:generate
+pnpm run dev
+```
+
+## E2E Test
+
+```bash
+pnpm run test:e2e
+```
+
+The Playwright test validates CSS Forge variables on `:root` and computed styles on
+`[data-testid="token-card"]`.
diff --git a/example/vanilla-react-css/cssforge.config.ts b/example/vanilla-react-css/cssforge.config.ts
new file mode 100644
index 0000000..0b1e64f
--- /dev/null
+++ b/example/vanilla-react-css/cssforge.config.ts
@@ -0,0 +1,46 @@
+import { defineConfig } from "/cssforge";
+
+export default defineConfig({
+  colors: {
+    palette: {
+      value: {
+        brand: {
+          value: {
+            primary: "#1d4ed8",
+            accent: "#f97316",
+            surface: "#0f172a",
+          },
+        },
+      },
+    },
+  },
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          1: "4px",
+          2: "8px",
+          3: "12px",
+          4: "16px",
+        },
+      },
+    },
+  },
+  typography: {
+    fluid: {
+      base: {
+        value: {
+          minWidth: 320,
+          minFontSize: 16,
+          minTypeScale: 1.2,
+          maxWidth: 1280,
+          maxFontSize: 18,
+          maxTypeScale: 1.25,
+          negativeSteps: 1,
+          positiveSteps: 2,
+          prefix: "text",
+        },
+      },
+    },
+  },
+});
diff --git a/example/vanilla-react-css/eslint.config.js b/example/vanilla-react-css/eslint.config.js
new file mode 100644
index 0000000..5e6b472
--- /dev/null
+++ b/example/vanilla-react-css/eslint.config.js
@@ -0,0 +1,23 @@
+import js from '@eslint/js'
+import globals from 'globals'
+import reactHooks from 'eslint-plugin-react-hooks'
+import reactRefresh from 'eslint-plugin-react-refresh'
+import tseslint from 'typescript-eslint'
+import { defineConfig, globalIgnores } from 'eslint/config'
+
+export default defineConfig([
+  globalIgnores(['dist']),
+  {
+    files: ['**/*.{ts,tsx}'],
+    extends: [
+      js.configs.recommended,
+      tseslint.configs.recommended,
+      reactHooks.configs.flat.recommended,
+      reactRefresh.configs.vite,
+    ],
+    languageOptions: {
+      ecmaVersion: 2020,
+      globals: globals.browser,
+    },
+  },
+])
diff --git a/example/vanilla-react-css/index.html b/example/vanilla-react-css/index.html
new file mode 100644
index 0000000..9cb49e1
--- /dev/null
+++ b/example/vanilla-react-css/index.html
@@ -0,0 +1,13 @@
+<!doctype html>
+<html lang="en">
+  <head>
+    <meta charset="UTF-8" />
+    <link rel="icon" type="image/svg+xml" href="/vite.svg" />
+    <meta name="viewport" content="width=device-width, initial-scale=1.0" />
+    <title>vanilla-react-css</title>
+  </head>
+  <body>
+    <div id="root"></div>
+    <script type="module" src="/src/main.tsx"></script>
+  </body>
+</html>
diff --git a/example/vanilla-react-css/moon.yml b/example/vanilla-react-css/moon.yml
new file mode 100644
index 0000000..31dd7ed
--- /dev/null
+++ b/example/vanilla-react-css/moon.yml
@@ -0,0 +1,76 @@
+$schema: "https://moonrepo.dev/schemas/project.json"
+
+language: "typescript"
+layer: "application"
+
+dependsOn:
+  - "cssforge"
+
+tasks:
+  build:
+    script: "tsc -b && vite build"
+    deps:
+      - "^:build"
+  dev:
+    command: "vite"
+    deps:
+      - "^:build"
+    preset: "server"
+    options:
+      runInCI: false
+  dev-e2e:
+    command: "vite"
+    args: ["--host", "127.0.0.1", "--port", "4177"]
+    deps:
+      - "^:build"
+    preset: "server"
+    options:
+      runInCI: false
+  lint:
+    command: "eslint"
+    args: ["."]
+    options:
+      runInCI: false
+  preview:
+    command: "vite"
+    args: ["preview"]
+    deps:
+      - "~:build"
+    preset: "server"
+    options:
+      runInCI: false
+  cssforge-generate:
+    command: "tsx"
+    args:
+      - "../../packages/cssforge/src/cli.ts"
+      - "--prefix"
+      - "."
+      - "--config"
+      - "./cssforge.config.ts"
+      - "--mode"
+      - "css"
+      - "--css"
+      - "./.cssforge/output.css"
+    deps:
+      - "^:build"
+    options:
+      runInCI: false
+  e2e:
+    command: "playwright"
+    args: ["test"]
+    deps:
+      - "~:cssforge-generate"
+    options:
+      runInCI: false
+  e2e-headed:
+    command: "playwright"
+    args: ["test", "--headed"]
+    deps:
+      - "~:cssforge-generate"
+    options:
+      runInCI: false
+  cssforge-build-local:
+    command: "moon"
+    args: ["run", "cssforge:jsr-dry-run"]
+    options:
+      runInCI: false
diff --git a/example/vanilla-react-css/package.json b/example/vanilla-react-css/package.json
new file mode 100644
index 0000000..2c0b233
--- /dev/null
+++ b/example/vanilla-react-css/package.json
@@ -0,0 +1,27 @@
+{
+  "name": "vanilla-react-css",
+  "private": true,
+  "version": "0.0.0",
+  "type": "module",
+  "dependencies": {
+    "react": "19.2.4",
+    "react-dom": "19.2.4"
+  },
+  "devDependencies": {
+    "@eslint/js": "^9.39.1",
+    "@hebilicious/cssforge": "workspace:*",
+    "@playwright/test": "1.58.2",
+    "@types/node": "^24.10.1",
+    "@types/react": "^19.2.7",
+    "@types/react-dom": "^19.2.3",
+    "@vitejs/plugin-react": "5.1.4",
+    "eslint": "^9.39.1",
+    "eslint-plugin-react-hooks": "^7.0.1",
+    "eslint-plugin-react-refresh": "^0.4.24",
+    "globals": "^16.5.0",
+    "tsx": "^4.20.6",
+    "typescript": "~5.9.3",
+    "typescript-eslint": "^8.48.0",
+    "vite": "7.3.1"
+  }
+}
diff --git a/example/vanilla-react-css/playwright.config.ts b/example/vanilla-react-css/playwright.config.ts
new file mode 100644
index 0000000..6c80c18
--- /dev/null
+++ b/example/vanilla-react-css/playwright.config.ts
@@ -0,0 +1,25 @@
+import { defineConfig, devices } from "@playwright/test";
+
+export default defineConfig({
+  testDir: "./tests",
+  timeout: 30_000,
+  fullyParallel: true,
+  use: {
+    baseURL: "http://127.0.0.1:4177",
+    trace: "on-first-retry",
+    screenshot: "only-on-failure",
+  },
+  projects: [
+    {
+      name: "chromium",
+      use: { ...devices["Desktop Chrome"] },
+    },
+  ],
+  webServer: {
+    command: "vite --host 127.0.0.1 --port 4177",
+    url: "http://127.0.0.1:4177",
+    reuseExistingServer: !process.env.CI,
+    stdout: "pipe",
+    stderr: "pipe",
+  },
+});
diff --git a/example/vanilla-react-css/public/vite.svg b/example/vanilla-react-css/public/vite.svg
new file mode 100644
index 0000000..e7b8dfb
--- /dev/null
+++ b/example/vanilla-react-css/public/vite.svg
@@ -0,0 +1 @@
+<svg xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" role="img" class="iconify iconify--logos" width="31.88" height="32" preserveAspectRatio="xMidYMid meet" viewBox="0 0 256 257"><defs><linearGradient id="IconifyId1813088fe1fbc01fb466" x1="-.828%" x2="57.636%" y1="7.652%" y2="78.411%"><stop offset="0%" stop-color="#41D1FF"></stop><stop offset="100%" stop-color="#BD34FE"></stop></linearGradient><linearGradient id="IconifyId1813088fe1fbc01fb467" x1="43.376%" x2="50.316%" y1="2.242%" y2="89.03%"><stop offset="0%" stop-color="#FFEA83"></stop><stop offset="8.333%" stop-color="#FFDD35"></stop><stop offset="100%" stop-color="#FFA800"></stop></linearGradient></defs><path fill="url(#IconifyId1813088fe1fbc01fb466)" d="M255.153 37.938L134.897 252.976c-2.483 4.44-8.862 4.466-11.382.048L.875 37.958c-2.746-4.814 1.371-10.646 6.827-9.67l120.385 21.517a6.537 6.537 0 0 0 2.322-.004l117.867-21.483c5.438-.991 9.574 4.796 6.877 9.62Z"></path><path fill="url(#IconifyId1813088fe1fbc01fb467)" d="M185.432.063L96.44 17.501a3.268 3.268 0 0 0-2.634 3.014l-5.474 92.456a3.268 3.268 0 0 0 3.997 3.378l24.777-5.718c2.318-.535 4.413 1.507 3.936 3.838l-7.361 36.047c-.495 2.426 1.782 4.5 4.151 3.78l15.304-4.649c2.372-.72 4.652 1.36 4.15 3.788l-11.698 56.621c-.732 3.542 3.979 5.473 5.943 2.437l1.313-2.028l72.516-144.72c1.215-2.423-.88-5.186-3.54-4.672l-25.505 4.922c-2.396.462-4.435-1.77-3.759-4.114l16.646-57.705c.677-2.35-1.37-4.583-3.769-4.113Z"></path></svg>
\ No newline at end of file
diff --git a/example/vanilla-react-css/src/App.css b/example/vanilla-react-css/src/App.css
new file mode 100644
index 0000000..8fe7e3a
--- /dev/null
+++ b/example/vanilla-react-css/src/App.css
@@ -0,0 +1,14 @@
+.token-card {
+  max-width: 42rem;
+  margin: 0 auto;
+  padding: var(--spacing-size-4);
+  border-radius: var(--spacing-size-2);
+  background: var(--palette-brand-primary);
+  font-size: var(--typography_fluid-base-text-m);
+  box-shadow: 0 12px 28px rgb(15 23 42 / 35%);
+}
+
+.token-card h1 {
+  margin: 0 0 var(--spacing-size-2);
+  font-size: var(--typography_fluid-base-text-l);
+}
diff --git a/example/vanilla-react-css/src/App.tsx b/example/vanilla-react-css/src/App.tsx
new file mode 100644
index 0000000..0ddb4a7
--- /dev/null
+++ b/example/vanilla-react-css/src/App.tsx
@@ -0,0 +1,17 @@
+import "./App.css";
+
+function App() {
+  return (
+    <main>
+      <section data-testid="token-card" className="token-card">
+        <h1>CSS Forge + React + Vanilla CSS</h1>
+        <p>
+          Tokens are generated from <code>cssforge.config.ts</code> and consumed as CSS
+          variables.
+        </p>
+      </section>
+    </main>
+  );
+}
+
+export default App;
diff --git a/example/vanilla-react-css/src/assets/react.svg b/example/vanilla-react-css/src/assets/react.svg
new file mode 100644
index 0000000..6c87de9
--- /dev/null
+++ b/example/vanilla-react-css/src/assets/react.svg
@@ -0,0 +1 @@
+<svg xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" role="img" class="iconify iconify--logos" width="35.93" height="32" preserveAspectRatio="xMidYMid meet" viewBox="0 0 256 228"><path fill="#00D8FF" d="M210.483 73.824a171.49 171.49 0 0 0-8.24-2.597c.465-1.9.893-3.777 1.273-5.621c6.238-30.281 2.16-54.676-11.769-62.708c-13.355-7.7-35.196.329-57.254 19.526a171.23 171.23 0 0 0-6.375 5.848a155.866 155.866 0 0 0-4.241-3.917C100.759 3.829 77.587-4.822 63.673 3.233C50.33 10.957 46.379 33.89 51.995 62.588a170.974 170.974 0 0 0 1.892 8.48c-3.28.932-6.445 1.924-9.474 2.98C17.309 83.498 0 98.307 0 113.668c0 15.865 18.582 31.778 46.812 41.427a145.52 145.52 0 0 0 6.921 2.165a167.467 167.467 0 0 0-2.01 9.138c-5.354 28.2-1.173 50.591 12.134 58.266c13.744 7.926 36.812-.22 59.273-19.855a145.567 145.567 0 0 0 5.342-4.923a168.064 168.064 0 0 0 6.92 6.314c21.758 18.722 43.246 26.282 56.54 18.586c13.731-7.949 18.194-32.003 12.4-61.268a145.016 145.016 0 0 0-1.535-6.842c1.62-.48 3.21-.974 4.76-1.488c29.348-9.723 48.443-25.443 48.443-41.52c0-15.417-17.868-30.326-45.517-39.844Zm-6.365 70.984c-1.4.463-2.836.91-4.3 1.345c-3.24-10.257-7.612-21.163-12.963-32.432c5.106-11 9.31-21.767 12.459-31.957c2.619.758 5.16 1.557 7.61 2.4c23.69 8.156 38.14 20.213 38.14 29.504c0 9.896-15.606 22.743-40.946 31.14Zm-10.514 20.834c2.562 12.94 2.927 24.64 1.23 33.787c-1.524 8.219-4.59 13.698-8.382 15.893c-8.067 4.67-25.32-1.4-43.927-17.412a156.726 156.726 0 0 1-6.437-5.87c7.214-7.889 14.423-17.06 21.459-27.246c12.376-1.098 24.068-2.894 34.671-5.345a134.17 134.17 0 0 1 1.386 6.193ZM87.276 214.515c-7.882 2.783-14.16 2.863-17.955.675c-8.075-4.657-11.432-22.636-6.853-46.752a156.923 156.923 0 0 1 1.869-8.499c10.486 2.32 22.093 3.988 34.498 4.994c7.084 9.967 14.501 19.128 21.976 27.15a134.668 134.668 0 0 1-4.877 4.492c-9.933 8.682-19.886 14.842-28.658 17.94ZM50.35 144.747c-12.483-4.267-22.792-9.812-29.858-15.863c-6.35-5.437-9.555-10.836-9.555-15.216c0-9.322 13.897-21.212 37.076-29.293c2.813-.98 5.757-1.905 8.812-2.773c3.204 10.42 7.406 21.315 12.477 32.332c-5.137 11.18-9.399 22.249-12.634 32.792a134.718 134.718 0 0 1-6.318-1.979Zm12.378-84.26c-4.811-24.587-1.616-43.134 6.425-47.789c8.564-4.958 27.502 2.111 47.463 19.835a144.318 144.318 0 0 1 3.841 3.545c-7.438 7.987-14.787 17.08-21.808 26.988c-12.04 1.116-23.565 2.908-34.161 5.309a160.342 160.342 0 0 1-1.76-7.887Zm110.427 27.268a347.8 347.8 0 0 0-7.785-12.803c8.168 1.033 15.994 2.404 23.343 4.08c-2.206 7.072-4.956 14.465-8.193 22.045a381.151 381.151 0 0 0-7.365-13.322Zm-45.032-43.861c5.044 5.465 10.096 11.566 15.065 18.186a322.04 322.04 0 0 0-30.257-.006c4.974-6.559 10.069-12.652 15.192-18.18ZM82.802 87.83a323.167 323.167 0 0 0-7.227 13.238c-3.184-7.553-5.909-14.98-8.134-22.152c7.304-1.634 15.093-2.97 23.209-3.984a321.524 321.524 0 0 0-7.848 12.897Zm8.081 65.352c-8.385-.936-16.291-2.203-23.593-3.793c2.26-7.3 5.045-14.885 8.298-22.6a321.187 321.187 0 0 0 7.257 13.246c2.594 4.48 5.28 8.868 8.038 13.147Zm37.542 31.03c-5.184-5.592-10.354-11.779-15.403-18.433c4.902.192 9.899.29 14.978.29c5.218 0 10.376-.117 15.453-.343c-4.985 6.774-10.018 12.97-15.028 18.486Zm52.198-57.817c3.422 7.8 6.306 15.345 8.596 22.52c-7.422 1.694-15.436 3.058-23.88 4.071a382.417 382.417 0 0 0 7.859-13.026a347.403 347.403 0 0 0 7.425-13.565Zm-16.898 8.101a358.557 358.557 0 0 1-12.281 19.815a329.4 329.4 0 0 1-23.444.823c-7.967 0-15.716-.248-23.178-.732a310.202 310.202 0 0 1-12.513-19.846h.001a307.41 307.41 0 0 1-10.923-20.627a310.278 310.278 0 0 1 10.89-20.637l-.001.001a307.318 307.318 0 0 1 12.413-19.761c7.613-.576 15.42-.876 23.31-.876H128c7.926 0 15.743.303 23.354.883a329.357 329.357 0 0 1 12.335 19.695a358.489 358.489 0 0 1 11.036 20.54a329.472 329.472 0 0 1-11 20.722Zm22.56-122.124c8.572 4.944 11.906 24.881 6.52 51.026c-.344 1.668-.73 3.367-1.15 5.09c-10.622-2.452-22.155-4.275-34.23-5.408c-7.034-10.017-14.323-19.124-21.64-27.008a160.789 160.789 0 0 1 5.888-5.4c18.9-16.447 36.564-22.941 44.612-18.3ZM128 90.808c12.625 0 22.86 10.235 22.86 22.86s-10.235 22.86-22.86 22.86s-22.86-10.235-22.86-22.86s10.235-22.86 22.86-22.86Z"></path></svg>
\ No newline at end of file
diff --git a/example/vanilla-react-css/src/index.css b/example/vanilla-react-css/src/index.css
new file mode 100644
index 0000000..360e507
--- /dev/null
+++ b/example/vanilla-react-css/src/index.css
@@ -0,0 +1,16 @@
+@import "../.cssforge/output.css" layer(cssforge);
+
+:root {
+  color: #fff;
+  background: var(--palette-brand-surface);
+  font-family: Arial, Helvetica, sans-serif;
+}
+
+body {
+  margin: 0;
+}
+
+#root {
+  min-height: 100vh;
+  padding: var(--spacing-size-4);
+}
diff --git a/example/vanilla-react-css/src/main.tsx b/example/vanilla-react-css/src/main.tsx
new file mode 100644
index 0000000..bef5202
--- /dev/null
+++ b/example/vanilla-react-css/src/main.tsx
@@ -0,0 +1,10 @@
+import { StrictMode } from 'react'
+import { createRoot } from 'react-dom/client'
+import './index.css'
+import App from './App.tsx'
+
+createRoot(document.getElementById('root')!).render(
+  <StrictMode>
+    <App />
+  </StrictMode>,
+)
diff --git a/example/vanilla-react-css/tests/e2e.spec.ts b/example/vanilla-react-css/tests/e2e.spec.ts
new file mode 100644
index 0000000..64bb4d9
--- /dev/null
+++ b/example/vanilla-react-css/tests/e2e.spec.ts
@@ -0,0 +1,34 @@
+import { expect, test } from "@playwright/test";
+
+test("cssforge variables exist and are applied in the DOM", async ({ page }) => {
+  await page.goto("/");
+
+  const root = await page.evaluate(() => {
+    const css = getComputedStyle(document.documentElement);
+    return {
+      spacing: css.getPropertyValue("--spacing-size-4").trim(),
+      color: css.getPropertyValue("--palette-brand-primary").trim(),
+      type: css.getPropertyValue("--typography_fluid-base-text-m").trim(),
+    };
+  });
+
+  expect(root.spacing).not.toBe("");
+  expect(root.color).not.toBe("");
+  expect(root.type).not.toBe("");
+
+  const tokenCard = page.getByTestId("token-card");
+  await expect(tokenCard).toBeVisible();
+
+  const computed = await tokenCard.evaluate((el) => {
+    const css = getComputedStyle(el);
+    return {
+      paddingTop: css.paddingTop,
+      backgroundColor: css.backgroundColor,
+      fontSize: css.fontSize,
+    };
+  });
+
+  expect(parseFloat(computed.paddingTop)).toBeGreaterThan(0);
+  expect(computed.backgroundColor).not.toBe("rgba(0, 0, 0, 0)");
+  expect(parseFloat(computed.fontSize)).toBeGreaterThan(0);
+});
diff --git a/example/vanilla-react-css/tsconfig.app.json b/example/vanilla-react-css/tsconfig.app.json
new file mode 100644
index 0000000..a9b5a59
--- /dev/null
+++ b/example/vanilla-react-css/tsconfig.app.json
@@ -0,0 +1,28 @@
+{
+  "compilerOptions": {
+    "tsBuildInfoFile": "./node_modules/.tmp/tsconfig.app.tsbuildinfo",
+    "target": "ES2022",
+    "useDefineForClassFields": true,
+    "lib": ["ES2022", "DOM", "DOM.Iterable"],
+    "module": "ESNext",
+    "types": ["vite/client"],
+    "skipLibCheck": true,
+
+    /* Bundler mode */
+    "moduleResolution": "bundler",
+    "allowImportingTsExtensions": true,
+    "verbatimModuleSyntax": true,
+    "moduleDetection": "force",
+    "noEmit": true,
+    "jsx": "react-jsx",
+
+    /* Linting */
+    "strict": true,
+    "noUnusedLocals": true,
+    "noUnusedParameters": true,
+    "erasableSyntaxOnly": true,
+    "noFallthroughCasesInSwitch": true,
+    "noUncheckedSideEffectImports": true
+  },
+  "include": ["src"]
+}
diff --git a/example/vanilla-react-css/tsconfig.json b/example/vanilla-react-css/tsconfig.json
new file mode 100644
index 0000000..989adc2
--- /dev/null
+++ b/example/vanilla-react-css/tsconfig.json
@@ -0,0 +1,14 @@
+{
+  "files": [],
+  "references": [
+    {
+      "path": "./tsconfig.app.json"
+    },
+    {
+      "path": "./tsconfig.node.json"
+    },
+    {
+      "path": "../../packages/cssforge"
+    }
+  ]
+}
diff --git a/example/vanilla-react-css/tsconfig.node.json b/example/vanilla-react-css/tsconfig.node.json
new file mode 100644
index 0000000..8a67f62
--- /dev/null
+++ b/example/vanilla-react-css/tsconfig.node.json
@@ -0,0 +1,26 @@
+{
+  "compilerOptions": {
+    "tsBuildInfoFile": "./node_modules/.tmp/tsconfig.node.tsbuildinfo",
+    "target": "ES2023",
+    "lib": ["ES2023"],
+    "module": "ESNext",
+    "types": ["node"],
+    "skipLibCheck": true,
+
+    /* Bundler mode */
+    "moduleResolution": "bundler",
+    "allowImportingTsExtensions": true,
+    "verbatimModuleSyntax": true,
+    "moduleDetection": "force",
+    "noEmit": true,
+
+    /* Linting */
+    "strict": true,
+    "noUnusedLocals": true,
+    "noUnusedParameters": true,
+    "erasableSyntaxOnly": true,
+    "noFallthroughCasesInSwitch": true,
+    "noUncheckedSideEffectImports": true
+  },
+  "include": ["vite.config.ts"]
+}
diff --git a/example/vanilla-react-css/vite.config.ts b/example/vanilla-react-css/vite.config.ts
new file mode 100644
index 0000000..8b0f57b
--- /dev/null
+++ b/example/vanilla-react-css/vite.config.ts
@@ -0,0 +1,7 @@
+import { defineConfig } from 'vite'
+import react from '@vitejs/plugin-react'
+
+// https://vite.dev/config/
+export default defineConfig({
+  plugins: [react()],
+})
diff --git a/example/vanilla-solid-css/.gitignore b/example/vanilla-solid-css/.gitignore
new file mode 100644
index 0000000..9f96471
--- /dev/null
+++ b/example/vanilla-solid-css/.gitignore
@@ -0,0 +1,28 @@
+# Logs
+logs
+*.log
+npm-debug.log*
+yarn-debug.log*
+yarn-error.log*
+pnpm-debug.log*
+lerna-debug.log*
+
+node_modules
+dist
+dist-ssr
+*.local
+
+# Editor directories and files
+.vscode/*
+!.vscode/extensions.json
+.idea
+.DS_Store
+*.suo
+*.ntvs*
+*.njsproj
+*.sln
+*.sw?
+.cssforge
+playwright-report
+test-results
+.playwright
diff --git a/example/vanilla-solid-css/README.md b/example/vanilla-solid-css/README.md
new file mode 100644
index 0000000..b2981b9
--- /dev/null
+++ b/example/vanilla-solid-css/README.md
@@ -0,0 +1,34 @@
+# Solid + Vanilla CSS (Vite)
+
+Node.js example that integrates CSS Forge tokens into a Solid app using vanilla CSS.
+
+## Scaffold Source
+
+```bash
+pnpm create vite@latest vanilla-solid-css -- --template solid-ts --no-interactive
+```
+
+## Resolved Versions
+
+- `solid-js@1.9.11`
+- `vite@7.3.1`
+- `@playwright/test@1.58.2`
+
+## Run Locally
+
+```bash
+pnpm install
+pnpm exec playwright install chromium
+pnpm run cssforge:build-local
+pnpm run cssforge:generate
+pnpm run dev
+```
+
+## E2E Test
+
+```bash
+pnpm run test:e2e
+```
+
+The Playwright test validates CSS Forge variables on `:root` and computed styles on
+`[data-testid="token-card"]`.
diff --git a/example/vanilla-solid-css/cssforge.config.ts b/example/vanilla-solid-css/cssforge.config.ts
new file mode 100644
index 0000000..0b1e64f
--- /dev/null
+++ b/example/vanilla-solid-css/cssforge.config.ts
@@ -0,0 +1,46 @@
+import { defineConfig } from "/cssforge";
+
+export default defineConfig({
+  colors: {
+    palette: {
+      value: {
+        brand: {
+          value: {
+            primary: "#1d4ed8",
+            accent: "#f97316",
+            surface: "#0f172a",
+          },
+        },
+      },
+    },
+  },
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          1: "4px",
+          2: "8px",
+          3: "12px",
+          4: "16px",
+        },
+      },
+    },
+  },
+  typography: {
+    fluid: {
+      base: {
+        value: {
+          minWidth: 320,
+          minFontSize: 16,
+          minTypeScale: 1.2,
+          maxWidth: 1280,
+          maxFontSize: 18,
+          maxTypeScale: 1.25,
+          negativeSteps: 1,
+          positiveSteps: 2,
+          prefix: "text",
+        },
+      },
+    },
+  },
+});
diff --git a/example/vanilla-solid-css/index.html b/example/vanilla-solid-css/index.html
new file mode 100644
index 0000000..44cf1b8
--- /dev/null
+++ b/example/vanilla-solid-css/index.html
@@ -0,0 +1,13 @@
+<!doctype html>
+<html lang="en">
+  <head>
+    <meta charset="UTF-8" />
+    <link rel="icon" type="image/svg+xml" href="/vite.svg" />
+    <meta name="viewport" content="width=device-width, initial-scale=1.0" />
+    <title>vanilla-solid-css</title>
+  </head>
+  <body>
+    <div id="root"></div>
+    <script type="module" src="/src/index.tsx"></script>
+  </body>
+</html>
diff --git a/example/vanilla-solid-css/moon.yml b/example/vanilla-solid-css/moon.yml
new file mode 100644
index 0000000..a4d9b61
--- /dev/null
+++ b/example/vanilla-solid-css/moon.yml
@@ -0,0 +1,71 @@
+$schema: "https://moonrepo.dev/schemas/project.json"
+
+language: "typescript"
+layer: "application"
+
+dependsOn:
+  - "cssforge"
+
+tasks:
+  build:
+    script: "tsc -b && vite build"
+    deps:
+      - "^:build"
+  dev:
+    command: "vite"
+    deps:
+      - "^:build"
+    preset: "server"
+    options:
+      runInCI: false
+  dev-e2e:
+    command: "vite"
+    args: ["--host", "127.0.0.1", "--port", "4180"]
+    deps:
+      - "^:build"
+    preset: "server"
+    options:
+      runInCI: false
+  preview:
+    command: "vite"
+    args: ["preview"]
+    deps:
+      - "~:build"
+    preset: "server"
+    options:
+      runInCI: false
+  cssforge-generate:
+    command: "tsx"
+    args:
+      - "../../packages/cssforge/src/cli.ts"
+      - "--prefix"
+      - "."
+      - "--config"
+      - "./cssforge.config.ts"
+      - "--mode"
+      - "css"
+      - "--css"
+      - "./.cssforge/output.css"
+    deps:
+      - "^:build"
+    options:
+      runInCI: false
+  e2e:
+    command: "playwright"
+    args: ["test"]
+    deps:
+      - "~:cssforge-generate"
+    options:
+      runInCI: false
+  e2e-headed:
+    command: "playwright"
+    args: ["test", "--headed"]
+    deps:
+      - "~:cssforge-generate"
+    options:
+      runInCI: false
+  cssforge-build-local:
+    command: "moon"
+    args: ["run", "cssforge:jsr-dry-run"]
+    options:
+      runInCI: false
diff --git a/example/vanilla-solid-css/package.json b/example/vanilla-solid-css/package.json
new file mode 100644
index 0000000..a7663c2
--- /dev/null
+++ b/example/vanilla-solid-css/package.json
@@ -0,0 +1,18 @@
+{
+  "name": "vanilla-solid-css",
+  "private": true,
+  "version": "0.0.0",
+  "type": "module",
+  "dependencies": {
+    "solid-js": "1.9.11"
+  },
+  "devDependencies": {
+    "@playwright/test": "1.58.2",
+    "@types/node": "^24.10.1",
+    "typescript": "~5.9.3",
+    "vite": "7.3.1",
+    "vite-plugin-solid": "2.11.10",
+    "@hebilicious/cssforge": "workspace:*",
+    "tsx": "^4.20.6"
+  }
+}
diff --git a/example/vanilla-solid-css/playwright.config.ts b/example/vanilla-solid-css/playwright.config.ts
new file mode 100644
index 0000000..e23fd4e
--- /dev/null
+++ b/example/vanilla-solid-css/playwright.config.ts
@@ -0,0 +1,25 @@
+import { defineConfig, devices } from "@playwright/test";
+
+export default defineConfig({
+  testDir: "./tests",
+  timeout: 30_000,
+  fullyParallel: true,
+  use: {
+    baseURL: "http://127.0.0.1:4180",
+    trace: "on-first-retry",
+    screenshot: "only-on-failure",
+  },
+  projects: [
+    {
+      name: "chromium",
+      use: { ...devices["Desktop Chrome"] },
+    },
+  ],
+  webServer: {
+    command: "vite --host 127.0.0.1 --port 4180",
+    url: "http://127.0.0.1:4180",
+    reuseExistingServer: !process.env.CI,
+    stdout: "pipe",
+    stderr: "pipe",
+  },
+});
diff --git a/example/vanilla-solid-css/public/vite.svg b/example/vanilla-solid-css/public/vite.svg
new file mode 100644
index 0000000..e7b8dfb
--- /dev/null
+++ b/example/vanilla-solid-css/public/vite.svg
@@ -0,0 +1 @@
+<svg xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" role="img" class="iconify iconify--logos" width="31.88" height="32" preserveAspectRatio="xMidYMid meet" viewBox="0 0 256 257"><defs><linearGradient id="IconifyId1813088fe1fbc01fb466" x1="-.828%" x2="57.636%" y1="7.652%" y2="78.411%"><stop offset="0%" stop-color="#41D1FF"></stop><stop offset="100%" stop-color="#BD34FE"></stop></linearGradient><linearGradient id="IconifyId1813088fe1fbc01fb467" x1="43.376%" x2="50.316%" y1="2.242%" y2="89.03%"><stop offset="0%" stop-color="#FFEA83"></stop><stop offset="8.333%" stop-color="#FFDD35"></stop><stop offset="100%" stop-color="#FFA800"></stop></linearGradient></defs><path fill="url(#IconifyId1813088fe1fbc01fb466)" d="M255.153 37.938L134.897 252.976c-2.483 4.44-8.862 4.466-11.382.048L.875 37.958c-2.746-4.814 1.371-10.646 6.827-9.67l120.385 21.517a6.537 6.537 0 0 0 2.322-.004l117.867-21.483c5.438-.991 9.574 4.796 6.877 9.62Z"></path><path fill="url(#IconifyId1813088fe1fbc01fb467)" d="M185.432.063L96.44 17.501a3.268 3.268 0 0 0-2.634 3.014l-5.474 92.456a3.268 3.268 0 0 0 3.997 3.378l24.777-5.718c2.318-.535 4.413 1.507 3.936 3.838l-7.361 36.047c-.495 2.426 1.782 4.5 4.151 3.78l15.304-4.649c2.372-.72 4.652 1.36 4.15 3.788l-11.698 56.621c-.732 3.542 3.979 5.473 5.943 2.437l1.313-2.028l72.516-144.72c1.215-2.423-.88-5.186-3.54-4.672l-25.505 4.922c-2.396.462-4.435-1.77-3.759-4.114l16.646-57.705c.677-2.35-1.37-4.583-3.769-4.113Z"></path></svg>
\ No newline at end of file
diff --git a/example/vanilla-solid-css/src/App.css b/example/vanilla-solid-css/src/App.css
new file mode 100644
index 0000000..8fe7e3a
--- /dev/null
+++ b/example/vanilla-solid-css/src/App.css
@@ -0,0 +1,14 @@
+.token-card {
+  max-width: 42rem;
+  margin: 0 auto;
+  padding: var(--spacing-size-4);
+  border-radius: var(--spacing-size-2);
+  background: var(--palette-brand-primary);
+  font-size: var(--typography_fluid-base-text-m);
+  box-shadow: 0 12px 28px rgb(15 23 42 / 35%);
+}
+
+.token-card h1 {
+  margin: 0 0 var(--spacing-size-2);
+  font-size: var(--typography_fluid-base-text-l);
+}
diff --git a/example/vanilla-solid-css/src/App.tsx b/example/vanilla-solid-css/src/App.tsx
new file mode 100644
index 0000000..50ea6d0
--- /dev/null
+++ b/example/vanilla-solid-css/src/App.tsx
@@ -0,0 +1,17 @@
+import "./App.css";
+
+function App() {
+  return (
+    <main>
+      <section data-testid="token-card" class="token-card">
+        <h1>CSS Forge + Solid + Vanilla CSS</h1>
+        <p>
+          Tokens are generated from <code>cssforge.config.ts</code> and consumed as CSS
+          variables.
+        </p>
+      </section>
+    </main>
+  );
+}
+
+export default App;
diff --git a/example/vanilla-solid-css/src/assets/solid.svg b/example/vanilla-solid-css/src/assets/solid.svg
new file mode 100644
index 0000000..025aa30
--- /dev/null
+++ b/example/vanilla-solid-css/src/assets/solid.svg
@@ -0,0 +1 @@
+<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 166 155.3"><path d="M163 35S110-4 69 5l-3 1c-6 2-11 5-14 9l-2 3-15 26 26 5c11 7 25 10 38 7l46 9 18-30z" fill="#76b3e1"/><linearGradient id="a" gradientUnits="userSpaceOnUse" x1="27.5" y1="3" x2="152" y2="63.5"><stop offset=".1" stop-color="#76b3e1"/><stop offset=".3" stop-color="#dcf2fd"/><stop offset="1" stop-color="#76b3e1"/></linearGradient><path d="M163 35S110-4 69 5l-3 1c-6 2-11 5-14 9l-2 3-15 26 26 5c11 7 25 10 38 7l46 9 18-30z" opacity=".3" fill="url(#a)"/><path d="M52 35l-4 1c-17 5-22 21-13 35 10 13 31 20 48 15l62-21S92 26 52 35z" fill="#518ac8"/><linearGradient id="b" gradientUnits="userSpaceOnUse" x1="95.8" y1="32.6" x2="74" y2="105.2"><stop offset="0" stop-color="#76b3e1"/><stop offset=".5" stop-color="#4377bb"/><stop offset="1" stop-color="#1f3b77"/></linearGradient><path d="M52 35l-4 1c-17 5-22 21-13 35 10 13 31 20 48 15l62-21S92 26 52 35z" opacity=".3" fill="url(#b)"/><linearGradient id="c" gradientUnits="userSpaceOnUse" x1="18.4" y1="64.2" x2="144.3" y2="149.8"><stop offset="0" stop-color="#315aa9"/><stop offset=".5" stop-color="#518ac8"/><stop offset="1" stop-color="#315aa9"/></linearGradient><path d="M134 80a45 45 0 00-48-15L24 85 4 120l112 19 20-36c4-7 3-15-2-23z" fill="url(#c)"/><linearGradient id="d" gradientUnits="userSpaceOnUse" x1="75.2" y1="74.5" x2="24.4" y2="260.8"><stop offset="0" stop-color="#4377bb"/><stop offset=".5" stop-color="#1a336b"/><stop offset="1" stop-color="#1a336b"/></linearGradient><path d="M114 115a45 45 0 00-48-15L4 120s53 40 94 30l3-1c17-5 23-21 13-34z" fill="url(#d)"/></svg>
\ No newline at end of file
diff --git a/example/vanilla-solid-css/src/index.css b/example/vanilla-solid-css/src/index.css
new file mode 100644
index 0000000..360e507
--- /dev/null
+++ b/example/vanilla-solid-css/src/index.css
@@ -0,0 +1,16 @@
+@import "../.cssforge/output.css" layer(cssforge);
+
+:root {
+  color: #fff;
+  background: var(--palette-brand-surface);
+  font-family: Arial, Helvetica, sans-serif;
+}
+
+body {
+  margin: 0;
+}
+
+#root {
+  min-height: 100vh;
+  padding: var(--spacing-size-4);
+}
diff --git a/example/vanilla-solid-css/src/index.tsx b/example/vanilla-solid-css/src/index.tsx
new file mode 100644
index 0000000..f67cd20
--- /dev/null
+++ b/example/vanilla-solid-css/src/index.tsx
@@ -0,0 +1,8 @@
+/* @refresh reload */
+import { render } from 'solid-js/web'
+import './index.css'
+import App from './App.tsx'
+
+const root = document.getElementById('root')
+
+render(() => <App />, root!)
diff --git a/example/vanilla-solid-css/tests/e2e.spec.ts b/example/vanilla-solid-css/tests/e2e.spec.ts
new file mode 100644
index 0000000..64bb4d9
--- /dev/null
+++ b/example/vanilla-solid-css/tests/e2e.spec.ts
@@ -0,0 +1,34 @@
+import { expect, test } from "@playwright/test";
+
+test("cssforge variables exist and are applied in the DOM", async ({ page }) => {
+  await page.goto("/");
+
+  const root = await page.evaluate(() => {
+    const css = getComputedStyle(document.documentElement);
+    return {
+      spacing: css.getPropertyValue("--spacing-size-4").trim(),
+      color: css.getPropertyValue("--palette-brand-primary").trim(),
+      type: css.getPropertyValue("--typography_fluid-base-text-m").trim(),
+    };
+  });
+
+  expect(root.spacing).not.toBe("");
+  expect(root.color).not.toBe("");
+  expect(root.type).not.toBe("");
+
+  const tokenCard = page.getByTestId("token-card");
+  await expect(tokenCard).toBeVisible();
+
+  const computed = await tokenCard.evaluate((el) => {
+    const css = getComputedStyle(el);
+    return {
+      paddingTop: css.paddingTop,
+      backgroundColor: css.backgroundColor,
+      fontSize: css.fontSize,
+    };
+  });
+
+  expect(parseFloat(computed.paddingTop)).toBeGreaterThan(0);
+  expect(computed.backgroundColor).not.toBe("rgba(0, 0, 0, 0)");
+  expect(parseFloat(computed.fontSize)).toBeGreaterThan(0);
+});
diff --git a/example/vanilla-solid-css/tsconfig.app.json b/example/vanilla-solid-css/tsconfig.app.json
new file mode 100644
index 0000000..c0b480e
--- /dev/null
+++ b/example/vanilla-solid-css/tsconfig.app.json
@@ -0,0 +1,29 @@
+{
+  "compilerOptions": {
+    "tsBuildInfoFile": "./node_modules/.tmp/tsconfig.app.tsbuildinfo",
+    "target": "ES2022",
+    "useDefineForClassFields": true,
+    "module": "ESNext",
+    "lib": ["ES2022", "DOM", "DOM.Iterable"],
+    "types": ["vite/client"],
+    "skipLibCheck": true,
+
+    /* Bundler mode */
+    "moduleResolution": "bundler",
+    "allowImportingTsExtensions": true,
+    "verbatimModuleSyntax": true,
+    "moduleDetection": "force",
+    "noEmit": true,
+    "jsx": "preserve",
+    "jsxImportSource": "solid-js",
+
+    /* Linting */
+    "strict": true,
+    "noUnusedLocals": true,
+    "noUnusedParameters": true,
+    "erasableSyntaxOnly": true,
+    "noFallthroughCasesInSwitch": true,
+    "noUncheckedSideEffectImports": true
+  },
+  "include": ["src"]
+}
diff --git a/example/vanilla-solid-css/tsconfig.json b/example/vanilla-solid-css/tsconfig.json
new file mode 100644
index 0000000..1ffef60
--- /dev/null
+++ b/example/vanilla-solid-css/tsconfig.json
@@ -0,0 +1,7 @@
+{
+  "files": [],
+  "references": [
+    { "path": "./tsconfig.app.json" },
+    { "path": "./tsconfig.node.json" }
+  ]
+}
diff --git a/example/vanilla-solid-css/tsconfig.node.json b/example/vanilla-solid-css/tsconfig.node.json
new file mode 100644
index 0000000..8a67f62
--- /dev/null
+++ b/example/vanilla-solid-css/tsconfig.node.json
@@ -0,0 +1,26 @@
+{
+  "compilerOptions": {
+    "tsBuildInfoFile": "./node_modules/.tmp/tsconfig.node.tsbuildinfo",
+    "target": "ES2023",
+    "lib": ["ES2023"],
+    "module": "ESNext",
+    "types": ["node"],
+    "skipLibCheck": true,
+
+    /* Bundler mode */
+    "moduleResolution": "bundler",
+    "allowImportingTsExtensions": true,
+    "verbatimModuleSyntax": true,
+    "moduleDetection": "force",
+    "noEmit": true,
+
+    /* Linting */
+    "strict": true,
+    "noUnusedLocals": true,
+    "noUnusedParameters": true,
+    "erasableSyntaxOnly": true,
+    "noFallthroughCasesInSwitch": true,
+    "noUncheckedSideEffectImports": true
+  },
+  "include": ["vite.config.ts"]
+}
diff --git a/example/vanilla-solid-css/vite.config.ts b/example/vanilla-solid-css/vite.config.ts
new file mode 100644
index 0000000..4095d9b
--- /dev/null
+++ b/example/vanilla-solid-css/vite.config.ts
@@ -0,0 +1,6 @@
+import { defineConfig } from 'vite'
+import solid from 'vite-plugin-solid'
+
+export default defineConfig({
+  plugins: [solid()],
+})
diff --git a/example/vanilla-svelte-css/.gitignore b/example/vanilla-svelte-css/.gitignore
new file mode 100644
index 0000000..9f96471
--- /dev/null
+++ b/example/vanilla-svelte-css/.gitignore
@@ -0,0 +1,28 @@
+# Logs
+logs
+*.log
+npm-debug.log*
+yarn-debug.log*
+yarn-error.log*
+pnpm-debug.log*
+lerna-debug.log*
+
+node_modules
+dist
+dist-ssr
+*.local
+
+# Editor directories and files
+.vscode/*
+!.vscode/extensions.json
+.idea
+.DS_Store
+*.suo
+*.ntvs*
+*.njsproj
+*.sln
+*.sw?
+.cssforge
+playwright-report
+test-results
+.playwright
diff --git a/example/vanilla-svelte-css/.vscode/extensions.json b/example/vanilla-svelte-css/.vscode/extensions.json
new file mode 100644
index 0000000..bdef820
--- /dev/null
+++ b/example/vanilla-svelte-css/.vscode/extensions.json
@@ -0,0 +1,3 @@
+{
+  "recommendations": ["svelte.svelte-vscode"]
+}
diff --git a/example/vanilla-svelte-css/README.md b/example/vanilla-svelte-css/README.md
new file mode 100644
index 0000000..e6dc514
--- /dev/null
+++ b/example/vanilla-svelte-css/README.md
@@ -0,0 +1,34 @@
+# Svelte + Vanilla CSS (Vite)
+
+Node.js example that integrates CSS Forge tokens into a Svelte app using vanilla CSS.
+
+## Scaffold Source
+
+```bash
+pnpm create vite@latest vanilla-svelte-css -- --template svelte-ts --no-interactive
+```
+
+## Resolved Versions
+
+- `svelte@5.53.0`
+- `vite@7.3.1`
+- `@playwright/test@1.58.2`
+
+## Run Locally
+
+```bash
+pnpm install
+pnpm exec playwright install chromium
+pnpm run cssforge:build-local
+pnpm run cssforge:generate
+pnpm run dev
+```
+
+## E2E Test
+
+```bash
+pnpm run test:e2e
+```
+
+The Playwright test validates CSS Forge variables on `:root` and computed styles on
+`[data-testid="token-card"]`.
diff --git a/example/vanilla-svelte-css/cssforge.config.ts b/example/vanilla-svelte-css/cssforge.config.ts
new file mode 100644
index 0000000..0b1e64f
--- /dev/null
+++ b/example/vanilla-svelte-css/cssforge.config.ts
@@ -0,0 +1,46 @@
+import { defineConfig } from "/cssforge";
+
+export default defineConfig({
+  colors: {
+    palette: {
+      value: {
+        brand: {
+          value: {
+            primary: "#1d4ed8",
+            accent: "#f97316",
+            surface: "#0f172a",
+          },
+        },
+      },
+    },
+  },
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          1: "4px",
+          2: "8px",
+          3: "12px",
+          4: "16px",
+        },
+      },
+    },
+  },
+  typography: {
+    fluid: {
+      base: {
+        value: {
+          minWidth: 320,
+          minFontSize: 16,
+          minTypeScale: 1.2,
+          maxWidth: 1280,
+          maxFontSize: 18,
+          maxTypeScale: 1.25,
+          negativeSteps: 1,
+          positiveSteps: 2,
+          prefix: "text",
+        },
+      },
+    },
+  },
+});
diff --git a/example/vanilla-svelte-css/index.html b/example/vanilla-svelte-css/index.html
new file mode 100644
index 0000000..5380520
--- /dev/null
+++ b/example/vanilla-svelte-css/index.html
@@ -0,0 +1,13 @@
+<!doctype html>
+<html lang="en">
+  <head>
+    <meta charset="UTF-8" />
+    <link rel="icon" type="image/svg+xml" href="/vite.svg" />
+    <meta name="viewport" content="width=device-width, initial-scale=1.0" />
+    <title>vanilla-svelte-css</title>
+  </head>
+  <body>
+    <div id="app"></div>
+    <script type="module" src="/src/main.ts"></script>
+  </body>
+</html>
diff --git a/example/vanilla-svelte-css/moon.yml b/example/vanilla-svelte-css/moon.yml
new file mode 100644
index 0000000..6639055
--- /dev/null
+++ b/example/vanilla-svelte-css/moon.yml
@@ -0,0 +1,76 @@
+$schema: "https://moonrepo.dev/schemas/project.json"
+
+language: "typescript"
+layer: "application"
+
+dependsOn:
+  - "cssforge"
+
+tasks:
+  build:
+    command: "vite"
+    args: ["build"]
+    deps:
+      - "^:build"
+  dev:
+    command: "vite"
+    deps:
+      - "^:build"
+    preset: "server"
+    options:
+      runInCI: false
+  dev-e2e:
+    command: "vite"
+    args: ["--host", "127.0.0.1", "--port", "4179"]
+    deps:
+      - "^:build"
+    preset: "server"
+    options:
+      runInCI: false
+  preview:
+    command: "vite"
+    args: ["preview"]
+    deps:
+      - "~:build"
+    preset: "server"
+    options:
+      runInCI: false
+  check:
+    script: "svelte-check --tsconfig ./tsconfig.app.json && tsc -p tsconfig.node.json"
+    options:
+      runInCI: false
+  cssforge-generate:
+    command: "tsx"
+    args:
+      - "../../packages/cssforge/src/cli.ts"
+      - "--prefix"
+      - "."
+      - "--config"
+      - "./cssforge.config.ts"
+      - "--mode"
+      - "css"
+      - "--css"
+      - "./.cssforge/output.css"
+    deps:
+      - "^:build"
+    options:
+      runInCI: false
+  e2e:
+    command: "playwright"
+    args: ["test"]
+    deps:
+      - "~:cssforge-generate"
+    options:
+      runInCI: false
+  e2e-headed:
+    command: "playwright"
+    args: ["test", "--headed"]
+    deps:
+      - "~:cssforge-generate"
+    options:
+      runInCI: false
+  cssforge-build-local:
+    command: "moon"
+    args: ["run", "cssforge:jsr-dry-run"]
+    options:
+      runInCI: false
diff --git a/example/vanilla-svelte-css/package.json b/example/vanilla-svelte-css/package.json
new file mode 100644
index 0000000..7071ffc
--- /dev/null
+++ b/example/vanilla-svelte-css/package.json
@@ -0,0 +1,18 @@
+{
+  "name": "vanilla-svelte-css",
+  "private": true,
+  "version": "0.0.0",
+  "type": "module",
+  "devDependencies": {
+    "@playwright/test": "1.58.2",
+    "@sveltejs/vite-plugin-svelte": "6.2.4",
+    "@tsconfig/svelte": "^5.0.6",
+    "@types/node": "^24.10.1",
+    "svelte": "5.53.0",
+    "svelte-check": "^4.3.4",
+    "typescript": "~5.9.3",
+    "vite": "7.3.1",
+    "@hebilicious/cssforge": "workspace:*",
+    "tsx": "^4.20.6"
+  }
+}
diff --git a/example/vanilla-svelte-css/playwright.config.ts b/example/vanilla-svelte-css/playwright.config.ts
new file mode 100644
index 0000000..db3cce2
--- /dev/null
+++ b/example/vanilla-svelte-css/playwright.config.ts
@@ -0,0 +1,25 @@
+import { defineConfig, devices } from "@playwright/test";
+
+export default defineConfig({
+  testDir: "./tests",
+  timeout: 30_000,
+  fullyParallel: true,
+  use: {
+    baseURL: "http://127.0.0.1:4179",
+    trace: "on-first-retry",
+    screenshot: "only-on-failure",
+  },
+  projects: [
+    {
+      name: "chromium",
+      use: { ...devices["Desktop Chrome"] },
+    },
+  ],
+  webServer: {
+    command: "vite --host 127.0.0.1 --port 4179",
+    url: "http://127.0.0.1:4179",
+    reuseExistingServer: !process.env.CI,
+    stdout: "pipe",
+    stderr: "pipe",
+  },
+});
diff --git a/example/vanilla-svelte-css/public/vite.svg b/example/vanilla-svelte-css/public/vite.svg
new file mode 100644
index 0000000..e7b8dfb
--- /dev/null
+++ b/example/vanilla-svelte-css/public/vite.svg
@@ -0,0 +1 @@
+<svg xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" role="img" class="iconify iconify--logos" width="31.88" height="32" preserveAspectRatio="xMidYMid meet" viewBox="0 0 256 257"><defs><linearGradient id="IconifyId1813088fe1fbc01fb466" x1="-.828%" x2="57.636%" y1="7.652%" y2="78.411%"><stop offset="0%" stop-color="#41D1FF"></stop><stop offset="100%" stop-color="#BD34FE"></stop></linearGradient><linearGradient id="IconifyId1813088fe1fbc01fb467" x1="43.376%" x2="50.316%" y1="2.242%" y2="89.03%"><stop offset="0%" stop-color="#FFEA83"></stop><stop offset="8.333%" stop-color="#FFDD35"></stop><stop offset="100%" stop-color="#FFA800"></stop></linearGradient></defs><path fill="url(#IconifyId1813088fe1fbc01fb466)" d="M255.153 37.938L134.897 252.976c-2.483 4.44-8.862 4.466-11.382.048L.875 37.958c-2.746-4.814 1.371-10.646 6.827-9.67l120.385 21.517a6.537 6.537 0 0 0 2.322-.004l117.867-21.483c5.438-.991 9.574 4.796 6.877 9.62Z"></path><path fill="url(#IconifyId1813088fe1fbc01fb467)" d="M185.432.063L96.44 17.501a3.268 3.268 0 0 0-2.634 3.014l-5.474 92.456a3.268 3.268 0 0 0 3.997 3.378l24.777-5.718c2.318-.535 4.413 1.507 3.936 3.838l-7.361 36.047c-.495 2.426 1.782 4.5 4.151 3.78l15.304-4.649c2.372-.72 4.652 1.36 4.15 3.788l-11.698 56.621c-.732 3.542 3.979 5.473 5.943 2.437l1.313-2.028l72.516-144.72c1.215-2.423-.88-5.186-3.54-4.672l-25.505 4.922c-2.396.462-4.435-1.77-3.759-4.114l16.646-57.705c.677-2.35-1.37-4.583-3.769-4.113Z"></path></svg>
\ No newline at end of file
diff --git a/example/vanilla-svelte-css/src/App.svelte b/example/vanilla-svelte-css/src/App.svelte
new file mode 100644
index 0000000..447fcd6
--- /dev/null
+++ b/example/vanilla-svelte-css/src/App.svelte
@@ -0,0 +1,9 @@
+<main>
+  <section data-testid="token-card" class="token-card">
+    <h1>CSS Forge + Svelte + Vanilla CSS</h1>
+    <p>
+      Tokens are generated from <code>cssforge.config.ts</code> and consumed as CSS
+      variables.
+    </p>
+  </section>
+</main>
diff --git a/example/vanilla-svelte-css/src/app.css b/example/vanilla-svelte-css/src/app.css
new file mode 100644
index 0000000..f3d931c
--- /dev/null
+++ b/example/vanilla-svelte-css/src/app.css
@@ -0,0 +1,31 @@
+@import "../.cssforge/output.css" layer(cssforge);
+
+:root {
+  color: #fff;
+  background: var(--palette-brand-surface);
+  font-family: Arial, Helvetica, sans-serif;
+}
+
+body {
+  margin: 0;
+}
+
+#app {
+  min-height: 100vh;
+  padding: var(--spacing-size-4);
+}
+
+.token-card {
+  max-width: 42rem;
+  margin: 0 auto;
+  padding: var(--spacing-size-4);
+  border-radius: var(--spacing-size-2);
+  background: var(--palette-brand-primary);
+  font-size: var(--typography_fluid-base-text-m);
+  box-shadow: 0 12px 28px rgb(15 23 42 / 35%);
+}
+
+.token-card h1 {
+  margin: 0 0 var(--spacing-size-2);
+  font-size: var(--typography_fluid-base-text-l);
+}
diff --git a/example/vanilla-svelte-css/src/assets/svelte.svg b/example/vanilla-svelte-css/src/assets/svelte.svg
new file mode 100644
index 0000000..c5e0848
--- /dev/null
+++ b/example/vanilla-svelte-css/src/assets/svelte.svg
@@ -0,0 +1 @@
+<svg xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" role="img" class="iconify iconify--logos" width="26.6" height="32" preserveAspectRatio="xMidYMid meet" viewBox="0 0 256 308"><path fill="#FF3E00" d="M239.682 40.707C211.113-.182 154.69-12.301 113.895 13.69L42.247 59.356a82.198 82.198 0 0 0-37.135 55.056a86.566 86.566 0 0 0 8.536 55.576a82.425 82.425 0 0 0-12.296 30.719a87.596 87.596 0 0 0 14.964 66.244c28.574 40.893 84.997 53.007 125.787 27.016l71.648-45.664a82.182 82.182 0 0 0 37.135-55.057a86.601 86.601 0 0 0-8.53-55.577a82.409 82.409 0 0 0 12.29-30.718a87.573 87.573 0 0 0-14.963-66.244"></path><path fill="#FFF" d="M106.889 270.841c-23.102 6.007-47.497-3.036-61.103-22.648a52.685 52.685 0 0 1-9.003-39.85a49.978 49.978 0 0 1 1.713-6.693l1.35-4.115l3.671 2.697a92.447 92.447 0 0 0 28.036 14.007l2.663.808l-.245 2.659a16.067 16.067 0 0 0 2.89 10.656a17.143 17.143 0 0 0 18.397 6.828a15.786 15.786 0 0 0 4.403-1.935l71.67-45.672a14.922 14.922 0 0 0 6.734-9.977a15.923 15.923 0 0 0-2.713-12.011a17.156 17.156 0 0 0-18.404-6.832a15.78 15.78 0 0 0-4.396 1.933l-27.35 17.434a52.298 52.298 0 0 1-14.553 6.391c-23.101 6.007-47.497-3.036-61.101-22.649a52.681 52.681 0 0 1-9.004-39.849a49.428 49.428 0 0 1 22.34-33.114l71.664-45.677a52.218 52.218 0 0 1 14.563-6.398c23.101-6.007 47.497 3.036 61.101 22.648a52.685 52.685 0 0 1 9.004 39.85a50.559 50.559 0 0 1-1.713 6.692l-1.35 4.116l-3.67-2.693a92.373 92.373 0 0 0-28.037-14.013l-2.664-.809l.246-2.658a16.099 16.099 0 0 0-2.89-10.656a17.143 17.143 0 0 0-18.398-6.828a15.786 15.786 0 0 0-4.402 1.935l-71.67 45.674a14.898 14.898 0 0 0-6.73 9.975a15.9 15.9 0 0 0 2.709 12.012a17.156 17.156 0 0 0 18.404 6.832a15.841 15.841 0 0 0 4.402-1.935l27.345-17.427a52.147 52.147 0 0 1 14.552-6.397c23.101-6.006 47.497 3.037 61.102 22.65a52.681 52.681 0 0 1 9.003 39.848a49.453 49.453 0 0 1-22.34 33.12l-71.664 45.673a52.218 52.218 0 0 1-14.563 6.398"></path></svg>
\ No newline at end of file
diff --git a/example/vanilla-svelte-css/src/lib/Counter.svelte b/example/vanilla-svelte-css/src/lib/Counter.svelte
new file mode 100644
index 0000000..37d75ce
--- /dev/null
+++ b/example/vanilla-svelte-css/src/lib/Counter.svelte
@@ -0,0 +1,10 @@
+<script lang="ts">
+  let count: number = $state(0)
+  const increment = () => {
+    count += 1
+  }
+</script>
+
+<button onclick={increment}>
+  count is {count}
+</button>
diff --git a/example/vanilla-svelte-css/src/main.ts b/example/vanilla-svelte-css/src/main.ts
new file mode 100644
index 0000000..664a057
--- /dev/null
+++ b/example/vanilla-svelte-css/src/main.ts
@@ -0,0 +1,9 @@
+import { mount } from 'svelte'
+import './app.css'
+import App from './App.svelte'
+
+const app = mount(App, {
+  target: document.getElementById('app')!,
+})
+
+export default app
diff --git a/example/vanilla-svelte-css/svelte.config.js b/example/vanilla-svelte-css/svelte.config.js
new file mode 100644
index 0000000..96b3455
--- /dev/null
+++ b/example/vanilla-svelte-css/svelte.config.js
@@ -0,0 +1,8 @@
+import { vitePreprocess } from '@sveltejs/vite-plugin-svelte'
+
+/** @type {import("@sveltejs/vite-plugin-svelte").SvelteConfig} */
+export default {
+  // Consult https://svelte.dev/docs#compile-time-svelte-preprocess
+  // for more information about preprocessors
+  preprocess: vitePreprocess(),
+}
diff --git a/example/vanilla-svelte-css/tests/e2e.spec.ts b/example/vanilla-svelte-css/tests/e2e.spec.ts
new file mode 100644
index 0000000..64bb4d9
--- /dev/null
+++ b/example/vanilla-svelte-css/tests/e2e.spec.ts
@@ -0,0 +1,34 @@
+import { expect, test } from "@playwright/test";
+
+test("cssforge variables exist and are applied in the DOM", async ({ page }) => {
+  await page.goto("/");
+
+  const root = await page.evaluate(() => {
+    const css = getComputedStyle(document.documentElement);
+    return {
+      spacing: css.getPropertyValue("--spacing-size-4").trim(),
+      color: css.getPropertyValue("--palette-brand-primary").trim(),
+      type: css.getPropertyValue("--typography_fluid-base-text-m").trim(),
+    };
+  });
+
+  expect(root.spacing).not.toBe("");
+  expect(root.color).not.toBe("");
+  expect(root.type).not.toBe("");
+
+  const tokenCard = page.getByTestId("token-card");
+  await expect(tokenCard).toBeVisible();
+
+  const computed = await tokenCard.evaluate((el) => {
+    const css = getComputedStyle(el);
+    return {
+      paddingTop: css.paddingTop,
+      backgroundColor: css.backgroundColor,
+      fontSize: css.fontSize,
+    };
+  });
+
+  expect(parseFloat(computed.paddingTop)).toBeGreaterThan(0);
+  expect(computed.backgroundColor).not.toBe("rgba(0, 0, 0, 0)");
+  expect(parseFloat(computed.fontSize)).toBeGreaterThan(0);
+});
diff --git a/example/vanilla-svelte-css/tsconfig.app.json b/example/vanilla-svelte-css/tsconfig.app.json
new file mode 100644
index 0000000..31c18cf
--- /dev/null
+++ b/example/vanilla-svelte-css/tsconfig.app.json
@@ -0,0 +1,21 @@
+{
+  "extends": "@tsconfig/svelte/tsconfig.json",
+  "compilerOptions": {
+    "tsBuildInfoFile": "./node_modules/.tmp/tsconfig.app.tsbuildinfo",
+    "target": "ES2022",
+    "useDefineForClassFields": true,
+    "module": "ESNext",
+    "types": ["svelte", "vite/client"],
+    "noEmit": true,
+    /**
+     * Typecheck JS in `.svelte` and `.js` files by default.
+     * Disable checkJs if you'd like to use dynamic types in JS.
+     * Note that setting allowJs false does not prevent the use
+     * of JS in `.svelte` files.
+     */
+    "allowJs": true,
+    "checkJs": true,
+    "moduleDetection": "force"
+  },
+  "include": ["src/**/*.ts", "src/**/*.js", "src/**/*.svelte"]
+}
diff --git a/example/vanilla-svelte-css/tsconfig.json b/example/vanilla-svelte-css/tsconfig.json
new file mode 100644
index 0000000..1ffef60
--- /dev/null
+++ b/example/vanilla-svelte-css/tsconfig.json
@@ -0,0 +1,7 @@
+{
+  "files": [],
+  "references": [
+    { "path": "./tsconfig.app.json" },
+    { "path": "./tsconfig.node.json" }
+  ]
+}
diff --git a/example/vanilla-svelte-css/tsconfig.node.json b/example/vanilla-svelte-css/tsconfig.node.json
new file mode 100644
index 0000000..8a67f62
--- /dev/null
+++ b/example/vanilla-svelte-css/tsconfig.node.json
@@ -0,0 +1,26 @@
+{
+  "compilerOptions": {
+    "tsBuildInfoFile": "./node_modules/.tmp/tsconfig.node.tsbuildinfo",
+    "target": "ES2023",
+    "lib": ["ES2023"],
+    "module": "ESNext",
+    "types": ["node"],
+    "skipLibCheck": true,
+
+    /* Bundler mode */
+    "moduleResolution": "bundler",
+    "allowImportingTsExtensions": true,
+    "verbatimModuleSyntax": true,
+    "moduleDetection": "force",
+    "noEmit": true,
+
+    /* Linting */
+    "strict": true,
+    "noUnusedLocals": true,
+    "noUnusedParameters": true,
+    "erasableSyntaxOnly": true,
+    "noFallthroughCasesInSwitch": true,
+    "noUncheckedSideEffectImports": true
+  },
+  "include": ["vite.config.ts"]
+}
diff --git a/example/vanilla-svelte-css/vite.config.ts b/example/vanilla-svelte-css/vite.config.ts
new file mode 100644
index 0000000..d32eba1
--- /dev/null
+++ b/example/vanilla-svelte-css/vite.config.ts
@@ -0,0 +1,7 @@
+import { defineConfig } from 'vite'
+import { svelte } from '@sveltejs/vite-plugin-svelte'
+
+// https://vite.dev/config/
+export default defineConfig({
+  plugins: [svelte()],
+})
diff --git a/example/vanilla-vue-css/.gitignore b/example/vanilla-vue-css/.gitignore
new file mode 100644
index 0000000..9f96471
--- /dev/null
+++ b/example/vanilla-vue-css/.gitignore
@@ -0,0 +1,28 @@
+# Logs
+logs
+*.log
+npm-debug.log*
+yarn-debug.log*
+yarn-error.log*
+pnpm-debug.log*
+lerna-debug.log*
+
+node_modules
+dist
+dist-ssr
+*.local
+
+# Editor directories and files
+.vscode/*
+!.vscode/extensions.json
+.idea
+.DS_Store
+*.suo
+*.ntvs*
+*.njsproj
+*.sln
+*.sw?
+.cssforge
+playwright-report
+test-results
+.playwright
diff --git a/example/vanilla-vue-css/.vscode/extensions.json b/example/vanilla-vue-css/.vscode/extensions.json
new file mode 100644
index 0000000..a7cea0b
--- /dev/null
+++ b/example/vanilla-vue-css/.vscode/extensions.json
@@ -0,0 +1,3 @@
+{
+  "recommendations": ["Vue.volar"]
+}
diff --git a/example/vanilla-vue-css/README.md b/example/vanilla-vue-css/README.md
new file mode 100644
index 0000000..604a4cc
--- /dev/null
+++ b/example/vanilla-vue-css/README.md
@@ -0,0 +1,34 @@
+# Vue + Vanilla CSS (Vite)
+
+Node.js example that integrates CSS Forge tokens into a Vue app using vanilla CSS.
+
+## Scaffold Source
+
+```bash
+pnpm create vite@latest vanilla-vue-css -- --template vue-ts --no-interactive
+```
+
+## Resolved Versions
+
+- `vue@3.5.28`
+- `vite@7.3.1`
+- `@playwright/test@1.58.2`
+
+## Run Locally
+
+```bash
+pnpm install
+pnpm exec playwright install chromium
+pnpm run cssforge:build-local
+pnpm run cssforge:generate
+pnpm run dev
+```
+
+## E2E Test
+
+```bash
+pnpm run test:e2e
+```
+
+The Playwright test validates CSS Forge variables on `:root` and computed styles on
+`[data-testid="token-card"]`.
diff --git a/example/vanilla-vue-css/cssforge.config.ts b/example/vanilla-vue-css/cssforge.config.ts
new file mode 100644
index 0000000..0b1e64f
--- /dev/null
+++ b/example/vanilla-vue-css/cssforge.config.ts
@@ -0,0 +1,46 @@
+import { defineConfig } from "/cssforge";
+
+export default defineConfig({
+  colors: {
+    palette: {
+      value: {
+        brand: {
+          value: {
+            primary: "#1d4ed8",
+            accent: "#f97316",
+            surface: "#0f172a",
+          },
+        },
+      },
+    },
+  },
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          1: "4px",
+          2: "8px",
+          3: "12px",
+          4: "16px",
+        },
+      },
+    },
+  },
+  typography: {
+    fluid: {
+      base: {
+        value: {
+          minWidth: 320,
+          minFontSize: 16,
+          minTypeScale: 1.2,
+          maxWidth: 1280,
+          maxFontSize: 18,
+          maxTypeScale: 1.25,
+          negativeSteps: 1,
+          positiveSteps: 2,
+          prefix: "text",
+        },
+      },
+    },
+  },
+});
diff --git a/example/vanilla-vue-css/index.html b/example/vanilla-vue-css/index.html
new file mode 100644
index 0000000..50337cc
--- /dev/null
+++ b/example/vanilla-vue-css/index.html
@@ -0,0 +1,13 @@
+<!doctype html>
+<html lang="en">
+  <head>
+    <meta charset="UTF-8" />
+    <link rel="icon" type="image/svg+xml" href="/vite.svg" />
+    <meta name="viewport" content="width=device-width, initial-scale=1.0" />
+    <title>vanilla-vue-css</title>
+  </head>
+  <body>
+    <div id="app"></div>
+    <script type="module" src="/src/main.ts"></script>
+  </body>
+</html>
diff --git a/example/vanilla-vue-css/moon.yml b/example/vanilla-vue-css/moon.yml
new file mode 100644
index 0000000..1663b0c
--- /dev/null
+++ b/example/vanilla-vue-css/moon.yml
@@ -0,0 +1,71 @@
+$schema: "https://moonrepo.dev/schemas/project.json"
+
+language: "typescript"
+layer: "application"
+
+dependsOn:
+  - "cssforge"
+
+tasks:
+  build:
+    script: "vue-tsc -b && vite build"
+    deps:
+      - "^:build"
+  dev:
+    command: "vite"
+    deps:
+      - "^:build"
+    preset: "server"
+    options:
+      runInCI: false
+  dev-e2e:
+    command: "vite"
+    args: ["--host", "127.0.0.1", "--port", "4178"]
+    deps:
+      - "^:build"
+    preset: "server"
+    options:
+      runInCI: false
+  preview:
+    command: "vite"
+    args: ["preview"]
+    deps:
+      - "~:build"
+    preset: "server"
+    options:
+      runInCI: false
+  cssforge-generate:
+    command: "tsx"
+    args:
+      - "../../packages/cssforge/src/cli.ts"
+      - "--prefix"
+      - "."
+      - "--config"
+      - "./cssforge.config.ts"
+      - "--mode"
+      - "css"
+      - "--css"
+      - "./.cssforge/output.css"
+    deps:
+      - "^:build"
+    options:
+      runInCI: false
+  e2e:
+    command: "playwright"
+    args: ["test"]
+    deps:
+      - "~:cssforge-generate"
+    options:
+      runInCI: false
+  e2e-headed:
+    command: "playwright"
+    args: ["test", "--headed"]
+    deps:
+      - "~:cssforge-generate"
+    options:
+      runInCI: false
+  cssforge-build-local:
+    command: "moon"
+    args: ["run", "cssforge:jsr-dry-run"]
+    options:
+      runInCI: false
diff --git a/example/vanilla-vue-css/package.json b/example/vanilla-vue-css/package.json
new file mode 100644
index 0000000..fe8127d
--- /dev/null
+++ b/example/vanilla-vue-css/package.json
@@ -0,0 +1,20 @@
+{
+  "name": "vanilla-vue-css",
+  "private": true,
+  "version": "0.0.0",
+  "type": "module",
+  "dependencies": {
+    "vue": "3.5.28"
+  },
+  "devDependencies": {
+    "@playwright/test": "1.58.2",
+    "@types/node": "^24.10.1",
+    "@vitejs/plugin-vue": "6.0.4",
+    "@vue/tsconfig": "^0.8.1",
+    "typescript": "~5.9.3",
+    "vite": "7.3.1",
+    "vue-tsc": "^3.1.5",
+    "@hebilicious/cssforge": "workspace:*",
+    "tsx": "^4.20.6"
+  }
+}
diff --git a/example/vanilla-vue-css/playwright.config.ts b/example/vanilla-vue-css/playwright.config.ts
new file mode 100644
index 0000000..5871862
--- /dev/null
+++ b/example/vanilla-vue-css/playwright.config.ts
@@ -0,0 +1,25 @@
+import { defineConfig, devices } from "@playwright/test";
+
+export default defineConfig({
+  testDir: "./tests",
+  timeout: 30_000,
+  fullyParallel: true,
+  use: {
+    baseURL: "http://127.0.0.1:4178",
+    trace: "on-first-retry",
+    screenshot: "only-on-failure",
+  },
+  projects: [
+    {
+      name: "chromium",
+      use: { ...devices["Desktop Chrome"] },
+    },
+  ],
+  webServer: {
+    command: "vite --host 127.0.0.1 --port 4178",
+    url: "http://127.0.0.1:4178",
+    reuseExistingServer: !process.env.CI,
+    stdout: "pipe",
+    stderr: "pipe",
+  },
+});
diff --git a/example/vanilla-vue-css/public/vite.svg b/example/vanilla-vue-css/public/vite.svg
new file mode 100644
index 0000000..e7b8dfb
--- /dev/null
+++ b/example/vanilla-vue-css/public/vite.svg
@@ -0,0 +1 @@
+<svg xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" role="img" class="iconify iconify--logos" width="31.88" height="32" preserveAspectRatio="xMidYMid meet" viewBox="0 0 256 257"><defs><linearGradient id="IconifyId1813088fe1fbc01fb466" x1="-.828%" x2="57.636%" y1="7.652%" y2="78.411%"><stop offset="0%" stop-color="#41D1FF"></stop><stop offset="100%" stop-color="#BD34FE"></stop></linearGradient><linearGradient id="IconifyId1813088fe1fbc01fb467" x1="43.376%" x2="50.316%" y1="2.242%" y2="89.03%"><stop offset="0%" stop-color="#FFEA83"></stop><stop offset="8.333%" stop-color="#FFDD35"></stop><stop offset="100%" stop-color="#FFA800"></stop></linearGradient></defs><path fill="url(#IconifyId1813088fe1fbc01fb466)" d="M255.153 37.938L134.897 252.976c-2.483 4.44-8.862 4.466-11.382.048L.875 37.958c-2.746-4.814 1.371-10.646 6.827-9.67l120.385 21.517a6.537 6.537 0 0 0 2.322-.004l117.867-21.483c5.438-.991 9.574 4.796 6.877 9.62Z"></path><path fill="url(#IconifyId1813088fe1fbc01fb467)" d="M185.432.063L96.44 17.501a3.268 3.268 0 0 0-2.634 3.014l-5.474 92.456a3.268 3.268 0 0 0 3.997 3.378l24.777-5.718c2.318-.535 4.413 1.507 3.936 3.838l-7.361 36.047c-.495 2.426 1.782 4.5 4.151 3.78l15.304-4.649c2.372-.72 4.652 1.36 4.15 3.788l-11.698 56.621c-.732 3.542 3.979 5.473 5.943 2.437l1.313-2.028l72.516-144.72c1.215-2.423-.88-5.186-3.54-4.672l-25.505 4.922c-2.396.462-4.435-1.77-3.759-4.114l16.646-57.705c.677-2.35-1.37-4.583-3.769-4.113Z"></path></svg>
\ No newline at end of file
diff --git a/example/vanilla-vue-css/src/App.vue b/example/vanilla-vue-css/src/App.vue
new file mode 100644
index 0000000..46751e1
--- /dev/null
+++ b/example/vanilla-vue-css/src/App.vue
@@ -0,0 +1,11 @@
+<template>
+  <main>
+    <section data-testid="token-card" class="token-card">
+      <h1>CSS Forge + Vue + Vanilla CSS</h1>
+      <p>
+        Tokens are generated from <code>cssforge.config.ts</code> and consumed as CSS
+        variables.
+      </p>
+    </section>
+  </main>
+</template>
diff --git a/example/vanilla-vue-css/src/assets/vue.svg b/example/vanilla-vue-css/src/assets/vue.svg
new file mode 100644
index 0000000..770e9d3
--- /dev/null
+++ b/example/vanilla-vue-css/src/assets/vue.svg
@@ -0,0 +1 @@
+<svg xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" role="img" class="iconify iconify--logos" width="37.07" height="36" preserveAspectRatio="xMidYMid meet" viewBox="0 0 256 198"><path fill="#41B883" d="M204.8 0H256L128 220.8L0 0h97.92L128 51.2L157.44 0h47.36Z"></path><path fill="#41B883" d="m0 0l128 220.8L256 0h-51.2L128 132.48L50.56 0H0Z"></path><path fill="#35495E" d="M50.56 0L128 133.12L204.8 0h-47.36L128 51.2L97.92 0H50.56Z"></path></svg>
\ No newline at end of file
diff --git a/example/vanilla-vue-css/src/components/HelloWorld.vue b/example/vanilla-vue-css/src/components/HelloWorld.vue
new file mode 100644
index 0000000..b58e52b
--- /dev/null
+++ b/example/vanilla-vue-css/src/components/HelloWorld.vue
@@ -0,0 +1,41 @@
+<script setup lang="ts">
+import { ref } from 'vue'
+
+defineProps<{ msg: string }>()
+
+const count = ref(0)
+</script>
+
+<template>
+  <h1>{{ msg }}</h1>
+
+  <div class="card">
+    <button type="button" @click="count++">count is {{ count }}</button>
+    <p>
+      Edit
+      <code>components/HelloWorld.vue</code> to test HMR
+    </p>
+  </div>
+
+  <p>
+    Check out
+    <a href="https://vuejs.org/guide/quick-start.html#local" target="_blank"
+      >create-vue</a
+    >, the official Vue + Vite starter
+  </p>
+  <p>
+    Learn more about IDE Support for Vue in the
+    <a
+      href="https://vuejs.org/guide/scaling-up/tooling.html#ide-support"
+      target="_blank"
+      >Vue Docs Scaling up Guide</a
+    >.
+  </p>
+  <p class="read-the-docs">Click on the Vite and Vue logos to learn more</p>
+</template>
+
+<style scoped>
+.read-the-docs {
+  color: #888;
+}
+</style>
diff --git a/example/vanilla-vue-css/src/main.ts b/example/vanilla-vue-css/src/main.ts
new file mode 100644
index 0000000..2425c0f
--- /dev/null
+++ b/example/vanilla-vue-css/src/main.ts
@@ -0,0 +1,5 @@
+import { createApp } from 'vue'
+import './style.css'
+import App from './App.vue'
+
+createApp(App).mount('#app')
diff --git a/example/vanilla-vue-css/src/style.css b/example/vanilla-vue-css/src/style.css
new file mode 100644
index 0000000..f3d931c
--- /dev/null
+++ b/example/vanilla-vue-css/src/style.css
@@ -0,0 +1,31 @@
+@import "../.cssforge/output.css" layer(cssforge);
+
+:root {
+  color: #fff;
+  background: var(--palette-brand-surface);
+  font-family: Arial, Helvetica, sans-serif;
+}
+
+body {
+  margin: 0;
+}
+
+#app {
+  min-height: 100vh;
+  padding: var(--spacing-size-4);
+}
+
+.token-card {
+  max-width: 42rem;
+  margin: 0 auto;
+  padding: var(--spacing-size-4);
+  border-radius: var(--spacing-size-2);
+  background: var(--palette-brand-primary);
+  font-size: var(--typography_fluid-base-text-m);
+  box-shadow: 0 12px 28px rgb(15 23 42 / 35%);
+}
+
+.token-card h1 {
+  margin: 0 0 var(--spacing-size-2);
+  font-size: var(--typography_fluid-base-text-l);
+}
diff --git a/example/vanilla-vue-css/tests/e2e.spec.ts b/example/vanilla-vue-css/tests/e2e.spec.ts
new file mode 100644
index 0000000..64bb4d9
--- /dev/null
+++ b/example/vanilla-vue-css/tests/e2e.spec.ts
@@ -0,0 +1,34 @@
+import { expect, test } from "@playwright/test";
+
+test("cssforge variables exist and are applied in the DOM", async ({ page }) => {
+  await page.goto("/");
+
+  const root = await page.evaluate(() => {
+    const css = getComputedStyle(document.documentElement);
+    return {
+      spacing: css.getPropertyValue("--spacing-size-4").trim(),
+      color: css.getPropertyValue("--palette-brand-primary").trim(),
+      type: css.getPropertyValue("--typography_fluid-base-text-m").trim(),
+    };
+  });
+
+  expect(root.spacing).not.toBe("");
+  expect(root.color).not.toBe("");
+  expect(root.type).not.toBe("");
+
+  const tokenCard = page.getByTestId("token-card");
+  await expect(tokenCard).toBeVisible();
+
+  const computed = await tokenCard.evaluate((el) => {
+    const css = getComputedStyle(el);
+    return {
+      paddingTop: css.paddingTop,
+      backgroundColor: css.backgroundColor,
+      fontSize: css.fontSize,
+    };
+  });
+
+  expect(parseFloat(computed.paddingTop)).toBeGreaterThan(0);
+  expect(computed.backgroundColor).not.toBe("rgba(0, 0, 0, 0)");
+  expect(parseFloat(computed.fontSize)).toBeGreaterThan(0);
+});
diff --git a/example/vanilla-vue-css/tsconfig.app.json b/example/vanilla-vue-css/tsconfig.app.json
new file mode 100644
index 0000000..8d16e42
--- /dev/null
+++ b/example/vanilla-vue-css/tsconfig.app.json
@@ -0,0 +1,16 @@
+{
+  "extends": "@vue/tsconfig/tsconfig.dom.json",
+  "compilerOptions": {
+    "tsBuildInfoFile": "./node_modules/.tmp/tsconfig.app.tsbuildinfo",
+    "types": ["vite/client"],
+
+    /* Linting */
+    "strict": true,
+    "noUnusedLocals": true,
+    "noUnusedParameters": true,
+    "erasableSyntaxOnly": true,
+    "noFallthroughCasesInSwitch": true,
+    "noUncheckedSideEffectImports": true
+  },
+  "include": ["src/**/*.ts", "src/**/*.tsx", "src/**/*.vue"]
+}
diff --git a/example/vanilla-vue-css/tsconfig.json b/example/vanilla-vue-css/tsconfig.json
new file mode 100644
index 0000000..1ffef60
--- /dev/null
+++ b/example/vanilla-vue-css/tsconfig.json
@@ -0,0 +1,7 @@
+{
+  "files": [],
+  "references": [
+    { "path": "./tsconfig.app.json" },
+    { "path": "./tsconfig.node.json" }
+  ]
+}
diff --git a/example/vanilla-vue-css/tsconfig.node.json b/example/vanilla-vue-css/tsconfig.node.json
new file mode 100644
index 0000000..8a67f62
--- /dev/null
+++ b/example/vanilla-vue-css/tsconfig.node.json
@@ -0,0 +1,26 @@
+{
+  "compilerOptions": {
+    "tsBuildInfoFile": "./node_modules/.tmp/tsconfig.node.tsbuildinfo",
+    "target": "ES2023",
+    "lib": ["ES2023"],
+    "module": "ESNext",
+    "types": ["node"],
+    "skipLibCheck": true,
+
+    /* Bundler mode */
+    "moduleResolution": "bundler",
+    "allowImportingTsExtensions": true,
+    "verbatimModuleSyntax": true,
+    "moduleDetection": "force",
+    "noEmit": true,
+
+    /* Linting */
+    "strict": true,
+    "noUnusedLocals": true,
+    "noUnusedParameters": true,
+    "erasableSyntaxOnly": true,
+    "noFallthroughCasesInSwitch": true,
+    "noUncheckedSideEffectImports": true
+  },
+  "include": ["vite.config.ts"]
+}
diff --git a/example/vanilla-vue-css/vite.config.ts b/example/vanilla-vue-css/vite.config.ts
new file mode 100644
index 0000000..bbcf80c
--- /dev/null
+++ b/example/vanilla-vue-css/vite.config.ts
@@ -0,0 +1,7 @@
+import { defineConfig } from 'vite'
+import vue from '@vitejs/plugin-vue'
+
+// https://vite.dev/config/
+export default defineConfig({
+  plugins: [vue()],
+})
diff --git a/package.json b/package.json
index 7af13f1..2ce587e 100644
--- a/package.json
+++ b/package.json
@@ -1,8 +1,11 @@
 {
-  "name": "@hebilicious/cssforge",
-  "version": "0.4.1",
-  "type": "module",
-  "scripts": {
-    "version": "npx @changesets/cli version && node scripts/sync-version.js"
+  "name": "cssforge-workspace",
+  "private": true,
+  "packageManager": "pnpm@10.30.0",
+  "engines": {
+    "node": "24.13.1"
+  },
+  "devDependencies": {
+    "@changesets/cli": "2.29.7"
   }
 }
diff --git a/CHANGELOG.md b/packages/cssforge/CHANGELOG.md
similarity index 100%
rename from CHANGELOG.md
rename to packages/cssforge/CHANGELOG.md
diff --git a/packages/cssforge/README.md b/packages/cssforge/README.md
new file mode 100644
index 0000000..aeb4c99
--- /dev/null
+++ b/packages/cssforge/README.md
@@ -0,0 +1,1089 @@
+# CSS Forge
+
+0 runtime design tokens generator for modern style systems.
+
+> [!WARNING]
+> CSSForge is an experimental library and its API _will_ change while I figure out a
+> schema that makes sense. That being said, when the schema change, you should be able to
+> search and replace your variables names.
+
+## Why
+
+CSS forge is library that leverages modern CSS features and conventions to help you
+generate CSS custom properties (css variables).
+
+At the core of CSSforge is the schema : A serializable configuration object.
+
+CSSforge has 0 runtime and generate at build time raw CSS, Typescript or JSON.
+
+This intentionally keeps things simple and flexible, and allows you to integrate it with
+any framework or CSS workflow.
+
+In the future, CSSforge will try to integrate with popular design tools such as Figma.
+
+## Features
+
+- 🎨 **Colors**: Create palettes, gradients and themes. Automatically convert to OKLCH.
+- 📐 **Typography**: Generate fluid typography
+- 📏 **Spacing**: Organise spacing utilities
+- 📦 **Primitives**: Define custom design tokens
+- 🎯 **Zero Runtime**: All processing happens at build time
+- 🔄 **Watch Mode**: Auto-regenerate when your config changes
+- 🔌 **Framework Agnostic**: Use with any CSS workflow
+
+## Installation
+
+For programmatic usage, you can install CSS Forge as a dependency:
+
+```bash
+# Using npm
+npx jsr add @hebilicious/cssforge
+
+# Using pnpm (10.9 +)
+pnpm i jsr:@hebilicious/cssforge
+```
+
+Then to run CSS forge, add the following script to your `package.json`:
+
+```json
+{
+  "scripts": {
+    "cssforge": "tsx ./node_modules/@hebilicious/cssforge/src/cli.ts"
+  }
+}
+```
+
+then run :
+
+```bash
+pnpm run cssforge
+```
+
+## Contributing Workflow
+
+This repository is a pnpm workspace orchestrated with moon.
+
+```bash
+pnpm install
+moon run :format
+moon run cssforge:test
+moon run cssforge:typecheck
+moon run cssforge:build
+moon run cssforge:jsr-dry-run
+```
+
+## Quick Start
+
+1. Create a configuration file (`cssforge.config.ts`):
+
+```typescript
+import { defineConfig } from "jsr:@hebilicious/cssforge";
+
+export default defineConfig({
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          1: "0.25rem",
+          2: "0.5rem",
+          3: "0.75rem",
+          4: "1rem",
+        },
+      },
+    },
+  },
+  typography: {
+    fluid: {
+      arial: {
+        value: {
+          minWidth: 320,
+          minFontSize: 14,
+          minTypeScale: 1.25,
+          maxWidth: 1435,
+          maxFontSize: 16,
+          maxTypeScale: 1.25,
+          positiveSteps: 5,
+          negativeSteps: 3,
+        },
+      },
+    },
+  },
+  colors: {
+    palette: {
+      value: {
+        coral: {
+          value: {
+            100: { hex: "#FF7F50" },
+          },
+        },
+        mint: {
+          value: {
+            100: { hex: "#4ADE80" },
+          },
+        },
+        indigo: {
+          value: {
+            100: { hex: "#4F46E5" },
+          },
+        },
+      },
+    },
+  },
+});
+```
+
+2. Run CSS Forge with the CLI :
+
+If you're using a `package.json`, add the following to your scripts:
+
+```json
+{
+  "scripts": {
+    "cssforge": "tsx ./node_modules/@hebilicious/cssforge/src/cli.ts"
+  }
+}
+```
+
+Then run the following command :
+
+```bash
+pnpm run cssforge # Basic usage
+pnpm run cssforge -- --help # To see all options
+pnpm run cssforge -- --watch # To watch for changes
+```
+
+3. Use the generated variables in your CSS:
+
+For example, you can import as a layer :
+
+```css
+@import "cssforge.output.css" layer(cssforge);
+
+.button {
+  background-color: var(--color-primary-500);
+  padding: var(--size-2) var(--size-4);
+}
+```
+
+> !IMPORTANT Do not manually edit the generated CSS file, edit the configuration file
+> instead and regenerate.
+
+4. Use the generated css in your JS/TS :
+
+```typescript
+import { cssForge } from "./.cssforge/output.ts";
+
+// Use like this anywhere :
+//`cssForge.colors.palette.basic.white` is fully typed { key: --myKey, value: white, variable: --key: white }
+
+export { cssForge };
+```
+
+## Configuration
+
+### Colors
+
+Define colors in any format - they'll be automatically converted to OKLCH. You can compose
+colors from the palette into gradients and themes.
+
+<!-- md:generate defineConfig
+export default defineConfig({
+  colors: {
+    palette: {
+      value: {
+        simple: {
+          value: {
+            white: "oklch(100% 0 0)",
+            black: "#000",
+            green: { rgb: [0, 255, 0] },
+            blue: { hsl: [240, 100, 50] },
+            violet: { oklch: "oklch(0.7 0.2 270)" },
+            red: { hex: "#FF0000" },
+          },
+        },
+        another: {
+          value: {
+            yellow: { hex: "#FFFF00" },
+            cyan: { hex: "#00FFFF" },
+          },
+          settings: {
+            selector: ".Another",
+          },
+        },
+      },
+    },
+    gradients: {
+      value: {
+        "white-green": {
+          value: {
+            primary: {
+              value: "linear-gradient(to right, var(--c1), var(--c2))",
+              variables: {
+                "c1": "palette.simple.white",
+                "c2": "palette.simple.green",
+              },
+            },
+          },
+        },
+      },
+    },
+    theme: {
+      light: {
+        value: {
+          background: {
+            value: {
+              primary: "var(--1)",
+              secondary: "var(--2)",
+            },
+            variables: {
+              1: "palette.simple.white",
+              2: "gradients.white-green.primary", //Reference the color name directly.
+            },
+            settings: {
+              variantNameOnly: true,
+            },
+          },
+        },
+      },
+      dark: {
+        value: {
+          background: {
+            value: {
+              primary: "var(--1)",
+              secondary: "var(--2)",
+            },
+            variables: {
+              1: "palette.another.yellow",
+              2: "palette.another.cyan",
+            },
+            settings: {
+              variantNameOnly: true,
+            },
+          },
+        },
+        settings: {
+          atRule: "@media (prefers-color-scheme: dark)",
+        },
+      },
+      pink: {
+        value: {
+          background: {
+            value: {
+              primary: "var(--1)",
+              secondary: "var(--2)",
+            },
+            variables: {
+              1: "palette.simple.red",
+              2: "palette.simple.violet",
+            },
+            settings: {
+              variantNameOnly: true,
+            },
+          },
+        },
+        settings: {
+          selector: ".ThemePink",
+        },
+      },
+    },
+  },
+});
+-->
+
+```typescript
+export default defineConfig({
+  colors: {
+    palette: {
+      value: {
+        simple: {
+          value: {
+            white: "oklch(100% 0 0)",
+            black: "#000",
+            green: { rgb: [0, 255, 0] },
+            blue: { hsl: [240, 100, 50] },
+            violet: { oklch: "oklch(0.7 0.2 270)" },
+            red: { hex: "#FF0000" },
+          },
+        },
+        another: {
+          value: {
+            yellow: { hex: "#FFFF00" },
+            cyan: { hex: "#00FFFF" },
+          },
+          settings: {
+            selector: ".Another",
+          },
+        },
+      },
+    },
+    gradients: {
+      value: {
+        "white-green": {
+          value: {
+            primary: {
+              value: "linear-gradient(to right, var(--c1), var(--c2))",
+              variables: {
+                "c1": "palette.simple.white",
+                "c2": "palette.simple.green",
+              },
+            },
+          },
+        },
+      },
+    },
+    theme: {
+      light: {
+        value: {
+          background: {
+            value: {
+              primary: "var(--1)",
+              secondary: "var(--2)",
+            },
+            variables: {
+              1: "palette.simple.white",
+              2: "gradients.white-green.primary", //Reference the color name directly.
+            },
+            settings: {
+              variantNameOnly: true,
+            },
+          },
+        },
+      },
+      dark: {
+        value: {
+          background: {
+            value: {
+              primary: "var(--1)",
+              secondary: "var(--2)",
+            },
+            variables: {
+              1: "palette.another.yellow",
+              2: "palette.another.cyan",
+            },
+            settings: {
+              variantNameOnly: true,
+            },
+          },
+        },
+        settings: {
+          atRule: "@media (prefers-color-scheme: dark)",
+        },
+      },
+      pink: {
+        value: {
+          background: {
+            value: {
+              primary: "var(--1)",
+              secondary: "var(--2)",
+            },
+            variables: {
+              1: "palette.simple.red",
+              2: "palette.simple.violet",
+            },
+            settings: {
+              variantNameOnly: true,
+            },
+          },
+        },
+        settings: {
+          selector: ".ThemePink",
+        },
+      },
+    },
+  },
+});
+```
+
+This will generate the following CSS :
+
+```css
+/*____ CSSForge ____*/
+:root {
+/*____ Colors ____*/
+/* Palette */
+/* simple */
+--palette-simple-white: oklch(100% 0 0);
+--palette-simple-black: oklch(0% 0 0);
+--palette-simple-green: oklch(86.644% 0.29483 142.49535);
+--palette-simple-blue: oklch(45.201% 0.31321 264.05202);
+--palette-simple-violet: oklch(70% 0.2 270);
+--palette-simple-red: oklch(62.796% 0.25768 29.23388);
+/* Gradients */
+/* white-green */
+--gradients-white-green-primary: linear-gradient(to right, var(--palette-simple-white), var(--palette-simple-green));
+/* Themes */
+/* Theme: light */
+/* background */
+--primary: var(--palette-simple-white);
+--secondary: var(--gradients-white-green-primary);
+/* Theme: dark */
+@media (prefers-color-scheme: dark) {
+  /* background */
+  --primary: var(--palette-another-yellow);
+  --secondary: var(--palette-another-cyan);
+}
+}
+/* another */
+.Another {
+  --palette-another-yellow: oklch(96.798% 0.21101 109.76924);
+  --palette-another-cyan: oklch(90.54% 0.15455 194.76896);
+}
+/* Theme: pink */
+.ThemePink {
+  /* background */
+  --primary: var(--palette-simple-red);
+  --secondary: var(--palette-simple-violet);
+}
+```
+
+<!-- /md:generate -->
+
+#### Condition
+
+You can conditionnally apply colors, gradients or themes by setting the `atRule` or the
+`selector` properties. Your variables will be wrapped within `:root` and the selectors
+will be placed outside of it.
+
+#### Theme: Variant Name Only
+
+When working with themes, you can choose to only include the variant name in the CSS
+variable name by setting `variantNameOnly: true` in the color definition settings. This is
+usually used in combination with `selector` to conditionnally apply themes.
+
+- Default: `--theme-${themeName}-${colorName}-${variantName}`
+- VariantOnly Name: `--${variantName}`
+- Path : `theme.${themeName}.${colorName}.${variantName}`
+
+### Spacing
+
+Define custom spacing scale, that can be referenced for other types, such as primitives.
+By default all spacing values are converted to from `px` to `rem`. This can be disabled
+with the settings.
+
+<!-- md:generate defineConfig
+export default defineConfig({
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          1: "0.25rem",
+          2: "0.5rem",
+          3: "0.75rem",
+          4: "16px",
+        },
+        settings: { pxToRem: true, rem: 16 }, // Optional, default settings
+      },
+    },
+  },
+});
+-->
+
+```typescript
+export default defineConfig({
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          1: "0.25rem",
+          2: "0.5rem",
+          3: "0.75rem",
+          4: "16px",
+        },
+        settings: { pxToRem: true, rem: 16 }, // Optional, default settings
+      },
+    },
+  },
+});
+```
+
+This will generate the following CSS :
+
+```css
+/*____ CSSForge ____*/
+:root {
+/*____ Spacing ____*/
+--spacing-size-1: 0.25rem;
+--spacing-size-2: 0.5rem;
+--spacing-size-3: 0.75rem;
+--spacing-size-4: 1rem;
+}
+```
+
+<!-- /md:generate -->
+
+#### Fluid Spacing (Utopia)
+
+You can generate fluid spacing scales powered by [Utopia](https://utopia.fyi). Fluid
+scales output `clamp()` expressions which interpolate between a minimum and maximum size
+across a viewport range.
+
+<!-- md:generate defineConfig
+export default defineConfig({
+  spacing: {
+    fluid: {
+      base: {
+        value: {
+          minSize: 4,
+          maxSize: 24,
+          minWidth: 320,
+          maxWidth: 1280,
+          negativeSteps: [0],
+          positiveSteps: [3],
+          prefix: "hi",
+        },
+      },
+    },
+  },
+});
+-->
+
+```typescript
+export default defineConfig({
+  spacing: {
+    fluid: {
+      base: {
+        value: {
+          minSize: 4,
+          maxSize: 24,
+          minWidth: 320,
+          maxWidth: 1280,
+          negativeSteps: [0],
+          positiveSteps: [3],
+          prefix: "hi",
+        },
+      },
+    },
+  },
+});
+```
+
+This will generate the following CSS :
+
+```css
+/*____ CSSForge ____*/
+:root {
+/*____ Spacing ____*/
+--spacing_fluid-base-hi-xs: clamp(0rem, 0rem + 0vw, 0rem);
+--spacing_fluid-base-hi-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
+--spacing_fluid-base-hi-m: clamp(0.75rem, -0.5rem + 6.25vw, 4.5rem);
+--spacing_fluid-base-hi-xs-s: clamp(0rem, -0.5rem + 2.5vw, 1.5rem);
+--spacing_fluid-base-hi-s-m: clamp(0.25rem, -1.1667rem + 7.0833vw, 4.5rem);
+}
+```
+
+<!-- /md:generate -->
+
+You can combine fluid and static spacing:
+
+<!-- md:generate defineConfig
+export default defineConfig({
+  spacing: {
+    fluid: {
+      base: {
+        value: {
+          minSize: 4,
+          maxSize: 24,
+          minWidth: 320,
+          maxWidth: 1280,
+          positiveSteps: [1.5, 2, 3, 4, 6],
+          negativeSteps: [0.75, 0.5, 0.25],
+          prefix: "smooth",
+        },
+      },
+    },
+    custom: {
+      gap: {
+        value: { 1: "4px", 2: "8px" },
+      },
+    },
+  },
+});
+-->
+
+```typescript
+export default defineConfig({
+  spacing: {
+    fluid: {
+      base: {
+        value: {
+          minSize: 4,
+          maxSize: 24,
+          minWidth: 320,
+          maxWidth: 1280,
+          positiveSteps: [1.5, 2, 3, 4, 6],
+          negativeSteps: [0.75, 0.5, 0.25],
+          prefix: "smooth",
+        },
+      },
+    },
+    custom: {
+      gap: {
+        value: { 1: "4px", 2: "8px" },
+      },
+    },
+  },
+});
+```
+
+This will generate the following CSS :
+
+```css
+/*____ CSSForge ____*/
+:root {
+/*____ Spacing ____*/
+--spacing_fluid-base-smooth-3xs: clamp(0.0625rem, -0.0417rem + 0.5208vw, 0.375rem);
+--spacing_fluid-base-smooth-2xs: clamp(0.125rem, -0.0833rem + 1.0417vw, 0.75rem);
+--spacing_fluid-base-smooth-xs: clamp(0.1875rem, -0.125rem + 1.5625vw, 1.125rem);
+--spacing_fluid-base-smooth-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
+--spacing_fluid-base-smooth-m: clamp(0.375rem, -0.25rem + 3.125vw, 2.25rem);
+--spacing_fluid-base-smooth-l: clamp(0.5rem, -0.3333rem + 4.1667vw, 3rem);
+--spacing_fluid-base-smooth-xl: clamp(0.75rem, -0.5rem + 6.25vw, 4.5rem);
+--spacing_fluid-base-smooth-2xl: clamp(1rem, -0.6667rem + 8.3333vw, 6rem);
+--spacing_fluid-base-smooth-3xl: clamp(1.5rem, -1rem + 12.5vw, 9rem);
+--spacing_fluid-base-smooth-3xs-2xs: clamp(0.0625rem, -0.1667rem + 1.1458vw, 0.75rem);
+--spacing_fluid-base-smooth-2xs-xs: clamp(0.125rem, -0.2083rem + 1.6667vw, 1.125rem);
+--spacing_fluid-base-smooth-xs-s: clamp(0.1875rem, -0.25rem + 2.1875vw, 1.5rem);
+--spacing_fluid-base-smooth-s-m: clamp(0.25rem, -0.4167rem + 3.3333vw, 2.25rem);
+--spacing_fluid-base-smooth-m-l: clamp(0.375rem, -0.5rem + 4.375vw, 3rem);
+--spacing_fluid-base-smooth-l-xl: clamp(0.5rem, -0.8333rem + 6.6667vw, 4.5rem);
+--spacing_fluid-base-smooth-xl-2xl: clamp(0.75rem, -1rem + 8.75vw, 6rem);
+--spacing_fluid-base-smooth-2xl-3xl: clamp(1rem, -1.6667rem + 13.3333vw, 9rem);
+--spacing-gap-1: 0.25rem;
+--spacing-gap-2: 0.5rem;
+}
+```
+
+<!-- /md:generate -->
+
+### Typography
+
+Define your typography, with fluid typescales powered by
+[utopia](https://utopia.fyi/type/calculator):
+
+<!-- md:generate defineConfig
+export default defineConfig({
+  typography: {
+    weight: {
+      arial: {
+        value: {
+          regular: "600",
+        },
+      },
+    },
+    fluid: {
+      arial: {
+        value: {
+          minWidth: 320,
+          minFontSize: 14,
+          minTypeScale: 1.25,
+          maxWidth: 1435,
+          maxFontSize: 16,
+          maxTypeScale: 1.25,
+          positiveSteps: 5,
+          negativeSteps: 3,
+        },
+      },
+    },
+  },
+});
+-->
+
+```typescript
+export default defineConfig({
+  typography: {
+    weight: {
+      arial: {
+        value: {
+          regular: "600",
+        },
+      },
+    },
+    fluid: {
+      arial: {
+        value: {
+          minWidth: 320,
+          minFontSize: 14,
+          minTypeScale: 1.25,
+          maxWidth: 1435,
+          maxFontSize: 16,
+          maxTypeScale: 1.25,
+          positiveSteps: 5,
+          negativeSteps: 3,
+        },
+      },
+    },
+  },
+});
+```
+
+This will generate the following CSS :
+
+```css
+/*____ CSSForge ____*/
+:root {
+/*____ Typography ____*/
+--typography_fluid-arial-4xl: clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem);
+--typography_fluid-arial-3xl: clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem);
+--typography_fluid-arial-2xl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);
+--typography_fluid-arial-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);
+--typography_fluid-arial-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);
+--typography_fluid-arial-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);
+--typography_fluid-arial-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);
+--typography_fluid-arial-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);
+--typography_fluid-arial-2xs: clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem);
+--typography-weight-arial-regular: 600;
+}
+```
+
+<!-- /md:generate -->
+
+#### Customizing Fluid Typography Scales
+
+You can customize the typescale by providing your prefix and custom labels. The prefix
+will overwrite the name of the key that you are using to define your typography.
+
+<!-- md:generate defineConfig
+const config = defineConfig({
+  typography: {
+    fluid: {
+      comicsans: {
+        value: {
+          minWidth: 320,
+          minFontSize: 14,
+          minTypeScale: 1.25,
+          maxWidth: 1435,
+          maxFontSize: 16,
+          maxTypeScale: 1.25,
+          positiveSteps: 2,
+          negativeSteps: 2,
+          prefix: "text",
+        },
+        settings: {
+          customLabel: {
+            "-2": "a",
+            "-1": "b",
+            "0": "c",
+            "1": "d",
+            "2": "e",
+          },
+        },
+      },
+    },
+  },
+});
+-->
+
+```typescript
+const config = defineConfig({
+  typography: {
+    fluid: {
+      comicsans: {
+        value: {
+          minWidth: 320,
+          minFontSize: 14,
+          minTypeScale: 1.25,
+          maxWidth: 1435,
+          maxFontSize: 16,
+          maxTypeScale: 1.25,
+          positiveSteps: 2,
+          negativeSteps: 2,
+          prefix: "text",
+        },
+        settings: {
+          customLabel: {
+            "-2": "a",
+            "-1": "b",
+            "0": "c",
+            "1": "d",
+            "2": "e",
+          },
+        },
+      },
+    },
+  },
+});
+```
+
+This will generate the following CSS :
+
+```css
+/*____ CSSForge ____*/
+:root {
+/*____ Typography ____*/
+--typography_fluid-comicsans-text-e: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);
+--typography_fluid-comicsans-text-d: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);
+--typography_fluid-comicsans-text-c: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);
+--typography_fluid-comicsans-text-b: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);
+--typography_fluid-comicsans-text-a: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);
+}
+```
+
+<!-- /md:generate -->
+
+### Primitives
+
+More flexible than other types, primitives allow you to define any type of token by
+composing the base types.
+
+<!-- md:generate defineConfig
+export default defineConfig({
+  typography: {
+    fluid: {
+      arial: {
+        value: {
+          minWidth: 320,
+          minFontSize: 14,
+          minTypeScale: 1.25,
+          maxWidth: 1435,
+          maxFontSize: 16,
+          maxTypeScale: 1.25,
+          positiveSteps: 5,
+          negativeSteps: 3,
+        },
+      },
+    },
+  },
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          2: "0.5rem",
+          3: "0.75rem",
+        },
+      },
+    },
+  },
+  primitives: {
+    button: {
+      value: {
+        small: {
+          value: {
+            width: "120px",
+            height: "40px",
+            fontSize: "var(--base)",
+            radius: "8px",
+            padding: "var(--2) var(--3)",
+          },
+          variables: {
+            "base": "typography_fluid.arial@m",
+            "2": "spacing.custom.size.2",
+            "3": "spacing.custom.size.3",
+          },
+        },
+      },
+    },
+  },
+});
+```
+-->
+
+```typescript
+export default defineConfig({
+  typography: {
+    fluid: {
+      arial: {
+        value: {
+          minWidth: 320,
+          minFontSize: 14,
+          minTypeScale: 1.25,
+          maxWidth: 1435,
+          maxFontSize: 16,
+          maxTypeScale: 1.25,
+          positiveSteps: 5,
+          negativeSteps: 3,
+        },
+      },
+    },
+  },
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          2: "0.5rem",
+          3: "0.75rem",
+        },
+      },
+    },
+  },
+  primitives: {
+    button: {
+      value: {
+        small: {
+          value: {
+            width: "120px",
+            height: "40px",
+            fontSize: "var(--base)",
+            radius: "8px",
+            padding: "var(--2) var(--3)",
+          },
+          variables: {
+            "base": "typography_fluid.arial@m",
+            "2": "spacing.custom.size.2",
+            "3": "spacing.custom.size.3",
+          },
+        },
+      },
+    },
+  },
+});
+```
+
+This will generate the following CSS :
+
+```css
+/*____ CSSForge ____*/
+:root {
+/*____ Spacing ____*/
+--spacing-size-2: 0.5rem;
+--spacing-size-3: 0.75rem;
+/*____ Typography ____*/
+--typography_fluid-arial-4xl: clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem);
+--typography_fluid-arial-3xl: clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem);
+--typography_fluid-arial-2xl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);
+--typography_fluid-arial-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);
+--typography_fluid-arial-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);
+--typography_fluid-arial-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);
+--typography_fluid-arial-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);
+--typography_fluid-arial-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);
+--typography_fluid-arial-2xs: clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem);
+/*____ Primitives ____*/
+/* button */
+--button-small-width: 7.5rem;
+--button-small-height: 2.5rem;
+--button-small-fontSize: var(--typography_fluid-arial-m);
+--button-small-radius: 0.5rem;
+--button-small-padding: var(--spacing-size-2) var(--spacing-size-3);
+}
+```
+
+<!-- /md:generate -->
+
+## Referencing Variables
+
+### Basic Referencing
+
+To reference any variable, use the `.` notation to navigate through the schema without
+using `.value`.
+
+For example, if an object has the following structure :
+
+```typescript
+{
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          1: "0.25rem",
+        },
+      },
+    },
+  },
+}
+```
+
+The reference would be : `spacing.custom.size.1`, not `spacing.custom.size.value.1`.
+
+#### Referencing Fluid Spacing
+
+To reference fluid spacing, use the `@` symbol and the label of the scale; ie:
+`spacing_fluid-base@xs`. Do not include the prefix in the reference. The labels follow the
+following convention :
+
+- 3xs
+- 2xs
+- xs
+- s
+- m
+- l
+- xl
+- 2xl
+- 3xl
+
+### Referencing Fluid Typography
+
+To reference fluid typography, use the `@` symbol and the label of the scale; ie:
+`typography_fluid.comicsans@a`. Do not include the prefix in the reference. The labels
+follow the following convention :
+
+- 3xs
+- 2xs
+- xs
+- s
+- m
+- l
+- xl
+- 2xl
+- 3xl
+
+## CLI Usage
+
+Assuming you have added the script to your `package.json`, you can run CSS Forge like this
+:
+
+```bash
+# Basic usage
+pnpm run cssforge
+
+# Watch mode
+pnpm run cssforge -- --watch
+
+# Custom paths and output 
+pnpm run cssforge -- --config ./foo/bar/custom-path.ts --css ./dist/design-tokens.css --ts ./dist/design-tokens.ts --json ./dist/design-tokens.json --mode all
+```
+
+## Programmatic Usage
+
+You can also use CSS Forge programmatically:
+
+```typescript
+import { generateCSS } from "jsr:@hebilicious/cssforge";
+
+// Generate CSS string
+const css = generateCSS(config);
+```
+
+## Agentic usage
+
+CSSForge is intentionally designed to be extremely simple and integrate well with various
+agents, such as Github Copilot, Gemini, Claude Code ... While there's no documentation
+yet, you can add the README file to the agent context directly.
+
+For most agents, this syntax works
+`@https://raw.githubusercontent.com/Hebilicious/cssforge/refs/heads/main/README.md`.
+
+## Best Practices
+
+- **Version Control**: Commit your generated CSS files
+- **CSS Layers**: Use `@layer` to manage specificity
+- **Config First**: Always edit the config file, never edit the generated files
+
+## Examples
+
+Check out our examples:
+
+- Basic
+  - [Basic Setup](./example/basic)
+- Tailwind Integrations
+  - [Next.js](./example/tailwind-nextjs)
+  - [Nuxt](./example/tailwind-nuxt)
+  - [SolidStart](./example/tailwind-solidstart)
+  - [SvelteKit](./example/tailwind-sveltekit)
+- Vanilla CSS Integrations
+  - [React (Vite)](./example/vanilla-react-css)
+  - [Vue (Vite)](./example/vanilla-vue-css)
+  - [Svelte (Vite)](./example/vanilla-svelte-css)
+  - [Solid (Vite)](./example/vanilla-solid-css)
+
+## TODO
+
+- [ ] Module:
+      [Custom Media Queries](https://www.w3.org/TR/mediaqueries-5/#at-ruledef-custom-media)
+- [ ] Typography : Line Height
+- [ ] Stable schema spec
+- [ ] VSCode Extension
+- [ ] Bundlers Plugin (Vite, Rollup, Webpack ...)
+- [ ] Nuxt Module
+
+## License
+
+MIT
diff --git a/packages/cssforge/deno.json b/packages/cssforge/deno.json
new file mode 100644
index 0000000..7f891e1
--- /dev/null
+++ b/packages/cssforge/deno.json
@@ -0,0 +1,18 @@
+{
+	"name": "@hebilicious/cssforge",
+	"version": "0.4.0",
+	"license": "MIT",
+	"exports": {
+		".": "./src/mod.ts",
+		"./cli": "./src/cli.ts"
+	},
+	"imports": {
+		"citty": "npm:citty@0.1.6",
+		"chokidar": "npm:chokidar@4.0.3",
+		"colorjs.io": "npm:colorjs.io@0.5.2",
+		"utopia-core": "npm:utopia-core@1.6.0"
+	},
+	"publish": {
+		"include": ["src/**/*.ts", "README.md", "CHANGELOG.md"]
+	}
+}
diff --git a/packages/cssforge/moon.yml b/packages/cssforge/moon.yml
new file mode 100644
index 0000000..90bb276
--- /dev/null
+++ b/packages/cssforge/moon.yml
@@ -0,0 +1,112 @@
+$schema: "https://moonrepo.dev/schemas/project.json"
+
+language: "typescript"
+layer: "library"
+
+tags:
+  - "cssforge"
+
+tasks:
+  format:
+    command: "biome"
+    args:
+      - "format"
+      - "src"
+      - "tests"
+      - "scripts"
+      - "package.json"
+      - "tsconfig.json"
+      - "vitest.config.ts"
+      - "tsup.config.ts"
+      - "deno.json"
+    inputs:
+      - "src/**/*"
+      - "tests/**/*"
+      - "scripts/**/*"
+      - "package.json"
+      - "tsconfig.json"
+      - "vitest.config.ts"
+      - "tsup.config.ts"
+      - "deno.json"
+      - "/biome.json"
+  format-write:
+    command: "biome"
+    args:
+      - "format"
+      - "src"
+      - "tests"
+      - "scripts"
+      - "package.json"
+      - "tsconfig.json"
+      - "vitest.config.ts"
+      - "tsup.config.ts"
+      - "deno.json"
+      - "--write"
+    options:
+      runInCI: false
+  lint:
+    command: "biome"
+    args: ["lint", "src", "tests", "scripts"]
+    inputs:
+      - "src/**/*"
+      - "tests/**/*"
+      - "scripts/**/*"
+      - "/biome.json"
+  typecheck:
+    command: "tsc"
+    args: ["--project", "tsconfig.json", "--noEmit"]
+    inputs:
+      - "src/**/*"
+      - "tests/**/*"
+      - "scripts/**/*"
+      - "tsconfig.json"
+      - "/tsconfig.base.json"
+  test:
+    command: "vitest"
+    args: ["run"]
+    inputs:
+      - "src/**/*"
+      - "tests/**/*"
+      - "vitest.config.ts"
+  test-watch:
+    command: "vitest"
+    options:
+      runInCI: false
+      persistent: true
+      cache: false
+      outputStyle: "stream"
+  build:
+    command: "tsup"
+    inputs:
+      - "src/**/*"
+      - "tsup.config.ts"
+      - "tsconfig.json"
+    outputs:
+      - "dist"
+  jsr-dry-run:
+    command: "npx"
+    args: ["jsr", "publish", "--dry-run", "--allow-dirty"]
+    deps:
+      - "~:build"
+    inputs:
+      - "src/**/*"
+      - "deno.json"
+      - "README.md"
+      - "CHANGELOG.md"
+  jsr-publish:
+    command: "npx"
+    args: ["jsr", "publish"]
+    deps:
+      - "~:build"
+    inputs:
+      - "src/**/*"
+      - "deno.json"
+      - "README.md"
+      - "CHANGELOG.md"
+    options:
+      runInCI: "only"
+  readme-update:
+    command: "tsx"
+    args: ["./scripts/update-readme.ts"]
+    options:
+      runInCI: false
diff --git a/packages/cssforge/package.json b/packages/cssforge/package.json
new file mode 100644
index 0000000..758c9a2
--- /dev/null
+++ b/packages/cssforge/package.json
@@ -0,0 +1,39 @@
+{
+	"name": "@hebilicious/cssforge",
+	"version": "0.4.0",
+	"description": "0 runtime design tokens generator for modern style systems.",
+	"license": "MIT",
+	"type": "module",
+	"main": "./dist/mod.js",
+	"types": "./dist/mod.d.ts",
+	"exports": {
+		".": {
+			"types": "./dist/mod.d.ts",
+			"import": "./dist/mod.js",
+			"default": "./dist/mod.js"
+		},
+		"./cli": "./dist/cli.js"
+	},
+	"files": [
+		"dist",
+		"src",
+		"README.md",
+		"CHANGELOG.md",
+		"deno.json"
+	],
+	"dependencies": {
+		"chokidar": "4.0.3",
+		"citty": "0.1.6",
+		"colorjs.io": "0.5.2",
+		"utopia-core": "1.6.0"
+	},
+	"devDependencies": {
+		"@biomejs/biome": "2.4.2",
+		"@types/node": "24.3.0",
+		"mdbox": "0.1.1",
+		"tsup": "8.5.0",
+		"tsx": "4.20.6",
+		"typescript": "5.9.3",
+		"vitest": "4.0.18"
+	}
+}
diff --git a/packages/cssforge/scripts/sync-version.js b/packages/cssforge/scripts/sync-version.js
new file mode 100644
index 0000000..51ee669
--- /dev/null
+++ b/packages/cssforge/scripts/sync-version.js
@@ -0,0 +1,16 @@
+import fs from "node:fs";
+import path from "node:path";
+import { fileURLToPath } from "node:url";
+
+const scriptDir = path.dirname(fileURLToPath(import.meta.url));
+const packageRoot = path.resolve(scriptDir, "..");
+
+const packageJsonPath = path.join(packageRoot, "package.json");
+const denoJsonPath = path.join(packageRoot, "deno.json");
+
+const packageJson = JSON.parse(fs.readFileSync(packageJsonPath, "utf8"));
+const denoJson = JSON.parse(fs.readFileSync(denoJsonPath, "utf8"));
+
+denoJson.version = packageJson.version;
+
+fs.writeFileSync(denoJsonPath, `${JSON.stringify(denoJson, null, 2)}\n`);
diff --git a/packages/cssforge/scripts/update-readme.ts b/packages/cssforge/scripts/update-readme.ts
new file mode 100644
index 0000000..78679b6
--- /dev/null
+++ b/packages/cssforge/scripts/update-readme.ts
@@ -0,0 +1,156 @@
+/**
+ * Script to parse README.md and generate documentation within delimiters.
+ *
+ * Delimiters:
+ *  startDefinition: <!-- md:generate defineConfig
+ *  startCode: -->
+ *  end: <!-- /md:generate -->
+ */
+
+import { randomUUID } from "node:crypto";
+import { mkdtemp, readFile, rm, writeFile } from "node:fs/promises";
+import { tmpdir } from "node:os";
+import { join, resolve } from "node:path";
+import { pathToFileURL } from "node:url";
+import { md } from "mdbox";
+import process from "node:process";
+import { generateCSS } from "../src/generator.ts";
+import type { CSSForgeConfig } from "../src/config.ts";
+
+const PACKAGE_ROOT = process.cwd();
+const README_PATH = resolve(PACKAGE_ROOT, "../../README.md");
+
+const START_DEFINITION = "<!-- md:generate defineConfig";
+const START_CODE = "-->";
+const END_BLOCK = "<!-- /md:generate -->";
+
+function buildReplacement(tsSource: string, css: string): string {
+	const tsBlock = md.codeBlock(tsSource.trim(), "typescript");
+	const cssBlock = md.codeBlock(css.trim(), "css");
+
+	return [
+		"",
+		tsBlock,
+		"",
+		"This will generate the following CSS :",
+		"",
+		cssBlock,
+		"",
+	].join("\n");
+}
+
+function wrapSource(tsSource: string): string {
+	const hasDefaultExport = /export\s+default\s+/m.test(tsSource);
+	const hasDefineConfigCall = /defineConfig\s*\(/m.test(tsSource);
+	const hasConfigVar = /\bconst\s+config\b|\blet\s+config\b|\bvar\s+config\b/m.test(
+		tsSource,
+	);
+	const srcModUrl = pathToFileURL(join(PACKAGE_ROOT, "src", "mod.ts")).href;
+	const importLine = `import { defineConfig } from "${srcModUrl}";\n`;
+
+	let normalized = tsSource.trim();
+	if (!hasDefaultExport) {
+		if (hasConfigVar) {
+			normalized = `${normalized}\nexport default config;`;
+		} else if (hasDefineConfigCall) {
+			normalized = `const config = (${normalized.replace(/;?\s*$/, "")});\nexport default config;`;
+		} else {
+			normalized = `const config = defineConfig(${normalized});\nexport default config;`;
+		}
+	}
+
+	return `${importLine}${normalized}\n`;
+}
+
+async function processReadme(): Promise<boolean> {
+	const original = await readFile(README_PATH, "utf8");
+	const lines = original.split(/\r?\n/);
+
+	type Block = { startIdx: number; codeIdx: number; endIdx: number };
+	const blocks: Block[] = [];
+
+	for (let i = 0; i < lines.length; i++) {
+		if (lines[i].startsWith(START_DEFINITION)) {
+			let codeIdx = -1;
+			let endIdx = -1;
+
+			for (let j = i + 1; j < lines.length; j++) {
+				if (lines[j].trim() === START_CODE) {
+					codeIdx = j;
+				} else if (lines[j].trim() === END_BLOCK) {
+					endIdx = j;
+					break;
+				}
+			}
+
+			if (codeIdx !== -1 && endIdx !== -1) {
+				blocks.push({ startIdx: i, codeIdx, endIdx });
+				i = endIdx;
+			}
+		}
+	}
+
+	if (blocks.length === 0) {
+		console.log("No md:generate blocks found.");
+		return false;
+	}
+
+	const resultLines: string[] = [];
+	let cursor = 0;
+	const tempRoot = await mkdtemp(join(tmpdir(), "cssforge-readme-"));
+
+	try {
+		for (const block of blocks) {
+			while (cursor < block.startIdx) {
+				resultLines.push(lines[cursor++]);
+			}
+
+			const tsPreLines = lines.slice(block.startIdx + 1, block.codeIdx);
+			const tsSource = tsPreLines
+				.filter((line) => !line.trim().startsWith("```"))
+				.join("\n")
+				.trim();
+
+			const tempConfigPath = join(tempRoot, `config-${randomUUID()}.ts`);
+			await writeFile(tempConfigPath, wrapSource(tsSource), "utf8");
+
+			const configUrl = pathToFileURL(tempConfigPath).href;
+			const userConfig = await import(`${configUrl}?t=${Date.now()}`);
+			const css = generateCSS(userConfig.default as CSSForgeConfig);
+
+			const replacement = buildReplacement(tsSource, css);
+
+			resultLines.push(lines[block.startIdx]);
+			for (let k = block.startIdx + 1; k < block.codeIdx; k++) {
+				resultLines.push(lines[k]);
+			}
+			resultLines.push(lines[block.codeIdx]);
+
+			if (replacement.length) {
+				resultLines.push(replacement);
+			}
+
+			resultLines.push(lines[block.endIdx]);
+			cursor = block.endIdx + 1;
+		}
+
+		while (cursor < lines.length) {
+			resultLines.push(lines[cursor++]);
+		}
+	} finally {
+		await rm(tempRoot, { recursive: true, force: true });
+	}
+
+	const updated = resultLines.join("\n");
+
+	if (updated !== original) {
+		await writeFile(README_PATH, updated, "utf8");
+		console.log("README.md updated successfully.");
+		return true;
+	}
+
+	console.log("README.md had no changes.");
+	return false;
+}
+
+await processReadme();
diff --git a/packages/cssforge/src/cli.ts b/packages/cssforge/src/cli.ts
new file mode 100644
index 0000000..b91289d
--- /dev/null
+++ b/packages/cssforge/src/cli.ts
@@ -0,0 +1,218 @@
+#!/usr/bin/env node
+/**
+ * This module provides the command-line interface (CLI) for CSSForge.
+ * It allows generating CSS variables from a configuration file, with options
+ * to watch for changes and specify output formats.
+ *
+ * @module
+ */
+import { defineCommand, runMain } from "citty";
+import chokidar from "chokidar";
+import fs from "node:fs/promises";
+import { resolve } from "node:path";
+import { pathToFileURL } from "node:url";
+import { generateCSS, generateJSON, generateTS } from "./generator.ts";
+import process from "node:process";
+import type { CSSForgeConfig } from "./config.ts";
+import type { CommandDef } from "citty";
+
+const writeFileRecursive = (path: string, data: string) =>
+	fs
+		.mkdir(path.replace(/\/[^/]*$/, ""), { recursive: true })
+		.then(() => fs.writeFile(path, data));
+
+/**
+ * Defines the options for the build command.
+ */
+export interface BuildOptions {
+	/** Path to the configuration file. */
+	config: string;
+	/** The output mode. */
+	mode: "css" | "json" | "ts" | "all";
+	/** Path for the CSS output file. */
+	cssOutput: string;
+	/** Path for the JSON output file. */
+	jsonOutput: string;
+	/** Path for the TypeScript output file. */
+	tsOutput: string;
+}
+
+/**
+ * Builds the CSS, JSON, and/or TypeScript files based on the configuration.
+ * @param options The build options.
+ * @returns A promise that resolves to an object indicating success or failure.
+ */
+export async function build({
+	config,
+	tsOutput,
+	cssOutput,
+	jsonOutput,
+	mode,
+}: BuildOptions): Promise<{ success: boolean; error?: unknown }> {
+	try {
+		const absoluteconfig = resolve(process.cwd(), config);
+		const absoluteCssOutput = resolve(process.cwd(), cssOutput);
+		const absoluteJsonOutput = resolve(process.cwd(), jsonOutput);
+		const absoluteTsOutput = resolve(process.cwd(), tsOutput);
+
+		// Import config with cache busting
+		const configUrl = pathToFileURL(absoluteconfig).href;
+		const userConfig = await import(`${configUrl}?t=${Date.now()}`);
+
+		if (mode === "css" || mode === "all") {
+			await writeFileRecursive(
+				absoluteCssOutput,
+				generateCSS(userConfig.default as CSSForgeConfig),
+			);
+			console.log(`✔ Generated CSS written to ${cssOutput}`);
+		}
+
+		if (mode === "json" || mode === "all") {
+			await writeFileRecursive(
+				absoluteJsonOutput,
+				generateJSON(userConfig.default as CSSForgeConfig),
+			);
+			console.log(`✔ Generated JSON written to ${jsonOutput}`);
+		}
+
+		if (mode === "ts" || mode === "all") {
+			await writeFileRecursive(
+				absoluteTsOutput,
+				generateTS(userConfig.default as CSSForgeConfig),
+			);
+			console.log(`✔ Generated TypeScript written to ${tsOutput}`);
+		}
+
+		return { success: true };
+	} catch (error) {
+		console.error(`Error during build:`, error);
+		return { success: false, error };
+	}
+}
+
+/**
+ * Defines the options for the watch command.
+ */
+export interface WatchOptions extends BuildOptions {
+	/** A callback function to execute on rebuild. */
+	onRebuild?: () => void;
+}
+
+/**
+ * Watches the configuration file for changes and rebuilds on modification.
+ * @param options The watch options.
+ * @returns A promise that resolves to a function to stop watching.
+ */
+export async function watch({
+	onRebuild,
+	...buildOptions
+}: WatchOptions): Promise<() => void> {
+	console.log(`👀 Watching ${buildOptions.config} for changes...`);
+
+	// Initial build
+	await build(buildOptions);
+
+	// Watch for changes
+	const watcher = chokidar.watch(buildOptions.config, {
+		persistent: true,
+		ignoreInitial: true,
+	});
+
+	watcher.on("change", async () => {
+		console.log(`🔄 Config changed, regenerating...`);
+		await build(buildOptions);
+		onRebuild?.();
+	});
+
+	// Return cleanup function
+	return () => watcher.close();
+}
+
+const mainCommand = defineCommand({
+	meta: {
+		name: "cssforge",
+		version: "0.1.0",
+		description: "Generate CSS variables from a configuration file",
+	},
+	args: {
+		watch: {
+			type: "boolean",
+			description: "Watch for changes in the config file",
+			alias: "w",
+		},
+		config: {
+			type: "string",
+			description: "Path to the config file",
+			default: "./cssforge.config.ts",
+		},
+		mode: {
+			type: "string",
+			description: "Output mode (css, json, ts, all)",
+			alias: "m",
+			default: "all",
+		},
+		prefix: {
+			type: "string",
+			description: "A prefix applied before all path",
+			default: "",
+		},
+		json: {
+			type: "string",
+			description: "Optional path for an output JSON file",
+			default: "./.cssforge/output.json",
+		},
+		css: {
+			type: "string",
+			description: "Path for the output CSS file",
+			default: "./.cssforge/output.css",
+		},
+		ts: {
+			type: "string",
+			description: "Path for the output TypeScript file",
+			default: "./.cssforge/output.ts",
+		},
+	},
+	async run({ args }) {
+		const { watch: shouldWatch, config, css, json, ts, mode, prefix } = args;
+		const realPath = (p: string) => resolve(prefix, p);
+		const settings = {
+			mode,
+			config: realPath(config),
+			cssOutput: realPath(css),
+			tsOutput: realPath(ts),
+			jsonOutput: realPath(json),
+		} as BuildOptions;
+		if (shouldWatch) {
+			const cleanup = await watch(settings);
+
+			// Handle process termination
+			process.on("SIGINT", () => {
+				cleanup();
+				console.log("\n🛑 Stopped watching");
+				process.exit(0);
+			});
+		} else {
+			const { success } = await build(settings);
+			process.exit(success ? 0 : 1);
+		}
+	},
+});
+
+const isDirectRun = (): boolean => {
+	const entryFile = process.argv[1];
+	if (!entryFile) {
+		return false;
+	}
+
+	return import.meta.url === pathToFileURL(entryFile).href;
+};
+
+// Run if called directly
+if (isDirectRun()) {
+	runMain(mainCommand);
+}
+
+/**
+ * The main command definition for the CSSForge CLI.
+ */
+export default mainCommand as CommandDef;
diff --git a/src/config.ts b/packages/cssforge/src/config.ts
similarity index 77%
rename from src/config.ts
rename to packages/cssforge/src/config.ts
index 2fa2432..e25b420 100644
--- a/src/config.ts
+++ b/packages/cssforge/src/config.ts
@@ -7,22 +7,22 @@ import type { TypographyConfig } from "./modules/typography.ts";
  * The main configuration object for CSSForge.
  */
 export interface CSSForgeConfig {
-  /**
-   * Color configuration, including palettes, gradients, and themes.
-   */
-  colors: ColorConfig;
-  /**
-   * Typography configuration, including type scales and weights.
-   */
-  typography: TypographyConfig;
-  /**
-   * Spacing configuration for creating spacing scales.
-   */
-  spacing: SpacingConfig;
-  /**
-   * Primitive configuration for creating custom design tokens.
-   */
-  primitives: PrimitiveConfig;
+	/**
+	 * Color configuration, including palettes, gradients, and themes.
+	 */
+	colors: ColorConfig;
+	/**
+	 * Typography configuration, including type scales and weights.
+	 */
+	typography: TypographyConfig;
+	/**
+	 * Spacing configuration for creating spacing scales.
+	 */
+	spacing: SpacingConfig;
+	/**
+	 * Primitive configuration for creating custom design tokens.
+	 */
+	primitives: PrimitiveConfig;
 }
 
 /**
@@ -80,5 +80,5 @@ export interface CSSForgeConfig {
  * ```
  */
 export function defineConfig<C extends Partial<CSSForgeConfig>>(config: C): C {
-  return config as C;
+	return config as C;
 }
diff --git a/packages/cssforge/src/generator.ts b/packages/cssforge/src/generator.ts
new file mode 100644
index 0000000..fc00b4f
--- /dev/null
+++ b/packages/cssforge/src/generator.ts
@@ -0,0 +1,230 @@
+import type { ResolveMap } from "./lib.ts";
+import type { CSSForgeConfig } from "./config.ts";
+import { processColors } from "./modules/colors.ts";
+import { processPrimitives } from "./modules/primitive.ts";
+import { processSpacing } from "./modules/spacing.ts";
+import { processTypography } from "./modules/typography.ts";
+
+type CssValue = {
+	value: string;
+	key: string;
+	variable: string;
+};
+
+type ForgeValue = {
+	[key: string]: ForgeValue | CssValue;
+};
+
+const isRecord = (value: unknown): value is Record<string, unknown> =>
+	typeof value === "object" && value !== null && !Array.isArray(value);
+
+const deepMerge = (target: ForgeValue, source: ForgeValue): ForgeValue => {
+	const result: Record<string, unknown> = { ...target };
+	for (const [key, sourceValue] of Object.entries(source)) {
+		const targetValue = result[key];
+		if (isRecord(targetValue) && isRecord(sourceValue)) {
+			result[key] = deepMerge(targetValue as ForgeValue, sourceValue as ForgeValue);
+			continue;
+		}
+		result[key] = sourceValue;
+	}
+	return result as ForgeValue;
+};
+
+/**
+ * Creates a nested object structure of design tokens from a configuration.
+ * @param config The CSSForge configuration.
+ * @returns A nested object representing the design tokens.
+ */
+export function createForgeValues(config: Partial<CSSForgeConfig>) {
+	type Input = readonly [string, CssValue];
+
+	/**
+	 * Creates a nested object structure from a path string and a value.
+	 * @example
+	 * ```ts
+	 * const path = ["a", "b", "c"];
+	 * const value = { key: "--a-b-c", value: "1rem", variable: "--a-b-c: 1rem;" };
+	 * const result = createNestedObject(path, value);
+	 * // result: { a: { b: { c: { key: "--a-b-c", value: "1rem", variable: "--a-b-c: 1rem;" } } } }
+	 * ```
+	 */
+	function createNestedObject(path: string[], value: CssValue | ForgeValue): ForgeValue {
+		if (path.length === 0) {
+			return value as ForgeValue;
+		}
+		// Take the first segment of the path
+		const [currentKey, ...remainingPath] = path;
+
+		// Recursively build the nested object
+		return {
+			[currentKey]: createNestedObject(remainingPath, value),
+		};
+	}
+
+	/**
+	 * Creates a deeply nested object from an array of path-value pairs.
+	 * @example
+	 * ```ts
+	 * const input = [
+	 *  ["a.b.c", { key: "--a-b-c", value: "1rem", variable: "--a-b-c: 1rem;" }],
+	 *  ["a.b.d", { key: "--a-b-d", value: "2rem", variable: "--a-b-d: 2rem;" }]
+	 * ];
+	 * const result = createForgeValuesFromKeys(input);
+	 * // result: { a: { b: { c: { key: "--a-b-c", value: "1rem", variable: "--a-b-c: 1rem;" }, d: { key: "--a-b-d", value: "2rem", variable: "--a-b-d: 2rem;" } } } }
+	 * ```
+	 */
+	function createForgeValuesFromKeys(input: Input[]): ForgeValue {
+		// Reduce the input array into a single merged object
+		return input.reduce((acc, [pathString, cssValues]) => {
+			// Split the path string into segments
+			const pathSegments = pathString.split(".");
+
+			// Create a nested object for this input
+			const nestedObject = createNestedObject(pathSegments, cssValues);
+
+			// Deep merge the new object with the accumulator
+			return deepMerge(acc, nestedObject);
+		}, {} as ForgeValue);
+	}
+
+	const forge = {
+		colors: config.colors ? processColors(config.colors) : undefined,
+		spacing: config.spacing ? processSpacing(config.spacing) : undefined,
+		typography: config.typography ? processTypography(config.typography) : undefined,
+		primitives: config.primitives
+			? processPrimitives({
+					primitives: config.primitives,
+					colors: config.colors,
+					typography: config.typography,
+					spacing: config.spacing,
+				})
+			: undefined,
+	};
+	const jsonKeys = [];
+	for (const [_, value] of Object.entries(forge)) {
+		if (value) {
+			const mapArray = [...value.resolveMap.entries()];
+			jsonKeys.push(...mapArray);
+		}
+	}
+	const forgeValues = createForgeValuesFromKeys(jsonKeys);
+	return forgeValues;
+}
+
+/**
+ * Generates a JSON string from the CSSForge configuration.
+ * This can be used to create a JSON file with all the design tokens.
+ * @example
+ * ```ts
+ * const config = defineConfig({ colors: { palette: { value: { red: { 100: { hex: "#ff0000" } } } } });
+ * const json = generateJSON(config);
+ * // json: "{\n  \"colors\": {\n    \"palette\": {\n      \"value\": {\n        \"red\": {\n          \"100\": {\n            \"key\": \"--color-red-100\",\n            \"value\": \"oklch(62.796% 0.25768 29.23388)\",\n            \"variable\": \"--color-red-100: oklch(62.796% 0.25768 29.23388);\"\n          }\n        }\n      }\n    }\n  }\n}"
+ * ```
+ */
+export function generateJSON(config: Partial<CSSForgeConfig>): string {
+	const forgeValues = createForgeValues(config);
+	return JSON.stringify(forgeValues, null, 2);
+}
+
+/**
+ * Generates a TypeScript module from the CSSForge configuration.
+ * This can be used to create a TypeScript file with all the design tokens, providing full type safety.
+ * @example
+ * ```ts
+ * const config = defineConfig({ colors: { palette: { value: { red: { 100: { hex: "#ff0000" } } } } });
+ * const ts = generateTS(config);
+ * // ts: "export const cssForge = {\n  \"colors\": {\n    \"palette\": {\n      \"value\": {\n        \"red\": {\n          \"100\": {\n            \"key\": \"--color-red-100\",\n            \"value\": \"oklch(62.796% 0.25768 29.23388)\",\n            \"variable\": \"--color-red-100: oklch(62.796% 0.25768 29.23388);\"\n          }\n        }\n      }\n    }\n  }\n} as const;"
+ * ```
+ */
+export function generateTS(config: Partial<CSSForgeConfig>): string {
+	const forgeValues = createForgeValues(config);
+	const forgeValuesString = JSON.stringify(forgeValues, null, 2);
+	return `export const cssForge = ${forgeValuesString} as const;`;
+}
+
+/**
+ * Generates a CSS string from the CSSForge configuration.
+ * This is the main function to generate the CSS variables.
+ * @example
+ * ```ts
+ * const config = defineConfig({ colors: { palette: { value: { red: { 100: { hex: "#ff0000" } } } } });
+ * const css = generateCSS(config);
+ * // css: "/*____ CSSForge ____*&#47;\n:root {\n/*____ Colors ____*&#47;\n/* Palette *&#47;\n--color-red-100: oklch(62.796% 0.25768 29.23388);\n}"
+ * ```
+ */
+export function generateCSS(config: Partial<CSSForgeConfig>): string {
+	const chunks: string[] = ["/*____ CSSForge ____*/", ":root {"];
+	const outsideChunks: string[] = [];
+	const processedConfig: {
+		[key: string]:
+			| { css: { root?: string; outside?: string }; resolveMap: ResolveMap }
+			| undefined;
+	} = {};
+
+	// Process colors if present
+	if (config.colors) {
+		processedConfig.colors = processColors(config.colors);
+		if (processedConfig.colors) {
+			if (processedConfig.colors.css.root) {
+				chunks.push("/*____ Colors ____*/");
+				chunks.push(processedConfig.colors.css.root);
+			}
+			if (processedConfig.colors.css.outside) {
+				outsideChunks.push(processedConfig.colors.css.outside);
+			}
+		}
+	}
+
+	// Process spacing if present
+	if (config.spacing) {
+		processedConfig.spacing = processSpacing(config.spacing);
+		if (processedConfig.spacing) {
+			if (processedConfig.spacing.css.root) {
+				chunks.push("/*____ Spacing ____*/");
+				chunks.push(processedConfig.spacing.css.root);
+			}
+			if (processedConfig.spacing.css.outside) {
+				outsideChunks.push(processedConfig.spacing.css.outside);
+			}
+		}
+	}
+
+	// Process Typography if present
+	if (config.typography) {
+		processedConfig.typography = processTypography(config.typography);
+		if (processedConfig.typography) {
+			if (processedConfig.typography.css.root) {
+				chunks.push("/*____ Typography ____*/");
+				chunks.push(processedConfig.typography.css.root);
+			}
+			if (processedConfig.typography.css.outside) {
+				outsideChunks.push(processedConfig.typography.css.outside);
+			}
+		}
+	}
+
+	if (config.primitives) {
+		const primitiveVars = processPrimitives({
+			primitives: config.primitives,
+			colors: config.colors,
+			typography: config.typography,
+			spacing: config.spacing,
+		});
+		if (primitiveVars) {
+			if (primitiveVars.css.root) {
+				chunks.push("/*____ Primitives ____*/");
+				chunks.push(primitiveVars.css.root);
+			}
+			if (primitiveVars.css.outside) {
+				outsideChunks.push(primitiveVars.css.outside);
+			}
+		}
+	}
+
+	chunks.push("}");
+
+	if (outsideChunks.length > 0) chunks.push(outsideChunks.join("\n"));
+
+	return chunks.join("\n");
+}
diff --git a/packages/cssforge/src/helpers.ts b/packages/cssforge/src/helpers.ts
new file mode 100644
index 0000000..bbb6785
--- /dev/null
+++ b/packages/cssforge/src/helpers.ts
@@ -0,0 +1,53 @@
+const reservedKeyWords = [
+	"spacing",
+	"spacing_fluid",
+	"typography",
+	"typography_fluid",
+	"theme",
+	"gradients",
+	"palette",
+];
+/**
+ * Validates a name to ensure it doesn't contain invalid characters.
+ * Throws an error if the name is invalid.
+ * @example
+ * ```ts
+ * validateName("valid-name"); // returns true
+ * validateName("invalid.name"); // throws error
+ * ```
+ */
+export function validateName(name: string): boolean {
+	if (name.length === 0 || name.includes(".") || name === "value") {
+		throw new Error(
+			`Invalid name: ${name}. Names must be non-empty strings that do not contain periods.`,
+		);
+	}
+	if (reservedKeyWords.includes(name)) {
+		throw new Error(
+			`Invalid name: ${name}. Names cannot be one of the reserved keywords: ${reservedKeyWords.join(
+				", ",
+			)}`,
+		);
+	}
+	return true;
+}
+
+/**
+ * Converts a pixel value to a rem value.
+ * If the value is not in pixels, it returns the original value.
+ * @example
+ * ```ts
+ * pxToRem({ value: "16px" }); // "1rem"
+ * pxToRem({ value: "1rem" }); // "1rem"
+ * pxToRem({ value: "32px", rem: 16 }); // "2rem"
+ * ```
+ */
+export function pxToRem({ value, rem = 16 }: { value: string; rem?: number }): string {
+	const pxMatch = value.endsWith("px");
+	if (pxMatch) {
+		const pxValue = parseFloat(value.slice(0, -2));
+		const remValue = pxValue / rem;
+		return `${remValue}rem`;
+	}
+	return value;
+}
diff --git a/packages/cssforge/src/lib.ts b/packages/cssforge/src/lib.ts
new file mode 100644
index 0000000..0a0aee5
--- /dev/null
+++ b/packages/cssforge/src/lib.ts
@@ -0,0 +1,147 @@
+/**
+ * A map where keys are dot-separated paths and values are objects
+ * containing the CSS variable key, its value, and the full variable declaration.
+ */
+export type ResolveMap = Map<string, { key: string; value: string; variable: string }>;
+
+/**
+ * Represents the output of a processing function, containing the generated
+ * CSS and a resolve map.
+ */
+export interface Output {
+	/** The generated CSS strings. */
+	css: { root?: string; outside?: string };
+	/** A map for resolving variable paths. */
+	resolveMap: ResolveMap;
+}
+
+export interface Variables {
+	[key: string]: string;
+}
+
+interface Modules {
+	colors?: Output | null;
+	typography?: Output | null;
+	spacing?: Output | null;
+}
+
+interface ResolveVariableParams extends Modules {
+	varPath: string;
+}
+
+interface GetResolvedVariablesMapParams extends Modules {
+	variables: Variables | undefined;
+}
+/**
+ * Resolves a variable path to its corresponding CSS variable name.
+ * This function is used to resolve references to other design tokens.
+ * @example
+ * ```ts
+ * const colors = {
+ *  css: "--color-red-100: oklch(62.796% 0.25768 29.23388);",
+ *  resolveMap: new Map([["colors.palette.value.red.100", { key: "--color-red-100", value: "oklch(62.796% 0.25768 29.23388)", variable: "--color-red-100: oklch(62.796% 0.25768 29.23388);" }]])
+ * };
+ * const varPath = "colors.palette.value.red.100";
+ * const resolved = resolveVariable({ varPath, colors });
+ * // resolved: "--color-red-100"
+ * ```
+ */
+function resolveVariable({
+	varPath,
+	colors,
+	typography,
+	spacing,
+}: ResolveVariableParams) {
+	const path = varPath.split(".");
+	const module = path[0];
+	//TODO: Make this configurable
+	const keyMap = {
+		palette: "palette",
+		gradients: "gradients",
+		theme: "theme",
+		typography: "typography",
+		typography_fluid: "typography_fluid",
+		spacing: "spacing",
+		spacing_fluid: "spacing_fluid",
+	};
+	switch (module) {
+		case keyMap.palette:
+		case keyMap.gradients:
+		case keyMap.theme: {
+			if (!colors) throw new Error("The colors object must be passed.");
+			const result = colors.resolveMap.get(varPath);
+			if (!result) {
+				throw new Error(
+					`The color path ${varPath} could not be resolved. Map contains ${Array.from(
+						colors.resolveMap.keys(),
+					).map((key) => `\n${key}`)}`,
+				);
+			}
+			return result.key;
+		}
+		case keyMap.typography_fluid:
+		case keyMap.typography: {
+			if (!typography) throw new Error("The typography object must be passed.");
+			const result = typography.resolveMap.get(varPath);
+			if (!result) {
+				throw new Error(
+					`The typography path ${varPath} could not be resolved. Map contains ${Array.from(
+						typography.resolveMap.keys(),
+					).map((key) => `\n${key}`)}`,
+				);
+			}
+			return result.key;
+		}
+		case keyMap.spacing:
+		case keyMap.spacing_fluid: {
+			if (!spacing) throw new Error("The spacing object must be passed.");
+			const result = spacing.resolveMap.get(varPath);
+			if (!result) {
+				throw new Error(
+					`The spacing path ${varPath} could not be resolved.  Map contains ${Array.from(
+						spacing.resolveMap.keys(),
+					).map((key) => `\n${key}`)}`,
+				);
+			}
+			return result.key;
+		}
+		default:
+			throw new Error(`${module} is not implemented and can't be resolved.`);
+	}
+}
+
+/**
+ * Generates a map of resolved CSS variable names from a variables object.
+ * It uses the provided modules (colors, typography, spacing) to resolve the paths.
+ */
+export const getResolvedVariablesMap = ({
+	variables,
+	...params
+}: GetResolvedVariablesMapParams): Map<`--${string}`, string> => {
+	const resolvedVariables = variables
+		? Object.entries(variables).map(([varKey, varPath]) => {
+				const resolved = resolveVariable({ varPath, ...params });
+				return [`--${varKey}`, resolved] as const;
+			})
+		: [];
+
+	const resolvedMap = new Map(resolvedVariables);
+	return resolvedMap;
+};
+
+/**
+ * Resolves a CSS variable value using a map of variable paths.
+ * It replaces occurrences of `var(--key)` in the value with the corresponding
+ * CSS variable from the map.
+ */
+export const resolveValue = ({
+	map,
+	value,
+}: {
+	map: Map<string, string>;
+	value: string;
+}) =>
+	value.replace(
+		/var\(--(\w+)\)/g,
+		(_, key: string) => `var(${map.get(`--${key}`) ?? `--${key}`})`,
+	);
diff --git a/packages/cssforge/src/mod.ts b/packages/cssforge/src/mod.ts
new file mode 100644
index 0000000..2705e67
--- /dev/null
+++ b/packages/cssforge/src/mod.ts
@@ -0,0 +1,59 @@
+/**
+ * This module provides the core functionalities of CSSForge, a tool for generating
+ * CSS variables from a configuration file. It exports functions for processing
+ * different aspects of a design system, such as colors, typography, and spacing,
+ * as well as the main function to generate the final CSS.
+ *
+ * @module
+ */
+import { generateCSS } from "./generator.ts";
+import { defineConfig } from "./config.ts";
+import { processColors } from "./modules/colors.ts";
+import { processTypography } from "./modules/typography.ts";
+import { processPrimitives } from "./modules/primitive.ts";
+import { processSpacing } from "./modules/spacing.ts";
+
+import type { CSSForgeConfig } from "./config.ts";
+/**
+ * The main configuration object for CSSForge.
+ */
+export type { CSSForgeConfig };
+
+export {
+	/**
+	 * A helper function to define the CSSForge configuration with type inference.
+	 * @param config The CSSForge configuration.
+	 * @returns The configuration object.
+	 */
+	defineConfig,
+	/**
+	 * Generates the CSS string from a CSSForge configuration.
+	 * @param config The CSSForge configuration.
+	 * @returns The generated CSS string.
+	 */
+	generateCSS,
+	/**
+	 * Processes the colors section of the configuration.
+	 * @param colors The colors configuration.
+	 * @returns A map of CSS variables for colors.
+	 */
+	processColors,
+	/**
+	 * Processes the primitives section of the configuration.
+	 * @param primitives The primitives configuration.
+	 * @returns A map of CSS variables for primitives.
+	 */
+	processPrimitives,
+	/**
+	 * Processes the spacing section of the configuration.
+	 * @param spacing The spacing configuration.
+	 * @returns A map of CSS variables for spacing.
+	 */
+	processSpacing,
+	/**
+	 * Processes the typography section of the configuration.
+	 * @param typography The typography configuration.
+	 * @returns A map of CSS variables for typography.
+	 */
+	processTypography,
+};
diff --git a/packages/cssforge/src/modules/colors.ts b/packages/cssforge/src/modules/colors.ts
new file mode 100644
index 0000000..77503d7
--- /dev/null
+++ b/packages/cssforge/src/modules/colors.ts
@@ -0,0 +1,423 @@
+import Color from "colorjs.io";
+import { type Output, type ResolveMap, resolveValue } from "../lib.ts";
+import { validateName } from "../helpers.ts";
+import { getResolvedVariablesMap } from "../lib.ts";
+import type { Variables } from "../lib.ts";
+
+type ExactlyOne<T> = {
+	[K in keyof T]: {
+		[P in K]: T[P];
+	} & {
+		[P in Exclude<keyof T, K>]?: never;
+	};
+}[keyof T];
+
+interface PossibleColorValues {
+	hex: string;
+	rgb: readonly [number, number, number] | string;
+	hsl: readonly [number, number, number] | string;
+	oklch: readonly [number, number, number] | string;
+}
+
+type ColorValue = ExactlyOne<PossibleColorValues>;
+
+type ColorValueOrString = ColorValue | string;
+
+interface ColorVariants {
+	[key: string]: ColorValueOrString;
+}
+
+export interface WithCondition {
+	/**
+	 * CSS selector to wrap variables in (e.g., ".MyClass"). This will be extracted out of the root.
+	 */
+	selector?: string;
+	/**
+	 * CSS at-rule to wrap variables in (e.g., "@supports (display: grid)")
+	 */
+	atRule?: string;
+}
+/**
+ * Settings for palette colors, including optional conditions like media queries.
+ */
+export interface PaletteColorSettings extends WithCondition {}
+
+/**
+ * Settings for gradients, including optional conditions like media queries.
+ */
+export interface GradientSettings extends WithCondition {}
+
+/**
+ * Settings for themes, including optional conditions like media queries.
+ */
+export interface ThemeSettings extends WithCondition {}
+
+/**
+ * A single palette color configuration with its values and optional settings.
+ */
+export interface PaletteColorConfig {
+	value: ColorVariants;
+	settings?: PaletteColorSettings;
+}
+
+/**
+ * A palette of colors, organized by name and variants.
+ */
+export interface ColorPalette {
+	[key: string]: PaletteColorConfig;
+}
+
+interface GradientDefinition {
+	value: string;
+	variables?: Variables;
+	settings?: unknown;
+}
+
+interface GradientValue {
+	[key: string]: GradientDefinition;
+}
+
+/**
+ * A single gradient definition.
+ */
+export interface Gradient {
+	value: GradientValue;
+	settings?: GradientSettings;
+}
+
+/**
+ * A collection of gradients.
+ */
+export interface GradientConfig {
+	[key: string]: Gradient;
+}
+
+interface ColorInThemeValues {
+	[key: string]: string;
+}
+
+interface ColorInTheme {
+	value: ColorInThemeValues;
+	variables?: Variables;
+	settings?: {
+		/**
+		 * Only include the variant name in the CSS variable name.
+		 * --theme-light-colors-primaryBackground => --primaryBackground
+		 */
+		variantNameOnly?: boolean;
+	};
+}
+
+export interface ThemeConfig {
+	value: {
+		[colorName: string]: ColorInTheme;
+	};
+	settings?: ThemeSettings;
+}
+
+export interface ColorTheme {
+	[themeName: string]: ThemeConfig;
+}
+
+/**
+ * The main color configuration object.
+ */
+export interface ColorConfig {
+	/**
+	 * The color palette.
+	 */
+	palette: {
+		value: ColorPalette;
+		settings?: unknown;
+	};
+	/**
+	 * A collection of gradients.
+	 */
+	gradients?: {
+		value: GradientConfig;
+		settings?: unknown;
+	};
+	/**
+	 * A collection of themes.
+	 */
+	theme?: {
+		[themeName: string]: ThemeConfig;
+	};
+}
+
+/**
+ * Gets the color string from a color value object.
+ * @example
+ * ```ts
+ * getColorString({ hex: "#ff0000" }); // "#ff0000"
+ * getColorString({ rgb: [255, 0, 0] }); // "rgb(255,0,0)"
+ * ```
+ */
+function getColorString(value: ColorValue): string {
+	if ("hex" in value) {
+		return value.hex as string;
+	}
+
+	if ("rgb" in value) {
+		return Array.isArray(value.rgb)
+			? `rgb(${(value.rgb as number[]).join(",")})`
+			: (value.rgb as string);
+	}
+
+	if ("hsl" in value) {
+		return Array.isArray(value.hsl)
+			? `hsl(${value.hsl[0]}deg ${value.hsl[1]}% ${value.hsl[2]}%)`
+			: (value.hsl as string);
+	}
+
+	if ("oklch" in value) {
+		return Array.isArray(value.oklch)
+			? `oklch(${(value.oklch as number[]).join(" ")})`
+			: (value.oklch as string);
+	}
+
+	throw new Error("Invalid color value");
+}
+
+/**
+ * Converts a color value to the OKLCH color space.
+ * @example
+ * ```ts
+ * colorValueToOklch({ hex: "#ff0000" }); // "oklch(62.796% 0.25768 29.23388)"
+ * colorValueToOklch("blue"); // "oklch(45.201% 0.31321 264.05202)"
+ * ```
+ */
+function colorValueToOklch(value: ColorValueOrString): string {
+	const colorString = typeof value === "string" ? value : getColorString(value);
+	const color = new Color(colorString);
+	const oklchColor = color.to("oklch");
+
+	const parsedCoords = oklchColor.coords.map((coord) =>
+		Number.isNaN(coord) ? 0 : coord,
+	);
+	const l = Number(parsedCoords[0].toFixed(5));
+	const c = Number(parsedCoords[1].toFixed(5));
+	const h = Number(parsedCoords[2].toFixed(5));
+	const alpha =
+		oklchColor.alpha === 1 ? "" : ` / ${Number(oklchColor.alpha.toFixed(3)) * 100}%`;
+	return `oklch(${Number((l * 100).toFixed(3))}% ${c} ${h}${alpha})`;
+}
+
+/**
+ * Processes the color configuration to generate CSS variables.
+ * This includes palettes, gradients, and themes.
+ * @example
+ * ```ts
+ * const colors = {
+ *  palette: {
+ *    value: {
+ *      red: {
+ *        100: { hex: "#ff0000" }
+ *      }
+ *    }
+ *  }
+ * };
+ * const output = processColors(colors);
+ * // output.css: "/* Palette * /;\n--color-red-100: oklch(62.796% 0.25768 29.23388);"
+ * ```
+ */
+export function processColors(colors: ColorConfig): Output {
+	const rootOutput: string[] = [];
+	const outsideOutput: string[] = [];
+	const resolveMap: ResolveMap = new Map();
+	rootOutput.push(`/* Palette */`);
+	const moduleKey = "palette";
+
+	function conditionalBuilder(
+		settings: WithCondition | undefined,
+		initialComment: string,
+	) {
+		const innerComments: string[] = [];
+		const vars: string[] = [];
+
+		const hasSelector = Boolean(settings?.selector);
+		const hasAtRule = Boolean(settings?.atRule);
+
+		// If no settings provided, emit comment immediately into root output
+		if (!hasSelector && !hasAtRule) rootOutput.push(initialComment);
+
+		return {
+			addComment(c: string) {
+				if (hasSelector || hasAtRule) innerComments.push(c);
+				else rootOutput.push(c);
+			},
+			pushVariable(v: string) {
+				if (hasSelector || hasAtRule) vars.push(v);
+				else rootOutput.push(v);
+			},
+			finalize() {
+				if (!hasSelector && !hasAtRule) return;
+				if (vars.length === 0 && innerComments.length === 0) return;
+				if (!settings) return;
+				if (hasSelector && hasAtRule) {
+					outsideOutput.push(initialComment);
+					outsideOutput.push(`${settings.atRule} {`);
+					outsideOutput.push(`  ${settings.selector} {`);
+					outsideOutput.push(...innerComments.map((c) => `    ${c}`));
+					outsideOutput.push(...vars.map((v) => `    ${v}`));
+					outsideOutput.push(`  }`);
+					outsideOutput.push(`}`);
+					return;
+				}
+
+				if (hasSelector) {
+					outsideOutput.push(initialComment);
+					outsideOutput.push(`${settings.selector} {`);
+					outsideOutput.push(...innerComments.map((c) => `  ${c}`));
+					outsideOutput.push(...vars.map((v) => `  ${v}`));
+					outsideOutput.push(`}`);
+					return;
+				}
+
+				if (hasAtRule) {
+					rootOutput.push(initialComment);
+					rootOutput.push(`${settings.atRule} {`);
+					rootOutput.push(...innerComments.map((c) => `  ${c}`));
+					rootOutput.push(...vars.map((v) => `  ${v}`));
+					rootOutput.push(`}`);
+					return;
+				}
+			},
+		};
+	}
+
+	for (const [colorName, colorConfig] of Object.entries(colors.palette.value)) {
+		validateName(colorName);
+
+		try {
+			const handler = conditionalBuilder(colorConfig.settings, `/* ${colorName} */`);
+
+			for (const [variantId, colorValue] of Object.entries(colorConfig.value)) {
+				validateName(variantId);
+				const key = `--${moduleKey}-${colorName}-${variantId}`;
+				const value = colorValueToOklch(colorValue);
+				const variable = `${key}: ${value};`;
+
+				handler.pushVariable(variable);
+
+				resolveMap.set(`${moduleKey}.${colorName}.${variantId}`, {
+					key,
+					value,
+					variable,
+				});
+			}
+
+			handler.finalize();
+		} catch (error) {
+			console.error(`Error processing color ${colorName}:`, error);
+		}
+	}
+
+	if (colors.gradients) {
+		rootOutput.push(`/* Gradients */`);
+		const moduleKey = "gradients";
+		const palette = {
+			css: { root: rootOutput.join("\n"), outside: outsideOutput.join("\n") },
+			resolveMap,
+		};
+
+		for (const [gradientName, gradient] of Object.entries(colors.gradients.value)) {
+			validateName(gradientName);
+			const handler = conditionalBuilder(gradient.settings, `/* ${gradientName} */`);
+
+			for (const [variantName, { value, variables }] of Object.entries(gradient.value)) {
+				validateName(variantName);
+				try {
+					const resolvedMapForGradient = getResolvedVariablesMap({
+						variables,
+						colors: palette,
+					});
+
+					const gradientValue = resolveValue({ map: resolvedMapForGradient, value });
+
+					const key = `--${moduleKey}-${gradientName}-${variantName}`;
+					const variable = `${key}: ${gradientValue};`;
+
+					handler.pushVariable(variable);
+
+					resolveMap.set(`${moduleKey}.${gradientName}.${variantName}`, {
+						variable,
+						key,
+						value: gradientValue,
+					});
+				} catch (error) {
+					console.error(
+						`Error processing gradient ${gradientName}-${variantName}:`,
+						error,
+					);
+					throw error;
+				}
+			}
+
+			handler.finalize();
+		}
+	}
+
+	if (colors.theme) {
+		rootOutput.push(`/* Themes */`);
+		const moduleKey = "theme";
+		const palette = {
+			css: { root: rootOutput.join("\n"), outside: outsideOutput.join("\n") },
+			resolveMap,
+		};
+
+		for (const [themeName, themeConfig] of Object.entries(colors.theme)) {
+			validateName(themeName);
+			const handler = conditionalBuilder(
+				themeConfig.settings,
+				`/* Theme: ${themeName} */`,
+			);
+
+			try {
+				for (const [colorName, colorInTheme] of Object.entries(themeConfig.value)) {
+					validateName(colorName);
+					const colorComment = `/* ${colorName} */`;
+					handler.addComment(colorComment);
+
+					const resolvedMap = getResolvedVariablesMap({
+						variables: colorInTheme.variables,
+						colors: palette,
+					});
+
+					const variantNameOnly = colorInTheme.settings?.variantNameOnly ?? false;
+					for (const [variantName, variantValue] of Object.entries(colorInTheme.value)) {
+						validateName(variantName);
+						const resolvedValue = resolveValue({
+							map: resolvedMap,
+							value: variantValue,
+						});
+
+						const key = variantNameOnly
+							? `--${variantName}`
+							: `--${moduleKey}-${themeName}-${colorName}-${variantName}`;
+
+						const variable = `${key}: ${resolvedValue};`;
+
+						handler.pushVariable(variable);
+
+						resolveMap.set(`${moduleKey}.${themeName}.${colorName}.${variantName}`, {
+							key,
+							value: resolvedValue,
+							variable,
+						});
+					}
+				}
+
+				handler.finalize();
+			} catch (error) {
+				console.error(`Error processing theme ${themeName}:`, error);
+			}
+		}
+	}
+
+	const output = {
+		css: { root: rootOutput.join("\n"), outside: outsideOutput.join("\n") },
+		resolveMap,
+	};
+	return output;
+}
diff --git a/packages/cssforge/src/modules/primitive.ts b/packages/cssforge/src/modules/primitive.ts
new file mode 100644
index 0000000..b221eed
--- /dev/null
+++ b/packages/cssforge/src/modules/primitive.ts
@@ -0,0 +1,138 @@
+import type { ColorConfig } from "./colors.ts";
+import { processColors } from "./colors.ts";
+import type { TypographyConfig } from "./typography.ts";
+import { processTypography } from "./typography.ts";
+import type { PixelSettings, SpacingConfig } from "./spacing.ts";
+import { processSpacing } from "./spacing.ts";
+import {
+	getResolvedVariablesMap,
+	type Output,
+	resolveValue,
+	type Variables,
+} from "../lib.ts";
+import { validateName } from "../helpers.ts";
+import { pxToRem } from "../helpers.ts";
+
+interface PrimitiveProperties {
+	[key: string]: string;
+}
+
+interface PrimitiveDefinition {
+	value: PrimitiveProperties;
+	variables?: Variables;
+	settings?: PixelSettings;
+}
+
+interface PrimitiveValue {
+	[key: string]: PrimitiveDefinition;
+}
+
+/**
+ * A single primitive definition.
+ */
+export interface Primitive {
+	value: PrimitiveValue;
+	settings?: unknown;
+}
+
+/**
+ * A collection of primitives.
+ */
+export interface PrimitiveConfig {
+	[key: string]: Primitive;
+}
+
+/**
+ * Processes the primitive configuration to generate CSS variables.
+ * Primitives can reference other design tokens from colors, typography, and spacing.
+ * @example
+ * ```ts
+ * const config = {
+ *  primitives: {
+ *    button: {
+ *      value: {
+ *        default: {
+ *          value: {
+ *            "background-color": "var(--bg)",
+ *          },
+ *          variables: {
+ *            "bg": "colors.palette.value.red.100",
+ *          },
+ *        },
+ *      },
+ *    },
+ *  },
+ *  colors: {
+ *    palette: {
+ *      value: {
+ *        red: {
+ *          100: { hex: "#ff0000" },
+ *        },
+ *      },
+ *    },
+ *  },
+ * };
+ * const output = processPrimitives(config);
+ * // output.css: "/* button * / ;\n--button-default-background-color: var(--color-red-100);"
+ * ```
+ */
+export function processPrimitives(config: {
+	primitives: PrimitiveConfig;
+	colors?: ColorConfig;
+	typography?: TypographyConfig;
+	spacing?: SpacingConfig;
+}): Output {
+	const cssOutput: string[] = [];
+	const resolveMap = new Map();
+	const moduleKey = "primitives";
+	const colorVariables = config.colors ? processColors(config.colors) : null;
+	const typographyVariables = config.typography
+		? processTypography(config.typography)
+		: null;
+	const spacingVariables = config.spacing ? processSpacing(config.spacing) : null;
+	for (const [primitiveName, primitive] of Object.entries(config.primitives)) {
+		validateName(primitiveName);
+		cssOutput.push(`/* ${primitiveName} */`);
+		for (const [
+			variantName,
+			{ value: properties, variables, settings = { pxToRem: true, rem: 16 } },
+		] of Object.entries(primitive.value)) {
+			validateName(variantName);
+			try {
+				const resolvedMap = getResolvedVariablesMap({
+					variables,
+					colors: colorVariables,
+					typography: typographyVariables,
+					spacing: spacingVariables,
+				});
+
+				for (const [propName, propValue] of Object.entries(properties)) {
+					validateName(propName);
+
+					const convertedValue = settings.pxToRem
+						? pxToRem({ value: propValue, rem: settings.rem })
+						: propValue;
+
+					const resolvedValue = resolveValue({ map: resolvedMap, value: convertedValue });
+
+					const key = `--${primitiveName}-${variantName}-${propName}`;
+					const variable = `${key}: ${resolvedValue};`;
+					cssOutput.push(variable);
+					resolveMap.set(`${moduleKey}.${primitiveName}.${variantName}.${propName}`, {
+						key,
+						value: resolvedValue,
+						variable,
+					});
+				}
+			} catch (error) {
+				console.error(
+					`Error processing primitive ${primitiveName}-${variantName}:`,
+					error,
+				);
+				throw error;
+			}
+		}
+	}
+
+	return { css: { root: cssOutput.join("\n") }, resolveMap };
+}
diff --git a/packages/cssforge/src/modules/spacing.ts b/packages/cssforge/src/modules/spacing.ts
new file mode 100644
index 0000000..c321cab
--- /dev/null
+++ b/packages/cssforge/src/modules/spacing.ts
@@ -0,0 +1,128 @@
+import type { UtopiaSpaceConfig } from "utopia-core";
+import { calculateSpaceScale } from "utopia-core";
+import { pxToRem, validateName } from "../helpers.ts";
+import type { Output, ResolveMap } from "../lib.ts";
+
+export interface FluidSpaceConfig {
+	value: UtopiaSpaceConfig & {
+		/**
+		 * An optional prefix for the generated CSS variables.
+		 */
+		prefix?: string;
+	};
+}
+
+type SpacingValue = string;
+
+interface SpacingScale {
+	[key: string]: SpacingValue;
+}
+
+/**
+ * Settings for pixel to rem conversion.
+ */
+export interface PixelSettings {
+	/**
+	 * Whether to convert pixel values to rems.
+	 * @default true
+	 */
+	pxToRem?: boolean;
+	/**
+	 * The base rem value to use for conversion.
+	 * @default 16
+	 */
+	rem?: number;
+}
+
+/**
+ * The spacing configuration object.
+ */
+export interface SpacingConfig {
+	/**
+	 * Fluid spacing scales powered by utopia `calculateSpaceScale`.
+	 * Each key defines one scale. Tokens are derived from the returned sizes' labels.
+	 */
+	fluid?: {
+		[key: string]: FluidSpaceConfig;
+	};
+	/**
+	 * Static spacing scales defined under the `custom` key.
+	 * Each scale's `value` map contains token -> size (string) pairs.
+	 */
+	custom?: {
+		[key: string]: { value: SpacingScale; settings?: PixelSettings };
+	};
+}
+
+/**
+ * Convert spacing configuration into CSS custom properties.
+ *
+ * Generated variable naming:
+ * - Custom scale: `--spacing-{scale}-{token}` (renamed from --space-)
+ * - Fluid scale:  `--spacing_fluid-{prefixOrScale}-{token}` (renamed from --fluidspace-)
+
+ *
+ * @example
+ * // Static + fluid combined
+ * const { css } = processSpacing({
+ *   fluid: {
+ *     base: { value: { minSize: 4, maxSize: 24, minWidth: 320, maxWidth: 1280, negativeSteps: 0, positiveSteps: 2, prefix: "space" } }
+ *   },
+ *   custom: {
+ *     gap: { value: { 1: "4px", 2: "8px" } }
+ *   }
+ * });
+ */
+export function processSpacing(spacing: SpacingConfig): Output {
+	const cssOutput: string[] = [];
+	const resolveMap: ResolveMap = new Map();
+
+	if (spacing.fluid) {
+		const moduleKey = "spacing_fluid";
+		for (const [scaleName, { value }] of Object.entries(spacing.fluid)) {
+			validateName(scaleName);
+			const { prefix, ...utopiaConfig } = value;
+			if (prefix) validateName(prefix);
+
+			const { sizes, customPairs, oneUpPairs } = calculateSpaceScale(utopiaConfig);
+
+			const resolvedPrefix = prefix ? `${scaleName}-${prefix}` : scaleName;
+			for (const { label, clamp } of [sizes, customPairs, oneUpPairs].flat()) {
+				const variableName = `--${moduleKey}-${resolvedPrefix}-${label}`;
+				const cssVar = `${variableName}: ${clamp};`;
+				cssOutput.push(cssVar);
+				resolveMap.set(`${moduleKey}.${scaleName}@${label}`, {
+					variable: cssVar,
+					key: variableName,
+					value: clamp,
+				});
+			}
+		}
+	}
+
+	if (spacing.custom) {
+		const moduleKey = "spacing";
+		for (const [
+			scaleName,
+			{ value, settings = { pxToRem: true, rem: 16 } },
+		] of Object.entries(spacing.custom)) {
+			validateName(scaleName);
+			for (const [scaleKey, scaleValue] of Object.entries(value)) {
+				validateName(scaleKey);
+				const convertedValue = settings.pxToRem
+					? pxToRem({ value: scaleValue, rem: settings.rem })
+					: scaleValue;
+				const varName = `--${moduleKey}-${scaleName}-${scaleKey}`;
+				const variable = `${varName}: ${convertedValue};`;
+				cssOutput.push(variable);
+				resolveMap.set(`${moduleKey}.custom.${scaleName}.${scaleKey}`, {
+					variable,
+					key: varName,
+					value: convertedValue,
+				});
+			}
+		}
+	}
+
+	return { css: { root: cssOutput.join("\n") }, resolveMap };
+}
diff --git a/packages/cssforge/src/modules/typography.ts b/packages/cssforge/src/modules/typography.ts
new file mode 100644
index 0000000..5b43a0c
--- /dev/null
+++ b/packages/cssforge/src/modules/typography.ts
@@ -0,0 +1,123 @@
+import { calculateTypeScale, type UtopiaTypeConfig } from "utopia-core";
+import type { Output, ResolveMap } from "../lib.ts";
+import { validateName } from "../helpers.ts";
+
+export interface FluidTypeScaleDefinition {
+	/**
+	 * The configuration for the type scale generation.
+	 */
+	value: Omit<UtopiaTypeConfig, "labelStyle"> & {
+		/**
+		 * An optional prefix for the generated CSS variables.
+		 */
+		prefix?: string;
+	};
+	/**
+	 * Optional settings for the type scale.
+	 */
+	settings?: {
+		/**
+		 * Custom labels for the type scale steps.
+		 */
+		customLabel?: Record<string, string>;
+	};
+}
+
+interface TypographyWeight {
+	value: {
+		[key: string]: string;
+	};
+}
+
+export interface TypographyConfig {
+	/**
+	 * A fluid typescale definition.
+	 */
+	fluid?: { [scaleName: string]: FluidTypeScaleDefinition };
+	/**
+	 * A collection of font weights.
+	 */
+	weight?: { [groupName: string]: TypographyWeight };
+}
+
+/**
+ * Generate CSS Custom Properties for typography.
+ *
+ * @example
+ * ```ts
+ * const typography: TypographyConfig = {
+ *   fluid: {
+ *     base: {
+ *       value: {
+ *         minWidth: 320,
+ *         minFontSize: 14,
+ *         minTypeScale: 1.25,
+ *         maxWidth: 1435,
+ *         maxFontSize: 16,
+ *         maxTypeScale: 1.25,
+ *         positiveSteps: 2,
+ *         negativeSteps: 1,
+ *         prefix: "text",
+ *       },
+ *     },
+ *   },
+ *   weight: { arial: { value: { regular: "400", bold: "700" } } },
+ * };
+ * const { css } = processTypography(typography);
+ * ```
+ */
+export function processTypography(config: TypographyConfig): Output {
+	const cssOutput: string[] = [];
+	const resolveMap: ResolveMap = new Map();
+
+	if (config.fluid) {
+		const moduleKey = "typography_fluid";
+		for (const [scaleName, definition] of Object.entries(config.fluid)) {
+			validateName(scaleName);
+			const { value, settings } = definition;
+			const { prefix, ...utopiaConfig } = value;
+			if (prefix) validateName(prefix);
+
+			const scale = calculateTypeScale({
+				labelStyle: settings?.customLabel ? "utopia" : "tshirt",
+				...utopiaConfig,
+			});
+
+			const resolvedPrefix = prefix ? `${scaleName}-${prefix}` : scaleName;
+			for (const { label, clamp } of scale) {
+				const resolvedLabel = settings?.customLabel
+					? (settings.customLabel[label] ?? label)
+					: label;
+				const key = `--${moduleKey}-${resolvedPrefix}-${resolvedLabel}`;
+				const variable = `${key}: ${clamp};`;
+				cssOutput.push(variable);
+				resolveMap.set(`${moduleKey}.${scaleName}@${resolvedLabel}`, {
+					variable,
+					key,
+					value: clamp,
+				});
+			}
+		}
+	}
+
+	// Weights
+	if (config.weight) {
+		const moduleKey = "typography";
+		for (const [weightName, { value }] of Object.entries(config.weight)) {
+			validateName(weightName);
+			for (const [token, weightValue] of Object.entries(value)) {
+				validateName(token);
+				const key = `--${moduleKey}-weight-${weightName}-${token}`;
+				const variable = `${key}: ${weightValue};`;
+				cssOutput.push(variable);
+				resolveMap.set(`${moduleKey}.weight.${weightName}.${token}`, {
+					variable,
+					key,
+					value: weightValue,
+				});
+			}
+		}
+	}
+
+	return { css: { root: cssOutput.join("\n") }, resolveMap };
+}
diff --git a/packages/cssforge/tests/__snapshots__/colors.test.ts.snap b/packages/cssforge/tests/__snapshots__/colors.test.ts.snap
new file mode 100644
index 0000000..8266dc5
--- /dev/null
+++ b/packages/cssforge/tests/__snapshots__/colors.test.ts.snap
@@ -0,0 +1,460 @@
+// Vitest Snapshot v1, https://vitest.dev/guide/snapshot.html
+
+exports[`processColors - converts hex to oklch 1`] = `
+"/* Palette */
+/* coral */
+--palette-coral-100: oklch(73.511% 0.16799 40.24666);
+--palette-coral-200: oklch(69.622% 0.19552 32.32143);"
+`;
+
+exports[`processColors - converts hex to oklch 2`] = `
+[
+  [
+    "palette.coral.100",
+    {
+      "key": "--palette-coral-100",
+      "value": "oklch(73.511% 0.16799 40.24666)",
+      "variable": "--palette-coral-100: oklch(73.511% 0.16799 40.24666);",
+    },
+  ],
+  [
+    "palette.coral.200",
+    {
+      "key": "--palette-coral-200",
+      "value": "oklch(69.622% 0.19552 32.32143)",
+      "variable": "--palette-coral-200: oklch(69.622% 0.19552 32.32143);",
+    },
+  ],
+]
+`;
+
+exports[`processColors - generates gradient with color variables 1`] = `
+"/* Palette */
+/* coral */
+--palette-coral-50: oklch(73.58% 0.16378 34.33822);
+--palette-coral-90: oklch(73.341% 0.17338 44.64289);
+--palette-coral-100: oklch(69.622% 0.19552 32.32143);
+/* indigo */
+--palette-indigo-100: oklch(51.057% 0.23005 276.96564);
+/* Gradients */
+/* orangeGradient */
+--gradients-orangeGradient-primary: linear-gradient(261.78deg, var(--palette-coral-50) 33.1%, var(--palette-coral-90) 56.3%, var(--palette-coral-100) 65.78%, var(--palette-indigo-100) 84.23%);"
+`;
+
+exports[`processColors - generates gradient with color variables 2`] = `
+[
+  [
+    "palette.coral.50",
+    {
+      "key": "--palette-coral-50",
+      "value": "oklch(73.58% 0.16378 34.33822)",
+      "variable": "--palette-coral-50: oklch(73.58% 0.16378 34.33822);",
+    },
+  ],
+  [
+    "palette.coral.90",
+    {
+      "key": "--palette-coral-90",
+      "value": "oklch(73.341% 0.17338 44.64289)",
+      "variable": "--palette-coral-90: oklch(73.341% 0.17338 44.64289);",
+    },
+  ],
+  [
+    "palette.coral.100",
+    {
+      "key": "--palette-coral-100",
+      "value": "oklch(69.622% 0.19552 32.32143)",
+      "variable": "--palette-coral-100: oklch(69.622% 0.19552 32.32143);",
+    },
+  ],
+  [
+    "palette.indigo.100",
+    {
+      "key": "--palette-indigo-100",
+      "value": "oklch(51.057% 0.23005 276.96564)",
+      "variable": "--palette-indigo-100: oklch(51.057% 0.23005 276.96564);",
+    },
+  ],
+  [
+    "gradients.orangeGradient.primary",
+    {
+      "key": "--gradients-orangeGradient-primary",
+      "value": "linear-gradient(261.78deg, var(--palette-coral-50) 33.1%, var(--palette-coral-90) 56.3%, var(--palette-coral-100) 65.78%, var(--palette-indigo-100) 84.23%)",
+      "variable": "--gradients-orangeGradient-primary: linear-gradient(261.78deg, var(--palette-coral-50) 33.1%, var(--palette-coral-90) 56.3%, var(--palette-coral-100) 65.78%, var(--palette-indigo-100) 84.23%);",
+    },
+  ],
+]
+`;
+
+exports[`processColors - handles different color formats 1`] = `
+"/* Palette */
+/* brand */
+--palette-brand-200: oklch(86.644% 0.29483 142.49535);
+--palette-brand-300: oklch(45.201% 0.31321 264.05202);
+--palette-brand-400: oklch(70% 0.2 270);
+--palette-brand-default: oklch(62.796% 0.25768 29.23388);"
+`;
+
+exports[`processColors - handles different color formats 2`] = `
+[
+  [
+    "palette.brand.200",
+    {
+      "key": "--palette-brand-200",
+      "value": "oklch(86.644% 0.29483 142.49535)",
+      "variable": "--palette-brand-200: oklch(86.644% 0.29483 142.49535);",
+    },
+  ],
+  [
+    "palette.brand.300",
+    {
+      "key": "--palette-brand-300",
+      "value": "oklch(45.201% 0.31321 264.05202)",
+      "variable": "--palette-brand-300: oklch(45.201% 0.31321 264.05202);",
+    },
+  ],
+  [
+    "palette.brand.400",
+    {
+      "key": "--palette-brand-400",
+      "value": "oklch(70% 0.2 270)",
+      "variable": "--palette-brand-400: oklch(70% 0.2 270);",
+    },
+  ],
+  [
+    "palette.brand.default",
+    {
+      "key": "--palette-brand-default",
+      "value": "oklch(62.796% 0.25768 29.23388)",
+      "variable": "--palette-brand-default: oklch(62.796% 0.25768 29.23388);",
+    },
+  ],
+]
+`;
+
+exports[`processColors - handles gradients with atRule 1`] = `
+"/* Palette */
+/* coral */
+--palette-coral-50: oklch(73.58% 0.16378 34.33822);
+/* Gradients */
+/* orangeGradient */
+@media (prefers-color-scheme: dark) {
+  --gradients-orangeGradient-primary: linear-gradient(to right, var(--palette-coral-50), var(--palette-coral-50));
+}"
+`;
+
+exports[`processColors - handles gradients with atRule 2`] = `
+[
+  [
+    "palette.coral.50",
+    {
+      "key": "--palette-coral-50",
+      "value": "oklch(73.58% 0.16378 34.33822)",
+      "variable": "--palette-coral-50: oklch(73.58% 0.16378 34.33822);",
+    },
+  ],
+  [
+    "gradients.orangeGradient.primary",
+    {
+      "key": "--gradients-orangeGradient-primary",
+      "value": "linear-gradient(to right, var(--palette-coral-50), var(--palette-coral-50))",
+      "variable": "--gradients-orangeGradient-primary: linear-gradient(to right, var(--palette-coral-50), var(--palette-coral-50));",
+    },
+  ],
+]
+`;
+
+exports[`processColors - handles palette colors with atRule 1`] = `
+"/* Palette */
+/* background */
+--palette-background-light: oklch(100% 0 0);
+/* backgroundDark */
+@media (prefers-color-scheme: dark) {
+  --palette-backgroundDark-dark: oklch(0% 0 0);
+}"
+`;
+
+exports[`processColors - handles palette colors with atRule 2`] = `
+[
+  [
+    "palette.background.light",
+    {
+      "key": "--palette-background-light",
+      "value": "oklch(100% 0 0)",
+      "variable": "--palette-background-light: oklch(100% 0 0);",
+    },
+  ],
+  [
+    "palette.backgroundDark.dark",
+    {
+      "key": "--palette-backgroundDark-dark",
+      "value": "oklch(0% 0 0)",
+      "variable": "--palette-backgroundDark-dark: oklch(0% 0 0);",
+    },
+  ],
+]
+`;
+
+exports[`processColors - handles selector + atRule 1`] = `
+"/* Palette */
+/* base */
+--palette-base-primary: oklch(73.511% 0.16799 40.24666);
+/* Themes */
+/* Theme: dark */
+@media (prefers-color-scheme: dark) {
+  .dark-theme {
+    /* background */
+    --theme-dark-background-primary: var(--palette-base-primary);
+  }
+}"
+`;
+
+exports[`processColors - handles selector + atRule 2`] = `
+[
+  [
+    "palette.base.primary",
+    {
+      "key": "--palette-base-primary",
+      "value": "oklch(73.511% 0.16799 40.24666)",
+      "variable": "--palette-base-primary: oklch(73.511% 0.16799 40.24666);",
+    },
+  ],
+  [
+    "theme.dark.background.primary",
+    {
+      "key": "--theme-dark-background-primary",
+      "value": "var(--palette-base-primary)",
+      "variable": "--theme-dark-background-primary: var(--palette-base-primary);",
+    },
+  ],
+]
+`;
+
+exports[`processColors - handles string values 1`] = `
+"/* Palette */
+/* simple */
+--palette-simple-white: oklch(100% 0 0);
+--palette-simple-black: oklch(0% 0 0);"
+`;
+
+exports[`processColors - handles string values 2`] = `
+[
+  [
+    "palette.simple.white",
+    {
+      "key": "--palette-simple-white",
+      "value": "oklch(100% 0 0)",
+      "variable": "--palette-simple-white: oklch(100% 0 0);",
+    },
+  ],
+  [
+    "palette.simple.black",
+    {
+      "key": "--palette-simple-black",
+      "value": "oklch(0% 0 0)",
+      "variable": "--palette-simple-black: oklch(0% 0 0);",
+    },
+  ],
+]
+`;
+
+exports[`processColors - handles theme variantNameOnly 1`] = `
+"/* Palette */
+/* simple */
+--palette-simple-white: oklch(100% 0 0);
+--palette-simple-black: oklch(0% 0 0);
+/* Themes */
+/* Theme: light */
+/* background */
+--primary: var(--palette-simple-white);
+--secondary: var(--palette-simple-black);"
+`;
+
+exports[`processColors - handles theme variantNameOnly 2`] = `
+[
+  [
+    "palette.simple.white",
+    {
+      "key": "--palette-simple-white",
+      "value": "oklch(100% 0 0)",
+      "variable": "--palette-simple-white: oklch(100% 0 0);",
+    },
+  ],
+  [
+    "palette.simple.black",
+    {
+      "key": "--palette-simple-black",
+      "value": "oklch(0% 0 0)",
+      "variable": "--palette-simple-black: oklch(0% 0 0);",
+    },
+  ],
+  [
+    "theme.light.background.primary",
+    {
+      "key": "--primary",
+      "value": "var(--palette-simple-white)",
+      "variable": "--primary: var(--palette-simple-white);",
+    },
+  ],
+  [
+    "theme.light.background.secondary",
+    {
+      "key": "--secondary",
+      "value": "var(--palette-simple-black)",
+      "variable": "--secondary: var(--palette-simple-black);",
+    },
+  ],
+]
+`;
+
+exports[`processColors - handles themes 1`] = `
+"/* Palette */
+/* simple */
+--palette-simple-white: oklch(100% 0 0);
+--palette-simple-black: oklch(0% 0 0);
+/* Themes */
+/* Theme: light */
+/* background */
+--theme-light-background-primary: var(--palette-simple-white);
+--theme-light-background-secondary: var(--palette-simple-black);"
+`;
+
+exports[`processColors - handles themes 2`] = `
+[
+  [
+    "palette.simple.white",
+    {
+      "key": "--palette-simple-white",
+      "value": "oklch(100% 0 0)",
+      "variable": "--palette-simple-white: oklch(100% 0 0);",
+    },
+  ],
+  [
+    "palette.simple.black",
+    {
+      "key": "--palette-simple-black",
+      "value": "oklch(0% 0 0)",
+      "variable": "--palette-simple-black: oklch(0% 0 0);",
+    },
+  ],
+  [
+    "theme.light.background.primary",
+    {
+      "key": "--theme-light-background-primary",
+      "value": "var(--palette-simple-white)",
+      "variable": "--theme-light-background-primary: var(--palette-simple-white);",
+    },
+  ],
+  [
+    "theme.light.background.secondary",
+    {
+      "key": "--theme-light-background-secondary",
+      "value": "var(--palette-simple-black)",
+      "variable": "--theme-light-background-secondary: var(--palette-simple-black);",
+    },
+  ],
+]
+`;
+
+exports[`processColors - handles themes referencing gradients 1`] = `
+"/* Palette */
+/* coral */
+--palette-coral-50: oklch(73.58% 0.16378 34.33822);
+/* Gradients */
+/* orangeGradient */
+--gradients-orangeGradient-primary: linear-gradient(to right, var(--palette-coral-50), var(--palette-coral-50));
+/* Themes */
+/* Theme: light */
+/* background */
+--theme-light-background-primary: var(--gradients-orangeGradient-primary);"
+`;
+
+exports[`processColors - handles themes referencing gradients 2`] = `
+[
+  [
+    "palette.coral.50",
+    {
+      "key": "--palette-coral-50",
+      "value": "oklch(73.58% 0.16378 34.33822)",
+      "variable": "--palette-coral-50: oklch(73.58% 0.16378 34.33822);",
+    },
+  ],
+  [
+    "gradients.orangeGradient.primary",
+    {
+      "key": "--gradients-orangeGradient-primary",
+      "value": "linear-gradient(to right, var(--palette-coral-50), var(--palette-coral-50))",
+      "variable": "--gradients-orangeGradient-primary: linear-gradient(to right, var(--palette-coral-50), var(--palette-coral-50));",
+    },
+  ],
+  [
+    "theme.light.background.primary",
+    {
+      "key": "--theme-light-background-primary",
+      "value": "var(--gradients-orangeGradient-primary)",
+      "variable": "--theme-light-background-primary: var(--gradients-orangeGradient-primary);",
+    },
+  ],
+]
+`;
+
+exports[`processColors - handles themes with selector 1`] = `
+"/* Palette */
+/* base */
+--palette-base-primary: oklch(73.511% 0.16799 40.24666);
+/* Themes */
+/* Theme: dark */
+.dark-theme {
+  /* background */
+  --theme-dark-background-primary: var(--palette-base-primary);
+}"
+`;
+
+exports[`processColors - handles themes with selector 2`] = `
+[
+  [
+    "palette.base.primary",
+    {
+      "key": "--palette-base-primary",
+      "value": "oklch(73.511% 0.16799 40.24666)",
+      "variable": "--palette-base-primary: oklch(73.511% 0.16799 40.24666);",
+    },
+  ],
+  [
+    "theme.dark.background.primary",
+    {
+      "key": "--theme-dark-background-primary",
+      "value": "var(--palette-base-primary)",
+      "variable": "--theme-dark-background-primary: var(--palette-base-primary);",
+    },
+  ],
+]
+`;
+
+exports[`processColors - handles transparency 1`] = `
+"/* Palette */
+/* alpha */
+--palette-alpha-softGray1: oklch(14.48% 0 0 / 12%);
+--palette-alpha-softGray2: oklch(14.48% 0 0 / 24%);"
+`;
+
+exports[`processColors - handles transparency 2`] = `
+[
+  [
+    "palette.alpha.softGray1",
+    {
+      "key": "--palette-alpha-softGray1",
+      "value": "oklch(14.48% 0 0 / 12%)",
+      "variable": "--palette-alpha-softGray1: oklch(14.48% 0 0 / 12%);",
+    },
+  ],
+  [
+    "palette.alpha.softGray2",
+    {
+      "key": "--palette-alpha-softGray2",
+      "value": "oklch(14.48% 0 0 / 24%)",
+      "variable": "--palette-alpha-softGray2: oklch(14.48% 0 0 / 24%);",
+    },
+  ],
+]
+`;
diff --git a/packages/cssforge/tests/__snapshots__/primitive.test.ts.snap b/packages/cssforge/tests/__snapshots__/primitive.test.ts.snap
new file mode 100644
index 0000000..b18ba8c
--- /dev/null
+++ b/packages/cssforge/tests/__snapshots__/primitive.test.ts.snap
@@ -0,0 +1,180 @@
+// Vitest Snapshot v1, https://vitest.dev/guide/snapshot.html
+
+exports[`processPrimitives - processes button with variables 1`] = `
+{
+  "root": "/* button */
+--button-small-width: 120px;
+--button-small-height: 40px;
+--button-small-fontSize: var(--typography_fluid-arial-foo-m);
+--button-small-radius: 8px;
+--button-small-padding: var(--spacing-size-2) var(--spacing-size-3);",
+}
+`;
+
+exports[`processPrimitives - processes button with variables 2`] = `
+[
+  [
+    "primitives.button.small.width",
+    {
+      "key": "--button-small-width",
+      "value": "120px",
+      "variable": "--button-small-width: 120px;",
+    },
+  ],
+  [
+    "primitives.button.small.height",
+    {
+      "key": "--button-small-height",
+      "value": "40px",
+      "variable": "--button-small-height: 40px;",
+    },
+  ],
+  [
+    "primitives.button.small.fontSize",
+    {
+      "key": "--button-small-fontSize",
+      "value": "var(--typography_fluid-arial-foo-m)",
+      "variable": "--button-small-fontSize: var(--typography_fluid-arial-foo-m);",
+    },
+  ],
+  [
+    "primitives.button.small.radius",
+    {
+      "key": "--button-small-radius",
+      "value": "8px",
+      "variable": "--button-small-radius: 8px;",
+    },
+  ],
+  [
+    "primitives.button.small.padding",
+    {
+      "key": "--button-small-padding",
+      "value": "var(--spacing-size-2) var(--spacing-size-3)",
+      "variable": "--button-small-padding: var(--spacing-size-2) var(--spacing-size-3);",
+    },
+  ],
+]
+`;
+
+exports[`processPrimitives - processes buttons with settings 1`] = `
+{
+  "root": "/* button */
+--button-small-width: 120px;
+--button-small-height: 40px;
+--button-small-radius: 8px;
+--button-big-width: 15rem;
+--button-big-height: 5rem;
+--button-big-radius: 1rem;",
+}
+`;
+
+exports[`processPrimitives - processes buttons with settings 2`] = `
+[
+  [
+    "primitives.button.small.width",
+    {
+      "key": "--button-small-width",
+      "value": "120px",
+      "variable": "--button-small-width: 120px;",
+    },
+  ],
+  [
+    "primitives.button.small.height",
+    {
+      "key": "--button-small-height",
+      "value": "40px",
+      "variable": "--button-small-height: 40px;",
+    },
+  ],
+  [
+    "primitives.button.small.radius",
+    {
+      "key": "--button-small-radius",
+      "value": "8px",
+      "variable": "--button-small-radius: 8px;",
+    },
+  ],
+  [
+    "primitives.button.big.width",
+    {
+      "key": "--button-big-width",
+      "value": "15rem",
+      "variable": "--button-big-width: 15rem;",
+    },
+  ],
+  [
+    "primitives.button.big.height",
+    {
+      "key": "--button-big-height",
+      "value": "5rem",
+      "variable": "--button-big-height: 5rem;",
+    },
+  ],
+  [
+    "primitives.button.big.radius",
+    {
+      "key": "--button-big-radius",
+      "value": "1rem",
+      "variable": "--button-big-radius: 1rem;",
+    },
+  ],
+]
+`;
+
+exports[`processPrimitives - references colors, gradients, and themes 1`] = `
+{
+  "root": "/* card */
+--card-default-background-color: var(--theme-light-background-primary);
+--card-default-background-image: var(--gradients-orangeGradient-primary);
+--card-default-border-color: var(--palette-coral-50);",
+}
+`;
+
+exports[`processPrimitives - references colors, gradients, and themes 2`] = `
+[
+  [
+    "primitives.card.default.background-color",
+    {
+      "key": "--card-default-background-color",
+      "value": "var(--theme-light-background-primary)",
+      "variable": "--card-default-background-color: var(--theme-light-background-primary);",
+    },
+  ],
+  [
+    "primitives.card.default.background-image",
+    {
+      "key": "--card-default-background-image",
+      "value": "var(--gradients-orangeGradient-primary)",
+      "variable": "--card-default-background-image: var(--gradients-orangeGradient-primary);",
+    },
+  ],
+  [
+    "primitives.card.default.border-color",
+    {
+      "key": "--card-default-border-color",
+      "value": "var(--palette-coral-50)",
+      "variable": "--card-default-border-color: var(--palette-coral-50);",
+    },
+  ],
+]
+`;
+
+exports[`processPrimitives - uses fluid spacing references 1`] = `
+{
+  "root": "/* box */
+--box-default-padding: var(--spacing_fluid-gap-gs-s) var(--spacing_fluid-gap-gs-m);",
+}
+`;
+
+exports[`processPrimitives - uses fluid spacing references 2`] = `
+[
+  [
+    "primitives.box.default.padding",
+    {
+      "key": "--box-default-padding",
+      "value": "var(--spacing_fluid-gap-gs-s) var(--spacing_fluid-gap-gs-m)",
+      "variable": "--box-default-padding: var(--spacing_fluid-gap-gs-s) var(--spacing_fluid-gap-gs-m);",
+    },
+  ],
+]
+`;
diff --git a/packages/cssforge/tests/__snapshots__/spacing.test.ts.snap b/packages/cssforge/tests/__snapshots__/spacing.test.ts.snap
new file mode 100644
index 0000000..88f149c
--- /dev/null
+++ b/packages/cssforge/tests/__snapshots__/spacing.test.ts.snap
@@ -0,0 +1,293 @@
+// Vitest Snapshot v1, https://vitest.dev/guide/snapshot.html
+
+exports[`processSpacing - combines fluid and custom spacing 1`] = `
+"--spacing_fluid-base-flux-xs: clamp(0rem, 0rem + 0vw, 0rem);
+--spacing_fluid-base-flux-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
+--spacing_fluid-base-flux-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
+--spacing_fluid-base-flux-xs-s: clamp(0rem, -0.5rem + 2.5vw, 1.5rem);
+--spacing_fluid-base-flux-s-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
+--spacing-gap-1: 4px;
+--spacing-gap-2: 8px;"
+`;
+
+exports[`processSpacing - combines fluid and custom spacing 2`] = `
+[
+  [
+    "spacing_fluid.base@xs",
+    {
+      "key": "--spacing_fluid-base-flux-xs",
+      "value": "clamp(0rem, 0rem + 0vw, 0rem)",
+      "variable": "--spacing_fluid-base-flux-xs: clamp(0rem, 0rem + 0vw, 0rem);",
+    },
+  ],
+  [
+    "spacing_fluid.base@s",
+    {
+      "key": "--spacing_fluid-base-flux-s",
+      "value": "clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem)",
+      "variable": "--spacing_fluid-base-flux-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
+    },
+  ],
+  [
+    "spacing_fluid.base@m",
+    {
+      "key": "--spacing_fluid-base-flux-m",
+      "value": "clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem)",
+      "variable": "--spacing_fluid-base-flux-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
+    },
+  ],
+  [
+    "spacing_fluid.base@xs-s",
+    {
+      "key": "--spacing_fluid-base-flux-xs-s",
+      "value": "clamp(0rem, -0.5rem + 2.5vw, 1.5rem)",
+      "variable": "--spacing_fluid-base-flux-xs-s: clamp(0rem, -0.5rem + 2.5vw, 1.5rem);",
+    },
+  ],
+  [
+    "spacing_fluid.base@s-m",
+    {
+      "key": "--spacing_fluid-base-flux-s-m",
+      "value": "clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem)",
+      "variable": "--spacing_fluid-base-flux-s-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
+    },
+  ],
+  [
+    "spacing.custom.gap.1",
+    {
+      "key": "--spacing-gap-1",
+      "value": "4px",
+      "variable": "--spacing-gap-1: 4px;",
+    },
+  ],
+  [
+    "spacing.custom.gap.2",
+    {
+      "key": "--spacing-gap-2",
+      "value": "8px",
+      "variable": "--spacing-gap-2: 8px;",
+    },
+  ],
+]
+`;
+
+exports[`processSpacing - fluid without prefix falls back to scale name 1`] = `
+"--spacing_fluid-rhythm-xs: clamp(0rem, 0rem + 0vw, 0rem);
+--spacing_fluid-rhythm-s: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);
+--spacing_fluid-rhythm-m: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);
+--spacing_fluid-rhythm-xs-s: clamp(0rem, -0.4167rem + 2.0833vw, 1.25rem);
+--spacing_fluid-rhythm-s-m: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);"
+`;
+
+exports[`processSpacing - fluid without prefix falls back to scale name 2`] = `
+[
+  [
+    "spacing_fluid.rhythm@xs",
+    {
+      "key": "--spacing_fluid-rhythm-xs",
+      "value": "clamp(0rem, 0rem + 0vw, 0rem)",
+      "variable": "--spacing_fluid-rhythm-xs: clamp(0rem, 0rem + 0vw, 0rem);",
+    },
+  ],
+  [
+    "spacing_fluid.rhythm@s",
+    {
+      "key": "--spacing_fluid-rhythm-s",
+      "value": "clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem)",
+      "variable": "--spacing_fluid-rhythm-s: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);",
+    },
+  ],
+  [
+    "spacing_fluid.rhythm@m",
+    {
+      "key": "--spacing_fluid-rhythm-m",
+      "value": "clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem)",
+      "variable": "--spacing_fluid-rhythm-m: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);",
+    },
+  ],
+  [
+    "spacing_fluid.rhythm@xs-s",
+    {
+      "key": "--spacing_fluid-rhythm-xs-s",
+      "value": "clamp(0rem, -0.4167rem + 2.0833vw, 1.25rem)",
+      "variable": "--spacing_fluid-rhythm-xs-s: clamp(0rem, -0.4167rem + 2.0833vw, 1.25rem);",
+    },
+  ],
+  [
+    "spacing_fluid.rhythm@s-m",
+    {
+      "key": "--spacing_fluid-rhythm-s-m",
+      "value": "clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem)",
+      "variable": "--spacing_fluid-rhythm-s-m: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);",
+    },
+  ],
+]
+`;
+
+exports[`processSpacing - generates correct spacing scale 1`] = `
+"--spacing-size-1: 0.25rem;
+--spacing-size-2: 0.5rem;
+--spacing-size-3: 0.75rem;
+--spacing-size-s: 1rem;"
+`;
+
+exports[`processSpacing - generates correct spacing scale 2`] = `
+[
+  [
+    "spacing.custom.size.1",
+    {
+      "key": "--spacing-size-1",
+      "value": "0.25rem",
+      "variable": "--spacing-size-1: 0.25rem;",
+    },
+  ],
+  [
+    "spacing.custom.size.2",
+    {
+      "key": "--spacing-size-2",
+      "value": "0.5rem",
+      "variable": "--spacing-size-2: 0.5rem;",
+    },
+  ],
+  [
+    "spacing.custom.size.3",
+    {
+      "key": "--spacing-size-3",
+      "value": "0.75rem",
+      "variable": "--spacing-size-3: 0.75rem;",
+    },
+  ],
+  [
+    "spacing.custom.size.s",
+    {
+      "key": "--spacing-size-s",
+      "value": "1rem",
+      "variable": "--spacing-size-s: 1rem;",
+    },
+  ],
+]
+`;
+
+exports[`processSpacing - generates fluid spacing (prefix) 1`] = `
+"--spacing_fluid-base-foo-xs: clamp(0rem, 0rem + 0vw, 0rem);
+--spacing_fluid-base-foo-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
+--spacing_fluid-base-foo-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
+--spacing_fluid-base-foo-l: clamp(0.5rem, -0.3333rem + 4.1667vw, 3rem);
+--spacing_fluid-base-foo-xs-l: clamp(0rem, -1rem + 5vw, 3rem);
+--spacing_fluid-base-foo-xs-s: clamp(0rem, -0.5rem + 2.5vw, 1.5rem);
+--spacing_fluid-base-foo-s-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
+--spacing_fluid-base-foo-m-l: clamp(0.25rem, -0.6667rem + 4.5833vw, 3rem);"
+`;
+
+exports[`processSpacing - generates fluid spacing (prefix) 2`] = `
+[
+  [
+    "spacing_fluid.base@xs",
+    {
+      "key": "--spacing_fluid-base-foo-xs",
+      "value": "clamp(0rem, 0rem + 0vw, 0rem)",
+      "variable": "--spacing_fluid-base-foo-xs: clamp(0rem, 0rem + 0vw, 0rem);",
+    },
+  ],
+  [
+    "spacing_fluid.base@s",
+    {
+      "key": "--spacing_fluid-base-foo-s",
+      "value": "clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem)",
+      "variable": "--spacing_fluid-base-foo-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
+    },
+  ],
+  [
+    "spacing_fluid.base@m",
+    {
+      "key": "--spacing_fluid-base-foo-m",
+      "value": "clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem)",
+      "variable": "--spacing_fluid-base-foo-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
+    },
+  ],
+  [
+    "spacing_fluid.base@l",
+    {
+      "key": "--spacing_fluid-base-foo-l",
+      "value": "clamp(0.5rem, -0.3333rem + 4.1667vw, 3rem)",
+      "variable": "--spacing_fluid-base-foo-l: clamp(0.5rem, -0.3333rem + 4.1667vw, 3rem);",
+    },
+  ],
+  [
+    "spacing_fluid.base@xs-l",
+    {
+      "key": "--spacing_fluid-base-foo-xs-l",
+      "value": "clamp(0rem, -1rem + 5vw, 3rem)",
+      "variable": "--spacing_fluid-base-foo-xs-l: clamp(0rem, -1rem + 5vw, 3rem);",
+    },
+  ],
+  [
+    "spacing_fluid.base@xs-s",
+    {
+      "key": "--spacing_fluid-base-foo-xs-s",
+      "value": "clamp(0rem, -0.5rem + 2.5vw, 1.5rem)",
+      "variable": "--spacing_fluid-base-foo-xs-s: clamp(0rem, -0.5rem + 2.5vw, 1.5rem);",
+    },
+  ],
+  [
+    "spacing_fluid.base@s-m",
+    {
+      "key": "--spacing_fluid-base-foo-s-m",
+      "value": "clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem)",
+      "variable": "--spacing_fluid-base-foo-s-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
+    },
+  ],
+  [
+    "spacing_fluid.base@m-l",
+    {
+      "key": "--spacing_fluid-base-foo-m-l",
+      "value": "clamp(0.25rem, -0.6667rem + 4.5833vw, 3rem)",
+      "variable": "--spacing_fluid-base-foo-m-l: clamp(0.25rem, -0.6667rem + 4.5833vw, 3rem);",
+    },
+  ],
+]
+`;
+
+exports[`processSpacing - handles settings 1`] = `
+"--spacing-size-1: 1rem;
+--spacing-size-2: 0.5rem;
+--spacing-scale-md: 8px;
+--spacing-scale-lg: 0.75rem;"
+`;
+
+exports[`processSpacing - handles settings 2`] = `
+[
+  [
+    "spacing.custom.size.1",
+    {
+      "key": "--spacing-size-1",
+      "value": "1rem",
+      "variable": "--spacing-size-1: 1rem;",
+    },
+  ],
+  [
+    "spacing.custom.size.2",
+    {
+      "key": "--spacing-size-2",
+      "value": "0.5rem",
+      "variable": "--spacing-size-2: 0.5rem;",
+    },
+  ],
+  [
+    "spacing.custom.scale.md",
+    {
+      "key": "--spacing-scale-md",
+      "value": "8px",
+      "variable": "--spacing-scale-md: 8px;",
+    },
+  ],
+  [
+    "spacing.custom.scale.lg",
+    {
+      "key": "--spacing-scale-lg",
+      "value": "0.75rem",
+      "variable": "--spacing-scale-lg: 0.75rem;",
+    },
+  ],
+]
+`;
diff --git a/packages/cssforge/tests/__snapshots__/typography.test.ts.snap b/packages/cssforge/tests/__snapshots__/typography.test.ts.snap
new file mode 100644
index 0000000..12e77b3
--- /dev/null
+++ b/packages/cssforge/tests/__snapshots__/typography.test.ts.snap
@@ -0,0 +1,274 @@
+// Vitest Snapshot v1, https://vitest.dev/guide/snapshot.html
+
+exports[`processTypography - can process weights 1`] = `
+{
+  "root": "--typography_fluid-arial-2xl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);
+--typography_fluid-arial-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);
+--typography_fluid-arial-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);
+--typography_fluid-arial-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);
+--typography_fluid-arial-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);
+--typography_fluid-arial-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);
+--typography_fluid-arial-2xs: clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem);
+--typography-weight-arial-regular: 500;",
+}
+`;
+
+exports[`processTypography - can process weights 2`] = `
+[
+  [
+    "typography_fluid.arial@2xl",
+    {
+      "key": "--typography_fluid-arial-2xl",
+      "value": "clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem)",
+      "variable": "--typography_fluid-arial-2xl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@xl",
+    {
+      "key": "--typography_fluid-arial-xl",
+      "value": "clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem)",
+      "variable": "--typography_fluid-arial-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@l",
+    {
+      "key": "--typography_fluid-arial-l",
+      "value": "clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem)",
+      "variable": "--typography_fluid-arial-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@m",
+    {
+      "key": "--typography_fluid-arial-m",
+      "value": "clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem)",
+      "variable": "--typography_fluid-arial-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@s",
+    {
+      "key": "--typography_fluid-arial-s",
+      "value": "clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem)",
+      "variable": "--typography_fluid-arial-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@xs",
+    {
+      "key": "--typography_fluid-arial-xs",
+      "value": "clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem)",
+      "variable": "--typography_fluid-arial-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@2xs",
+    {
+      "key": "--typography_fluid-arial-2xs",
+      "value": "clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem)",
+      "variable": "--typography_fluid-arial-2xs: clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem);",
+    },
+  ],
+  [
+    "typography.weight.arial.regular",
+    {
+      "key": "--typography-weight-arial-regular",
+      "value": "500",
+      "variable": "--typography-weight-arial-regular: 500;",
+    },
+  ],
+]
+`;
+
+exports[`processTypography - generates correct CSS variables 1`] = `
+{
+  "root": "--typography_fluid-arial-4xl: clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem);
+--typography_fluid-arial-3xl: clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem);
+--typography_fluid-arial-2xl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);
+--typography_fluid-arial-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);
+--typography_fluid-arial-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);
+--typography_fluid-arial-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);
+--typography_fluid-arial-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);
+--typography_fluid-arial-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);
+--typography_fluid-arial-2xs: clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem);",
+}
+`;
+
+exports[`processTypography - generates correct CSS variables 2`] = `
+[
+  [
+    "typography_fluid.arial@4xl",
+    {
+      "key": "--typography_fluid-arial-4xl",
+      "value": "clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem)",
+      "variable": "--typography_fluid-arial-4xl: clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@3xl",
+    {
+      "key": "--typography_fluid-arial-3xl",
+      "value": "clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem)",
+      "variable": "--typography_fluid-arial-3xl: clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@2xl",
+    {
+      "key": "--typography_fluid-arial-2xl",
+      "value": "clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem)",
+      "variable": "--typography_fluid-arial-2xl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@xl",
+    {
+      "key": "--typography_fluid-arial-xl",
+      "value": "clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem)",
+      "variable": "--typography_fluid-arial-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@l",
+    {
+      "key": "--typography_fluid-arial-l",
+      "value": "clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem)",
+      "variable": "--typography_fluid-arial-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@m",
+    {
+      "key": "--typography_fluid-arial-m",
+      "value": "clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem)",
+      "variable": "--typography_fluid-arial-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@s",
+    {
+      "key": "--typography_fluid-arial-s",
+      "value": "clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem)",
+      "variable": "--typography_fluid-arial-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@xs",
+    {
+      "key": "--typography_fluid-arial-xs",
+      "value": "clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem)",
+      "variable": "--typography_fluid-arial-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@2xs",
+    {
+      "key": "--typography_fluid-arial-2xs",
+      "value": "clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem)",
+      "variable": "--typography_fluid-arial-2xs: clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem);",
+    },
+  ],
+]
+`;
+
+exports[`typography - can handle custom labels and prefixes 1`] = `
+{
+  "root": "--typography_fluid-arial-text-h1: clamp(4.1723rem, 4.0013rem + 0.8553vw, 4.7684rem);
+--typography_fluid-arial-text-h2: clamp(3.3379rem, 3.201rem + 0.6843vw, 3.8147rem);
+--typography_fluid-arial-text-h3: clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem);
+--typography_fluid-arial-text-h4: clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem);
+--typography_fluid-arial-text-xxl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);
+--typography_fluid-arial-text-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);
+--typography_fluid-arial-text-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);
+--typography_fluid-arial-text-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);
+--typography_fluid-arial-text-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);
+--typography_fluid-arial-text-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);",
+}
+`;
+
+exports[`typography - can handle custom labels and prefixes 2`] = `
+[
+  [
+    "typography_fluid.arial@h1",
+    {
+      "key": "--typography_fluid-arial-text-h1",
+      "value": "clamp(4.1723rem, 4.0013rem + 0.8553vw, 4.7684rem)",
+      "variable": "--typography_fluid-arial-text-h1: clamp(4.1723rem, 4.0013rem + 0.8553vw, 4.7684rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@h2",
+    {
+      "key": "--typography_fluid-arial-text-h2",
+      "value": "clamp(3.3379rem, 3.201rem + 0.6843vw, 3.8147rem)",
+      "variable": "--typography_fluid-arial-text-h2: clamp(3.3379rem, 3.201rem + 0.6843vw, 3.8147rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@h3",
+    {
+      "key": "--typography_fluid-arial-text-h3",
+      "value": "clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem)",
+      "variable": "--typography_fluid-arial-text-h3: clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@h4",
+    {
+      "key": "--typography_fluid-arial-text-h4",
+      "value": "clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem)",
+      "variable": "--typography_fluid-arial-text-h4: clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@xxl",
+    {
+      "key": "--typography_fluid-arial-text-xxl",
+      "value": "clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem)",
+      "variable": "--typography_fluid-arial-text-xxl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@xl",
+    {
+      "key": "--typography_fluid-arial-text-xl",
+      "value": "clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem)",
+      "variable": "--typography_fluid-arial-text-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@l",
+    {
+      "key": "--typography_fluid-arial-text-l",
+      "value": "clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem)",
+      "variable": "--typography_fluid-arial-text-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@m",
+    {
+      "key": "--typography_fluid-arial-text-m",
+      "value": "clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem)",
+      "variable": "--typography_fluid-arial-text-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@s",
+    {
+      "key": "--typography_fluid-arial-text-s",
+      "value": "clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem)",
+      "variable": "--typography_fluid-arial-text-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);",
+    },
+  ],
+  [
+    "typography_fluid.arial@xs",
+    {
+      "key": "--typography_fluid-arial-text-xs",
+      "value": "clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem)",
+      "variable": "--typography_fluid-arial-text-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);",
+    },
+  ],
+]
+`;
diff --git a/packages/cssforge/tests/colors.test.ts b/packages/cssforge/tests/colors.test.ts
new file mode 100644
index 0000000..64700c2
--- /dev/null
+++ b/packages/cssforge/tests/colors.test.ts
@@ -0,0 +1,589 @@
+import { Deno, assert, assertEquals, assertSnapshot } from "./vitest-compat.ts";
+import { defineConfig, processColors } from "../src/mod.ts";
+import { combine, getLines } from "./helpers.ts";
+
+Deno.test("processColors - converts hex to oklch", async (t) => {
+	const config = defineConfig({
+		colors: {
+			palette: {
+				value: {
+					coral: {
+						value: {
+							100: { hex: "#FF7F50" },
+							200: { hex: "#FF6347" },
+						},
+					},
+				},
+			},
+		},
+	});
+
+	const { css, resolveMap } = processColors(config.colors);
+	const combined = combine(css);
+	const lines = getLines(combined);
+	assertEquals(lines[2].trim(), "--palette-coral-100: oklch(73.511% 0.16799 40.24666);");
+	assertEquals(lines[3].trim(), "--palette-coral-200: oklch(69.622% 0.19552 32.32143);");
+	assertEquals(Array.from(resolveMap.keys()), ["palette.coral.100", "palette.coral.200"]);
+	await assertSnapshot(t, combined);
+	await assertSnapshot(t, Array.from(resolveMap.entries()));
+});
+
+Deno.test("processColors - handles different color formats", async (t) => {
+	const config = defineConfig({
+		colors: {
+			palette: {
+				value: {
+					brand: {
+						value: {
+							default: { hex: "#FF0000" },
+							200: { rgb: [0, 255, 0] },
+							300: { hsl: [240, 100, 50] },
+							400: { oklch: "oklch(0.7 0.2 270)" },
+						},
+					},
+				},
+			},
+		},
+	} as const);
+	const { css, resolveMap } = processColors(config.colors);
+	const combined = combine(css);
+	const lines = getLines(combined);
+
+	assertEquals(lines[2].trim(), "--palette-brand-200: oklch(86.644% 0.29483 142.49535);");
+	assertEquals(lines[3].trim(), "--palette-brand-300: oklch(45.201% 0.31321 264.05202);");
+	assertEquals(lines[4].trim(), "--palette-brand-400: oklch(70% 0.2 270);");
+	assertEquals(
+		lines[5].trim(),
+		"--palette-brand-default: oklch(62.796% 0.25768 29.23388);",
+	);
+
+	assertEquals(Array.from(resolveMap.keys()), [
+		"palette.brand.200",
+		"palette.brand.300",
+		"palette.brand.400",
+		"palette.brand.default",
+	]);
+	await assertSnapshot(t, combined);
+	await assertSnapshot(t, Array.from(resolveMap.entries()));
+});
+
+Deno.test("processColors - handles string values", async (t) => {
+	const config = defineConfig({
+		colors: {
+			palette: {
+				value: {
+					simple: {
+						value: {
+							white: "oklch(100% 0 0)",
+							black: "#000",
+						},
+					},
+				},
+			},
+		},
+	});
+	const { css, resolveMap } = processColors(config.colors);
+	const combined = combine(css);
+	const lines = getLines(combined);
+	assertEquals(lines[2].trim(), "--palette-simple-white: oklch(100% 0 0);");
+	assertEquals(lines[3].trim(), "--palette-simple-black: oklch(0% 0 0);");
+	assertEquals(Array.from(resolveMap.keys()), [
+		"palette.simple.white",
+		"palette.simple.black",
+	]);
+	await assertSnapshot(t, combined);
+	await assertSnapshot(t, Array.from(resolveMap.entries()));
+});
+
+Deno.test("processColors - handles themes", async (t) => {
+	const config = defineConfig({
+		colors: {
+			palette: {
+				value: {
+					simple: {
+						value: {
+							white: "oklch(100% 0 0)",
+							black: { hex: "#000" },
+						},
+					},
+				},
+			},
+			theme: {
+				light: {
+					value: {
+						background: {
+							value: {
+								primary: "var(--1)",
+								secondary: "var(--2)",
+							},
+							variables: {
+								1: "palette.simple.white",
+								2: "palette.simple.black",
+							},
+						},
+					},
+				},
+			},
+		},
+	});
+	const { css, resolveMap } = processColors(config.colors);
+	const combined = combine(css);
+	const lines = getLines(combined);
+	assertEquals(
+		lines[7].trim(),
+		"--theme-light-background-primary: var(--palette-simple-white);",
+	);
+	assertEquals(
+		lines[8].trim(),
+		"--theme-light-background-secondary: var(--palette-simple-black);",
+	);
+	assertEquals(Array.from(resolveMap.keys()), [
+		"palette.simple.white",
+		"palette.simple.black",
+		"theme.light.background.primary",
+		"theme.light.background.secondary",
+	]);
+	await assertSnapshot(t, combined);
+	await assertSnapshot(t, Array.from(resolveMap.entries()));
+});
+
+Deno.test("processColors - handles transparency", async (t) => {
+	const config = defineConfig({
+		colors: {
+			palette: {
+				value: {
+					alpha: {
+						value: {
+							softGray1: "oklch(14.48% 0 0 / 12%)",
+							softGray2: "oklch(14.48% 0 0 / 24%)",
+						},
+					},
+				},
+			},
+		},
+	});
+	const { css, resolveMap } = processColors(config.colors);
+	const combined = combine(css);
+	const lines = getLines(combined);
+	assertEquals(lines[2].trim(), "--palette-alpha-softGray1: oklch(14.48% 0 0 / 12%);");
+	assertEquals(lines[3].trim(), "--palette-alpha-softGray2: oklch(14.48% 0 0 / 24%);");
+	assertEquals(Array.from(resolveMap.keys()), [
+		"palette.alpha.softGray1",
+		"palette.alpha.softGray2",
+	]);
+	await assertSnapshot(t, combined);
+	await assertSnapshot(t, Array.from(resolveMap.entries()));
+});
+
+Deno.test("processColors - generates gradient with color variables", async (t) => {
+	const config = defineConfig({
+		colors: {
+			palette: {
+				value: {
+					coral: {
+						value: {
+							"50": { hex: "#FF7E60" },
+							"90": { hex: "#FF7F40" },
+							"100": { hex: "#FF6347" },
+						},
+					},
+					indigo: {
+						value: {
+							"100": { hex: "#4F46E5" },
+						},
+					},
+				},
+			},
+			gradients: {
+				value: {
+					orangeGradient: {
+						value: {
+							primary: {
+								value:
+									"linear-gradient(261.78deg, var(--1) 33.1%, var(--2) 56.3%, var(--3) 65.78%, var(--4) 84.23%)",
+								variables: {
+									"1": "palette.coral.50",
+									"2": "palette.coral.90",
+									"3": "palette.coral.100",
+									"4": "palette.indigo.100",
+								},
+							},
+						},
+					},
+				},
+			},
+		},
+	});
+
+	const result = processColors(config.colors);
+	const combined = [result.css.root, result.css.outside].filter(Boolean).join("\n");
+	const lines = getLines(combined);
+	const expected = [
+		"--gradients-orangeGradient-primary: linear-gradient(261.78deg, var(--palette-coral-50) 33.1%, var(--palette-coral-90) 56.3%, var(--palette-coral-100) 65.78%, var(--palette-indigo-100) 84.23%);",
+	].join("\n");
+
+	assertEquals(lines.at(-1), expected);
+	assertEquals(Array.from(result.resolveMap.keys()), [
+		"palette.coral.50",
+		"palette.coral.90",
+		"palette.coral.100",
+		"palette.indigo.100",
+		"gradients.orangeGradient.primary",
+	]);
+	await assertSnapshot(t, combined);
+	await assertSnapshot(t, Array.from(result.resolveMap.entries()));
+});
+
+Deno.test("processColors - handles themes referencing gradients", async (t) => {
+	const config = defineConfig({
+		colors: {
+			palette: {
+				value: {
+					coral: {
+						value: {
+							"50": { hex: "#FF7E60" },
+						},
+					},
+				},
+			},
+			gradients: {
+				value: {
+					orangeGradient: {
+						value: {
+							primary: {
+								value: "linear-gradient(to right, var(--c1), var(--c2))",
+								variables: {
+									c1: "palette.coral.50",
+									c2: "palette.coral.50",
+								},
+							},
+						},
+					},
+				},
+			},
+			theme: {
+				light: {
+					value: {
+						background: {
+							value: {
+								primary: "var(--grad)",
+							},
+							variables: {
+								grad: "gradients.orangeGradient.primary",
+							},
+						},
+					},
+				},
+			},
+		},
+	});
+
+	const { css, resolveMap } = processColors(config.colors);
+	const combined = combine(css);
+	const lines = getLines(combined);
+	const lastLine = lines.pop();
+	assertEquals(
+		lastLine,
+		"--theme-light-background-primary: var(--gradients-orangeGradient-primary);",
+	);
+	assertEquals(Array.from(resolveMap.keys()), [
+		"palette.coral.50",
+		"gradients.orangeGradient.primary",
+		"theme.light.background.primary",
+	]);
+	await assertSnapshot(t, combined);
+	await assertSnapshot(t, Array.from(resolveMap.entries()));
+});
+
+Deno.test("processColors - handles gradients with atRule", async (t) => {
+	const config = defineConfig({
+		colors: {
+			palette: {
+				value: {
+					coral: {
+						value: {
+							"50": { hex: "#FF7E60" },
+						},
+					},
+				},
+			},
+			gradients: {
+				value: {
+					orangeGradient: {
+						value: {
+							primary: {
+								value: "linear-gradient(to right, var(--c1), var(--c2))",
+								variables: {
+									c1: "palette.coral.50",
+									c2: "palette.coral.50",
+								},
+							},
+						},
+						settings: {
+							atRule: "@media (prefers-color-scheme: dark)",
+						},
+					},
+				},
+			},
+		},
+	});
+
+	const { css, resolveMap } = processColors(config.colors);
+	const combined = combine(css);
+	const lines = getLines(combined);
+
+	const mediaQueryIndex = lines.findIndex((line) =>
+		line.includes("@media (prefers-color-scheme: dark)"),
+	);
+
+	assertEquals(lines[mediaQueryIndex], "@media (prefers-color-scheme: dark) {");
+
+	const varIndex = lines.findIndex(
+		(line, idx) =>
+			idx > mediaQueryIndex && line.includes("--gradients-orangeGradient-primary:"),
+	);
+
+	assert(
+		varIndex > mediaQueryIndex,
+		"Gradient variable should be inside the media query block",
+	);
+
+	assertEquals(
+		lines[varIndex].trim(),
+		"--gradients-orangeGradient-primary: linear-gradient(to right, var(--palette-coral-50), var(--palette-coral-50));",
+	);
+
+	assertEquals(Array.from(resolveMap.keys()), [
+		"palette.coral.50",
+		"gradients.orangeGradient.primary",
+	]);
+	await assertSnapshot(t, combined);
+	await assertSnapshot(t, Array.from(resolveMap.entries()));
+});
+
+Deno.test("processColors - handles palette colors with atRule", async (t) => {
+	const config = defineConfig({
+		colors: {
+			palette: {
+				value: {
+					background: {
+						value: {
+							light: "oklch(100% 0 0)",
+						},
+					},
+					backgroundDark: {
+						value: {
+							dark: { hex: "#000" },
+						},
+						settings: {
+							atRule: "@media (prefers-color-scheme: dark)",
+						},
+					},
+				},
+			},
+		},
+	});
+	const { css, resolveMap } = processColors(config.colors);
+	const combined = combine(css);
+	const lines = getLines(combined);
+
+	assertEquals(lines[2].trim(), "--palette-background-light: oklch(100% 0 0);");
+
+	const mediaQueryIndex = lines.findIndex((line) =>
+		line.includes("@media (prefers-color-scheme: dark)"),
+	);
+
+	assertEquals(lines[mediaQueryIndex], "@media (prefers-color-scheme: dark) {");
+
+	const darkVarIndex = lines.findIndex((line) =>
+		line.includes("--palette-backgroundDark-dark:"),
+	);
+
+	assertEquals(
+		lines[darkVarIndex].trim(),
+		"--palette-backgroundDark-dark: oklch(0% 0 0);",
+	);
+
+	const closingBraceIndex = lines.findIndex(
+		(line, idx) => idx > mediaQueryIndex && line === "}",
+	);
+	assert(closingBraceIndex > darkVarIndex, "Closing brace should exist after variables");
+
+	assertEquals(Array.from(resolveMap.keys()), [
+		"palette.background.light",
+		"palette.backgroundDark.dark",
+	]);
+	await assertSnapshot(t, combined);
+	await assertSnapshot(t, Array.from(resolveMap.entries()));
+});
+
+Deno.test("processColors - handles themes with selector", async (t) => {
+	const config = defineConfig({
+		colors: {
+			palette: {
+				value: {
+					base: {
+						value: {
+							primary: { hex: "#FF7F50" },
+						},
+					},
+				},
+			},
+			theme: {
+				dark: {
+					value: {
+						background: {
+							value: {
+								primary: "var(--1)",
+							},
+							variables: {
+								"1": "palette.base.primary",
+							},
+						},
+					},
+					settings: {
+						selector: ".dark-theme",
+					},
+				},
+			},
+		},
+	});
+
+	const { css, resolveMap } = processColors(config.colors);
+	const combined = combine(css);
+	const lines = getLines(combined);
+
+	const classIndex = lines.findIndex((l) => l.includes(".dark-theme"));
+	assertEquals(lines[classIndex], ".dark-theme {");
+
+	const varIndex = lines.findIndex((l) => l.includes("--theme-dark-background-primary:"));
+	assert(varIndex > classIndex, "theme variable should be inside the class block");
+
+	assertEquals(Array.from(resolveMap.keys()), [
+		"palette.base.primary",
+		"theme.dark.background.primary",
+	]);
+	await assertSnapshot(t, combined);
+	await assertSnapshot(t, Array.from(resolveMap.entries()));
+});
+
+Deno.test("processColors - handles selector + atRule", async (t) => {
+	const config = defineConfig({
+		colors: {
+			palette: {
+				value: {
+					base: {
+						value: {
+							primary: { hex: "#FF7F50" },
+						},
+					},
+				},
+			},
+			theme: {
+				dark: {
+					value: {
+						background: {
+							value: {
+								primary: "var(--1)",
+							},
+							variables: {
+								"1": "palette.base.primary",
+							},
+						},
+					},
+					settings: {
+						selector: ".dark-theme",
+						atRule: "@media (prefers-color-scheme: dark)",
+					},
+				},
+			},
+		},
+	});
+
+	const { css, resolveMap } = processColors(config.colors);
+	const combined = combine(css);
+	const lines = getLines(combined);
+
+	const mediaIndex = lines.findIndex((l) =>
+		l.includes("@media (prefers-color-scheme: dark)"),
+	);
+	assertEquals(lines[mediaIndex], "@media (prefers-color-scheme: dark) {");
+
+	const classIndex = lines.findIndex(
+		(l, idx) => idx > mediaIndex && l.includes(".dark-theme"),
+	);
+	assert(classIndex > mediaIndex, "selector should be inside the media query block");
+	assertEquals(lines[classIndex].trim(), ".dark-theme {");
+
+	const varIndex = lines.findIndex(
+		(l, idx) => idx > classIndex && l.includes("--theme-dark-background-primary:"),
+	);
+	assert(
+		varIndex > classIndex,
+		"theme variable should be inside the selector block within the media query",
+	);
+
+	assertEquals(Array.from(resolveMap.keys()), [
+		"palette.base.primary",
+		"theme.dark.background.primary",
+	]);
+
+	await assertSnapshot(t, combined);
+	await assertSnapshot(t, Array.from(resolveMap.entries()));
+});
+
+Deno.test("processColors - handles theme variantNameOnly", async (t) => {
+	const config = defineConfig({
+		colors: {
+			palette: {
+				value: {
+					simple: {
+						value: {
+							white: "oklch(100% 0 0)",
+							black: { hex: "#000" },
+						},
+					},
+				},
+			},
+			theme: {
+				light: {
+					value: {
+						background: {
+							value: {
+								primary: "var(--1)",
+								secondary: "var(--2)",
+							},
+							variables: {
+								1: "palette.simple.white",
+								2: "palette.simple.black",
+							},
+							settings: {
+								variantNameOnly: true,
+							},
+						},
+					},
+				},
+			},
+		},
+	});
+
+	const { css, resolveMap } = processColors(config.colors);
+	const combined = combine(css);
+	const lines = getLines(combined);
+
+	const primaryLine = lines.find((l) => l.includes("--primary:"));
+	const secondaryLine = lines.find((l) => l.includes("--secondary:"));
+
+	assertEquals(primaryLine?.trim(), "--primary: var(--palette-simple-white);");
+	assertEquals(secondaryLine?.trim(), "--secondary: var(--palette-simple-black);");
+
+	assertEquals(Array.from(resolveMap.keys()), [
+		"palette.simple.white",
+		"palette.simple.black",
+		"theme.light.background.primary",
+		"theme.light.background.secondary",
+	]);
+
+	await assertSnapshot(t, combined);
+	await assertSnapshot(t, Array.from(resolveMap.entries()));
+});
diff --git a/tests/helpers.ts b/packages/cssforge/tests/helpers.ts
similarity index 55%
rename from tests/helpers.ts
rename to packages/cssforge/tests/helpers.ts
index ae82203..4bef7c4 100644
--- a/tests/helpers.ts
+++ b/packages/cssforge/tests/helpers.ts
@@ -1,10 +1,10 @@
 import type { Output } from "../src/lib.ts";
 
 export const getLines = (result?: string) =>
-  result ? result.split("\n").filter((line) => line.trim()) : [];
+	result ? result.split("\n").filter((line) => line.trim()) : [];
 
 export const combine = (css: Output["css"]) =>
-  [css.root, css.outside].filter(Boolean).join("\n");
+	[css.root, css.outside].filter(Boolean).join("\n");
 
 export const lineHasProp = (lines: string[]) => (prop: string) =>
-  lines.some((line) => line.includes(prop));
+	lines.some((line) => line.includes(prop));
diff --git a/packages/cssforge/tests/primitive.test.ts b/packages/cssforge/tests/primitive.test.ts
new file mode 100644
index 0000000..8799871
--- /dev/null
+++ b/packages/cssforge/tests/primitive.test.ts
@@ -0,0 +1,231 @@
+import { Deno, assertEquals, assertSnapshot } from "./vitest-compat.ts";
+import { processPrimitives } from "../src/modules/primitive.ts";
+import { defineConfig } from "../src/mod.ts";
+
+Deno.test("processPrimitives - processes button with variables", async (t) => {
+	const config = defineConfig({
+		typography: {
+			fluid: {
+				arial: {
+					value: {
+						minWidth: 320,
+						minFontSize: 14,
+						minTypeScale: 1.25,
+						maxWidth: 1435,
+						maxFontSize: 16,
+						maxTypeScale: 1.25,
+						positiveSteps: 5,
+						negativeSteps: 3,
+						prefix: "foo",
+					},
+				},
+			},
+		},
+		spacing: {
+			custom: {
+				size: {
+					value: {
+						2: "0.5rem",
+						3: "0.75rem",
+					},
+				},
+			},
+		},
+		primitives: {
+			button: {
+				value: {
+					small: {
+						value: {
+							width: "120px",
+							height: "40px",
+							fontSize: "var(--base)",
+							radius: "8px",
+							padding: "var(--2) var(--3)",
+						},
+						variables: {
+							base: "typography_fluid.arial@m",
+							"2": "spacing.custom.size.2",
+							"3": "spacing.custom.size.3",
+						},
+						settings: { pxToRem: false },
+					},
+				},
+			},
+		},
+	});
+
+	const result = processPrimitives(config);
+	const expected = [
+		"/* button */",
+		"--button-small-width: 120px;",
+		"--button-small-height: 40px;",
+		"--button-small-fontSize: var(--typography_fluid-arial-foo-m);",
+		"--button-small-radius: 8px;",
+		"--button-small-padding: var(--spacing-size-2) var(--spacing-size-3);",
+	].join("\n");
+
+	assertEquals(result.css.root, expected);
+	await assertSnapshot(t, result.css);
+	await assertSnapshot(t, Array.from(result.resolveMap.entries()));
+});
+
+Deno.test("processPrimitives - processes buttons with settings", async (t) => {
+	const config = defineConfig({
+		primitives: {
+			button: {
+				value: {
+					small: {
+						value: {
+							width: "120px",
+							height: "40px",
+							radius: "8px",
+						},
+						settings: { pxToRem: false },
+					},
+					big: {
+						value: {
+							width: "240px",
+							height: "80px",
+							radius: "16px",
+						},
+						settings: { pxToRem: true },
+					},
+				},
+			},
+		},
+	});
+
+	const result = processPrimitives(config);
+	const expected = [
+		"/* button */",
+		"--button-small-width: 120px;",
+		"--button-small-height: 40px;",
+		"--button-small-radius: 8px;",
+		"--button-big-width: 15rem;",
+		"--button-big-height: 5rem;",
+		"--button-big-radius: 1rem;",
+	].join("\n");
+
+	assertEquals(result.css.root, expected);
+	await assertSnapshot(t, result.css);
+	await assertSnapshot(t, Array.from(result.resolveMap.entries()));
+});
+
+Deno.test("processPrimitives - references colors, gradients, and themes", async (t) => {
+	const config = defineConfig({
+		colors: {
+			palette: {
+				value: {
+					coral: {
+						value: {
+							"50": { hex: "#FF7E60" },
+						},
+					},
+				},
+			},
+			gradients: {
+				value: {
+					orangeGradient: {
+						value: {
+							primary: {
+								value: "linear-gradient(to right, var(--c1), var(--c2))",
+								variables: {
+									c1: "palette.coral.50",
+									c2: "palette.coral.50",
+								},
+							},
+						},
+					},
+				},
+			},
+			theme: {
+				light: {
+					value: {
+						background: {
+							value: {
+								primary: "var(--grad)",
+							},
+							variables: {
+								grad: "gradients.orangeGradient.primary",
+							},
+						},
+					},
+				},
+			},
+		},
+		primitives: {
+			card: {
+				value: {
+					default: {
+						value: {
+							"background-color": "var(--bg)",
+							"background-image": "var(--grad)",
+							"border-color": "var(--border)",
+						},
+						variables: {
+							bg: "theme.light.background.primary",
+							grad: "gradients.orangeGradient.primary",
+							border: "palette.coral.50",
+						},
+					},
+				},
+			},
+		},
+	});
+
+	const result = processPrimitives(config);
+	const expected = [
+		"/* card */",
+		"--card-default-background-color: var(--theme-light-background-primary);",
+		"--card-default-background-image: var(--gradients-orangeGradient-primary);",
+		"--card-default-border-color: var(--palette-coral-50);",
+	].join("\n");
+
+	assertEquals(result.css.root, expected);
+	await assertSnapshot(t, result.css);
+	await assertSnapshot(t, Array.from(result.resolveMap.entries()));
+});
+
+Deno.test("processPrimitives - uses fluid spacing references", async (t) => {
+	const config = defineConfig({
+		spacing: {
+			fluid: {
+				gap: {
+					value: {
+						minSize: 4,
+						maxSize: 24,
+						minWidth: 320,
+						maxWidth: 1280,
+						negativeSteps: [0],
+						positiveSteps: [1],
+						prefix: "gs",
+					},
+				},
+			},
+		},
+		primitives: {
+			box: {
+				value: {
+					default: {
+						value: {
+							padding: "var(--s) var(--m)",
+						},
+						variables: {
+							s: "spacing_fluid.gap@s",
+							m: "spacing_fluid.gap@m",
+						},
+						settings: { pxToRem: false },
+					},
+				},
+			},
+		},
+	});
+	const primitives = processPrimitives(config);
+	const expected = [
+		"/* box */",
+		"--box-default-padding: var(--spacing_fluid-gap-gs-s) var(--spacing_fluid-gap-gs-m);",
+	].join("\n");
+	assertEquals(primitives.css.root, expected);
+	await assertSnapshot(t, primitives.css);
+	await assertSnapshot(t, Array.from(primitives.resolveMap.entries()));
+});
diff --git a/packages/cssforge/tests/spacing.test.ts b/packages/cssforge/tests/spacing.test.ts
new file mode 100644
index 0000000..30eb5c0
--- /dev/null
+++ b/packages/cssforge/tests/spacing.test.ts
@@ -0,0 +1,207 @@
+import { Deno, assertEquals, assertSnapshot } from "./vitest-compat.ts";
+import { processSpacing } from "../src/modules/spacing.ts";
+import { defineConfig } from "../src/config.ts";
+
+Deno.test("processSpacing - generates correct spacing scale", async (t) => {
+	const config = defineConfig({
+		spacing: {
+			custom: {
+				size: {
+					value: { 1: "0.25rem", 2: "0.5rem", 3: "0.75rem", s: "16px" },
+				},
+			},
+		},
+	});
+
+	const result = processSpacing(config.spacing);
+	const expected = [
+		"--spacing-size-1: 0.25rem;",
+		"--spacing-size-2: 0.5rem;",
+		"--spacing-size-3: 0.75rem;",
+		"--spacing-size-s: 1rem;",
+	].join("\n");
+	assertEquals(result.css.root, expected);
+
+	assertEquals(Array.from(result.resolveMap.keys()), [
+		"spacing.custom.size.1",
+		"spacing.custom.size.2",
+		"spacing.custom.size.3",
+		"spacing.custom.size.s",
+	]);
+	await assertSnapshot(t, result.css.root);
+	await assertSnapshot(t, Array.from(result.resolveMap.entries()));
+});
+
+// Test with string keys
+Deno.test("processSpacing - handles settings", async (t) => {
+	const config = defineConfig({
+		spacing: {
+			custom: {
+				size: {
+					value: { 1: "16px", 2: "0.5rem" },
+					settings: { pxToRem: true },
+				},
+				scale: {
+					value: { md: "8px", lg: "0.75rem" },
+					settings: { pxToRem: false },
+				},
+			},
+		},
+	});
+
+	const result = processSpacing(config.spacing);
+	const expected = [
+		"--spacing-size-1: 1rem;",
+		"--spacing-size-2: 0.5rem;",
+		"--spacing-scale-md: 8px;",
+		"--spacing-scale-lg: 0.75rem;",
+	].join("\n");
+
+	assertEquals(result.css.root, expected);
+
+	assertEquals(Array.from(result.resolveMap.keys()), [
+		"spacing.custom.size.1",
+		"spacing.custom.size.2",
+		"spacing.custom.scale.md",
+		"spacing.custom.scale.lg",
+	]);
+	await assertSnapshot(t, result.css.root);
+	await assertSnapshot(t, Array.from(result.resolveMap.entries()));
+});
+
+Deno.test("processSpacing - generates fluid spacing (prefix)", async (t) => {
+	const config = defineConfig({
+		spacing: {
+			fluid: {
+				base: {
+					value: {
+						minSize: 4,
+						maxSize: 24,
+						minWidth: 320,
+						maxWidth: 1280,
+						negativeSteps: [0],
+						positiveSteps: [1, 2],
+						prefix: "foo",
+						customSizes: ["xs-l"],
+					},
+				},
+			},
+		},
+	});
+
+	const { css, resolveMap } = processSpacing(config.spacing);
+	const expected = [
+		"--spacing_fluid-base-foo-xs: clamp(0rem, 0rem + 0vw, 0rem);",
+		"--spacing_fluid-base-foo-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
+		"--spacing_fluid-base-foo-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
+		"--spacing_fluid-base-foo-l: clamp(0.5rem, -0.3333rem + 4.1667vw, 3rem);",
+		"--spacing_fluid-base-foo-xs-l: clamp(0rem, -1rem + 5vw, 3rem);",
+		"--spacing_fluid-base-foo-xs-s: clamp(0rem, -0.5rem + 2.5vw, 1.5rem);",
+		"--spacing_fluid-base-foo-s-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
+		"--spacing_fluid-base-foo-m-l: clamp(0.25rem, -0.6667rem + 4.5833vw, 3rem);",
+	].join("\n");
+	assertEquals(css.root, expected);
+
+	assertEquals(Array.from(resolveMap.keys()), [
+		"spacing_fluid.base@xs",
+		"spacing_fluid.base@s",
+		"spacing_fluid.base@m",
+		"spacing_fluid.base@l",
+		"spacing_fluid.base@xs-l",
+		"spacing_fluid.base@xs-s",
+		"spacing_fluid.base@s-m",
+		"spacing_fluid.base@m-l",
+	]);
+	await assertSnapshot(t, css.root);
+	await assertSnapshot(t, Array.from(resolveMap.entries()));
+});
+
+Deno.test("processSpacing - fluid without prefix falls back to scale name", async (t) => {
+	const config = defineConfig({
+		spacing: {
+			fluid: {
+				rhythm: {
+					value: {
+						minSize: 2,
+						maxSize: 20,
+						minWidth: 320,
+						maxWidth: 1280,
+						negativeSteps: [0],
+						positiveSteps: [1],
+					},
+				},
+			},
+		},
+	});
+	const { css, resolveMap } = processSpacing(config.spacing);
+	const expected = [
+		"--spacing_fluid-rhythm-xs: clamp(0rem, 0rem + 0vw, 0rem);",
+		"--spacing_fluid-rhythm-s: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);",
+		"--spacing_fluid-rhythm-m: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);",
+		"--spacing_fluid-rhythm-xs-s: clamp(0rem, -0.4167rem + 2.0833vw, 1.25rem);",
+		"--spacing_fluid-rhythm-s-m: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);",
+	].join("\n");
+	assertEquals(css.root, expected);
+
+	assertEquals(Array.from(resolveMap.keys()), [
+		"spacing_fluid.rhythm@xs",
+		"spacing_fluid.rhythm@s",
+		"spacing_fluid.rhythm@m",
+		"spacing_fluid.rhythm@xs-s",
+		"spacing_fluid.rhythm@s-m",
+	]);
+	await assertSnapshot(t, css.root);
+	await assertSnapshot(t, Array.from(resolveMap.entries()));
+});
+
+Deno.test("processSpacing - combines fluid and custom spacing", async (t) => {
+	const config = defineConfig({
+		spacing: {
+			fluid: {
+				base: {
+					value: {
+						minSize: 4,
+						maxSize: 24,
+						minWidth: 320,
+						maxWidth: 1280,
+						negativeSteps: [0],
+						positiveSteps: [1],
+						prefix: "flux",
+					},
+				},
+			},
+			custom: {
+				gap: {
+					value: { 1: "4px", 2: "8px" },
+					settings: { pxToRem: false },
+				},
+			},
+		},
+	});
+	const spacingConfig = config.spacing;
+	if (!spacingConfig) {
+		throw new Error("Expected spacing config.");
+	}
+	const { css, resolveMap } = processSpacing(spacingConfig);
+	const expected = [
+		"--spacing_fluid-base-flux-xs: clamp(0rem, 0rem + 0vw, 0rem);",
+		"--spacing_fluid-base-flux-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
+		"--spacing_fluid-base-flux-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
+		"--spacing_fluid-base-flux-xs-s: clamp(0rem, -0.5rem + 2.5vw, 1.5rem);",
+		"--spacing_fluid-base-flux-s-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
+		"--spacing-gap-1: 4px;",
+		"--spacing-gap-2: 8px;",
+	].join("\n");
+	assertEquals(css.root, expected);
+	assertEquals(Array.from(resolveMap.keys()), [
+		"spacing_fluid.base@xs",
+		"spacing_fluid.base@s",
+		"spacing_fluid.base@m",
+		"spacing_fluid.base@xs-s",
+		"spacing_fluid.base@s-m",
+		"spacing.custom.gap.1",
+		"spacing.custom.gap.2",
+	]);
+	await assertSnapshot(t, css.root);
+	await assertSnapshot(t, Array.from(resolveMap.entries()));
+});
diff --git a/packages/cssforge/tests/typography.test.ts b/packages/cssforge/tests/typography.test.ts
new file mode 100644
index 0000000..2e83d7d
--- /dev/null
+++ b/packages/cssforge/tests/typography.test.ts
@@ -0,0 +1,162 @@
+import { Deno, assertEquals, assertSnapshot } from "./vitest-compat.ts";
+import { defineConfig, processTypography } from "../src/mod.ts";
+import { getLines } from "./helpers.ts";
+
+Deno.test("processTypography - generates correct CSS variables", async (t) => {
+	const config = defineConfig({
+		typography: {
+			fluid: {
+				arial: {
+					value: {
+						minWidth: 320,
+						minFontSize: 14,
+						minTypeScale: 1.25,
+						maxWidth: 1435,
+						maxFontSize: 16,
+						maxTypeScale: 1.25,
+						positiveSteps: 5,
+						negativeSteps: 3,
+					},
+				},
+			},
+		},
+	});
+
+	const expectedSizes = ["4xl", "3xl", "2xl", "xl", "l", "m", "s", "xs", "2xs"];
+	const result = processTypography(config.typography);
+	const lines = getLines(result.css.root);
+	assertEquals(lines.length, expectedSizes.length);
+
+	// Test a specific value for precision
+	const xlLine = lines.find((line) => line.includes("--typography_fluid-arial-xl:"));
+	assertEquals(
+		xlLine,
+		"--typography_fluid-arial-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);",
+	);
+
+	assertEquals(
+		Array.from(result.resolveMap.keys()),
+		expectedSizes.map((size) => `typography_fluid.arial@${size}`),
+	);
+
+	// Test that we have all the expected size variables
+	expectedSizes.forEach((size) => {
+		const hasSize = lines.some((line) =>
+			line.includes(`--typography_fluid-arial-${size}:`),
+		);
+		assertEquals(hasSize, true, `Missing size ${size}`);
+	});
+	await assertSnapshot(t, result.css);
+	await assertSnapshot(t, Array.from(result.resolveMap.entries()));
+});
+
+Deno.test("typography - can handle custom labels and prefixes", async (t) => {
+	const config = defineConfig({
+		typography: {
+			fluid: {
+				arial: {
+					value: {
+						minWidth: 320,
+						minFontSize: 14,
+						minTypeScale: 1.25,
+						maxWidth: 1435,
+						maxFontSize: 16,
+						maxTypeScale: 1.25,
+						positiveSteps: 7,
+						negativeSteps: 2,
+						prefix: "text",
+					},
+					settings: {
+						customLabel: {
+							"-2": "xs",
+							"-1": "s",
+							"0": "m",
+							"1": "l",
+							"2": "xl",
+							"3": "xxl",
+							"4": "h4",
+							"5": "h3",
+							"6": "h2",
+							"7": "h1",
+						},
+					},
+				},
+			},
+		},
+	});
+
+	const expectedSizes = ["xs", "s", "m", "l", "xl", "xxl", "h4", "h3", "h2", "h1"];
+	const result = processTypography(config.typography);
+	const lines = getLines(result.css.root);
+	assertEquals(lines.length, expectedSizes.length);
+
+	// Test a specific value for precision
+	const xlLine = lines.find((line) => line.includes("--typography_fluid-arial-text-xl:"));
+	assertEquals(
+		xlLine,
+		"--typography_fluid-arial-text-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);",
+	);
+
+	assertEquals(
+		Array.from(result.resolveMap.keys()),
+		expectedSizes.toReversed().map((size) => `typography_fluid.arial@${size}`),
+	);
+
+	// Test that we have all the expected size variables
+	expectedSizes.forEach((size) => {
+		const hasSize = lines.some((line) =>
+			line.includes(`--typography_fluid-arial-text-${size}:`),
+		);
+		assertEquals(hasSize, true, `Missing size ${size}`);
+	});
+	await assertSnapshot(t, result.css);
+	await assertSnapshot(t, Array.from(result.resolveMap.entries()));
+});
+
+Deno.test("processTypography - can process weights", async (t) => {
+	const positiveSteps = 3;
+	const negativeSteps = 3;
+	const config = defineConfig({
+		typography: {
+			fluid: {
+				arial: {
+					value: {
+						minWidth: 320,
+						minFontSize: 14,
+						minTypeScale: 1.25,
+						maxWidth: 1435,
+						maxFontSize: 16,
+						maxTypeScale: 1.25,
+						positiveSteps,
+						negativeSteps,
+					},
+				},
+			},
+			weight: {
+				arial: { value: { regular: "500" } },
+			},
+		},
+	});
+
+	const result = processTypography(config.typography);
+	const lines = getLines(result.css.root);
+	assertEquals(lines.length, positiveSteps + negativeSteps + 1 + 1); // 1 for base size and 1 for weight
+
+	assertEquals(Array.from(result.resolveMap.keys()), [
+		"typography_fluid.arial@2xl",
+		"typography_fluid.arial@xl",
+		"typography_fluid.arial@l",
+		"typography_fluid.arial@m",
+		"typography_fluid.arial@s",
+		"typography_fluid.arial@xs",
+		"typography_fluid.arial@2xs",
+		"typography.weight.arial.regular",
+	]);
+	// Test that we have the weight variable
+	const xlLine = lines.find((line) =>
+		line.includes("--typography-weight-arial-regular:"),
+	);
+	assertEquals(xlLine, "--typography-weight-arial-regular: 500;");
+	await assertSnapshot(t, result.css);
+	await assertSnapshot(t, Array.from(result.resolveMap.entries()));
+});
diff --git a/packages/cssforge/tests/vitest-compat.ts b/packages/cssforge/tests/vitest-compat.ts
new file mode 100644
index 0000000..774813c
--- /dev/null
+++ b/packages/cssforge/tests/vitest-compat.ts
@@ -0,0 +1,18 @@
+import { expect, test } from "vitest";
+import type { TestContext } from "vitest";
+
+export const Deno = {
+	test,
+};
+
+export const assert = (condition: unknown, message?: string) => {
+	expect(Boolean(condition), message).toBe(true);
+};
+
+export const assertEquals = <T>(actual: T, expected: T, message?: string) => {
+	expect(actual, message).toEqual(expected);
+};
+
+export const assertSnapshot = async (_ctx: TestContext, value: unknown) => {
+	expect(value).toMatchSnapshot();
+};
diff --git a/packages/cssforge/tsconfig.json b/packages/cssforge/tsconfig.json
new file mode 100644
index 0000000..0996662
--- /dev/null
+++ b/packages/cssforge/tsconfig.json
@@ -0,0 +1,13 @@
+{
+	"extends": "../../tsconfig.base.json",
+	"compilerOptions": {
+		"types": ["node", "vitest/globals"]
+	},
+	"include": [
+		"src/**/*.ts",
+		"tests/**/*.ts",
+		"scripts/**/*.ts",
+		"vitest.config.ts",
+		"tsup.config.ts"
+	]
+}
diff --git a/packages/cssforge/tsup.config.ts b/packages/cssforge/tsup.config.ts
new file mode 100644
index 0000000..b8d491a
--- /dev/null
+++ b/packages/cssforge/tsup.config.ts
@@ -0,0 +1,14 @@
+import { defineConfig } from "tsup";
+
+export default defineConfig({
+	entry: {
+		mod: "src/mod.ts",
+		cli: "src/cli.ts",
+	},
+	format: ["esm"],
+	dts: true,
+	clean: true,
+	sourcemap: true,
+	target: "node24",
+	outDir: "dist",
+});
diff --git a/packages/cssforge/vitest.config.ts b/packages/cssforge/vitest.config.ts
new file mode 100644
index 0000000..5bdee00
--- /dev/null
+++ b/packages/cssforge/vitest.config.ts
@@ -0,0 +1,7 @@
+import { defineConfig } from "vitest/config";
+
+export default defineConfig({
+	test: {
+		include: ["tests/**/*.test.ts"],
+	},
+});
diff --git a/packages/repo-tools/moon.yml b/packages/repo-tools/moon.yml
new file mode 100644
index 0000000..7280eeb
--- /dev/null
+++ b/packages/repo-tools/moon.yml
@@ -0,0 +1,15 @@
+$schema: "https://moonrepo.dev/schemas/project.json"
+
+layer: "tool"
+
+tasks:
+  changeset:
+    command: "npx"
+    args: ["changeset"]
+    options:
+      runFromWorkspaceRoot: true
+      runInCI: false
+  version:
+    script: "npx changeset version && node packages/cssforge/scripts/sync-version.js"
+    options:
+      runFromWorkspaceRoot: true
diff --git a/pnpm-lock.yaml b/pnpm-lock.yaml
new file mode 100644
index 0000000..8ceaa3a
--- /dev/null
+++ b/pnpm-lock.yaml
@@ -0,0 +1,13227 @@
+lockfileVersion: '9.0'
+
+settings:
+  autoInstallPeers: true
+  excludeLinksFromLockfile: false
+
+importers:
+
+  .:
+    devDependencies:
+      '@changesets/cli':
+        specifier: 2.29.7
+        version: 2.29.7(@types/node@24.10.13)
+
+  example/tailwind-nextjs:
+    dependencies:
+      next:
+        specifier: 16.1.6
+        version: 16.1.6(@playwright/test@1.58.2)(react-dom@19.2.4(react@19.2.4))(react@19.2.4)
+      react:
+        specifier: 19.2.4
+        version: 19.2.4
+      react-dom:
+        specifier: 19.2.4
+        version: 19.2.4(react@19.2.4)
+    devDependencies:
+      '@hebilicious/cssforge':
+        specifier: workspace:*
+        version: link:../../packages/cssforge
+      '@playwright/test':
+        specifier: 1.58.2
+        version: 1.58.2
+      '@tailwindcss/postcss':
+        specifier: 4.2.0
+        version: 4.2.0
+      '@types/node':
+        specifier: ^20
+        version: 20.19.33
+      '@types/react':
+        specifier: ^19
+        version: 19.2.14
+      '@types/react-dom':
+        specifier: ^19
+        version: 19.2.3(@types/react@19.2.14)
+      eslint:
+        specifier: ^9
+        version: 9.39.2(jiti@2.6.1)
+      eslint-config-next:
+        specifier: 16.1.6
+        version: 16.1.6(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3)
+      tailwindcss:
+        specifier: 4.2.0
+        version: 4.2.0
+      tsx:
+        specifier: ^4.20.6
+        version: 4.20.6
+      typescript:
+        specifier: ^5
+        version: 5.9.3
+
+  example/tailwind-nuxt:
+    dependencies:
+      nuxt:
+        specifier: 4.3.1
+        version: 4.3.1(@biomejs/biome@2.4.2)(@parcel/watcher@2.5.6)(@types/node@24.10.13)(@vue/compiler-sfc@3.5.28)(cac@6.7.14)(db0@0.3.4)(eslint@9.39.2(jiti@2.6.1))(ioredis@5.9.3)(lightningcss@1.31.1)(magicast@0.5.2)(optionator@0.9.4)(rollup@4.57.1)(terser@5.46.0)(tsx@4.20.6)(typescript@5.9.3)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue-tsc@3.2.4(typescript@5.9.3))(yaml@2.8.2)
+      vue:
+        specifier: 3.5.28
+        version: 3.5.28(typescript@5.9.3)
+      vue-router:
+        specifier: 4.6.4
+        version: 4.6.4(vue@3.5.28(typescript@5.9.3))
+    devDependencies:
+      '@hebilicious/cssforge':
+        specifier: workspace:*
+        version: link:../../packages/cssforge
+      '@playwright/test':
+        specifier: 1.58.2
+        version: 1.58.2
+      '@tailwindcss/vite':
+        specifier: 4.2.0
+        version: 4.2.0(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      tailwindcss:
+        specifier: 4.2.0
+        version: 4.2.0
+      tsx:
+        specifier: ^4.20.6
+        version: 4.20.6
+
+  example/tailwind-solidstart:
+    dependencies:
+      '@solidjs/router':
+        specifier: 0.15.4
+        version: 0.15.4(solid-js@1.9.11)
+      '@solidjs/start':
+        specifier: 1.2.1
+        version: 1.2.1(solid-js@1.9.11)(vinxi@0.5.11(@types/node@24.10.13)(db0@0.3.4)(ioredis@5.9.3)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      solid-js:
+        specifier: 1.9.11
+        version: 1.9.11
+      vinxi:
+        specifier: 0.5.11
+        version: 0.5.11(@types/node@24.10.13)(db0@0.3.4)(ioredis@5.9.3)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+    devDependencies:
+      '@hebilicious/cssforge':
+        specifier: workspace:*
+        version: link:../../packages/cssforge
+      '@playwright/test':
+        specifier: 1.58.2
+        version: 1.58.2
+      '@tailwindcss/vite':
+        specifier: 4.2.0
+        version: 4.2.0(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      tailwindcss:
+        specifier: 4.2.0
+        version: 4.2.0
+      tsx:
+        specifier: ^4.20.6
+        version: 4.20.6
+
+  example/tailwind-sveltekit:
+    devDependencies:
+      '@hebilicious/cssforge':
+        specifier: workspace:*
+        version: link:../../packages/cssforge
+      '@playwright/test':
+        specifier: 1.58.2
+        version: 1.58.2
+      '@sveltejs/adapter-auto':
+        specifier: 7.0.1
+        version: 7.0.1(@sveltejs/kit@2.52.2(@sveltejs/vite-plugin-svelte@6.2.4(svelte@5.53.0)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)))(svelte@5.53.0)(typescript@5.9.3)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)))
+      '@sveltejs/kit':
+        specifier: 2.52.2
+        version: 2.52.2(@sveltejs/vite-plugin-svelte@6.2.4(svelte@5.53.0)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)))(svelte@5.53.0)(typescript@5.9.3)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      '@sveltejs/vite-plugin-svelte':
+        specifier: 6.2.4
+        version: 6.2.4(svelte@5.53.0)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      '@tailwindcss/vite':
+        specifier: 4.2.0
+        version: 4.2.0(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      svelte:
+        specifier: 5.53.0
+        version: 5.53.0
+      svelte-check:
+        specifier: 4.3.6
+        version: 4.3.6(picomatch@4.0.3)(svelte@5.53.0)(typescript@5.9.3)
+      tailwindcss:
+        specifier: 4.2.0
+        version: 4.2.0
+      tsx:
+        specifier: ^4.20.6
+        version: 4.20.6
+      typescript:
+        specifier: 5.9.3
+        version: 5.9.3
+      vite:
+        specifier: 7.3.1
+        version: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+
+  example/vanilla-react-css:
+    dependencies:
+      react:
+        specifier: 19.2.4
+        version: 19.2.4
+      react-dom:
+        specifier: 19.2.4
+        version: 19.2.4(react@19.2.4)
+    devDependencies:
+      '@eslint/js':
+        specifier: ^9.39.1
+        version: 9.39.2
+      '@hebilicious/cssforge':
+        specifier: workspace:*
+        version: link:../../packages/cssforge
+      '@playwright/test':
+        specifier: 1.58.2
+        version: 1.58.2
+      '@types/node':
+        specifier: ^24.10.1
+        version: 24.10.13
+      '@types/react':
+        specifier: ^19.2.7
+        version: 19.2.14
+      '@types/react-dom':
+        specifier: ^19.2.3
+        version: 19.2.3(@types/react@19.2.14)
+      '@vitejs/plugin-react':
+        specifier: 5.1.4
+        version: 5.1.4(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      eslint:
+        specifier: ^9.39.1
+        version: 9.39.2(jiti@2.6.1)
+      eslint-plugin-react-hooks:
+        specifier: ^7.0.1
+        version: 7.0.1(eslint@9.39.2(jiti@2.6.1))
+      eslint-plugin-react-refresh:
+        specifier: ^0.4.24
+        version: 0.4.26(eslint@9.39.2(jiti@2.6.1))
+      globals:
+        specifier: ^16.5.0
+        version: 16.5.0
+      tsx:
+        specifier: ^4.20.6
+        version: 4.20.6
+      typescript:
+        specifier: ~5.9.3
+        version: 5.9.3
+      typescript-eslint:
+        specifier: ^8.48.0
+        version: 8.56.0(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3)
+      vite:
+        specifier: 7.3.1
+        version: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+
+  example/vanilla-solid-css:
+    dependencies:
+      solid-js:
+        specifier: 1.9.11
+        version: 1.9.11
+    devDependencies:
+      '@hebilicious/cssforge':
+        specifier: workspace:*
+        version: link:../../packages/cssforge
+      '@playwright/test':
+        specifier: 1.58.2
+        version: 1.58.2
+      '@types/node':
+        specifier: ^24.10.1
+        version: 24.10.13
+      tsx:
+        specifier: ^4.20.6
+        version: 4.20.6
+      typescript:
+        specifier: ~5.9.3
+        version: 5.9.3
+      vite:
+        specifier: 7.3.1
+        version: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+      vite-plugin-solid:
+        specifier: 2.11.10
+        version: 2.11.10(solid-js@1.9.11)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+
+  example/vanilla-svelte-css:
+    devDependencies:
+      '@hebilicious/cssforge':
+        specifier: workspace:*
+        version: link:../../packages/cssforge
+      '@playwright/test':
+        specifier: 1.58.2
+        version: 1.58.2
+      '@sveltejs/vite-plugin-svelte':
+        specifier: 6.2.4
+        version: 6.2.4(svelte@5.53.0)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      '@tsconfig/svelte':
+        specifier: ^5.0.6
+        version: 5.0.8
+      '@types/node':
+        specifier: ^24.10.1
+        version: 24.10.13
+      svelte:
+        specifier: 5.53.0
+        version: 5.53.0
+      svelte-check:
+        specifier: ^4.3.4
+        version: 4.3.6(picomatch@4.0.3)(svelte@5.53.0)(typescript@5.9.3)
+      tsx:
+        specifier: ^4.20.6
+        version: 4.20.6
+      typescript:
+        specifier: ~5.9.3
+        version: 5.9.3
+      vite:
+        specifier: 7.3.1
+        version: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+
+  example/vanilla-vue-css:
+    dependencies:
+      vue:
+        specifier: 3.5.28
+        version: 3.5.28(typescript@5.9.3)
+    devDependencies:
+      '@hebilicious/cssforge':
+        specifier: workspace:*
+        version: link:../../packages/cssforge
+      '@playwright/test':
+        specifier: 1.58.2
+        version: 1.58.2
+      '@types/node':
+        specifier: ^24.10.1
+        version: 24.10.13
+      '@vitejs/plugin-vue':
+        specifier: 6.0.4
+        version: 6.0.4(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue@3.5.28(typescript@5.9.3))
+      '@vue/tsconfig':
+        specifier: ^0.8.1
+        version: 0.8.1(typescript@5.9.3)(vue@3.5.28(typescript@5.9.3))
+      tsx:
+        specifier: ^4.20.6
+        version: 4.20.6
+      typescript:
+        specifier: ~5.9.3
+        version: 5.9.3
+      vite:
+        specifier: 7.3.1
+        version: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+      vue-tsc:
+        specifier: ^3.1.5
+        version: 3.2.4(typescript@5.9.3)
+
+  packages/cssforge:
+    dependencies:
+      chokidar:
+        specifier: 4.0.3
+        version: 4.0.3
+      citty:
+        specifier: 0.1.6
+        version: 0.1.6
+      colorjs.io:
+        specifier: 0.5.2
+        version: 0.5.2
+      utopia-core:
+        specifier: 1.6.0
+        version: 1.6.0
+    devDependencies:
+      '@biomejs/biome':
+        specifier: 2.4.2
+        version: 2.4.2
+      '@types/node':
+        specifier: 24.3.0
+        version: 24.3.0
+      mdbox:
+        specifier: 0.1.1
+        version: 0.1.1
+      tsup:
+        specifier: 8.5.0
+        version: 8.5.0(jiti@2.6.1)(postcss@8.5.6)(tsx@4.20.6)(typescript@5.9.3)(yaml@2.8.2)
+      tsx:
+        specifier: 4.20.6
+        version: 4.20.6
+      typescript:
+        specifier: 5.9.3
+        version: 5.9.3
+      vitest:
+        specifier: 4.0.18
+        version: 4.0.18(@types/node@24.3.0)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+
+packages:
+
+  '@alloc/quick-lru@5.2.0':
+    resolution: {integrity: sha512-UrcABB+4bUrFABwbluTIBErXwvbsU/V7TZWfmbgJfbkwiBuziS9gxdODUyuiecfdGQ85jglMW6juS3+z5TsKLw==}
+    engines: {node: '>=10'}
+
+  '@babel/code-frame@7.26.2':
+    resolution: {integrity: sha512-RJlIHRueQgwWitWgF8OdFYGZX328Ax5BCemNGlqHfplnRT9ESi8JkFlvaVYbS+UubVY6dpv87Fs2u5M29iNFVQ==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/code-frame@7.29.0':
+    resolution: {integrity: sha512-9NhCeYjq9+3uxgdtp20LSiJXJvN0FeCtNGpJxuMFZ1Kv3cWUNb6DOhJwUvcVCzKGR66cw4njwM6hrJLqgOwbcw==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/compat-data@7.29.0':
+    resolution: {integrity: sha512-T1NCJqT/j9+cn8fvkt7jtwbLBfLC/1y1c7NtCeXFRgzGTsafi68MRv8yzkYSapBnFA6L3U2VSc02ciDzoAJhJg==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/core@7.29.0':
+    resolution: {integrity: sha512-CGOfOJqWjg2qW/Mb6zNsDm+u5vFQ8DxXfbM09z69p5Z6+mE1ikP2jUXw+j42Pf1XTYED2Rni5f95npYeuwMDQA==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/generator@7.29.1':
+    resolution: {integrity: sha512-qsaF+9Qcm2Qv8SRIMMscAvG4O3lJ0F1GuMo5HR/Bp02LopNgnZBC/EkbevHFeGs4ls/oPz9v+Bsmzbkbe+0dUw==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/helper-annotate-as-pure@7.27.3':
+    resolution: {integrity: sha512-fXSwMQqitTGeHLBC08Eq5yXz2m37E4pJX1qAU1+2cNedz/ifv/bVXft90VeSav5nFO61EcNgwr0aJxbyPaWBPg==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/helper-compilation-targets@7.28.6':
+    resolution: {integrity: sha512-JYtls3hqi15fcx5GaSNL7SCTJ2MNmjrkHXg4FSpOA/grxK8KwyZ5bubHsCq8FXCkua6xhuaaBit+3b7+VZRfcA==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/helper-create-class-features-plugin@7.28.6':
+    resolution: {integrity: sha512-dTOdvsjnG3xNT9Y0AUg1wAl38y+4Rl4sf9caSQZOXdNqVn+H+HbbJ4IyyHaIqNR6SW9oJpA/RuRjsjCw2IdIow==}
+    engines: {node: '>=6.9.0'}
+    peerDependencies:
+      '@babel/core': ^7.0.0
+
+  '@babel/helper-globals@7.28.0':
+    resolution: {integrity: sha512-+W6cISkXFa1jXsDEdYA8HeevQT/FULhxzR99pxphltZcVaugps53THCeiWA8SguxxpSp3gKPiuYfSWopkLQ4hw==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/helper-member-expression-to-functions@7.28.5':
+    resolution: {integrity: sha512-cwM7SBRZcPCLgl8a7cY0soT1SptSzAlMH39vwiRpOQkJlh53r5hdHwLSCZpQdVLT39sZt+CRpNwYG4Y2v77atg==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/helper-module-imports@7.18.6':
+    resolution: {integrity: sha512-0NFvs3VkuSYbFi1x2Vd6tKrywq+z/cLeYC/RJNFrIX/30Bf5aiGYbtvGXolEktzJH8o5E5KJ3tT+nkxuuZFVlA==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/helper-module-imports@7.28.6':
+    resolution: {integrity: sha512-l5XkZK7r7wa9LucGw9LwZyyCUscb4x37JWTPz7swwFE/0FMQAGpiWUZn8u9DzkSBWEcK25jmvubfpw2dnAMdbw==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/helper-module-transforms@7.28.6':
+    resolution: {integrity: sha512-67oXFAYr2cDLDVGLXTEABjdBJZ6drElUSI7WKp70NrpyISso3plG9SAGEF6y7zbha/wOzUByWWTJvEDVNIUGcA==}
+    engines: {node: '>=6.9.0'}
+    peerDependencies:
+      '@babel/core': ^7.0.0
+
+  '@babel/helper-optimise-call-expression@7.27.1':
+    resolution: {integrity: sha512-URMGH08NzYFhubNSGJrpUEphGKQwMQYBySzat5cAByY1/YgIRkULnIy3tAMeszlL/so2HbeilYloUmSpd7GdVw==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/helper-plugin-utils@7.28.6':
+    resolution: {integrity: sha512-S9gzZ/bz83GRysI7gAD4wPT/AI3uCnY+9xn+Mx/KPs2JwHJIz1W8PZkg2cqyt3RNOBM8ejcXhV6y8Og7ly/Dug==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/helper-replace-supers@7.28.6':
+    resolution: {integrity: sha512-mq8e+laIk94/yFec3DxSjCRD2Z0TAjhVbEJY3UQrlwVo15Lmt7C2wAUbK4bjnTs4APkwsYLTahXRraQXhb1WCg==}
+    engines: {node: '>=6.9.0'}
+    peerDependencies:
+      '@babel/core': ^7.0.0
+
+  '@babel/helper-skip-transparent-expression-wrappers@7.27.1':
+    resolution: {integrity: sha512-Tub4ZKEXqbPjXgWLl2+3JpQAYBJ8+ikpQ2Ocj/q/r0LwE3UhENh7EUabyHjz2kCEsrRY83ew2DQdHluuiDQFzg==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/helper-string-parser@7.27.1':
+    resolution: {integrity: sha512-qMlSxKbpRlAridDExk92nSobyDdpPijUq2DW6oDnUqd0iOGxmQjyqhMIihI9+zv4LPyZdRje2cavWPbCbWm3eA==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/helper-validator-identifier@7.28.5':
+    resolution: {integrity: sha512-qSs4ifwzKJSV39ucNjsvc6WVHs6b7S03sOh2OcHF9UHfVPqWWALUsNUVzhSBiItjRZoLHx7nIarVjqKVusUZ1Q==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/helper-validator-option@7.27.1':
+    resolution: {integrity: sha512-YvjJow9FxbhFFKDSuFnVCe2WxXk1zWc22fFePVNEaWJEu8IrZVlda6N0uHwzZrUM1il7NC9Mlp4MaJYbYd9JSg==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/helpers@7.28.6':
+    resolution: {integrity: sha512-xOBvwq86HHdB7WUDTfKfT/Vuxh7gElQ+Sfti2Cy6yIWNW05P8iUslOVcZ4/sKbE+/jQaukQAdz/gf3724kYdqw==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/parser@7.29.0':
+    resolution: {integrity: sha512-IyDgFV5GeDUVX4YdF/3CPULtVGSXXMLh1xVIgdCgxApktqnQV0r7/8Nqthg+8YLGaAtdyIlo2qIdZrbCv4+7ww==}
+    engines: {node: '>=6.0.0'}
+    hasBin: true
+
+  '@babel/plugin-syntax-jsx@7.28.6':
+    resolution: {integrity: sha512-wgEmr06G6sIpqr8YDwA2dSRTE3bJ+V0IfpzfSY3Lfgd7YWOaAdlykvJi13ZKBt8cZHfgH1IXN+CL656W3uUa4w==}
+    engines: {node: '>=6.9.0'}
+    peerDependencies:
+      '@babel/core': ^7.0.0-0
+
+  '@babel/plugin-syntax-typescript@7.28.6':
+    resolution: {integrity: sha512-+nDNmQye7nlnuuHDboPbGm00Vqg3oO8niRRL27/4LYHUsHYh0zJ1xWOz0uRwNFmM1Avzk8wZbc6rdiYhomzv/A==}
+    engines: {node: '>=6.9.0'}
+    peerDependencies:
+      '@babel/core': ^7.0.0-0
+
+  '@babel/plugin-transform-react-jsx-self@7.27.1':
+    resolution: {integrity: sha512-6UzkCs+ejGdZ5mFFC/OCUrv028ab2fp1znZmCZjAOBKiBK2jXD1O+BPSfX8X2qjJ75fZBMSnQn3Rq2mrBJK2mw==}
+    engines: {node: '>=6.9.0'}
+    peerDependencies:
+      '@babel/core': ^7.0.0-0
+
+  '@babel/plugin-transform-react-jsx-source@7.27.1':
+    resolution: {integrity: sha512-zbwoTsBruTeKB9hSq73ha66iFeJHuaFkUbwvqElnygoNbj/jHRsSeokowZFN3CZ64IvEqcmmkVe89OPXc7ldAw==}
+    engines: {node: '>=6.9.0'}
+    peerDependencies:
+      '@babel/core': ^7.0.0-0
+
+  '@babel/plugin-transform-typescript@7.28.6':
+    resolution: {integrity: sha512-0YWL2RFxOqEm9Efk5PvreamxPME8OyY0wM5wh5lHjF+VtVhdneCWGzZeSqzOfiobVqQaNCd2z0tQvnI9DaPWPw==}
+    engines: {node: '>=6.9.0'}
+    peerDependencies:
+      '@babel/core': ^7.0.0-0
+
+  '@babel/runtime@7.28.6':
+    resolution: {integrity: sha512-05WQkdpL9COIMz4LjTxGpPNCdlpyimKppYNoJ5Di5EUObifl8t4tuLuUBBZEpoLYOmfvIWrsp9fCl0HoPRVTdA==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/template@7.28.6':
+    resolution: {integrity: sha512-YA6Ma2KsCdGb+WC6UpBVFJGXL58MDA6oyONbjyF/+5sBgxY/dwkhLogbMT2GXXyU84/IhRw/2D1Os1B/giz+BQ==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/traverse@7.29.0':
+    resolution: {integrity: sha512-4HPiQr0X7+waHfyXPZpWPfWL/J7dcN1mx9gL6WdQVMbPnF3+ZhSMs8tCxN7oHddJE9fhNE7+lxdnlyemKfJRuA==}
+    engines: {node: '>=6.9.0'}
+
+  '@babel/types@7.29.0':
+    resolution: {integrity: sha512-LwdZHpScM4Qz8Xw2iKSzS+cfglZzJGvofQICy7W7v4caru4EaAmyUuO6BGrbyQ2mYV11W0U8j5mBhd14dd3B0A==}
+    engines: {node: '>=6.9.0'}
+
+  '@biomejs/biome@2.4.2':
+    resolution: {integrity: sha512-vVE/FqLxNLbvYnFDYg3Xfrh1UdFhmPT5i+yPT9GE2nTUgI4rkqo5krw5wK19YHBd7aE7J6r91RRmb8RWwkjy6w==}
+    engines: {node: '>=14.21.3'}
+    hasBin: true
+
+  '@biomejs/cli-darwin-arm64@2.4.2':
+    resolution: {integrity: sha512-3pEcKCP/1POKyaZZhXcxFl3+d9njmeAihZ17k8lL/1vk+6e0Cbf0yPzKItFiT+5Yh6TQA4uKvnlqe0oVZwRxCA==}
+    engines: {node: '>=14.21.3'}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@biomejs/cli-darwin-x64@2.4.2':
+    resolution: {integrity: sha512-P7hK1jLVny+0R9UwyGcECxO6sjETxfPyBm/1dmFjnDOHgdDPjPqozByunrwh4xPKld8sxOr5eAsSqal5uKgeBg==}
+    engines: {node: '>=14.21.3'}
+    cpu: [x64]
+    os: [darwin]
+
+  '@biomejs/cli-linux-arm64-musl@2.4.2':
+    resolution: {integrity: sha512-/x04YK9+7erw6tYEcJv9WXoBHcULI/wMOvNdAyE9S3JStZZ9yJyV67sWAI+90UHuDo/BDhq0d96LDqGlSVv7WA==}
+    engines: {node: '>=14.21.3'}
+    cpu: [arm64]
+    os: [linux]
+    libc: [musl]
+
+  '@biomejs/cli-linux-arm64@2.4.2':
+    resolution: {integrity: sha512-DI3Mi7GT2zYNgUTDEbSjl3e1KhoP76OjQdm8JpvZYZWtVDRyLd3w8llSr2TWk1z+U3P44kUBWY3X7H9MD1/DGQ==}
+    engines: {node: '>=14.21.3'}
+    cpu: [arm64]
+    os: [linux]
+    libc: [glibc]
+
+  '@biomejs/cli-linux-x64-musl@2.4.2':
+    resolution: {integrity: sha512-wbBmTkeAoAYbOQ33f6sfKG7pcRSydQiF+dTYOBjJsnXO2mWEOQHllKlC2YVnedqZFERp2WZhFUoO7TNRwnwEHQ==}
+    engines: {node: '>=14.21.3'}
+    cpu: [x64]
+    os: [linux]
+    libc: [musl]
+
+  '@biomejs/cli-linux-x64@2.4.2':
+    resolution: {integrity: sha512-GK2ErnrKpWFigYP68cXiCHK4RTL4IUWhK92AFS3U28X/nuAL5+hTuy6hyobc8JZRSt+upXt1nXChK+tuHHx4mA==}
+    engines: {node: '>=14.21.3'}
+    cpu: [x64]
+    os: [linux]
+    libc: [glibc]
+
+  '@biomejs/cli-win32-arm64@2.4.2':
+    resolution: {integrity: sha512-k2uqwLYrNNxnaoiW3RJxoMGnbKda8FuCmtYG3cOtVljs3CzWxaTR+AoXwKGHscC9thax9R4kOrtWqWN0+KdPTw==}
+    engines: {node: '>=14.21.3'}
+    cpu: [arm64]
+    os: [win32]
+
+  '@biomejs/cli-win32-x64@2.4.2':
+    resolution: {integrity: sha512-9ma7C4g8Sq3cBlRJD2yrsHXB1mnnEBdpy7PhvFrylQWQb4PoyCmPucdX7frvsSBQuFtIiKCrolPl/8tCZrKvgQ==}
+    engines: {node: '>=14.21.3'}
+    cpu: [x64]
+    os: [win32]
+
+  '@bomb.sh/tab@0.0.12':
+    resolution: {integrity: sha512-dYRwg4MqfHR5/BcTy285XOGRhjQFmNpaJBZ0tl2oU+RY595MQ5ApTF6j3OvauPAooHL6cfoOZMySQrOQztT8RQ==}
+    hasBin: true
+    peerDependencies:
+      cac: ^6.7.14
+      citty: ^0.1.6
+      commander: ^13.1.0
+    peerDependenciesMeta:
+      cac:
+        optional: true
+      citty:
+        optional: true
+      commander:
+        optional: true
+
+  '@changesets/apply-release-plan@7.0.14':
+    resolution: {integrity: sha512-ddBvf9PHdy2YY0OUiEl3TV78mH9sckndJR14QAt87KLEbIov81XO0q0QAmvooBxXlqRRP8I9B7XOzZwQG7JkWA==}
+
+  '@changesets/assemble-release-plan@6.0.9':
+    resolution: {integrity: sha512-tPgeeqCHIwNo8sypKlS3gOPmsS3wP0zHt67JDuL20P4QcXiw/O4Hl7oXiuLnP9yg+rXLQ2sScdV1Kkzde61iSQ==}
+
+  '@changesets/changelog-git@0.2.1':
+    resolution: {integrity: sha512-x/xEleCFLH28c3bQeQIyeZf8lFXyDFVn1SgcBiR2Tw/r4IAWlk1fzxCEZ6NxQAjF2Nwtczoen3OA2qR+UawQ8Q==}
+
+  '@changesets/cli@2.29.7':
+    resolution: {integrity: sha512-R7RqWoaksyyKXbKXBTbT4REdy22yH81mcFK6sWtqSanxUCbUi9Uf+6aqxZtDQouIqPdem2W56CdxXgsxdq7FLQ==}
+    hasBin: true
+
+  '@changesets/config@3.1.2':
+    resolution: {integrity: sha512-CYiRhA4bWKemdYi/uwImjPxqWNpqGPNbEBdX1BdONALFIDK7MCUj6FPkzD+z9gJcvDFUQJn9aDVf4UG7OT6Kog==}
+
+  '@changesets/errors@0.2.0':
+    resolution: {integrity: sha512-6BLOQUscTpZeGljvyQXlWOItQyU71kCdGz7Pi8H8zdw6BI0g3m43iL4xKUVPWtG+qrrL9DTjpdn8eYuCQSRpow==}
+
+  '@changesets/get-dependents-graph@2.1.3':
+    resolution: {integrity: sha512-gphr+v0mv2I3Oxt19VdWRRUxq3sseyUpX9DaHpTUmLj92Y10AGy+XOtV+kbM6L/fDcpx7/ISDFK6T8A/P3lOdQ==}
+
+  '@changesets/get-release-plan@4.0.14':
+    resolution: {integrity: sha512-yjZMHpUHgl4Xl5gRlolVuxDkm4HgSJqT93Ri1Uz8kGrQb+5iJ8dkXJ20M2j/Y4iV5QzS2c5SeTxVSKX+2eMI0g==}
+
+  '@changesets/get-version-range-type@0.4.0':
+    resolution: {integrity: sha512-hwawtob9DryoGTpixy1D3ZXbGgJu1Rhr+ySH2PvTLHvkZuQ7sRT4oQwMh0hbqZH1weAooedEjRsbrWcGLCeyVQ==}
+
+  '@changesets/git@3.0.4':
+    resolution: {integrity: sha512-BXANzRFkX+XcC1q/d27NKvlJ1yf7PSAgi8JG6dt8EfbHFHi4neau7mufcSca5zRhwOL8j9s6EqsxmT+s+/E6Sw==}
+
+  '@changesets/logger@0.1.1':
+    resolution: {integrity: sha512-OQtR36ZlnuTxKqoW4Sv6x5YIhOmClRd5pWsjZsddYxpWs517R0HkyiefQPIytCVh4ZcC5x9XaG8KTdd5iRQUfg==}
+
+  '@changesets/parse@0.4.2':
+    resolution: {integrity: sha512-Uo5MC5mfg4OM0jU3up66fmSn6/NE9INK+8/Vn/7sMVcdWg46zfbvvUSjD9EMonVqPi9fbrJH9SXHn48Tr1f2yA==}
+
+  '@changesets/pre@2.0.2':
+    resolution: {integrity: sha512-HaL/gEyFVvkf9KFg6484wR9s0qjAXlZ8qWPDkTyKF6+zqjBe/I2mygg3MbpZ++hdi0ToqNUF8cjj7fBy0dg8Ug==}
+
+  '@changesets/read@0.6.6':
+    resolution: {integrity: sha512-P5QaN9hJSQQKJShzzpBT13FzOSPyHbqdoIBUd2DJdgvnECCyO6LmAOWSV+O8se2TaZJVwSXjL+v9yhb+a9JeJg==}
+
+  '@changesets/should-skip-package@0.1.2':
+    resolution: {integrity: sha512-qAK/WrqWLNCP22UDdBTMPH5f41elVDlsNyat180A33dWxuUDyNpg6fPi/FyTZwRriVjg0L8gnjJn2F9XAoF0qw==}
+
+  '@changesets/types@4.1.0':
+    resolution: {integrity: sha512-LDQvVDv5Kb50ny2s25Fhm3d9QSZimsoUGBsUioj6MC3qbMUCuC8GPIvk/M6IvXx3lYhAs0lwWUQLb+VIEUCECw==}
+
+  '@changesets/types@6.1.0':
+    resolution: {integrity: sha512-rKQcJ+o1nKNgeoYRHKOS07tAMNd3YSN0uHaJOZYjBAgxfV7TUE7JE+z4BzZdQwb5hKaYbayKN5KrYV7ODb2rAA==}
+
+  '@changesets/write@0.4.0':
+    resolution: {integrity: sha512-CdTLvIOPiCNuH71pyDu3rA+Q0n65cmAbXnwWH84rKGiFumFzkmHNT8KHTMEchcxN+Kl8I54xGUhJ7l3E7X396Q==}
+
+  '@clack/core@1.0.1':
+    resolution: {integrity: sha512-WKeyK3NOBwDOzagPR5H08rFk9D/WuN705yEbuZvKqlkmoLM2woKtXb10OO2k1NoSU4SFG947i2/SCYh+2u5e4g==}
+
+  '@clack/prompts@1.0.1':
+    resolution: {integrity: sha512-/42G73JkuYdyWZ6m8d/CJtBrGl1Hegyc7Fy78m5Ob+jF85TOUmLR5XLce/U3LxYAw0kJ8CT5aI99RIvPHcGp/Q==}
+
+  '@cloudflare/kv-asset-handler@0.4.2':
+    resolution: {integrity: sha512-SIOD2DxrRRwQ+jgzlXCqoEFiKOFqaPjhnNTGKXSRLvp1HiOvapLaFG2kEr9dYQTYe8rKrd9uvDUzmAITeNyaHQ==}
+    engines: {node: '>=18.0.0'}
+
+  '@deno/shim-deno-test@0.5.0':
+    resolution: {integrity: sha512-4nMhecpGlPi0cSzT67L+Tm+GOJqvuk8gqHBziqcUQOarnuIax1z96/gJHCSIz2Z0zhxE6Rzwb3IZXPtFh51j+w==}
+
+  '@deno/shim-deno@0.19.2':
+    resolution: {integrity: sha512-q3VTHl44ad8T2Tw2SpeAvghdGOjlnLPDNO2cpOxwMrBE/PVas6geWpbpIgrM+czOCH0yejp0yi8OaTuB+NU40Q==}
+
+  '@dxup/nuxt@0.3.2':
+    resolution: {integrity: sha512-2f2usP4oLNsIGjPprvABe3f3GWuIhIDp0169pGLFxTDRI5A4d4sBbGpR+tD9bGZCT+1Btb6Q2GKlyv3LkDCW5g==}
+
+  '@dxup/unimport@0.1.2':
+    resolution: {integrity: sha512-/B8YJGPzaYq1NbsQmwgP8EZqg40NpTw4ZB3suuI0TplbxKHeK94jeaawLmVhCv+YwUnOpiWEz9U6SeThku/8JQ==}
+
+  '@emnapi/core@1.8.1':
+    resolution: {integrity: sha512-AvT9QFpxK0Zd8J0jopedNm+w/2fIzvtPKPjqyw9jwvBaReTTqPBk9Hixaz7KbjimP+QNz605/XnjFcDAL2pqBg==}
+
+  '@emnapi/runtime@1.8.1':
+    resolution: {integrity: sha512-mehfKSMWjjNol8659Z8KxEMrdSJDDot5SXMq00dM8BN4o+CLNXQ0xH2V7EchNHV4RmbZLmmPdEaXZc5H2FXmDg==}
+
+  '@emnapi/wasi-threads@1.1.0':
+    resolution: {integrity: sha512-WI0DdZ8xFSbgMjR1sFsKABJ/C5OnRrjT06JXbZKexJGrDuPTzZdDYfFlsgcCXCyf+suG5QU2e/y1Wo2V/OapLQ==}
+
+  '@esbuild/aix-ppc64@0.25.12':
+    resolution: {integrity: sha512-Hhmwd6CInZ3dwpuGTF8fJG6yoWmsToE+vYgD4nytZVxcu1ulHpUQRAB1UJ8+N1Am3Mz4+xOByoQoSZf4D+CpkA==}
+    engines: {node: '>=18'}
+    cpu: [ppc64]
+    os: [aix]
+
+  '@esbuild/aix-ppc64@0.27.3':
+    resolution: {integrity: sha512-9fJMTNFTWZMh5qwrBItuziu834eOCUcEqymSH7pY+zoMVEZg3gcPuBNxH1EvfVYe9h0x/Ptw8KBzv7qxb7l8dg==}
+    engines: {node: '>=18'}
+    cpu: [ppc64]
+    os: [aix]
+
+  '@esbuild/android-arm64@0.25.12':
+    resolution: {integrity: sha512-6AAmLG7zwD1Z159jCKPvAxZd4y/VTO0VkprYy+3N2FtJ8+BQWFXU+OxARIwA46c5tdD9SsKGZ/1ocqBS/gAKHg==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [android]
+
+  '@esbuild/android-arm64@0.27.3':
+    resolution: {integrity: sha512-YdghPYUmj/FX2SYKJ0OZxf+iaKgMsKHVPF1MAq/P8WirnSpCStzKJFjOjzsW0QQ7oIAiccHdcqjbHmJxRb/dmg==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [android]
+
+  '@esbuild/android-arm@0.25.12':
+    resolution: {integrity: sha512-VJ+sKvNA/GE7Ccacc9Cha7bpS8nyzVv0jdVgwNDaR4gDMC/2TTRc33Ip8qrNYUcpkOHUT5OZ0bUcNNVZQ9RLlg==}
+    engines: {node: '>=18'}
+    cpu: [arm]
+    os: [android]
+
+  '@esbuild/android-arm@0.27.3':
+    resolution: {integrity: sha512-i5D1hPY7GIQmXlXhs2w8AWHhenb00+GxjxRncS2ZM7YNVGNfaMxgzSGuO8o8SJzRc/oZwU2bcScvVERk03QhzA==}
+    engines: {node: '>=18'}
+    cpu: [arm]
+    os: [android]
+
+  '@esbuild/android-x64@0.25.12':
+    resolution: {integrity: sha512-5jbb+2hhDHx5phYR2By8GTWEzn6I9UqR11Kwf22iKbNpYrsmRB18aX/9ivc5cabcUiAT/wM+YIZ6SG9QO6a8kg==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [android]
+
+  '@esbuild/android-x64@0.27.3':
+    resolution: {integrity: sha512-IN/0BNTkHtk8lkOM8JWAYFg4ORxBkZQf9zXiEOfERX/CzxW3Vg1ewAhU7QSWQpVIzTW+b8Xy+lGzdYXV6UZObQ==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [android]
+
+  '@esbuild/darwin-arm64@0.25.12':
+    resolution: {integrity: sha512-N3zl+lxHCifgIlcMUP5016ESkeQjLj/959RxxNYIthIg+CQHInujFuXeWbWMgnTo4cp5XVHqFPmpyu9J65C1Yg==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@esbuild/darwin-arm64@0.27.3':
+    resolution: {integrity: sha512-Re491k7ByTVRy0t3EKWajdLIr0gz2kKKfzafkth4Q8A5n1xTHrkqZgLLjFEHVD+AXdUGgQMq+Godfq45mGpCKg==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@esbuild/darwin-x64@0.25.12':
+    resolution: {integrity: sha512-HQ9ka4Kx21qHXwtlTUVbKJOAnmG1ipXhdWTmNXiPzPfWKpXqASVcWdnf2bnL73wgjNrFXAa3yYvBSd9pzfEIpA==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [darwin]
+
+  '@esbuild/darwin-x64@0.27.3':
+    resolution: {integrity: sha512-vHk/hA7/1AckjGzRqi6wbo+jaShzRowYip6rt6q7VYEDX4LEy1pZfDpdxCBnGtl+A5zq8iXDcyuxwtv3hNtHFg==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [darwin]
+
+  '@esbuild/freebsd-arm64@0.25.12':
+    resolution: {integrity: sha512-gA0Bx759+7Jve03K1S0vkOu5Lg/85dou3EseOGUes8flVOGxbhDDh/iZaoek11Y8mtyKPGF3vP8XhnkDEAmzeg==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [freebsd]
+
+  '@esbuild/freebsd-arm64@0.27.3':
+    resolution: {integrity: sha512-ipTYM2fjt3kQAYOvo6vcxJx3nBYAzPjgTCk7QEgZG8AUO3ydUhvelmhrbOheMnGOlaSFUoHXB6un+A7q4ygY9w==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [freebsd]
+
+  '@esbuild/freebsd-x64@0.25.12':
+    resolution: {integrity: sha512-TGbO26Yw2xsHzxtbVFGEXBFH0FRAP7gtcPE7P5yP7wGy7cXK2oO7RyOhL5NLiqTlBh47XhmIUXuGciXEqYFfBQ==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [freebsd]
+
+  '@esbuild/freebsd-x64@0.27.3':
+    resolution: {integrity: sha512-dDk0X87T7mI6U3K9VjWtHOXqwAMJBNN2r7bejDsc+j03SEjtD9HrOl8gVFByeM0aJksoUuUVU9TBaZa2rgj0oA==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [freebsd]
+
+  '@esbuild/linux-arm64@0.25.12':
+    resolution: {integrity: sha512-8bwX7a8FghIgrupcxb4aUmYDLp8pX06rGh5HqDT7bB+8Rdells6mHvrFHHW2JAOPZUbnjUpKTLg6ECyzvas2AQ==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [linux]
+
+  '@esbuild/linux-arm64@0.27.3':
+    resolution: {integrity: sha512-sZOuFz/xWnZ4KH3YfFrKCf1WyPZHakVzTiqji3WDc0BCl2kBwiJLCXpzLzUBLgmp4veFZdvN5ChW4Eq/8Fc2Fg==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [linux]
+
+  '@esbuild/linux-arm@0.25.12':
+    resolution: {integrity: sha512-lPDGyC1JPDou8kGcywY0YILzWlhhnRjdof3UlcoqYmS9El818LLfJJc3PXXgZHrHCAKs/Z2SeZtDJr5MrkxtOw==}
+    engines: {node: '>=18'}
+    cpu: [arm]
+    os: [linux]
+
+  '@esbuild/linux-arm@0.27.3':
+    resolution: {integrity: sha512-s6nPv2QkSupJwLYyfS+gwdirm0ukyTFNl3KTgZEAiJDd+iHZcbTPPcWCcRYH+WlNbwChgH2QkE9NSlNrMT8Gfw==}
+    engines: {node: '>=18'}
+    cpu: [arm]
+    os: [linux]
+
+  '@esbuild/linux-ia32@0.25.12':
+    resolution: {integrity: sha512-0y9KrdVnbMM2/vG8KfU0byhUN+EFCny9+8g202gYqSSVMonbsCfLjUO+rCci7pM0WBEtz+oK/PIwHkzxkyharA==}
+    engines: {node: '>=18'}
+    cpu: [ia32]
+    os: [linux]
+
+  '@esbuild/linux-ia32@0.27.3':
+    resolution: {integrity: sha512-yGlQYjdxtLdh0a3jHjuwOrxQjOZYD/C9PfdbgJJF3TIZWnm/tMd/RcNiLngiu4iwcBAOezdnSLAwQDPqTmtTYg==}
+    engines: {node: '>=18'}
+    cpu: [ia32]
+    os: [linux]
+
+  '@esbuild/linux-loong64@0.25.12':
+    resolution: {integrity: sha512-h///Lr5a9rib/v1GGqXVGzjL4TMvVTv+s1DPoxQdz7l/AYv6LDSxdIwzxkrPW438oUXiDtwM10o9PmwS/6Z0Ng==}
+    engines: {node: '>=18'}
+    cpu: [loong64]
+    os: [linux]
+
+  '@esbuild/linux-loong64@0.27.3':
+    resolution: {integrity: sha512-WO60Sn8ly3gtzhyjATDgieJNet/KqsDlX5nRC5Y3oTFcS1l0KWba+SEa9Ja1GfDqSF1z6hif/SkpQJbL63cgOA==}
+    engines: {node: '>=18'}
+    cpu: [loong64]
+    os: [linux]
+
+  '@esbuild/linux-mips64el@0.25.12':
+    resolution: {integrity: sha512-iyRrM1Pzy9GFMDLsXn1iHUm18nhKnNMWscjmp4+hpafcZjrr2WbT//d20xaGljXDBYHqRcl8HnxbX6uaA/eGVw==}
+    engines: {node: '>=18'}
+    cpu: [mips64el]
+    os: [linux]
+
+  '@esbuild/linux-mips64el@0.27.3':
+    resolution: {integrity: sha512-APsymYA6sGcZ4pD6k+UxbDjOFSvPWyZhjaiPyl/f79xKxwTnrn5QUnXR5prvetuaSMsb4jgeHewIDCIWljrSxw==}
+    engines: {node: '>=18'}
+    cpu: [mips64el]
+    os: [linux]
+
+  '@esbuild/linux-ppc64@0.25.12':
+    resolution: {integrity: sha512-9meM/lRXxMi5PSUqEXRCtVjEZBGwB7P/D4yT8UG/mwIdze2aV4Vo6U5gD3+RsoHXKkHCfSxZKzmDssVlRj1QQA==}
+    engines: {node: '>=18'}
+    cpu: [ppc64]
+    os: [linux]
+
+  '@esbuild/linux-ppc64@0.27.3':
+    resolution: {integrity: sha512-eizBnTeBefojtDb9nSh4vvVQ3V9Qf9Df01PfawPcRzJH4gFSgrObw+LveUyDoKU3kxi5+9RJTCWlj4FjYXVPEA==}
+    engines: {node: '>=18'}
+    cpu: [ppc64]
+    os: [linux]
+
+  '@esbuild/linux-riscv64@0.25.12':
+    resolution: {integrity: sha512-Zr7KR4hgKUpWAwb1f3o5ygT04MzqVrGEGXGLnj15YQDJErYu/BGg+wmFlIDOdJp0PmB0lLvxFIOXZgFRrdjR0w==}
+    engines: {node: '>=18'}
+    cpu: [riscv64]
+    os: [linux]
+
+  '@esbuild/linux-riscv64@0.27.3':
+    resolution: {integrity: sha512-3Emwh0r5wmfm3ssTWRQSyVhbOHvqegUDRd0WhmXKX2mkHJe1SFCMJhagUleMq+Uci34wLSipf8Lagt4LlpRFWQ==}
+    engines: {node: '>=18'}
+    cpu: [riscv64]
+    os: [linux]
+
+  '@esbuild/linux-s390x@0.25.12':
+    resolution: {integrity: sha512-MsKncOcgTNvdtiISc/jZs/Zf8d0cl/t3gYWX8J9ubBnVOwlk65UIEEvgBORTiljloIWnBzLs4qhzPkJcitIzIg==}
+    engines: {node: '>=18'}
+    cpu: [s390x]
+    os: [linux]
+
+  '@esbuild/linux-s390x@0.27.3':
+    resolution: {integrity: sha512-pBHUx9LzXWBc7MFIEEL0yD/ZVtNgLytvx60gES28GcWMqil8ElCYR4kvbV2BDqsHOvVDRrOxGySBM9Fcv744hw==}
+    engines: {node: '>=18'}
+    cpu: [s390x]
+    os: [linux]
+
+  '@esbuild/linux-x64@0.25.12':
+    resolution: {integrity: sha512-uqZMTLr/zR/ed4jIGnwSLkaHmPjOjJvnm6TVVitAa08SLS9Z0VM8wIRx7gWbJB5/J54YuIMInDquWyYvQLZkgw==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [linux]
+
+  '@esbuild/linux-x64@0.27.3':
+    resolution: {integrity: sha512-Czi8yzXUWIQYAtL/2y6vogER8pvcsOsk5cpwL4Gk5nJqH5UZiVByIY8Eorm5R13gq+DQKYg0+JyQoytLQas4dA==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [linux]
+
+  '@esbuild/netbsd-arm64@0.25.12':
+    resolution: {integrity: sha512-xXwcTq4GhRM7J9A8Gv5boanHhRa/Q9KLVmcyXHCTaM4wKfIpWkdXiMog/KsnxzJ0A1+nD+zoecuzqPmCRyBGjg==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [netbsd]
+
+  '@esbuild/netbsd-arm64@0.27.3':
+    resolution: {integrity: sha512-sDpk0RgmTCR/5HguIZa9n9u+HVKf40fbEUt+iTzSnCaGvY9kFP0YKBWZtJaraonFnqef5SlJ8/TiPAxzyS+UoA==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [netbsd]
+
+  '@esbuild/netbsd-x64@0.25.12':
+    resolution: {integrity: sha512-Ld5pTlzPy3YwGec4OuHh1aCVCRvOXdH8DgRjfDy/oumVovmuSzWfnSJg+VtakB9Cm0gxNO9BzWkj6mtO1FMXkQ==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [netbsd]
+
+  '@esbuild/netbsd-x64@0.27.3':
+    resolution: {integrity: sha512-P14lFKJl/DdaE00LItAukUdZO5iqNH7+PjoBm+fLQjtxfcfFE20Xf5CrLsmZdq5LFFZzb5JMZ9grUwvtVYzjiA==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [netbsd]
+
+  '@esbuild/openbsd-arm64@0.25.12':
+    resolution: {integrity: sha512-fF96T6KsBo/pkQI950FARU9apGNTSlZGsv1jZBAlcLL1MLjLNIWPBkj5NlSz8aAzYKg+eNqknrUJ24QBybeR5A==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [openbsd]
+
+  '@esbuild/openbsd-arm64@0.27.3':
+    resolution: {integrity: sha512-AIcMP77AvirGbRl/UZFTq5hjXK+2wC7qFRGoHSDrZ5v5b8DK/GYpXW3CPRL53NkvDqb9D+alBiC/dV0Fb7eJcw==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [openbsd]
+
+  '@esbuild/openbsd-x64@0.25.12':
+    resolution: {integrity: sha512-MZyXUkZHjQxUvzK7rN8DJ3SRmrVrke8ZyRusHlP+kuwqTcfWLyqMOE3sScPPyeIXN/mDJIfGXvcMqCgYKekoQw==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [openbsd]
+
+  '@esbuild/openbsd-x64@0.27.3':
+    resolution: {integrity: sha512-DnW2sRrBzA+YnE70LKqnM3P+z8vehfJWHXECbwBmH/CU51z6FiqTQTHFenPlHmo3a8UgpLyH3PT+87OViOh1AQ==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [openbsd]
+
+  '@esbuild/openharmony-arm64@0.25.12':
+    resolution: {integrity: sha512-rm0YWsqUSRrjncSXGA7Zv78Nbnw4XL6/dzr20cyrQf7ZmRcsovpcRBdhD43Nuk3y7XIoW2OxMVvwuRvk9XdASg==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [openharmony]
+
+  '@esbuild/openharmony-arm64@0.27.3':
+    resolution: {integrity: sha512-NinAEgr/etERPTsZJ7aEZQvvg/A6IsZG/LgZy+81wON2huV7SrK3e63dU0XhyZP4RKGyTm7aOgmQk0bGp0fy2g==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [openharmony]
+
+  '@esbuild/sunos-x64@0.25.12':
+    resolution: {integrity: sha512-3wGSCDyuTHQUzt0nV7bocDy72r2lI33QL3gkDNGkod22EsYl04sMf0qLb8luNKTOmgF/eDEDP5BFNwoBKH441w==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [sunos]
+
+  '@esbuild/sunos-x64@0.27.3':
+    resolution: {integrity: sha512-PanZ+nEz+eWoBJ8/f8HKxTTD172SKwdXebZ0ndd953gt1HRBbhMsaNqjTyYLGLPdoWHy4zLU7bDVJztF5f3BHA==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [sunos]
+
+  '@esbuild/win32-arm64@0.25.12':
+    resolution: {integrity: sha512-rMmLrur64A7+DKlnSuwqUdRKyd3UE7oPJZmnljqEptesKM8wx9J8gx5u0+9Pq0fQQW8vqeKebwNXdfOyP+8Bsg==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [win32]
+
+  '@esbuild/win32-arm64@0.27.3':
+    resolution: {integrity: sha512-B2t59lWWYrbRDw/tjiWOuzSsFh1Y/E95ofKz7rIVYSQkUYBjfSgf6oeYPNWHToFRr2zx52JKApIcAS/D5TUBnA==}
+    engines: {node: '>=18'}
+    cpu: [arm64]
+    os: [win32]
+
+  '@esbuild/win32-ia32@0.25.12':
+    resolution: {integrity: sha512-HkqnmmBoCbCwxUKKNPBixiWDGCpQGVsrQfJoVGYLPT41XWF8lHuE5N6WhVia2n4o5QK5M4tYr21827fNhi4byQ==}
+    engines: {node: '>=18'}
+    cpu: [ia32]
+    os: [win32]
+
+  '@esbuild/win32-ia32@0.27.3':
+    resolution: {integrity: sha512-QLKSFeXNS8+tHW7tZpMtjlNb7HKau0QDpwm49u0vUp9y1WOF+PEzkU84y9GqYaAVW8aH8f3GcBck26jh54cX4Q==}
+    engines: {node: '>=18'}
+    cpu: [ia32]
+    os: [win32]
+
+  '@esbuild/win32-x64@0.25.12':
+    resolution: {integrity: sha512-alJC0uCZpTFrSL0CCDjcgleBXPnCrEAhTBILpeAp7M/OFgoqtAetfBzX0xM00MUsVVPpVjlPuMbREqnZCXaTnA==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [win32]
+
+  '@esbuild/win32-x64@0.27.3':
+    resolution: {integrity: sha512-4uJGhsxuptu3OcpVAzli+/gWusVGwZZHTlS63hh++ehExkVT8SgiEf7/uC/PclrPPkLhZqGgCTjd0VWLo6xMqA==}
+    engines: {node: '>=18'}
+    cpu: [x64]
+    os: [win32]
+
+  '@eslint-community/eslint-utils@4.9.1':
+    resolution: {integrity: sha512-phrYmNiYppR7znFEdqgfWHXR6NCkZEK7hwWDHZUjit/2/U0r6XvkDl0SYnoM51Hq7FhCGdLDT6zxCCOY1hexsQ==}
+    engines: {node: ^12.22.0 || ^14.17.0 || >=16.0.0}
+    peerDependencies:
+      eslint: ^6.0.0 || ^7.0.0 || >=8.0.0
+
+  '@eslint-community/regexpp@4.12.2':
+    resolution: {integrity: sha512-EriSTlt5OC9/7SXkRSCAhfSxxoSUgBm33OH+IkwbdpgoqsSsUg7y3uh+IICI/Qg4BBWr3U2i39RpmycbxMq4ew==}
+    engines: {node: ^12.0.0 || ^14.0.0 || >=16.0.0}
+
+  '@eslint/config-array@0.21.1':
+    resolution: {integrity: sha512-aw1gNayWpdI/jSYVgzN5pL0cfzU02GT3NBpeT/DXbx1/1x7ZKxFPd9bwrzygx/qiwIQiJ1sw/zD8qY/kRvlGHA==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+
+  '@eslint/config-helpers@0.4.2':
+    resolution: {integrity: sha512-gBrxN88gOIf3R7ja5K9slwNayVcZgK6SOUORm2uBzTeIEfeVaIhOpCtTox3P6R7o2jLFwLFTLnC7kU/RGcYEgw==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+
+  '@eslint/core@0.17.0':
+    resolution: {integrity: sha512-yL/sLrpmtDaFEiUj1osRP4TI2MDz1AddJL+jZ7KSqvBuliN4xqYY54IfdN8qD8Toa6g1iloph1fxQNkjOxrrpQ==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+
+  '@eslint/eslintrc@3.3.3':
+    resolution: {integrity: sha512-Kr+LPIUVKz2qkx1HAMH8q1q6azbqBAsXJUxBl/ODDuVPX45Z9DfwB8tPjTi6nNZ8BuM3nbJxC5zCAg5elnBUTQ==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+
+  '@eslint/js@9.39.2':
+    resolution: {integrity: sha512-q1mjIoW1VX4IvSocvM/vbTiveKC4k9eLrajNEuSsmjymSDEbpGddtpfOoN7YGAqBK3NG+uqo8ia4PDTt8buCYA==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+
+  '@eslint/object-schema@2.1.7':
+    resolution: {integrity: sha512-VtAOaymWVfZcmZbp6E2mympDIHvyjXs/12LqWYjVw6qjrfF+VK+fyG33kChz3nnK+SU5/NeHOqrTEHS8sXO3OA==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+
+  '@eslint/plugin-kit@0.4.1':
+    resolution: {integrity: sha512-43/qtrDUokr7LJqoF2c3+RInu/t4zfrpYdoSDfYyhg52rwLV6TnOvdG4fXm7IkSB3wErkcmJS9iEhjVtOSEjjA==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+
+  '@humanfs/core@0.19.1':
+    resolution: {integrity: sha512-5DyQ4+1JEUzejeK1JGICcideyfUbGixgS9jNgex5nqkW+cY7WZhxBigmieN5Qnw9ZosSNVC9KQKyb+GUaGyKUA==}
+    engines: {node: '>=18.18.0'}
+
+  '@humanfs/node@0.16.7':
+    resolution: {integrity: sha512-/zUx+yOsIrG4Y43Eh2peDeKCxlRt/gET6aHfaKpuq267qXdYDFViVHfMaLyygZOnl0kGWxFIgsBy8QFuTLUXEQ==}
+    engines: {node: '>=18.18.0'}
+
+  '@humanwhocodes/module-importer@1.0.1':
+    resolution: {integrity: sha512-bxveV4V8v5Yb4ncFTT3rPSgZBOpCkjfK0y4oVVVJwIuDVBRMDXrPyXRL988i5ap9m9bnyEEjWfm5WkBmtffLfA==}
+    engines: {node: '>=12.22'}
+
+  '@humanwhocodes/retry@0.4.3':
+    resolution: {integrity: sha512-bV0Tgo9K4hfPCek+aMAn81RppFKv2ySDQeMoSZuvTASywNTnVJCArCZE2FWqpvIatKu7VMRLWlR1EazvVhDyhQ==}
+    engines: {node: '>=18.18'}
+
+  '@img/colour@1.0.0':
+    resolution: {integrity: sha512-A5P/LfWGFSl6nsckYtjw9da+19jB8hkJ6ACTGcDfEJ0aE+l2n2El7dsVM7UVHZQ9s2lmYMWlrS21YLy2IR1LUw==}
+    engines: {node: '>=18'}
+
+  '@img/sharp-darwin-arm64@0.34.5':
+    resolution: {integrity: sha512-imtQ3WMJXbMY4fxb/Ndp6HBTNVtWCUI0WdobyheGf5+ad6xX8VIDO8u2xE4qc/fr08CKG/7dDseFtn6M6g/r3w==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@img/sharp-darwin-x64@0.34.5':
+    resolution: {integrity: sha512-YNEFAF/4KQ/PeW0N+r+aVVsoIY0/qxxikF2SWdp+NRkmMB7y9LBZAVqQ4yhGCm/H3H270OSykqmQMKLBhBJDEw==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [x64]
+    os: [darwin]
+
+  '@img/sharp-libvips-darwin-arm64@1.2.4':
+    resolution: {integrity: sha512-zqjjo7RatFfFoP0MkQ51jfuFZBnVE2pRiaydKJ1G/rHZvnsrHAOcQALIi9sA5co5xenQdTugCvtb1cuf78Vf4g==}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@img/sharp-libvips-darwin-x64@1.2.4':
+    resolution: {integrity: sha512-1IOd5xfVhlGwX+zXv2N93k0yMONvUlANylbJw1eTah8K/Jtpi15KC+WSiaX/nBmbm2HxRM1gZ0nSdjSsrZbGKg==}
+    cpu: [x64]
+    os: [darwin]
+
+  '@img/sharp-libvips-linux-arm64@1.2.4':
+    resolution: {integrity: sha512-excjX8DfsIcJ10x1Kzr4RcWe1edC9PquDRRPx3YVCvQv+U5p7Yin2s32ftzikXojb1PIFc/9Mt28/y+iRklkrw==}
+    cpu: [arm64]
+    os: [linux]
+    libc: [glibc]
+
+  '@img/sharp-libvips-linux-arm@1.2.4':
+    resolution: {integrity: sha512-bFI7xcKFELdiNCVov8e44Ia4u2byA+l3XtsAj+Q8tfCwO6BQ8iDojYdvoPMqsKDkuoOo+X6HZA0s0q11ANMQ8A==}
+    cpu: [arm]
+    os: [linux]
+    libc: [glibc]
+
+  '@img/sharp-libvips-linux-ppc64@1.2.4':
+    resolution: {integrity: sha512-FMuvGijLDYG6lW+b/UvyilUWu5Ayu+3r2d1S8notiGCIyYU/76eig1UfMmkZ7vwgOrzKzlQbFSuQfgm7GYUPpA==}
+    cpu: [ppc64]
+    os: [linux]
+    libc: [glibc]
+
+  '@img/sharp-libvips-linux-riscv64@1.2.4':
+    resolution: {integrity: sha512-oVDbcR4zUC0ce82teubSm+x6ETixtKZBh/qbREIOcI3cULzDyb18Sr/Wcyx7NRQeQzOiHTNbZFF1UwPS2scyGA==}
+    cpu: [riscv64]
+    os: [linux]
+    libc: [glibc]
+
+  '@img/sharp-libvips-linux-s390x@1.2.4':
+    resolution: {integrity: sha512-qmp9VrzgPgMoGZyPvrQHqk02uyjA0/QrTO26Tqk6l4ZV0MPWIW6LTkqOIov+J1yEu7MbFQaDpwdwJKhbJvuRxQ==}
+    cpu: [s390x]
+    os: [linux]
+    libc: [glibc]
+
+  '@img/sharp-libvips-linux-x64@1.2.4':
+    resolution: {integrity: sha512-tJxiiLsmHc9Ax1bz3oaOYBURTXGIRDODBqhveVHonrHJ9/+k89qbLl0bcJns+e4t4rvaNBxaEZsFtSfAdquPrw==}
+    cpu: [x64]
+    os: [linux]
+    libc: [glibc]
+
+  '@img/sharp-libvips-linuxmusl-arm64@1.2.4':
+    resolution: {integrity: sha512-FVQHuwx1IIuNow9QAbYUzJ+En8KcVm9Lk5+uGUQJHaZmMECZmOlix9HnH7n1TRkXMS0pGxIJokIVB9SuqZGGXw==}
+    cpu: [arm64]
+    os: [linux]
+    libc: [musl]
+
+  '@img/sharp-libvips-linuxmusl-x64@1.2.4':
+    resolution: {integrity: sha512-+LpyBk7L44ZIXwz/VYfglaX/okxezESc6UxDSoyo2Ks6Jxc4Y7sGjpgU9s4PMgqgjj1gZCylTieNamqA1MF7Dg==}
+    cpu: [x64]
+    os: [linux]
+    libc: [musl]
+
+  '@img/sharp-linux-arm64@0.34.5':
+    resolution: {integrity: sha512-bKQzaJRY/bkPOXyKx5EVup7qkaojECG6NLYswgktOZjaXecSAeCWiZwwiFf3/Y+O1HrauiE3FVsGxFg8c24rZg==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [arm64]
+    os: [linux]
+    libc: [glibc]
+
+  '@img/sharp-linux-arm@0.34.5':
+    resolution: {integrity: sha512-9dLqsvwtg1uuXBGZKsxem9595+ujv0sJ6Vi8wcTANSFpwV/GONat5eCkzQo/1O6zRIkh0m/8+5BjrRr7jDUSZw==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [arm]
+    os: [linux]
+    libc: [glibc]
+
+  '@img/sharp-linux-ppc64@0.34.5':
+    resolution: {integrity: sha512-7zznwNaqW6YtsfrGGDA6BRkISKAAE1Jo0QdpNYXNMHu2+0dTrPflTLNkpc8l7MUP5M16ZJcUvysVWWrMefZquA==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [ppc64]
+    os: [linux]
+    libc: [glibc]
+
+  '@img/sharp-linux-riscv64@0.34.5':
+    resolution: {integrity: sha512-51gJuLPTKa7piYPaVs8GmByo7/U7/7TZOq+cnXJIHZKavIRHAP77e3N2HEl3dgiqdD/w0yUfiJnII77PuDDFdw==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [riscv64]
+    os: [linux]
+    libc: [glibc]
+
+  '@img/sharp-linux-s390x@0.34.5':
+    resolution: {integrity: sha512-nQtCk0PdKfho3eC5MrbQoigJ2gd1CgddUMkabUj+rBevs8tZ2cULOx46E7oyX+04WGfABgIwmMC0VqieTiR4jg==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [s390x]
+    os: [linux]
+    libc: [glibc]
+
+  '@img/sharp-linux-x64@0.34.5':
+    resolution: {integrity: sha512-MEzd8HPKxVxVenwAa+JRPwEC7QFjoPWuS5NZnBt6B3pu7EG2Ge0id1oLHZpPJdn3OQK+BQDiw9zStiHBTJQQQQ==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [x64]
+    os: [linux]
+    libc: [glibc]
+
+  '@img/sharp-linuxmusl-arm64@0.34.5':
+    resolution: {integrity: sha512-fprJR6GtRsMt6Kyfq44IsChVZeGN97gTD331weR1ex1c1rypDEABN6Tm2xa1wE6lYb5DdEnk03NZPqA7Id21yg==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [arm64]
+    os: [linux]
+    libc: [musl]
+
+  '@img/sharp-linuxmusl-x64@0.34.5':
+    resolution: {integrity: sha512-Jg8wNT1MUzIvhBFxViqrEhWDGzqymo3sV7z7ZsaWbZNDLXRJZoRGrjulp60YYtV4wfY8VIKcWidjojlLcWrd8Q==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [x64]
+    os: [linux]
+    libc: [musl]
+
+  '@img/sharp-wasm32@0.34.5':
+    resolution: {integrity: sha512-OdWTEiVkY2PHwqkbBI8frFxQQFekHaSSkUIJkwzclWZe64O1X4UlUjqqqLaPbUpMOQk6FBu/HtlGXNblIs0huw==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [wasm32]
+
+  '@img/sharp-win32-arm64@0.34.5':
+    resolution: {integrity: sha512-WQ3AgWCWYSb2yt+IG8mnC6Jdk9Whs7O0gxphblsLvdhSpSTtmu69ZG1Gkb6NuvxsNACwiPV6cNSZNzt0KPsw7g==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [arm64]
+    os: [win32]
+
+  '@img/sharp-win32-ia32@0.34.5':
+    resolution: {integrity: sha512-FV9m/7NmeCmSHDD5j4+4pNI8Cp3aW+JvLoXcTUo0IqyjSfAZJ8dIUmijx1qaJsIiU+Hosw6xM5KijAWRJCSgNg==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [ia32]
+    os: [win32]
+
+  '@img/sharp-win32-x64@0.34.5':
+    resolution: {integrity: sha512-+29YMsqY2/9eFEiW93eqWnuLcWcufowXewwSNIT6UwZdUUCrM3oFjMWH/Z6/TMmb4hlFenmfAVbpWeup2jryCw==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+    cpu: [x64]
+    os: [win32]
+
+  '@inquirer/external-editor@1.0.3':
+    resolution: {integrity: sha512-RWbSrDiYmO4LbejWY7ttpxczuwQyZLBUyygsA9Nsv95hpzUWwnNTVQmAq3xuh7vNwCp07UTmE5i11XAEExx4RA==}
+    engines: {node: '>=18'}
+    peerDependencies:
+      '@types/node': '>=18'
+    peerDependenciesMeta:
+      '@types/node':
+        optional: true
+
+  '@ioredis/commands@1.5.0':
+    resolution: {integrity: sha512-eUgLqrMf8nJkZxT24JvVRrQya1vZkQh8BBeYNwGDqa5I0VUi8ACx7uFvAaLxintokpTenkK6DASvo/bvNbBGow==}
+
+  '@isaacs/cliui@8.0.2':
+    resolution: {integrity: sha512-O8jcjabXaleOG9DQ0+ARXWZBTfnP4WNAqzuiJK7ll44AmxGKv/J2M4TPjxjY3znBCfvBXFzucm1twdyFybFqEA==}
+    engines: {node: '>=12'}
+
+  '@isaacs/fs-minipass@4.0.1':
+    resolution: {integrity: sha512-wgm9Ehl2jpeqP3zw/7mo3kRHFp5MEDhqAdwy1fTGkHAwnkGOVsgpvQhL8B5n1qlb01jV3n/bI0ZfZp5lWA1k4w==}
+    engines: {node: '>=18.0.0'}
+
+  '@jridgewell/gen-mapping@0.3.13':
+    resolution: {integrity: sha512-2kkt/7niJ6MgEPxF0bYdQ6etZaA+fQvDcLKckhy1yIQOzaoKjBBjSj63/aLVjYE3qhRt5dvM+uUyfCg6UKCBbA==}
+
+  '@jridgewell/remapping@2.3.5':
+    resolution: {integrity: sha512-LI9u/+laYG4Ds1TDKSJW2YPrIlcVYOwi2fUC6xB43lueCjgxV4lffOCZCtYFiH6TNOX+tQKXx97T4IKHbhyHEQ==}
+
+  '@jridgewell/resolve-uri@3.1.2':
+    resolution: {integrity: sha512-bRISgCIjP20/tbWSPWMEi54QVPRZExkuD9lJL+UIxUKtwVJA8wW1Trb1jMs1RFXo1CBTNZ/5hpC9QvmKWdopKw==}
+    engines: {node: '>=6.0.0'}
+
+  '@jridgewell/source-map@0.3.11':
+    resolution: {integrity: sha512-ZMp1V8ZFcPG5dIWnQLr3NSI1MiCU7UETdS/A0G8V/XWHvJv3ZsFqutJn1Y5RPmAPX6F3BiE397OqveU/9NCuIA==}
+
+  '@jridgewell/sourcemap-codec@1.5.5':
+    resolution: {integrity: sha512-cYQ9310grqxueWbl+WuIUIaiUaDcj7WOq5fVhEljNVgRfOUhY9fy2zTvfoqWsnebh8Sl70VScFbICvJnLKB0Og==}
+
+  '@jridgewell/trace-mapping@0.3.31':
+    resolution: {integrity: sha512-zzNR+SdQSDJzc8joaeP8QQoCQr8NuYx2dIIytl1QeBEZHJ9uW6hebsrYgbz8hJwUQao3TWCMtmfV8Nu1twOLAw==}
+
+  '@kwsites/file-exists@1.1.1':
+    resolution: {integrity: sha512-m9/5YGR18lIwxSFDwfE3oA7bWuq9kdau6ugN4H2rJeyhFQZcG9AgSHkQtSD15a8WvTgfz9aikZMrKPHvbpqFiw==}
+
+  '@kwsites/promise-deferred@1.1.1':
+    resolution: {integrity: sha512-GaHYm+c0O9MjZRu0ongGBRbinu8gVAMd2UZjji6jVmqKtZluZnptXGWhz1E8j8D2HJ3f/yMxKAUC0b+57wncIw==}
+
+  '@manypkg/find-root@1.1.0':
+    resolution: {integrity: sha512-mki5uBvhHzO8kYYix/WRy2WX8S3B5wdVSc9D6KcU5lQNglP2yt58/VfLuAK49glRXChosY8ap2oJ1qgma3GUVA==}
+
+  '@manypkg/get-packages@1.1.3':
+    resolution: {integrity: sha512-fo+QhuU3qE/2TQMQmbVMqaQ6EWbMhi4ABWP+O4AM1NqPBuy0OrApV5LO6BrrgnhtAHS2NH6RrVk9OL181tTi8A==}
+
+  '@mapbox/node-pre-gyp@2.0.3':
+    resolution: {integrity: sha512-uwPAhccfFJlsfCxMYTwOdVfOz3xqyj8xYL3zJj8f0pb30tLohnnFPhLuqp4/qoEz8sNxe4SESZedcBojRefIzg==}
+    engines: {node: '>=18'}
+    hasBin: true
+
+  '@napi-rs/wasm-runtime@0.2.12':
+    resolution: {integrity: sha512-ZVWUcfwY4E/yPitQJl481FjFo3K22D6qF0DuFH6Y/nbnE11GY5uguDxZMGXPQ8WQ0128MXQD7TnfHyK4oWoIJQ==}
+
+  '@napi-rs/wasm-runtime@1.1.1':
+    resolution: {integrity: sha512-p64ah1M1ld8xjWv3qbvFwHiFVWrq1yFvV4f7w+mzaqiR4IlSgkqhcRdHwsGgomwzBH51sRY4NEowLxnaBjcW/A==}
+
+  '@next/env@16.1.6':
+    resolution: {integrity: sha512-N1ySLuZjnAtN3kFnwhAwPvZah8RJxKasD7x1f8shFqhncnWZn4JMfg37diLNuoHsLAlrDfM3g4mawVdtAG8XLQ==}
+
+  '@next/eslint-plugin-next@16.1.6':
+    resolution: {integrity: sha512-/Qq3PTagA6+nYVfryAtQ7/9FEr/6YVyvOtl6rZnGsbReGLf0jZU6gkpr1FuChAQpvV46a78p4cmHOVP8mbfSMQ==}
+
+  '@next/swc-darwin-arm64@16.1.6':
+    resolution: {integrity: sha512-wTzYulosJr/6nFnqGW7FrG3jfUUlEf8UjGA0/pyypJl42ExdVgC6xJgcXQ+V8QFn6niSG2Pb8+MIG1mZr2vczw==}
+    engines: {node: '>= 10'}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@next/swc-darwin-x64@16.1.6':
+    resolution: {integrity: sha512-BLFPYPDO+MNJsiDWbeVzqvYd4NyuRrEYVB5k2N3JfWncuHAy2IVwMAOlVQDFjj+krkWzhY2apvmekMkfQR0CUQ==}
+    engines: {node: '>= 10'}
+    cpu: [x64]
+    os: [darwin]
+
+  '@next/swc-linux-arm64-gnu@16.1.6':
+    resolution: {integrity: sha512-OJYkCd5pj/QloBvoEcJ2XiMnlJkRv9idWA/j0ugSuA34gMT6f5b7vOiCQHVRpvStoZUknhl6/UxOXL4OwtdaBw==}
+    engines: {node: '>= 10'}
+    cpu: [arm64]
+    os: [linux]
+    libc: [glibc]
+
+  '@next/swc-linux-arm64-musl@16.1.6':
+    resolution: {integrity: sha512-S4J2v+8tT3NIO9u2q+S0G5KdvNDjXfAv06OhfOzNDaBn5rw84DGXWndOEB7d5/x852A20sW1M56vhC/tRVbccQ==}
+    engines: {node: '>= 10'}
+    cpu: [arm64]
+    os: [linux]
+    libc: [musl]
+
+  '@next/swc-linux-x64-gnu@16.1.6':
+    resolution: {integrity: sha512-2eEBDkFlMMNQnkTyPBhQOAyn2qMxyG2eE7GPH2WIDGEpEILcBPI/jdSv4t6xupSP+ot/jkfrCShLAa7+ZUPcJQ==}
+    engines: {node: '>= 10'}
+    cpu: [x64]
+    os: [linux]
+    libc: [glibc]
+
+  '@next/swc-linux-x64-musl@16.1.6':
+    resolution: {integrity: sha512-oicJwRlyOoZXVlxmIMaTq7f8pN9QNbdes0q2FXfRsPhfCi8n8JmOZJm5oo1pwDaFbnnD421rVU409M3evFbIqg==}
+    engines: {node: '>= 10'}
+    cpu: [x64]
+    os: [linux]
+    libc: [musl]
+
+  '@next/swc-win32-arm64-msvc@16.1.6':
+    resolution: {integrity: sha512-gQmm8izDTPgs+DCWH22kcDmuUp7NyiJgEl18bcr8irXA5N2m2O+JQIr6f3ct42GOs9c0h8QF3L5SzIxcYAAXXw==}
+    engines: {node: '>= 10'}
+    cpu: [arm64]
+    os: [win32]
+
+  '@next/swc-win32-x64-msvc@16.1.6':
+    resolution: {integrity: sha512-NRfO39AIrzBnixKbjuo2YiYhB6o9d8v/ymU9m/Xk8cyVk+k7XylniXkHwjs4s70wedVffc6bQNbufk5v0xEm0A==}
+    engines: {node: '>= 10'}
+    cpu: [x64]
+    os: [win32]
+
+  '@nodelib/fs.scandir@2.1.5':
+    resolution: {integrity: sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g==}
+    engines: {node: '>= 8'}
+
+  '@nodelib/fs.stat@2.0.5':
+    resolution: {integrity: sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A==}
+    engines: {node: '>= 8'}
+
+  '@nodelib/fs.walk@1.2.8':
+    resolution: {integrity: sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg==}
+    engines: {node: '>= 8'}
+
+  '@nolyfill/is-core-module@1.0.39':
+    resolution: {integrity: sha512-nn5ozdjYQpUCZlWGuxcJY/KpxkWQs4DcbMCmKojjyrYDEAGy4Ce19NN4v5MduafTwJlbKc99UA8YhSVqq9yPZA==}
+    engines: {node: '>=12.4.0'}
+
+  '@nuxt/cli@3.33.1':
+    resolution: {integrity: sha512-/sCrcI0WemING9zASaXPgPDY7PrQTPlRyCXlSgGx8VwRAkWbxGaPhIc3kZQikgLwVAwy+muWVV4Wks8OTtW5Tw==}
+    engines: {node: ^16.10.0 || >=18.0.0}
+    hasBin: true
+    peerDependencies:
+      '@nuxt/schema': ^4.3.0
+    peerDependenciesMeta:
+      '@nuxt/schema':
+        optional: true
+
+  '@nuxt/devalue@2.0.2':
+    resolution: {integrity: sha512-GBzP8zOc7CGWyFQS6dv1lQz8VVpz5C2yRszbXufwG/9zhStTIH50EtD87NmWbTMwXDvZLNg8GIpb1UFdH93JCA==}
+
+  '@nuxt/devtools-kit@3.2.1':
+    resolution: {integrity: sha512-lwCtTgqH2izU/d+mAmddnPG3mBaia9BsknxYkMFAPbxtph/ex5tPkmQjKACPQU5q4Tl5bTgWgZWo9pa3oz4LMQ==}
+    peerDependencies:
+      vite: '>=6.0'
+
+  '@nuxt/devtools-wizard@3.2.1':
+    resolution: {integrity: sha512-NKUg54cLQSDeBWaNwAPkVIpwXtd1CrxLr0inl9Z7OdLwsidqMrncNObO6K3HgV0PEdAcqY4IwE2hkON2dlRLYw==}
+    hasBin: true
+
+  '@nuxt/devtools@3.2.1':
+    resolution: {integrity: sha512-cujObmksivcE1AQJUKigJtybQ5FvnsfPIDWoepC8Tx+Nq57WFy1xM0qX4rPesRFvTxn7O6RaYQeXOh7U8a1WKQ==}
+    hasBin: true
+    peerDependencies:
+      '@vitejs/devtools': '*'
+      vite: '>=6.0'
+    peerDependenciesMeta:
+      '@vitejs/devtools':
+        optional: true
+
+  '@nuxt/kit@4.3.1':
+    resolution: {integrity: sha512-UjBFt72dnpc+83BV3OIbCT0YHLevJtgJCHpxMX0YRKWLDhhbcDdUse87GtsQBrjvOzK7WUNUYLDS/hQLYev5rA==}
+    engines: {node: '>=18.12.0'}
+
+  '@nuxt/nitro-server@4.3.1':
+    resolution: {integrity: sha512-4aNiM69Re02gI1ywnDND0m6QdVKXhWzDdtvl/16veytdHZj3FSq57ZCwOClNJ7HQkEMqXgS+bi6S2HmJX+et+g==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    peerDependencies:
+      nuxt: ^4.3.1
+
+  '@nuxt/schema@4.3.1':
+    resolution: {integrity: sha512-S+wHJdYDuyk9I43Ej27y5BeWMZgi7R/UVql3b3qtT35d0fbpXW7fUenzhLRCCDC6O10sjguc6fcMcR9sMKvV8g==}
+    engines: {node: ^14.18.0 || >=16.10.0}
+
+  '@nuxt/telemetry@2.7.0':
+    resolution: {integrity: sha512-mrKC3NjAlBOooLLVTYcIUie1meipoYq5vkoESoVTEWTB34T3a0QJzOfOPch+HYlUR+5Lqy1zLMv6epHFgYAKLA==}
+    engines: {node: '>=18.12.0'}
+    hasBin: true
+    peerDependencies:
+      '@nuxt/kit': '>=3.0.0'
+
+  '@nuxt/vite-builder@4.3.1':
+    resolution: {integrity: sha512-LndnxPJzDUDbWAB8q5gZZN1mSOLHEyMOoj4T3pTdPydGf31QZdMR0V1fQ1fdRgtgNtWB3WLP0d1ZfaAOITsUpw==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    peerDependencies:
+      nuxt: 4.3.1
+      rolldown: ^1.0.0-beta.38
+      vue: ^3.3.4
+    peerDependenciesMeta:
+      rolldown:
+        optional: true
+
+  '@oxc-minify/binding-android-arm-eabi@0.112.0':
+    resolution: {integrity: sha512-m7TGBR2hjsBJIN9UJ909KBoKsuogo6CuLsHKvUIBXdjI0JVHP8g4ZHeB+BJpGn5LJdeSGDfz9MWiuXrZDRzunw==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm]
+    os: [android]
+
+  '@oxc-minify/binding-android-arm64@0.112.0':
+    resolution: {integrity: sha512-RvxOOkzvP5NeeoraBtgNJSBqO+XzlS7DooxST/drAXCfO52GsmxVB1N7QmifrsTYtH8GC2z3DTFjZQ1w/AJOWg==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [android]
+
+  '@oxc-minify/binding-darwin-arm64@0.112.0':
+    resolution: {integrity: sha512-hDslO3uVHza3kB9zkcsi25JzN65Gj5ZYty0OvylS11Mhg9ydCYxAzfQ/tISHW/YmV1NRUJX8+GGqM1cKmrHaTA==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@oxc-minify/binding-darwin-x64@0.112.0':
+    resolution: {integrity: sha512-mWA2Y5bUyNoGM+gSGGHesgtQ3LDWgpRe4zDGkBDovxNIiDLBXqu/7QcuS+G918w8oG9VYm1q1iinILer/2pD1Q==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [x64]
+    os: [darwin]
+
+  '@oxc-minify/binding-freebsd-x64@0.112.0':
+    resolution: {integrity: sha512-T7fsegxcy82xS0jWPXkz/BMhrkb3D7YOCiV0R9pDksjaov+iIFoNEWAoBsaC5NtpdzkX+bmffwDpu336EIfEeg==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [x64]
+    os: [freebsd]
+
+  '@oxc-minify/binding-linux-arm-gnueabihf@0.112.0':
+    resolution: {integrity: sha512-yePavbIilAcpVYc8vRsDCn3xJxHMXDZIiamyH9fuLosAHNELcLib4/JR4fhDk4NmHVagQH3kRhsnm5Q9cm3pAw==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm]
+    os: [linux]
+
+  '@oxc-minify/binding-linux-arm-musleabihf@0.112.0':
+    resolution: {integrity: sha512-lmPWLXtW6FspERhy97iP0hwbmLtL66xI29QQ9GpHmTiE4k+zv/FaefuV/Qw+LuHnmFSYzUNrLcxh4ulOZTIP2g==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm]
+    os: [linux]
+
+  '@oxc-minify/binding-linux-arm64-gnu@0.112.0':
+    resolution: {integrity: sha512-gySS5XqU5MKs/oCjsTlVm8zb8lqcNKHEANsaRmhW2qvGKJoeGwFb6Fbq6TLCZMRuk143mLbncbverBCa1c3dog==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [linux]
+    libc: [glibc]
+
+  '@oxc-minify/binding-linux-arm64-musl@0.112.0':
+    resolution: {integrity: sha512-IRFMZX589lr3rjG0jc8N261/7wqFq2Vl0OMrJWeFls5BF8HiB+fRYuf0Zy2CyRH6NCY2vbdDdp+QCAavQGVsGw==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [linux]
+    libc: [musl]
+
+  '@oxc-minify/binding-linux-ppc64-gnu@0.112.0':
+    resolution: {integrity: sha512-V/69XqIW9hCUceDpcZh79oDg+F4ptEgIfKRENzYs41LRbSoJ7sNjjcW4zifqyviTvzcnXLgK4uoTyoymmNZBMQ==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [ppc64]
+    os: [linux]
+    libc: [glibc]
+
+  '@oxc-minify/binding-linux-riscv64-gnu@0.112.0':
+    resolution: {integrity: sha512-zghvexySyGXGNW+MutjZN7UGTyOQl56RWMlPe1gb+knBm/+0hf9qjk7Q6ofm2tSte+vQolPfQttifGl0dP9uvQ==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [riscv64]
+    os: [linux]
+    libc: [glibc]
+
+  '@oxc-minify/binding-linux-riscv64-musl@0.112.0':
+    resolution: {integrity: sha512-E4a8VUFDJPb2mPcc7J4NQQPi1ssHKF7/g4r6KD2+SBVERIaEEd3cGNqR7SG3g82/BLGV2UDoQe/WvZCkt5M/bQ==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [riscv64]
+    os: [linux]
+    libc: [musl]
+
+  '@oxc-minify/binding-linux-s390x-gnu@0.112.0':
+    resolution: {integrity: sha512-2Hx87sK3y6jBV364Mvv0zyxiITIuy26Ixenv6pK7e+4an3HgNdhAj8nk3aLoLTTSvLik5/MaGhcZGEu9tYV1aA==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [s390x]
+    os: [linux]
+    libc: [glibc]
+
+  '@oxc-minify/binding-linux-x64-gnu@0.112.0':
+    resolution: {integrity: sha512-2MSCnEPLk9ddSouMhJo78Xy2/JbYC80OYzWdR4yWTGSULsgH3d1VXg73DSwFL8vU7Ad9oK10DioBY2ww7sQTEg==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [x64]
+    os: [linux]
+    libc: [glibc]
+
+  '@oxc-minify/binding-linux-x64-musl@0.112.0':
+    resolution: {integrity: sha512-HAPfmQKlkVi97/zRonVE9t/kKUG3ni+mOuU1Euw+3s37KwUuOJjmcwXdclVgXKBlTkCGO0FajPwW5dAJeIXCCw==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [x64]
+    os: [linux]
+    libc: [musl]
+
+  '@oxc-minify/binding-openharmony-arm64@0.112.0':
+    resolution: {integrity: sha512-bLnMojcPadYzMNpB6IAqMiTOag4etc0zbs8On73JsotO1W5c5/j/ncplpSokpEpNasKRUpHVRXpmq0KRXprNhw==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [openharmony]
+
+  '@oxc-minify/binding-wasm32-wasi@0.112.0':
+    resolution: {integrity: sha512-tv7PmHYq/8QBlqMaDjsy51GF5KQkG17Yc/PsgB5OVndU34kwbQuebBIic7UfK9ygzidI8moYq3ztnu3za/rqHw==}
+    engines: {node: '>=14.0.0'}
+    cpu: [wasm32]
+
+  '@oxc-minify/binding-win32-arm64-msvc@0.112.0':
+    resolution: {integrity: sha512-d+jes2jwRkcBSpcaZC6cL8GBi56Br6uAorn9dfquhWLczWL+hHSvvVrRgT1i5/6dkf5UWx2zdoEsAMiJ11w78A==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [win32]
+
+  '@oxc-minify/binding-win32-ia32-msvc@0.112.0':
+    resolution: {integrity: sha512-TV1C3qDwj7//jNIi5tnNRhReSUgtaRQKi5KobDE6zVAc5gjeuBA8G2qizS9ziXlf/I0dlelrGmGMMDJmH9ekWg==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [ia32]
+    os: [win32]
+
+  '@oxc-minify/binding-win32-x64-msvc@0.112.0':
+    resolution: {integrity: sha512-LML2Gld6VY8/+7a3VH4k1qngsBXvTkXgbmYgSYwaElqtiQiYaAcXfi0XKOUGe3k3GbBK4juAGixC31CrdFHAQw==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [x64]
+    os: [win32]
+
+  '@oxc-parser/binding-android-arm-eabi@0.112.0':
+    resolution: {integrity: sha512-retxBzJ39Da7Lh/eZTn9+HJgTeDUxZIpuI0urOsmcFsBKXAth3lc1jIvwseQ9qbAI/VrsoFOXiGIzgclARbAHg==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm]
+    os: [android]
+
+  '@oxc-parser/binding-android-arm64@0.112.0':
+    resolution: {integrity: sha512-pRkbBRbuIIsufUWpOJ+JHWfJFNupkidy4sbjfcm37e6xwYrn9LSKMLubPHvNaL1Zf92ZRhGiwaYkEcmaFg2VcA==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [android]
+
+  '@oxc-parser/binding-darwin-arm64@0.112.0':
+    resolution: {integrity: sha512-fh6/KQL/cbH5DukT3VkdCqnULLuvVnszVKySD5IgSE0WZb32YZo/cPsPdEv052kk6w3N4agu+NTiMnZjcvhUIg==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@oxc-parser/binding-darwin-x64@0.112.0':
+    resolution: {integrity: sha512-vUBOOY1E30vlu/DoTGDoT1UbLlwu5Yv9tqeBabAwRzwNDz8Skho16VKhsBDUiyqddtpsR3//v6vNk38w4c+6IA==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [x64]
+    os: [darwin]
+
+  '@oxc-parser/binding-freebsd-x64@0.112.0':
+    resolution: {integrity: sha512-hnEtO/9AVnYWzrgnp6L+oPs/6UqlFeteUL6n7magkd2tttgmx1C01hyNNh6nTpZfLzEVJSNJ0S+4NTsK2q2CxA==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [x64]
+    os: [freebsd]
+
+  '@oxc-parser/binding-linux-arm-gnueabihf@0.112.0':
+    resolution: {integrity: sha512-WxJrUz3pcIc2hp4lvJbvt/sTL33oX9NPvkD3vDDybE6tc0V++rS+hNOJxwXdD2FDIFPkHs/IEn5asEZFVH+VKw==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm]
+    os: [linux]
+
+  '@oxc-parser/binding-linux-arm-musleabihf@0.112.0':
+    resolution: {integrity: sha512-jj8A8WWySaJQqM9XKAIG8U2Q3qxhFQKrXPWv98d1oC35at+L1h+C+V4M3l8BAKhpHKCu3dYlloaAbHd5q1Hw6A==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm]
+    os: [linux]
+
+  '@oxc-parser/binding-linux-arm64-gnu@0.112.0':
+    resolution: {integrity: sha512-G2F8H6FcAExVK5vvhpSh61tqWx5QoaXXUnSsj5FyuDiFT/K7AMMVSQVqnZREDc+YxhrjB0vnKjCcuobXK63kIw==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [linux]
+    libc: [glibc]
+
+  '@oxc-parser/binding-linux-arm64-musl@0.112.0':
+    resolution: {integrity: sha512-3R0iqjM3xYOZCnwgcxOQXH7hrz64/USDIuLbNTM1kZqQzRqaR4w7SwoWKU934zABo8d0op2oSwOp+CV3hZnM7A==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [linux]
+    libc: [musl]
+
+  '@oxc-parser/binding-linux-ppc64-gnu@0.112.0':
+    resolution: {integrity: sha512-lAQf8PQxfgy7h0bmcfSVE3hg3qMueshPYULFsCrHM+8KefGZ9W+ZMvRyU33gLrB4w1O3Fz1orR0hmKMCRxXNrQ==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [ppc64]
+    os: [linux]
+    libc: [glibc]
+
+  '@oxc-parser/binding-linux-riscv64-gnu@0.112.0':
+    resolution: {integrity: sha512-2QlvQBUhHuAE3ezD4X3CAEKMXdfgInggQ5Bj/7gb5NcYP3GyfLTj7c+mMu+BRwfC9B3AXBNyqHWbqEuuUvZyRQ==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [riscv64]
+    os: [linux]
+    libc: [glibc]
+
+  '@oxc-parser/binding-linux-riscv64-musl@0.112.0':
+    resolution: {integrity: sha512-v06iu0osHszgqJ1dLQRb6leWFU1sjG/UQk4MoVBtE6ZPewgfTkby6G9II1SpEAf2onnAuQceVYxQH9iuU3NJqw==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [riscv64]
+    os: [linux]
+    libc: [musl]
+
+  '@oxc-parser/binding-linux-s390x-gnu@0.112.0':
+    resolution: {integrity: sha512-+5HhNHtxsdcd7+ljXFnn9FOoCNXJX3UPgIfIE6vdwS1HqdGNH6eAcVobuqGOp54l8pvcxDQA6F4cPswCgLrQfQ==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [s390x]
+    os: [linux]
+    libc: [glibc]
+
+  '@oxc-parser/binding-linux-x64-gnu@0.112.0':
+    resolution: {integrity: sha512-jKwO7ZLNkjxwg7FoCLw+fJszooL9yXRZsDN0AQ1AQUTWq1l8GH/2e44k68N3fcP19jl8O8jGpqLAZcQTYk6skA==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [x64]
+    os: [linux]
+    libc: [glibc]
+
+  '@oxc-parser/binding-linux-x64-musl@0.112.0':
+    resolution: {integrity: sha512-TYqnuKV/p3eOc+N61E0961nA7DC+gaCeJ3+V2LcjJdTwFMdikqWL6uVk1jlrpUCBrozHDATVUKDZYH7r4FQYjQ==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [x64]
+    os: [linux]
+    libc: [musl]
+
+  '@oxc-parser/binding-openharmony-arm64@0.112.0':
+    resolution: {integrity: sha512-ZhrVmWFifVEFQX4XPwLoVFDHw9tAWH9p9vHsHFH+5uCKdfVR+jje4WxVo6YrokWCboGckoOzHq5KKMOcPZfkRg==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [openharmony]
+
+  '@oxc-parser/binding-wasm32-wasi@0.112.0':
+    resolution: {integrity: sha512-Gr8X2PUU3hX1g3F5oLWIZB8DhzDmjr5TfOrmn5tlBOo9l8ojPGdKjnIBfObM7X15928vza8QRKW25RTR7jfivg==}
+    engines: {node: '>=14.0.0'}
+    cpu: [wasm32]
+
+  '@oxc-parser/binding-win32-arm64-msvc@0.112.0':
+    resolution: {integrity: sha512-t5CDLbU70Ea88bGRhvU/dLJTc/Wcrtf2Jp534E8P3cgjAvHDjdKsfDDqBZrhybJ8Jv9v9vW5ngE40EK51BluDA==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [win32]
+
+  '@oxc-parser/binding-win32-ia32-msvc@0.112.0':
+    resolution: {integrity: sha512-rZH0JynCCwnhe2HfRoyNOl/Kfd9pudoWxgpC5OZhj7j77pMK0UOAa35hYDfrtSOUk2HLzrikV5dPUOY2DpSBSA==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [ia32]
+    os: [win32]
+
+  '@oxc-parser/binding-win32-x64-msvc@0.112.0':
+    resolution: {integrity: sha512-oGHluohzmVFAuQrkEnl1OXAxMz2aYmimxUqIgKXpBgbr7PvFv0doELB273sX+5V3fKeggohKg1A2Qq21W9Z9cQ==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [x64]
+    os: [win32]
+
+  '@oxc-project/types@0.112.0':
+    resolution: {integrity: sha512-m6RebKHIRsax2iCwVpYW2ErQwa4ywHJrE4sCK3/8JK8ZZAWOKXaRJFl/uP51gaVyyXlaS4+chU1nSCdzYf6QqQ==}
+
+  '@oxc-transform/binding-android-arm-eabi@0.112.0':
+    resolution: {integrity: sha512-r4LuBaPnOAi0eUOBNi880Fm2tO2omH7N1FRrL6+nyz/AjQ+QPPLtoyZJva0O+sKi1buyN/7IzM5p9m+5ANSDbg==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm]
+    os: [android]
+
+  '@oxc-transform/binding-android-arm64@0.112.0':
+    resolution: {integrity: sha512-ve46vQcQrY8eGe8990VSlS9gkD+AogJqbtfOkeua+5sQGQTDgeIRRxOm7ktCo19uZc2bEBwXRJITgosd+NRVmQ==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [android]
+
+  '@oxc-transform/binding-darwin-arm64@0.112.0':
+    resolution: {integrity: sha512-ddbmLU3Tr+i7MOynfwAXxUXud3SjJKlv7XNjaq08qiI8Av/QvhXVGc2bMhXkWQSMSBUeTDoiughKjK+Zsb6y/A==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@oxc-transform/binding-darwin-x64@0.112.0':
+    resolution: {integrity: sha512-TKvmNw96jQZPqYb4pRrzLFDailNB3YS14KNn+x2hwRbqc6CqY96S9PYwyOpVpYdxfoRjYO9WgX9SoS+62a1DPA==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [x64]
+    os: [darwin]
+
+  '@oxc-transform/binding-freebsd-x64@0.112.0':
+    resolution: {integrity: sha512-YPMkSCDaelO8HHYRMYjm+Q+IfkfIbdtQzwPuasItYkq8UUkNeHNPheNh2JkvQa3c+io3E9ePOgHQ2yihpk7o/Q==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [x64]
+    os: [freebsd]
+
+  '@oxc-transform/binding-linux-arm-gnueabihf@0.112.0':
+    resolution: {integrity: sha512-nA7kzQGNEpuTRknst/IJ3l8hqmDmEda3aun6jkXgp7gKxESjuHeaNH04mKISxvJ7fIacvP2g/wtTSnm4u5jL8Q==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm]
+    os: [linux]
+
+  '@oxc-transform/binding-linux-arm-musleabihf@0.112.0':
+    resolution: {integrity: sha512-w8GuLmckKlGc3YujaZKhtbFxziCcosvM2l9GnQjCb/yENWLGDiyQOy0BTAgPGdJwpYTiOeJblEXSuXYvlE1Ong==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm]
+    os: [linux]
+
+  '@oxc-transform/binding-linux-arm64-gnu@0.112.0':
+    resolution: {integrity: sha512-9LwwGnJ8+WT0rXcrI8M0RJtDNt91eMqcDPPEvJxhRFHIMcHTy5D5xT+fOl3Us0yMqKo3HUWkbfUYqAp4GoZ3Jw==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [linux]
+    libc: [glibc]
+
+  '@oxc-transform/binding-linux-arm64-musl@0.112.0':
+    resolution: {integrity: sha512-Lg6VOuSd3oXv7J0eGywgqh/086h+qQzIBOD+47pYKMTTJcbDe+f3h/RgGoMKJE5HhiwT5sH1aGEJfIfaYUiVSw==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [linux]
+    libc: [musl]
+
+  '@oxc-transform/binding-linux-ppc64-gnu@0.112.0':
+    resolution: {integrity: sha512-PXzmj82o1moA4IGphYImTRgc2youTi4VRfyFX3CHwLjxPcQ5JtcsgbDt4QUdOzXZ+zC07s5jf2ZzhRapEOlj2w==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [ppc64]
+    os: [linux]
+    libc: [glibc]
+
+  '@oxc-transform/binding-linux-riscv64-gnu@0.112.0':
+    resolution: {integrity: sha512-vhJsMsVH/6xwa3bt1LGts33FXUkGjaEGDwsRyp4lIfOjSfQVWMtCmWMFNaA0dW9FVWdD2Gt2fSFBSZ+azDxlpg==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [riscv64]
+    os: [linux]
+    libc: [glibc]
+
+  '@oxc-transform/binding-linux-riscv64-musl@0.112.0':
+    resolution: {integrity: sha512-cXWFb7z+2IjFUEcXtRwluq9oEG5qnyFCjiu3SWrgYNcWwPdHusv3I/7K5/CTbbi4StoZ5txbi7/iSfDHNyWuRw==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [riscv64]
+    os: [linux]
+    libc: [musl]
+
+  '@oxc-transform/binding-linux-s390x-gnu@0.112.0':
+    resolution: {integrity: sha512-eEFu4SRqJTJ20/88KRWmp+jpHKAw0Y1DsnSgpEeXyBIIcsOaLIUMU/TfYWUmqRbvbMV9rmOmI3kp5xWYUq6kSQ==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [s390x]
+    os: [linux]
+    libc: [glibc]
+
+  '@oxc-transform/binding-linux-x64-gnu@0.112.0':
+    resolution: {integrity: sha512-ST1MDT+TlOyZ1c5btrGinRSUW2Jf4Pa+0gdKwsyjDSOC3dxy2ZNkN3mosTf4ywc3J+mxfYKqtjs7zSwHz03ILA==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [x64]
+    os: [linux]
+    libc: [glibc]
+
+  '@oxc-transform/binding-linux-x64-musl@0.112.0':
+    resolution: {integrity: sha512-ISQoA3pD4cyTGpf9sXXeerH6pL2L6EIpdy6oAy2ttkswyVFDyQNVOVIGIdLZDgbpmqGljxZnWqt/J/N68pQaig==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [x64]
+    os: [linux]
+    libc: [musl]
+
+  '@oxc-transform/binding-openharmony-arm64@0.112.0':
+    resolution: {integrity: sha512-UOGVrGIv7yLJovyEXEyUTADuLq98vd/cbMHFLJweRXD+11I8Tn4jASi4WzdsN8C3BVYGRHrXH2NlSBmhz33a4g==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [openharmony]
+
+  '@oxc-transform/binding-wasm32-wasi@0.112.0':
+    resolution: {integrity: sha512-XIX7Gpq9koAvzBVHDlVFHM79r5uOVK6kTEsdsN4qaajpjkgtv4tdsAOKIYK6l7fUbsbE6xS+6w1+yRFrDeC1kg==}
+    engines: {node: '>=14.0.0'}
+    cpu: [wasm32]
+
+  '@oxc-transform/binding-win32-arm64-msvc@0.112.0':
+    resolution: {integrity: sha512-EgXef9kOne9BNsbYBbuRqxk2hteT0xsAGcx/VbtCBMJYNj8fANFhT271DUSOgfa4DAgrQQmsyt/Kr1aV9mpU9w==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [arm64]
+    os: [win32]
+
+  '@oxc-transform/binding-win32-ia32-msvc@0.112.0':
+    resolution: {integrity: sha512-6QaB0qjNaou2YR+blncHdw7j0e26IOwOIjLbhVGDeuf9+4rjJeiqRXJ2hOtCcS4zblnao/MjdgQuZ3fM0nl+Kw==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [ia32]
+    os: [win32]
+
+  '@oxc-transform/binding-win32-x64-msvc@0.112.0':
+    resolution: {integrity: sha512-FRKYlY959QeqRPx9kXs0HjU2xuXPT1cdF+vvA200D9uAX/KLcC34MwRqUKTYml4kCc2Vf/P2pBR9cQuBm3zECQ==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    cpu: [x64]
+    os: [win32]
+
+  '@parcel/watcher-android-arm64@2.5.6':
+    resolution: {integrity: sha512-YQxSS34tPF/6ZG7r/Ih9xy+kP/WwediEUsqmtf0cuCV5TPPKw/PQHRhueUo6JdeFJaqV3pyjm0GdYjZotbRt/A==}
+    engines: {node: '>= 10.0.0'}
+    cpu: [arm64]
+    os: [android]
+
+  '@parcel/watcher-darwin-arm64@2.5.6':
+    resolution: {integrity: sha512-Z2ZdrnwyXvvvdtRHLmM4knydIdU9adO3D4n/0cVipF3rRiwP+3/sfzpAwA/qKFL6i1ModaabkU7IbpeMBgiVEA==}
+    engines: {node: '>= 10.0.0'}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@parcel/watcher-darwin-x64@2.5.6':
+    resolution: {integrity: sha512-HgvOf3W9dhithcwOWX9uDZyn1lW9R+7tPZ4sug+NGrGIo4Rk1hAXLEbcH1TQSqxts0NYXXlOWqVpvS1SFS4fRg==}
+    engines: {node: '>= 10.0.0'}
+    cpu: [x64]
+    os: [darwin]
+
+  '@parcel/watcher-freebsd-x64@2.5.6':
+    resolution: {integrity: sha512-vJVi8yd/qzJxEKHkeemh7w3YAn6RJCtYlE4HPMoVnCpIXEzSrxErBW5SJBgKLbXU3WdIpkjBTeUNtyBVn8TRng==}
+    engines: {node: '>= 10.0.0'}
+    cpu: [x64]
+    os: [freebsd]
+
+  '@parcel/watcher-linux-arm-glibc@2.5.6':
+    resolution: {integrity: sha512-9JiYfB6h6BgV50CCfasfLf/uvOcJskMSwcdH1PHH9rvS1IrNy8zad6IUVPVUfmXr+u+Km9IxcfMLzgdOudz9EQ==}
+    engines: {node: '>= 10.0.0'}
+    cpu: [arm]
+    os: [linux]
+    libc: [glibc]
+
+  '@parcel/watcher-linux-arm-musl@2.5.6':
+    resolution: {integrity: sha512-Ve3gUCG57nuUUSyjBq/MAM0CzArtuIOxsBdQ+ftz6ho8n7s1i9E1Nmk/xmP323r2YL0SONs1EuwqBp2u1k5fxg==}
+    engines: {node: '>= 10.0.0'}
+    cpu: [arm]
+    os: [linux]
+    libc: [musl]
+
+  '@parcel/watcher-linux-arm64-glibc@2.5.6':
+    resolution: {integrity: sha512-f2g/DT3NhGPdBmMWYoxixqYr3v/UXcmLOYy16Bx0TM20Tchduwr4EaCbmxh1321TABqPGDpS8D/ggOTaljijOA==}
+    engines: {node: '>= 10.0.0'}
+    cpu: [arm64]
+    os: [linux]
+    libc: [glibc]
+
+  '@parcel/watcher-linux-arm64-musl@2.5.6':
+    resolution: {integrity: sha512-qb6naMDGlbCwdhLj6hgoVKJl2odL34z2sqkC7Z6kzir8b5W65WYDpLB6R06KabvZdgoHI/zxke4b3zR0wAbDTA==}
+    engines: {node: '>= 10.0.0'}
+    cpu: [arm64]
+    os: [linux]
+    libc: [musl]
+
+  '@parcel/watcher-linux-x64-glibc@2.5.6':
+    resolution: {integrity: sha512-kbT5wvNQlx7NaGjzPFu8nVIW1rWqV780O7ZtkjuWaPUgpv2NMFpjYERVi0UYj1msZNyCzGlaCWEtzc+exjMGbQ==}
+    engines: {node: '>= 10.0.0'}
+    cpu: [x64]
+    os: [linux]
+    libc: [glibc]
+
+  '@parcel/watcher-linux-x64-musl@2.5.6':
+    resolution: {integrity: sha512-1JRFeC+h7RdXwldHzTsmdtYR/Ku8SylLgTU/reMuqdVD7CtLwf0VR1FqeprZ0eHQkO0vqsbvFLXUmYm/uNKJBg==}
+    engines: {node: '>= 10.0.0'}
+    cpu: [x64]
+    os: [linux]
+    libc: [musl]
+
+  '@parcel/watcher-wasm@2.3.0':
+    resolution: {integrity: sha512-ejBAX8H0ZGsD8lSICDNyMbSEtPMWgDL0WFCt/0z7hyf5v8Imz4rAM8xY379mBsECkq/Wdqa5WEDLqtjZ+6NxfA==}
+    engines: {node: '>= 10.0.0'}
+    bundledDependencies:
+      - napi-wasm
+
+  '@parcel/watcher-wasm@2.5.6':
+    resolution: {integrity: sha512-byAiBZ1t3tXQvc8dMD/eoyE7lTXYorhn+6uVW5AC+JGI1KtJC/LvDche5cfUE+qiefH+Ybq0bUCJU0aB1cSHUA==}
+    engines: {node: '>= 10.0.0'}
+    bundledDependencies:
+      - napi-wasm
+
+  '@parcel/watcher-win32-arm64@2.5.6':
+    resolution: {integrity: sha512-3ukyebjc6eGlw9yRt678DxVF7rjXatWiHvTXqphZLvo7aC5NdEgFufVwjFfY51ijYEWpXbqF5jtrK275z52D4Q==}
+    engines: {node: '>= 10.0.0'}
+    cpu: [arm64]
+    os: [win32]
+
+  '@parcel/watcher-win32-ia32@2.5.6':
+    resolution: {integrity: sha512-k35yLp1ZMwwee3Ez/pxBi5cf4AoBKYXj00CZ80jUz5h8prpiaQsiRPKQMxoLstNuqe2vR4RNPEAEcjEFzhEz/g==}
+    engines: {node: '>= 10.0.0'}
+    cpu: [ia32]
+    os: [win32]
+
+  '@parcel/watcher-win32-x64@2.5.6':
+    resolution: {integrity: sha512-hbQlYcCq5dlAX9Qx+kFb0FHue6vbjlf0FrNzSKdYK2APUf7tGfGxQCk2ihEREmbR6ZMc0MVAD5RIX/41gpUzTw==}
+    engines: {node: '>= 10.0.0'}
+    cpu: [x64]
+    os: [win32]
+
+  '@parcel/watcher@2.5.6':
+    resolution: {integrity: sha512-tmmZ3lQxAe/k/+rNnXQRawJ4NjxO2hqiOLTHvWchtGZULp4RyFeh6aU4XdOYBFe2KE1oShQTv4AblOs2iOrNnQ==}
+    engines: {node: '>= 10.0.0'}
+
+  '@pkgjs/parseargs@0.11.0':
+    resolution: {integrity: sha512-+1VkjdD0QBLPodGrJUeqarH8VAIvQODIbwh9XpP5Syisf7YoQgsJKPNFoqqLQlu+VQ/tVSshMR6loPMn8U+dPg==}
+    engines: {node: '>=14'}
+
+  '@playwright/test@1.58.2':
+    resolution: {integrity: sha512-akea+6bHYBBfA9uQqSYmlJXn61cTa+jbO87xVLCWbTqbWadRVmhxlXATaOjOgcBaWU4ePo0wB41KMFv3o35IXA==}
+    engines: {node: '>=18'}
+    hasBin: true
+
+  '@polka/url@1.0.0-next.29':
+    resolution: {integrity: sha512-wwQAWhWSuHaag8c4q/KN/vCoeOJYshAIvMQwD4GpSb3OiZklFfvAgmj0VCBBImRpuF/aFgIRzllXlVX93Jevww==}
+
+  '@poppinss/colors@4.1.6':
+    resolution: {integrity: sha512-H9xkIdFswbS8n1d6vmRd8+c10t2Qe+rZITbbDHHkQixH5+2x1FDGmi/0K+WgWiqQFKPSlIYB7jlH6Kpfn6Fleg==}
+
+  '@poppinss/dumper@0.6.5':
+    resolution: {integrity: sha512-NBdYIb90J7LfOI32dOewKI1r7wnkiH6m920puQ3qHUeZkxNkQiFnXVWoE6YtFSv6QOiPPf7ys6i+HWWecDz7sw==}
+
+  '@poppinss/exception@1.2.3':
+    resolution: {integrity: sha512-dCED+QRChTVatE9ibtoaxc+WkdzOSjYTKi/+uacHWIsfodVfpsueo3+DKpgU5Px8qXjgmXkSvhXvSCz3fnP9lw==}
+
+  '@rolldown/pluginutils@1.0.0-rc.2':
+    resolution: {integrity: sha512-izyXV/v+cHiRfozX62W9htOAvwMo4/bXKDrQ+vom1L1qRuexPock/7VZDAhnpHCLNejd3NJ6hiab+tO0D44Rgw==}
+
+  '@rolldown/pluginutils@1.0.0-rc.3':
+    resolution: {integrity: sha512-eybk3TjzzzV97Dlj5c+XrBFW57eTNhzod66y9HrBlzJ6NsCrWCp/2kaPS3K9wJmurBC0Tdw4yPjXKZqlznim3Q==}
+
+  '@rolldown/pluginutils@1.0.0-rc.5':
+    resolution: {integrity: sha512-RxlLX/DPoarZ9PtxVrQgZhPoor987YtKQqCo5zkjX+0S0yLJ7Vv515Wk6+xtTL67VONKJKxETWZwuZjss2idYw==}
+
+  '@rollup/plugin-alias@6.0.0':
+    resolution: {integrity: sha512-tPCzJOtS7uuVZd+xPhoy5W4vThe6KWXNmsFCNktaAh5RTqcLiSfT4huPQIXkgJ6YCOjJHvecOAzQxLFhPxKr+g==}
+    engines: {node: '>=20.19.0'}
+    peerDependencies:
+      rollup: '>=4.0.0'
+    peerDependenciesMeta:
+      rollup:
+        optional: true
+
+  '@rollup/plugin-commonjs@29.0.0':
+    resolution: {integrity: sha512-U2YHaxR2cU/yAiwKJtJRhnyLk7cifnQw0zUpISsocBDoHDJn+HTV74ABqnwr5bEgWUwFZC9oFL6wLe21lHu5eQ==}
+    engines: {node: '>=16.0.0 || 14 >= 14.17'}
+    peerDependencies:
+      rollup: ^2.68.0||^3.0.0||^4.0.0
+    peerDependenciesMeta:
+      rollup:
+        optional: true
+
+  '@rollup/plugin-inject@5.0.5':
+    resolution: {integrity: sha512-2+DEJbNBoPROPkgTDNe8/1YXWcqxbN5DTjASVIOx8HS+pITXushyNiBV56RB08zuptzz8gT3YfkqriTBVycepg==}
+    engines: {node: '>=14.0.0'}
+    peerDependencies:
+      rollup: ^1.20.0||^2.0.0||^3.0.0||^4.0.0
+    peerDependenciesMeta:
+      rollup:
+        optional: true
+
+  '@rollup/plugin-json@6.1.0':
+    resolution: {integrity: sha512-EGI2te5ENk1coGeADSIwZ7G2Q8CJS2sF120T7jLw4xFw9n7wIOXHo+kIYRAoVpJAN+kmqZSoO3Fp4JtoNF4ReA==}
+    engines: {node: '>=14.0.0'}
+    peerDependencies:
+      rollup: ^1.20.0||^2.0.0||^3.0.0||^4.0.0
+    peerDependenciesMeta:
+      rollup:
+        optional: true
+
+  '@rollup/plugin-node-resolve@16.0.3':
+    resolution: {integrity: sha512-lUYM3UBGuM93CnMPG1YocWu7X802BrNF3jW2zny5gQyLQgRFJhV1Sq0Zi74+dh/6NBx1DxFC4b4GXg9wUCG5Qg==}
+    engines: {node: '>=14.0.0'}
+    peerDependencies:
+      rollup: ^2.78.0||^3.0.0||^4.0.0
+    peerDependenciesMeta:
+      rollup:
+        optional: true
+
+  '@rollup/plugin-replace@6.0.3':
+    resolution: {integrity: sha512-J4RZarRvQAm5IF0/LwUUg+obsm+xZhYnbMXmXROyoSE1ATJe3oXSb9L5MMppdxP2ylNSjv6zFBwKYjcKMucVfA==}
+    engines: {node: '>=14.0.0'}
+    peerDependencies:
+      rollup: ^1.20.0||^2.0.0||^3.0.0||^4.0.0
+    peerDependenciesMeta:
+      rollup:
+        optional: true
+
+  '@rollup/plugin-terser@0.4.4':
+    resolution: {integrity: sha512-XHeJC5Bgvs8LfukDwWZp7yeqin6ns8RTl2B9avbejt6tZqsqvVoWI7ZTQrcNsfKEDWBTnTxM8nMDkO2IFFbd0A==}
+    engines: {node: '>=14.0.0'}
+    peerDependencies:
+      rollup: ^2.0.0||^3.0.0||^4.0.0
+    peerDependenciesMeta:
+      rollup:
+        optional: true
+
+  '@rollup/pluginutils@5.3.0':
+    resolution: {integrity: sha512-5EdhGZtnu3V88ces7s53hhfK5KSASnJZv8Lulpc04cWO3REESroJXg73DFsOmgbU2BhwV0E20bu2IDZb3VKW4Q==}
+    engines: {node: '>=14.0.0'}
+    peerDependencies:
+      rollup: ^1.20.0||^2.0.0||^3.0.0||^4.0.0
+    peerDependenciesMeta:
+      rollup:
+        optional: true
+
+  '@rollup/rollup-android-arm-eabi@4.57.1':
+    resolution: {integrity: sha512-A6ehUVSiSaaliTxai040ZpZ2zTevHYbvu/lDoeAteHI8QnaosIzm4qwtezfRg1jOYaUmnzLX1AOD6Z+UJjtifg==}
+    cpu: [arm]
+    os: [android]
+
+  '@rollup/rollup-android-arm64@4.57.1':
+    resolution: {integrity: sha512-dQaAddCY9YgkFHZcFNS/606Exo8vcLHwArFZ7vxXq4rigo2bb494/xKMMwRRQW6ug7Js6yXmBZhSBRuBvCCQ3w==}
+    cpu: [arm64]
+    os: [android]
+
+  '@rollup/rollup-darwin-arm64@4.57.1':
+    resolution: {integrity: sha512-crNPrwJOrRxagUYeMn/DZwqN88SDmwaJ8Cvi/TN1HnWBU7GwknckyosC2gd0IqYRsHDEnXf328o9/HC6OkPgOg==}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@rollup/rollup-darwin-x64@4.57.1':
+    resolution: {integrity: sha512-Ji8g8ChVbKrhFtig5QBV7iMaJrGtpHelkB3lsaKzadFBe58gmjfGXAOfI5FV0lYMH8wiqsxKQ1C9B0YTRXVy4w==}
+    cpu: [x64]
+    os: [darwin]
+
+  '@rollup/rollup-freebsd-arm64@4.57.1':
+    resolution: {integrity: sha512-R+/WwhsjmwodAcz65guCGFRkMb4gKWTcIeLy60JJQbXrJ97BOXHxnkPFrP+YwFlaS0m+uWJTstrUA9o+UchFug==}
+    cpu: [arm64]
+    os: [freebsd]
+
+  '@rollup/rollup-freebsd-x64@4.57.1':
+    resolution: {integrity: sha512-IEQTCHeiTOnAUC3IDQdzRAGj3jOAYNr9kBguI7MQAAZK3caezRrg0GxAb6Hchg4lxdZEI5Oq3iov/w/hnFWY9Q==}
+    cpu: [x64]
+    os: [freebsd]
+
+  '@rollup/rollup-linux-arm-gnueabihf@4.57.1':
+    resolution: {integrity: sha512-F8sWbhZ7tyuEfsmOxwc2giKDQzN3+kuBLPwwZGyVkLlKGdV1nvnNwYD0fKQ8+XS6hp9nY7B+ZeK01EBUE7aHaw==}
+    cpu: [arm]
+    os: [linux]
+    libc: [glibc]
+
+  '@rollup/rollup-linux-arm-musleabihf@4.57.1':
+    resolution: {integrity: sha512-rGfNUfn0GIeXtBP1wL5MnzSj98+PZe/AXaGBCRmT0ts80lU5CATYGxXukeTX39XBKsxzFpEeK+Mrp9faXOlmrw==}
+    cpu: [arm]
+    os: [linux]
+    libc: [musl]
+
+  '@rollup/rollup-linux-arm64-gnu@4.57.1':
+    resolution: {integrity: sha512-MMtej3YHWeg/0klK2Qodf3yrNzz6CGjo2UntLvk2RSPlhzgLvYEB3frRvbEF2wRKh1Z2fDIg9KRPe1fawv7C+g==}
+    cpu: [arm64]
+    os: [linux]
+    libc: [glibc]
+
+  '@rollup/rollup-linux-arm64-musl@4.57.1':
+    resolution: {integrity: sha512-1a/qhaaOXhqXGpMFMET9VqwZakkljWHLmZOX48R0I/YLbhdxr1m4gtG1Hq7++VhVUmf+L3sTAf9op4JlhQ5u1Q==}
+    cpu: [arm64]
+    os: [linux]
+    libc: [musl]
+
+  '@rollup/rollup-linux-loong64-gnu@4.57.1':
+    resolution: {integrity: sha512-QWO6RQTZ/cqYtJMtxhkRkidoNGXc7ERPbZN7dVW5SdURuLeVU7lwKMpo18XdcmpWYd0qsP1bwKPf7DNSUinhvA==}
+    cpu: [loong64]
+    os: [linux]
+    libc: [glibc]
+
+  '@rollup/rollup-linux-loong64-musl@4.57.1':
+    resolution: {integrity: sha512-xpObYIf+8gprgWaPP32xiN5RVTi/s5FCR+XMXSKmhfoJjrpRAjCuuqQXyxUa/eJTdAE6eJ+KDKaoEqjZQxh3Gw==}
+    cpu: [loong64]
+    os: [linux]
+    libc: [musl]
+
+  '@rollup/rollup-linux-ppc64-gnu@4.57.1':
+    resolution: {integrity: sha512-4BrCgrpZo4hvzMDKRqEaW1zeecScDCR+2nZ86ATLhAoJ5FQ+lbHVD3ttKe74/c7tNT9c6F2viwB3ufwp01Oh2w==}
+    cpu: [ppc64]
+    os: [linux]
+    libc: [glibc]
+
+  '@rollup/rollup-linux-ppc64-musl@4.57.1':
+    resolution: {integrity: sha512-NOlUuzesGauESAyEYFSe3QTUguL+lvrN1HtwEEsU2rOwdUDeTMJdO5dUYl/2hKf9jWydJrO9OL/XSSf65R5+Xw==}
+    cpu: [ppc64]
+    os: [linux]
+    libc: [musl]
+
+  '@rollup/rollup-linux-riscv64-gnu@4.57.1':
+    resolution: {integrity: sha512-ptA88htVp0AwUUqhVghwDIKlvJMD/fmL/wrQj99PRHFRAG6Z5nbWoWG4o81Nt9FT+IuqUQi+L31ZKAFeJ5Is+A==}
+    cpu: [riscv64]
+    os: [linux]
+    libc: [glibc]
+
+  '@rollup/rollup-linux-riscv64-musl@4.57.1':
+    resolution: {integrity: sha512-S51t7aMMTNdmAMPpBg7OOsTdn4tySRQvklmL3RpDRyknk87+Sp3xaumlatU+ppQ+5raY7sSTcC2beGgvhENfuw==}
+    cpu: [riscv64]
+    os: [linux]
+    libc: [musl]
+
+  '@rollup/rollup-linux-s390x-gnu@4.57.1':
+    resolution: {integrity: sha512-Bl00OFnVFkL82FHbEqy3k5CUCKH6OEJL54KCyx2oqsmZnFTR8IoNqBF+mjQVcRCT5sB6yOvK8A37LNm/kPJiZg==}
+    cpu: [s390x]
+    os: [linux]
+    libc: [glibc]
+
+  '@rollup/rollup-linux-x64-gnu@4.57.1':
+    resolution: {integrity: sha512-ABca4ceT4N+Tv/GtotnWAeXZUZuM/9AQyCyKYyKnpk4yoA7QIAuBt6Hkgpw8kActYlew2mvckXkvx0FfoInnLg==}
+    cpu: [x64]
+    os: [linux]
+    libc: [glibc]
+
+  '@rollup/rollup-linux-x64-musl@4.57.1':
+    resolution: {integrity: sha512-HFps0JeGtuOR2convgRRkHCekD7j+gdAuXM+/i6kGzQtFhlCtQkpwtNzkNj6QhCDp7DRJ7+qC/1Vg2jt5iSOFw==}
+    cpu: [x64]
+    os: [linux]
+    libc: [musl]
+
+  '@rollup/rollup-openbsd-x64@4.57.1':
+    resolution: {integrity: sha512-H+hXEv9gdVQuDTgnqD+SQffoWoc0Of59AStSzTEj/feWTBAnSfSD3+Dql1ZruJQxmykT/JVY0dE8Ka7z0DH1hw==}
+    cpu: [x64]
+    os: [openbsd]
+
+  '@rollup/rollup-openharmony-arm64@4.57.1':
+    resolution: {integrity: sha512-4wYoDpNg6o/oPximyc/NG+mYUejZrCU2q+2w6YZqrAs2UcNUChIZXjtafAiiZSUc7On8v5NyNj34Kzj/Ltk6dQ==}
+    cpu: [arm64]
+    os: [openharmony]
+
+  '@rollup/rollup-win32-arm64-msvc@4.57.1':
+    resolution: {integrity: sha512-O54mtsV/6LW3P8qdTcamQmuC990HDfR71lo44oZMZlXU4tzLrbvTii87Ni9opq60ds0YzuAlEr/GNwuNluZyMQ==}
+    cpu: [arm64]
+    os: [win32]
+
+  '@rollup/rollup-win32-ia32-msvc@4.57.1':
+    resolution: {integrity: sha512-P3dLS+IerxCT/7D2q2FYcRdWRl22dNbrbBEtxdWhXrfIMPP9lQhb5h4Du04mdl5Woq05jVCDPCMF7Ub0NAjIew==}
+    cpu: [ia32]
+    os: [win32]
+
+  '@rollup/rollup-win32-x64-gnu@4.57.1':
+    resolution: {integrity: sha512-VMBH2eOOaKGtIJYleXsi2B8CPVADrh+TyNxJ4mWPnKfLB/DBUmzW+5m1xUrcwWoMfSLagIRpjUFeW5CO5hyciQ==}
+    cpu: [x64]
+    os: [win32]
+
+  '@rollup/rollup-win32-x64-msvc@4.57.1':
+    resolution: {integrity: sha512-mxRFDdHIWRxg3UfIIAwCm6NzvxG0jDX/wBN6KsQFTvKFqqg9vTrWUE68qEjHt19A5wwx5X5aUi2zuZT7YR0jrA==}
+    cpu: [x64]
+    os: [win32]
+
+  '@rtsao/scc@1.1.0':
+    resolution: {integrity: sha512-zt6OdqaDoOnJ1ZYsCYGt9YmWzDXl4vQdKTyJev62gFhRGKdx7mcT54V9KIjg+d2wi9EXsPvAPKe7i7WjfVWB8g==}
+
+  '@shikijs/core@1.29.2':
+    resolution: {integrity: sha512-vju0lY9r27jJfOY4Z7+Rt/nIOjzJpZ3y+nYpqtUZInVoXQ/TJZcfGnNOGnKjFdVZb8qexiCuSlZRKcGfhhTTZQ==}
+
+  '@shikijs/engine-javascript@1.29.2':
+    resolution: {integrity: sha512-iNEZv4IrLYPv64Q6k7EPpOCE/nuvGiKl7zxdq0WFuRPF5PAE9PRo2JGq/d8crLusM59BRemJ4eOqrFrC4wiQ+A==}
+
+  '@shikijs/engine-oniguruma@1.29.2':
+    resolution: {integrity: sha512-7iiOx3SG8+g1MnlzZVDYiaeHe7Ez2Kf2HrJzdmGwkRisT7r4rak0e655AcM/tF9JG/kg5fMNYlLLKglbN7gBqA==}
+
+  '@shikijs/langs@1.29.2':
+    resolution: {integrity: sha512-FIBA7N3LZ+223U7cJDUYd5shmciFQlYkFXlkKVaHsCPgfVLiO+e12FmQE6Tf9vuyEsFe3dIl8qGWKXgEHL9wmQ==}
+
+  '@shikijs/themes@1.29.2':
+    resolution: {integrity: sha512-i9TNZlsq4uoyqSbluIcZkmPL9Bfi3djVxRnofUHwvx/h6SRW3cwgBC5SML7vsDcWyukY0eCzVN980rqP6qNl9g==}
+
+  '@shikijs/types@1.29.2':
+    resolution: {integrity: sha512-VJjK0eIijTZf0QSTODEXCqinjBn0joAHQ+aPSBzrv4O2d/QSbsMw+ZeSRx03kV34Hy7NzUvV/7NqfYGRLrASmw==}
+
+  '@shikijs/vscode-textmate@10.0.2':
+    resolution: {integrity: sha512-83yeghZ2xxin3Nj8z1NMd/NCuca+gsYXswywDy5bHvwlWL8tpTQmzGeUuHd9FC3E/SBEMvzJRwWEOz5gGes9Qg==}
+
+  '@sindresorhus/is@7.2.0':
+    resolution: {integrity: sha512-P1Cz1dWaFfR4IR+U13mqqiGsLFf1KbayybWwdd2vfctdV6hDpUkgCY0nKOLLTMSoRd/jJNjtbqzf13K8DCCXQw==}
+    engines: {node: '>=18'}
+
+  '@sindresorhus/merge-streams@4.0.0':
+    resolution: {integrity: sha512-tlqY9xq5ukxTUZBmoOp+m61cqwQD5pHJtFY3Mn8CA8ps6yghLH/Hw8UPdqg4OLmFW3IFlcXnQNmo/dh8HzXYIQ==}
+    engines: {node: '>=18'}
+
+  '@solidjs/router@0.15.4':
+    resolution: {integrity: sha512-WOpgg9a9T638cR+5FGbFi/IV4l2FpmBs1GpIMSPa0Ce9vyJN7Wts+X2PqMf9IYn0zUj2MlSJtm1gp7/HI/n5TQ==}
+    peerDependencies:
+      solid-js: ^1.8.6
+
+  '@solidjs/start@1.2.1':
+    resolution: {integrity: sha512-O5E7rcCwm2f8GlXKgS2xnU37Ld5vMVXJgo/qR7UI5iR5uFo9V2Ac+SSVNXkM98CeHKHt55h1UjbpxxTANEsHmA==}
+    peerDependencies:
+      vinxi: ^0.5.7
+
+  '@speed-highlight/core@1.2.14':
+    resolution: {integrity: sha512-G4ewlBNhUtlLvrJTb88d2mdy2KRijzs4UhnlrOSRT4bmjh/IqNElZa3zkrZ+TC47TwtlDWzVLFADljF1Ijp5hA==}
+
+  '@standard-schema/spec@1.1.0':
+    resolution: {integrity: sha512-l2aFy5jALhniG5HgqrD6jXLi/rUWrKvqN/qJx6yoJsgKhblVd+iqqU4RCXavm/jPityDo5TCvKMnpjKnOriy0w==}
+
+  '@sveltejs/acorn-typescript@1.0.9':
+    resolution: {integrity: sha512-lVJX6qEgs/4DOcRTpo56tmKzVPtoWAaVbL4hfO7t7NVwl9AAXzQR6cihesW1BmNMPl+bK6dreu2sOKBP2Q9CIA==}
+    peerDependencies:
+      acorn: ^8.9.0
+
+  '@sveltejs/adapter-auto@7.0.1':
+    resolution: {integrity: sha512-dvuPm1E7M9NI/+canIQ6KKQDU2AkEefEZ2Dp7cY6uKoPq9Z/PhOXABe526UdW2mN986gjVkuSLkOYIBnS/M2LQ==}
+    peerDependencies:
+      '@sveltejs/kit': ^2.0.0
+
+  '@sveltejs/kit@2.52.2':
+    resolution: {integrity: sha512-1in76dftrofUt138rVLvYuwiQLkg9K3cG8agXEE6ksf7gCGs8oIr3+pFrVtbRmY9JvW+psW5fvLM/IwVybOLBA==}
+    engines: {node: '>=18.13'}
+    hasBin: true
+    peerDependencies:
+      '@opentelemetry/api': ^1.0.0
+      '@sveltejs/vite-plugin-svelte': ^3.0.0 || ^4.0.0-next.1 || ^5.0.0 || ^6.0.0-next.0
+      svelte: ^4.0.0 || ^5.0.0-next.0
+      typescript: ^5.3.3
+      vite: ^5.0.3 || ^6.0.0 || ^7.0.0-beta.0
+    peerDependenciesMeta:
+      '@opentelemetry/api':
+        optional: true
+      typescript:
+        optional: true
+
+  '@sveltejs/vite-plugin-svelte-inspector@5.0.2':
+    resolution: {integrity: sha512-TZzRTcEtZffICSAoZGkPSl6Etsj2torOVrx6Uw0KpXxrec9Gg6jFWQ60Q3+LmNGfZSxHRCZL7vXVZIWmuV50Ig==}
+    engines: {node: ^20.19 || ^22.12 || >=24}
+    peerDependencies:
+      '@sveltejs/vite-plugin-svelte': ^6.0.0-next.0
+      svelte: ^5.0.0
+      vite: ^6.3.0 || ^7.0.0
+
+  '@sveltejs/vite-plugin-svelte@6.2.4':
+    resolution: {integrity: sha512-ou/d51QSdTyN26D7h6dSpusAKaZkAiGM55/AKYi+9AGZw7q85hElbjK3kEyzXHhLSnRISHOYzVge6x0jRZ7DXA==}
+    engines: {node: ^20.19 || ^22.12 || >=24}
+    peerDependencies:
+      svelte: ^5.0.0
+      vite: ^6.3.0 || ^7.0.0
+
+  '@swc/helpers@0.5.15':
+    resolution: {integrity: sha512-JQ5TuMi45Owi4/BIMAJBoSQoOJu12oOk/gADqlcUL9JEdHB8vyjUSsxqeNXnmXHjYKMi2WcYtezGEEhqUI/E2g==}
+
+  '@tailwindcss/node@4.2.0':
+    resolution: {integrity: sha512-Yv+fn/o2OmL5fh/Ir62VXItdShnUxfpkMA4Y7jdeC8O81WPB8Kf6TT6GSHvnqgSwDzlB5iT7kDpeXxLsUS0T6Q==}
+
+  '@tailwindcss/oxide-android-arm64@4.2.0':
+    resolution: {integrity: sha512-F0QkHAVaW/JNBWl4CEKWdZ9PMb0khw5DCELAOnu+RtjAfx5Zgw+gqCHFvqg3AirU1IAd181fwOtJQ5I8Yx5wtw==}
+    engines: {node: '>= 20'}
+    cpu: [arm64]
+    os: [android]
+
+  '@tailwindcss/oxide-darwin-arm64@4.2.0':
+    resolution: {integrity: sha512-I0QylkXsBsJMZ4nkUNSR04p6+UptjcwhcVo3Zu828ikiEqHjVmQL9RuQ6uT/cVIiKpvtVA25msu/eRV97JeNSA==}
+    engines: {node: '>= 20'}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@tailwindcss/oxide-darwin-x64@4.2.0':
+    resolution: {integrity: sha512-6TmQIn4p09PBrmnkvbYQ0wbZhLtbaksCDx7Y7R3FYYx0yxNA7xg5KP7dowmQ3d2JVdabIHvs3Hx4K3d5uCf8xg==}
+    engines: {node: '>= 20'}
+    cpu: [x64]
+    os: [darwin]
+
+  '@tailwindcss/oxide-freebsd-x64@4.2.0':
+    resolution: {integrity: sha512-qBudxDvAa2QwGlq9y7VIzhTvp2mLJ6nD/G8/tI70DCDoneaUeLWBJaPcbfzqRIWraj+o969aDQKvKW9dvkUizw==}
+    engines: {node: '>= 20'}
+    cpu: [x64]
+    os: [freebsd]
+
+  '@tailwindcss/oxide-linux-arm-gnueabihf@4.2.0':
+    resolution: {integrity: sha512-7XKkitpy5NIjFZNUQPeUyNJNJn1CJeV7rmMR+exHfTuOsg8rxIO9eNV5TSEnqRcaOK77zQpsyUkBWmPy8FgdSg==}
+    engines: {node: '>= 20'}
+    cpu: [arm]
+    os: [linux]
+
+  '@tailwindcss/oxide-linux-arm64-gnu@4.2.0':
+    resolution: {integrity: sha512-Mff5a5Q3WoQR01pGU1gr29hHM1N93xYrKkGXfPw/aRtK4bOc331Ho4Tgfsm5WDGvpevqMpdlkCojT3qlCQbCpA==}
+    engines: {node: '>= 20'}
+    cpu: [arm64]
+    os: [linux]
+    libc: [glibc]
+
+  '@tailwindcss/oxide-linux-arm64-musl@4.2.0':
+    resolution: {integrity: sha512-XKcSStleEVnbH6W/9DHzZv1YhjE4eSS6zOu2eRtYAIh7aV4o3vIBs+t/B15xlqoxt6ef/0uiqJVB6hkHjWD/0A==}
+    engines: {node: '>= 20'}
+    cpu: [arm64]
+    os: [linux]
+    libc: [musl]
+
+  '@tailwindcss/oxide-linux-x64-gnu@4.2.0':
+    resolution: {integrity: sha512-/hlXCBqn9K6fi7eAM0RsobHwJYa5V/xzWspVTzxnX+Ft9v6n+30Pz8+RxCn7sQL/vRHHLS30iQPrHQunu6/vJA==}
+    engines: {node: '>= 20'}
+    cpu: [x64]
+    os: [linux]
+    libc: [glibc]
+
+  '@tailwindcss/oxide-linux-x64-musl@4.2.0':
+    resolution: {integrity: sha512-lKUaygq4G7sWkhQbfdRRBkaq4LY39IriqBQ+Gk6l5nKq6Ay2M2ZZb1tlIyRNgZKS8cbErTwuYSor0IIULC0SHw==}
+    engines: {node: '>= 20'}
+    cpu: [x64]
+    os: [linux]
+    libc: [musl]
+
+  '@tailwindcss/oxide-wasm32-wasi@4.2.0':
+    resolution: {integrity: sha512-xuDjhAsFdUuFP5W9Ze4k/o4AskUtI8bcAGU4puTYprr89QaYFmhYOPfP+d1pH+k9ets6RoE23BXZM1X1jJqoyw==}
+    engines: {node: '>=14.0.0'}
+    cpu: [wasm32]
+    bundledDependencies:
+      - '@napi-rs/wasm-runtime'
+      - '@emnapi/core'
+      - '@emnapi/runtime'
+      - '@tybys/wasm-util'
+      - '@emnapi/wasi-threads'
+      - tslib
+
+  '@tailwindcss/oxide-win32-arm64-msvc@4.2.0':
+    resolution: {integrity: sha512-2UU/15y1sWDEDNJXxEIrfWKC2Yb4YgIW5Xz2fKFqGzFWfoMHWFlfa1EJlGO2Xzjkq/tvSarh9ZTjvbxqWvLLXA==}
+    engines: {node: '>= 20'}
+    cpu: [arm64]
+    os: [win32]
+
+  '@tailwindcss/oxide-win32-x64-msvc@4.2.0':
+    resolution: {integrity: sha512-CrFadmFoc+z76EV6LPG1jx6XceDsaCG3lFhyLNo/bV9ByPrE+FnBPckXQVP4XRkN76h3Fjt/a+5Er/oA/nCBvQ==}
+    engines: {node: '>= 20'}
+    cpu: [x64]
+    os: [win32]
+
+  '@tailwindcss/oxide@4.2.0':
+    resolution: {integrity: sha512-AZqQzADaj742oqn2xjl5JbIOzZB/DGCYF/7bpvhA8KvjUj9HJkag6bBuwZvH1ps6dfgxNHyuJVlzSr2VpMgdTQ==}
+    engines: {node: '>= 20'}
+
+  '@tailwindcss/postcss@4.2.0':
+    resolution: {integrity: sha512-u6YBacGpOm/ixPfKqfgrJEjMfrYmPD7gEFRoygS/hnQaRtV0VCBdpkx5Ouw9pnaLRwwlgGCuJw8xLpaR0hOrQg==}
+
+  '@tailwindcss/vite@4.2.0':
+    resolution: {integrity: sha512-da9mFCaHpoOgtQiWtDGIikTrSpUFBtIZCG3jy/u2BGV+l/X1/pbxzmIUxNt6JWm19N3WtGi4KlJdSH/Si83WOA==}
+    peerDependencies:
+      vite: ^5.2.0 || ^6 || ^7
+
+  '@tanstack/directive-functions-plugin@1.121.21':
+    resolution: {integrity: sha512-B9z/HbF7gJBaRHieyX7f2uQ4LpLLAVAEutBZipH6w+CYD6RHRJvSVPzECGHF7icFhNWTiJQL2QR6K07s59yzEw==}
+    engines: {node: '>=12'}
+    peerDependencies:
+      vite: '>=6.0.0'
+
+  '@tanstack/router-utils@1.158.0':
+    resolution: {integrity: sha512-qZ76eaLKU6Ae9iI/mc5zizBX149DXXZkBVVO3/QRIll79uKLJZHQlMKR++2ba7JsciBWz1pgpIBcCJPE9S0LVg==}
+    engines: {node: '>=12'}
+
+  '@tanstack/server-functions-plugin@1.121.21':
+    resolution: {integrity: sha512-a05fzK+jBGacsSAc1vE8an7lpBh4H0PyIEcivtEyHLomgSeElAJxm9E2It/0nYRZ5Lh23m0okbhzJNaYWZpAOg==}
+    engines: {node: '>=12'}
+
+  '@tsconfig/svelte@5.0.8':
+    resolution: {integrity: sha512-UkNnw1/oFEfecR8ypyHIQuWYdkPvHiwcQ78sh+ymIiYoF+uc5H1UBetbjyqT+vgGJ3qQN6nhucJviX6HesWtKQ==}
+
+  '@tybys/wasm-util@0.10.1':
+    resolution: {integrity: sha512-9tTaPJLSiejZKx+Bmog4uSubteqTvFrVrURwkmHixBo0G4seD0zUxp98E1DzUBJxLQ3NPwXrGKDiVjwx/DpPsg==}
+
+  '@types/babel__core@7.20.5':
+    resolution: {integrity: sha512-qoQprZvz5wQFJwMDqeseRXWv3rqMvhgpbXFfVyWhbx9X47POIA6i/+dXefEmZKoAgOaTdaIgNSMqMIU61yRyzA==}
+
+  '@types/babel__generator@7.27.0':
+    resolution: {integrity: sha512-ufFd2Xi92OAVPYsy+P4n7/U7e68fex0+Ee8gSG9KX7eo084CWiQ4sdxktvdl0bOPupXtVJPY19zk6EwWqUQ8lg==}
+
+  '@types/babel__template@7.4.4':
+    resolution: {integrity: sha512-h/NUaSyG5EyxBIp8YRxo4RMe2/qQgvyowRwVMzhYhBCONbW8PUsg4lkFMrhgZhUe5z3L3MiLDuvyJ/CaPa2A8A==}
+
+  '@types/babel__traverse@7.28.0':
+    resolution: {integrity: sha512-8PvcXf70gTDZBgt9ptxJ8elBeBjcLOAcOtoO/mPJjtji1+CdGbHgm77om1GrsPxsiE+uXIpNSK64UYaIwQXd4Q==}
+
+  '@types/braces@3.0.5':
+    resolution: {integrity: sha512-SQFof9H+LXeWNz8wDe7oN5zu7ket0qwMu5vZubW4GCJ8Kkeh6nBWUz87+KTz/G3Kqsrp0j/W253XJb3KMEeg3w==}
+
+  '@types/chai@5.2.3':
+    resolution: {integrity: sha512-Mw558oeA9fFbv65/y4mHtXDs9bPnFMZAL/jxdPFUpOHHIXX91mcgEHbS5Lahr+pwZFR8A7GQleRWeI6cGFC2UA==}
+
+  '@types/cookie@0.6.0':
+    resolution: {integrity: sha512-4Kh9a6B2bQciAhf7FSuMRRkUWecJgJu9nPnx3yzpsfXX/c50REIqpHY4C82bXP90qrLtXtkDxTZosYO3UpOwlA==}
+
+  '@types/deep-eql@4.0.2':
+    resolution: {integrity: sha512-c9h9dVVMigMPc4bwTvC5dxqtqJZwQPePsWjPlpSOnojbor6pGqdk541lfA7AqFQr5pB1BRdq0juY9db81BwyFw==}
+
+  '@types/estree@1.0.8':
+    resolution: {integrity: sha512-dWHzHa2WqEXI/O1E9OjrocMTKJl2mSrEolh1Iomrv6U+JuNwaHXsXx9bLu5gG7BUWFIN0skIQJQ/L1rIex4X6w==}
+
+  '@types/hast@3.0.4':
+    resolution: {integrity: sha512-WPs+bbQw5aCj+x6laNGWLH3wviHtoCv/P3+otBhbOhJgG8qtpdAMlTCxLtsTWA7LH1Oh/bFCHsBn0TPS5m30EQ==}
+
+  '@types/json-schema@7.0.15':
+    resolution: {integrity: sha512-5+fP8P8MFNC+AyZCDxrB2pkZFPGzqQWUzpSeuuVLvm8VMcorNYavBqoFcxK8bQz4Qsbn4oUEEem4wDLfcysGHA==}
+
+  '@types/json5@0.0.29':
+    resolution: {integrity: sha512-dRLjCWHYg4oaA77cxO64oO+7JwCwnIzkZPdrrC71jQmQtlhM556pwKo5bUzqvZndkVbeFLIIi+9TC40JNF5hNQ==}
+
+  '@types/mdast@4.0.4':
+    resolution: {integrity: sha512-kGaNbPh1k7AFzgpud/gMdvIm5xuECykRR+JnWKQno9TAXVa6WIVCGTPvYGekIDL4uwCZQSYbUxNBSb1aUo79oA==}
+
+  '@types/micromatch@4.0.10':
+    resolution: {integrity: sha512-5jOhFDElqr4DKTrTEbnW8DZ4Hz5LRUEmyrGpCMrD/NphYv3nUnaF08xmSLx1rGGnyEs/kFnhiw6dCgcDqMr5PQ==}
+
+  '@types/node@12.20.55':
+    resolution: {integrity: sha512-J8xLz7q2OFulZ2cyGTLE1TbbZcjpno7FaN6zdJNrgAdrJ+DZzh/uFR6YrTb4C+nXakvud8Q4+rbhoIWlYQbUFQ==}
+
+  '@types/node@20.19.33':
+    resolution: {integrity: sha512-Rs1bVAIdBs5gbTIKza/tgpMuG1k3U/UMJLWecIMxNdJFDMzcM5LOiLVRYh3PilWEYDIeUDv7bpiHPLPsbydGcw==}
+
+  '@types/node@24.10.13':
+    resolution: {integrity: sha512-oH72nZRfDv9lADUBSo104Aq7gPHpQZc4BTx38r9xf9pg5LfP6EzSyH2n7qFmmxRQXh7YlUXODcYsg6PuTDSxGg==}
+
+  '@types/node@24.3.0':
+    resolution: {integrity: sha512-aPTXCrfwnDLj4VvXrm+UUCQjNEvJgNA8s5F1cvwQU+3KNltTOkBm1j30uNLyqqPNe7gE3KFzImYoZEfLhp4Yow==}
+
+  '@types/react-dom@19.2.3':
+    resolution: {integrity: sha512-jp2L/eY6fn+KgVVQAOqYItbF0VY/YApe5Mz2F0aykSO8gx31bYCZyvSeYxCHKvzHG5eZjc+zyaS5BrBWya2+kQ==}
+    peerDependencies:
+      '@types/react': ^19.2.0
+
+  '@types/react@19.2.14':
+    resolution: {integrity: sha512-ilcTH/UniCkMdtexkoCN0bI7pMcJDvmQFPvuPvmEaYA/NSfFTAgdUSLAoVjaRJm7+6PvcM+q1zYOwS4wTYMF9w==}
+
+  '@types/resolve@1.20.2':
+    resolution: {integrity: sha512-60BCwRFOZCQhDncwQdxxeOEEkbc5dIMccYLwbxsS4TUNeVECQ/pBJ0j09mrHOl/JJvpRPGwO9SvE4nR2Nb/a4Q==}
+
+  '@types/trusted-types@2.0.7':
+    resolution: {integrity: sha512-ScaPdn1dQczgbl0QFTeTOmVHFULt394XJgOQNoyVhZ6r2vLnMLJfBPd53SB52T/3G36VI1/g2MZaX0cwDuXsfw==}
+
+  '@types/unist@3.0.3':
+    resolution: {integrity: sha512-ko/gIFJRv177XgZsZcBwnqJN5x/Gien8qNOn0D5bQU/zAzVf9Zt3BlcUiLqhV9y4ARk0GbT3tnUiPNgnTXzc/Q==}
+
+  '@typescript-eslint/eslint-plugin@8.56.0':
+    resolution: {integrity: sha512-lRyPDLzNCuae71A3t9NEINBiTn7swyOhvUj3MyUOxb8x6g6vPEFoOU+ZRmGMusNC3X3YMhqMIX7i8ShqhT74Pw==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+    peerDependencies:
+      '@typescript-eslint/parser': ^8.56.0
+      eslint: ^8.57.0 || ^9.0.0 || ^10.0.0
+      typescript: '>=4.8.4 <6.0.0'
+
+  '@typescript-eslint/parser@8.56.0':
+    resolution: {integrity: sha512-IgSWvLobTDOjnaxAfDTIHaECbkNlAlKv2j5SjpB2v7QHKv1FIfjwMy8FsDbVfDX/KjmCmYICcw7uGaXLhtsLNg==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+    peerDependencies:
+      eslint: ^8.57.0 || ^9.0.0 || ^10.0.0
+      typescript: '>=4.8.4 <6.0.0'
+
+  '@typescript-eslint/project-service@8.56.0':
+    resolution: {integrity: sha512-M3rnyL1vIQOMeWxTWIW096/TtVP+8W3p/XnaFflhmcFp+U4zlxUxWj4XwNs6HbDeTtN4yun0GNTTDBw/SvufKg==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+    peerDependencies:
+      typescript: '>=4.8.4 <6.0.0'
+
+  '@typescript-eslint/scope-manager@8.56.0':
+    resolution: {integrity: sha512-7UiO/XwMHquH+ZzfVCfUNkIXlp/yQjjnlYUyYz7pfvlK3/EyyN6BK+emDmGNyQLBtLGaYrTAI6KOw8tFucWL2w==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+
+  '@typescript-eslint/tsconfig-utils@8.56.0':
+    resolution: {integrity: sha512-bSJoIIt4o3lKXD3xmDh9chZcjCz5Lk8xS7Rxn+6l5/pKrDpkCwtQNQQwZ2qRPk7TkUYhrq3WPIHXOXlbXP0itg==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+    peerDependencies:
+      typescript: '>=4.8.4 <6.0.0'
+
+  '@typescript-eslint/type-utils@8.56.0':
+    resolution: {integrity: sha512-qX2L3HWOU2nuDs6GzglBeuFXviDODreS58tLY/BALPC7iu3Fa+J7EOTwnX9PdNBxUI7Uh0ntP0YWGnxCkXzmfA==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+    peerDependencies:
+      eslint: ^8.57.0 || ^9.0.0 || ^10.0.0
+      typescript: '>=4.8.4 <6.0.0'
+
+  '@typescript-eslint/types@8.56.0':
+    resolution: {integrity: sha512-DBsLPs3GsWhX5HylbP9HNG15U0bnwut55Lx12bHB9MpXxQ+R5GC8MwQe+N1UFXxAeQDvEsEDY6ZYwX03K7Z6HQ==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+
+  '@typescript-eslint/typescript-estree@8.56.0':
+    resolution: {integrity: sha512-ex1nTUMWrseMltXUHmR2GAQ4d+WjkZCT4f+4bVsps8QEdh0vlBsaCokKTPlnqBFqqGaxilDNJG7b8dolW2m43Q==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+    peerDependencies:
+      typescript: '>=4.8.4 <6.0.0'
+
+  '@typescript-eslint/utils@8.56.0':
+    resolution: {integrity: sha512-RZ3Qsmi2nFGsS+n+kjLAYDPVlrzf7UhTffrDIKr+h2yzAlYP/y5ZulU0yeDEPItos2Ph46JAL5P/On3pe7kDIQ==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+    peerDependencies:
+      eslint: ^8.57.0 || ^9.0.0 || ^10.0.0
+      typescript: '>=4.8.4 <6.0.0'
+
+  '@typescript-eslint/visitor-keys@8.56.0':
+    resolution: {integrity: sha512-q+SL+b+05Ud6LbEE35qe4A99P+htKTKVbyiNEe45eCbJFyh/HVK9QXwlrbz+Q4L8SOW4roxSVwXYj4DMBT7Ieg==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+
+  '@ungap/structured-clone@1.3.0':
+    resolution: {integrity: sha512-WmoN8qaIAo7WTYWbAZuG8PYEhn5fkz7dZrqTBZ7dtt//lL2Gwms1IcnQ5yHqjDfX8Ft5j4YzDM23f87zBfDe9g==}
+
+  '@unhead/vue@2.1.4':
+    resolution: {integrity: sha512-MFvywgkHMt/AqbhmKOqRuzvuHBTcmmmnUa7Wm/Sg11leXAeRShv2PcmY7IiYdeeJqBMCm1jwhcs6201jj6ggZg==}
+    peerDependencies:
+      vue: '>=3.5.18'
+
+  '@unrs/resolver-binding-android-arm-eabi@1.11.1':
+    resolution: {integrity: sha512-ppLRUgHVaGRWUx0R0Ut06Mjo9gBaBkg3v/8AxusGLhsIotbBLuRk51rAzqLC8gq6NyyAojEXglNjzf6R948DNw==}
+    cpu: [arm]
+    os: [android]
+
+  '@unrs/resolver-binding-android-arm64@1.11.1':
+    resolution: {integrity: sha512-lCxkVtb4wp1v+EoN+HjIG9cIIzPkX5OtM03pQYkG+U5O/wL53LC4QbIeazgiKqluGeVEeBlZahHalCaBvU1a2g==}
+    cpu: [arm64]
+    os: [android]
+
+  '@unrs/resolver-binding-darwin-arm64@1.11.1':
+    resolution: {integrity: sha512-gPVA1UjRu1Y/IsB/dQEsp2V1pm44Of6+LWvbLc9SDk1c2KhhDRDBUkQCYVWe6f26uJb3fOK8saWMgtX8IrMk3g==}
+    cpu: [arm64]
+    os: [darwin]
+
+  '@unrs/resolver-binding-darwin-x64@1.11.1':
+    resolution: {integrity: sha512-cFzP7rWKd3lZaCsDze07QX1SC24lO8mPty9vdP+YVa3MGdVgPmFc59317b2ioXtgCMKGiCLxJ4HQs62oz6GfRQ==}
+    cpu: [x64]
+    os: [darwin]
+
+  '@unrs/resolver-binding-freebsd-x64@1.11.1':
+    resolution: {integrity: sha512-fqtGgak3zX4DCB6PFpsH5+Kmt/8CIi4Bry4rb1ho6Av2QHTREM+47y282Uqiu3ZRF5IQioJQ5qWRV6jduA+iGw==}
+    cpu: [x64]
+    os: [freebsd]
+
+  '@unrs/resolver-binding-linux-arm-gnueabihf@1.11.1':
+    resolution: {integrity: sha512-u92mvlcYtp9MRKmP+ZvMmtPN34+/3lMHlyMj7wXJDeXxuM0Vgzz0+PPJNsro1m3IZPYChIkn944wW8TYgGKFHw==}
+    cpu: [arm]
+    os: [linux]
+
+  '@unrs/resolver-binding-linux-arm-musleabihf@1.11.1':
+    resolution: {integrity: sha512-cINaoY2z7LVCrfHkIcmvj7osTOtm6VVT16b5oQdS4beibX2SYBwgYLmqhBjA1t51CarSaBuX5YNsWLjsqfW5Cw==}
+    cpu: [arm]
+    os: [linux]
+
+  '@unrs/resolver-binding-linux-arm64-gnu@1.11.1':
+    resolution: {integrity: sha512-34gw7PjDGB9JgePJEmhEqBhWvCiiWCuXsL9hYphDF7crW7UgI05gyBAi6MF58uGcMOiOqSJ2ybEeCvHcq0BCmQ==}
+    cpu: [arm64]
+    os: [linux]
+    libc: [glibc]
+
+  '@unrs/resolver-binding-linux-arm64-musl@1.11.1':
+    resolution: {integrity: sha512-RyMIx6Uf53hhOtJDIamSbTskA99sPHS96wxVE/bJtePJJtpdKGXO1wY90oRdXuYOGOTuqjT8ACccMc4K6QmT3w==}
+    cpu: [arm64]
+    os: [linux]
+    libc: [musl]
+
+  '@unrs/resolver-binding-linux-ppc64-gnu@1.11.1':
+    resolution: {integrity: sha512-D8Vae74A4/a+mZH0FbOkFJL9DSK2R6TFPC9M+jCWYia/q2einCubX10pecpDiTmkJVUH+y8K3BZClycD8nCShA==}
+    cpu: [ppc64]
+    os: [linux]
+    libc: [glibc]
+
+  '@unrs/resolver-binding-linux-riscv64-gnu@1.11.1':
+    resolution: {integrity: sha512-frxL4OrzOWVVsOc96+V3aqTIQl1O2TjgExV4EKgRY09AJ9leZpEg8Ak9phadbuX0BA4k8U5qtvMSQQGGmaJqcQ==}
+    cpu: [riscv64]
+    os: [linux]
+    libc: [glibc]
+
+  '@unrs/resolver-binding-linux-riscv64-musl@1.11.1':
+    resolution: {integrity: sha512-mJ5vuDaIZ+l/acv01sHoXfpnyrNKOk/3aDoEdLO/Xtn9HuZlDD6jKxHlkN8ZhWyLJsRBxfv9GYM2utQ1SChKew==}
+    cpu: [riscv64]
+    os: [linux]
+    libc: [musl]
+
+  '@unrs/resolver-binding-linux-s390x-gnu@1.11.1':
+    resolution: {integrity: sha512-kELo8ebBVtb9sA7rMe1Cph4QHreByhaZ2QEADd9NzIQsYNQpt9UkM9iqr2lhGr5afh885d/cB5QeTXSbZHTYPg==}
+    cpu: [s390x]
+    os: [linux]
+    libc: [glibc]
+
+  '@unrs/resolver-binding-linux-x64-gnu@1.11.1':
+    resolution: {integrity: sha512-C3ZAHugKgovV5YvAMsxhq0gtXuwESUKc5MhEtjBpLoHPLYM+iuwSj3lflFwK3DPm68660rZ7G8BMcwSro7hD5w==}
+    cpu: [x64]
+    os: [linux]
+    libc: [glibc]
+
+  '@unrs/resolver-binding-linux-x64-musl@1.11.1':
+    resolution: {integrity: sha512-rV0YSoyhK2nZ4vEswT/QwqzqQXw5I6CjoaYMOX0TqBlWhojUf8P94mvI7nuJTeaCkkds3QE4+zS8Ko+GdXuZtA==}
+    cpu: [x64]
+    os: [linux]
+    libc: [musl]
+
+  '@unrs/resolver-binding-wasm32-wasi@1.11.1':
+    resolution: {integrity: sha512-5u4RkfxJm+Ng7IWgkzi3qrFOvLvQYnPBmjmZQ8+szTK/b31fQCnleNl1GgEt7nIsZRIf5PLhPwT0WM+q45x/UQ==}
+    engines: {node: '>=14.0.0'}
+    cpu: [wasm32]
+
+  '@unrs/resolver-binding-win32-arm64-msvc@1.11.1':
+    resolution: {integrity: sha512-nRcz5Il4ln0kMhfL8S3hLkxI85BXs3o8EYoattsJNdsX4YUU89iOkVn7g0VHSRxFuVMdM4Q1jEpIId1Ihim/Uw==}
+    cpu: [arm64]
+    os: [win32]
+
+  '@unrs/resolver-binding-win32-ia32-msvc@1.11.1':
+    resolution: {integrity: sha512-DCEI6t5i1NmAZp6pFonpD5m7i6aFrpofcp4LA2i8IIq60Jyo28hamKBxNrZcyOwVOZkgsRp9O2sXWBWP8MnvIQ==}
+    cpu: [ia32]
+    os: [win32]
+
+  '@unrs/resolver-binding-win32-x64-msvc@1.11.1':
+    resolution: {integrity: sha512-lrW200hZdbfRtztbygyaq/6jP6AKE8qQN2KvPcJ+x7wiD038YtnYtZ82IMNJ69GJibV7bwL3y9FgK+5w/pYt6g==}
+    cpu: [x64]
+    os: [win32]
+
+  '@vercel/nft@1.3.1':
+    resolution: {integrity: sha512-ihNT1rswiq3cy4WKQAV5kJi6UjWX1vLUzlLc+Vvq83G8CU9nMgfDWz5f1tOnSlS8LeC4Wp4qTB3+HGj/ccUrFQ==}
+    engines: {node: '>=20'}
+    hasBin: true
+
+  '@vinxi/listhen@1.5.6':
+    resolution: {integrity: sha512-WSN1z931BtasZJlgPp704zJFnQFRg7yzSjkm3MzAWQYe4uXFXlFr1hc5Ac2zae5/HDOz5x1/zDM5Cb54vTCnWw==}
+    hasBin: true
+
+  '@vinxi/plugin-directives@0.5.1':
+    resolution: {integrity: sha512-pH/KIVBvBt7z7cXrUH/9uaqcdxjegFC7+zvkZkdOyWzs+kQD5KPf3cl8kC+5ayzXHT+OMlhGhyitytqN3cGmHg==}
+    peerDependencies:
+      vinxi: ^0.5.5
+
+  '@vinxi/server-components@0.5.1':
+    resolution: {integrity: sha512-0BsG95qac3dkhfdRZxqzqYWJE4NvPL7ILlV43B6K6ho1etXWB2e5b0IxsUAUbyqpqiXM7mSRivojuXjb2G4OsQ==}
+    peerDependencies:
+      vinxi: ^0.5.5
+
+  '@vitejs/plugin-react@5.1.4':
+    resolution: {integrity: sha512-VIcFLdRi/VYRU8OL/puL7QXMYafHmqOnwTZY50U1JPlCNj30PxCMx65c494b1K9be9hX83KVt0+gTEwTWLqToA==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    peerDependencies:
+      vite: ^4.2.0 || ^5.0.0 || ^6.0.0 || ^7.0.0
+
+  '@vitejs/plugin-vue-jsx@5.1.4':
+    resolution: {integrity: sha512-70LmoVk9riR7qc4W2CpjsbNMWTPnuZb9dpFKX1emru0yP57nsc9k8nhLA6U93ngQapv5VDIUq2JatNfLbBIkrA==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    peerDependencies:
+      vite: ^5.0.0 || ^6.0.0 || ^7.0.0 || ^8.0.0-0
+      vue: ^3.0.0
+
+  '@vitejs/plugin-vue@6.0.4':
+    resolution: {integrity: sha512-uM5iXipgYIn13UUQCZNdWkYk+sysBeA97d5mHsAoAt1u/wpN3+zxOmsVJWosuzX+IMGRzeYUNytztrYznboIkQ==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    peerDependencies:
+      vite: ^5.0.0 || ^6.0.0 || ^7.0.0 || ^8.0.0-0
+      vue: ^3.2.25
+
+  '@vitest/expect@4.0.18':
+    resolution: {integrity: sha512-8sCWUyckXXYvx4opfzVY03EOiYVxyNrHS5QxX3DAIi5dpJAAkyJezHCP77VMX4HKA2LDT/Jpfo8i2r5BE3GnQQ==}
+
+  '@vitest/mocker@4.0.18':
+    resolution: {integrity: sha512-HhVd0MDnzzsgevnOWCBj5Otnzobjy5wLBe4EdeeFGv8luMsGcYqDuFRMcttKWZA5vVO8RFjexVovXvAM4JoJDQ==}
+    peerDependencies:
+      msw: ^2.4.9
+      vite: ^6.0.0 || ^7.0.0-0
+    peerDependenciesMeta:
+      msw:
+        optional: true
+      vite:
+        optional: true
+
+  '@vitest/pretty-format@4.0.18':
+    resolution: {integrity: sha512-P24GK3GulZWC5tz87ux0m8OADrQIUVDPIjjj65vBXYG17ZeU3qD7r+MNZ1RNv4l8CGU2vtTRqixrOi9fYk/yKw==}
+
+  '@vitest/runner@4.0.18':
+    resolution: {integrity: sha512-rpk9y12PGa22Jg6g5M3UVVnTS7+zycIGk9ZNGN+m6tZHKQb7jrP7/77WfZy13Y/EUDd52NDsLRQhYKtv7XfPQw==}
+
+  '@vitest/snapshot@4.0.18':
+    resolution: {integrity: sha512-PCiV0rcl7jKQjbgYqjtakly6T1uwv/5BQ9SwBLekVg/EaYeQFPiXcgrC2Y7vDMA8dM1SUEAEV82kgSQIlXNMvA==}
+
+  '@vitest/spy@4.0.18':
+    resolution: {integrity: sha512-cbQt3PTSD7P2OARdVW3qWER5EGq7PHlvE+QfzSC0lbwO+xnt7+XH06ZzFjFRgzUX//JmpxrCu92VdwvEPlWSNw==}
+
+  '@vitest/utils@4.0.18':
+    resolution: {integrity: sha512-msMRKLMVLWygpK3u2Hybgi4MNjcYJvwTb0Ru09+fOyCXIgT5raYP041DRRdiJiI3k/2U6SEbAETB3YtBrUkCFA==}
+
+  '@volar/language-core@2.4.27':
+    resolution: {integrity: sha512-DjmjBWZ4tJKxfNC1F6HyYERNHPYS7L7OPFyCrestykNdUZMFYzI9WTyvwPcaNaHlrEUwESHYsfEw3isInncZxQ==}
+
+  '@volar/source-map@2.4.27':
+    resolution: {integrity: sha512-ynlcBReMgOZj2i6po+qVswtDUeeBRCTgDurjMGShbm8WYZgJ0PA4RmtebBJ0BCYol1qPv3GQF6jK7C9qoVc7lg==}
+
+  '@volar/typescript@2.4.27':
+    resolution: {integrity: sha512-eWaYCcl/uAPInSK2Lze6IqVWaBu/itVqR5InXcHXFyles4zO++Mglt3oxdgj75BDcv1Knr9Y93nowS8U3wqhxg==}
+
+  '@vue-macros/common@3.1.2':
+    resolution: {integrity: sha512-h9t4ArDdniO9ekYHAD95t9AZcAbb19lEGK+26iAjUODOIJKmObDNBSe4+6ELQAA3vtYiFPPBtHh7+cQCKi3Dng==}
+    engines: {node: '>=20.19.0'}
+    peerDependencies:
+      vue: ^2.7.0 || ^3.2.25
+    peerDependenciesMeta:
+      vue:
+        optional: true
+
+  '@vue/babel-helper-vue-transform-on@2.0.1':
+    resolution: {integrity: sha512-uZ66EaFbnnZSYqYEyplWvn46GhZ1KuYSThdT68p+am7MgBNbQ3hphTL9L+xSIsWkdktwhPYLwPgVWqo96jDdRA==}
+
+  '@vue/babel-plugin-jsx@2.0.1':
+    resolution: {integrity: sha512-a8CaLQjD/s4PVdhrLD/zT574ZNPnZBOY+IhdtKWRB4HRZ0I2tXBi5ne7d9eCfaYwp5gU5+4KIyFTV1W1YL9xZA==}
+    peerDependencies:
+      '@babel/core': ^7.0.0-0
+    peerDependenciesMeta:
+      '@babel/core':
+        optional: true
+
+  '@vue/babel-plugin-resolve-type@2.0.1':
+    resolution: {integrity: sha512-ybwgIuRGRRBhOU37GImDoWQoz+TlSqap65qVI6iwg/J7FfLTLmMf97TS7xQH9I7Qtr/gp161kYVdhr1ZMraSYQ==}
+    peerDependencies:
+      '@babel/core': ^7.0.0-0
+
+  '@vue/compiler-core@3.5.28':
+    resolution: {integrity: sha512-kviccYxTgoE8n6OCw96BNdYlBg2GOWfBuOW4Vqwrt7mSKWKwFVvI8egdTltqRgITGPsTFYtKYfxIG8ptX2PJHQ==}
+
+  '@vue/compiler-dom@3.5.28':
+    resolution: {integrity: sha512-/1ZepxAb159jKR1btkefDP+J2xuWL5V3WtleRmxaT+K2Aqiek/Ab/+Ebrw2pPj0sdHO8ViAyyJWfhXXOP/+LQA==}
+
+  '@vue/compiler-sfc@3.5.28':
+    resolution: {integrity: sha512-6TnKMiNkd6u6VeVDhZn/07KhEZuBSn43Wd2No5zaP5s3xm8IqFTHBj84HJah4UepSUJTro5SoqqlOY22FKY96g==}
+
+  '@vue/compiler-ssr@3.5.28':
+    resolution: {integrity: sha512-JCq//9w1qmC6UGLWJX7RXzrGpKkroubey/ZFqTpvEIDJEKGgntuDMqkuWiZvzTzTA5h2qZvFBFHY7fAAa9475g==}
+
+  '@vue/devtools-api@6.6.4':
+    resolution: {integrity: sha512-sGhTPMuXqZ1rVOk32RylztWkfXTRhuS7vgAKv0zjqk8gbsHkJ7xfFf+jbySxt7tWObEJwyKaHMikV/WGDiQm8g==}
+
+  '@vue/devtools-core@8.0.6':
+    resolution: {integrity: sha512-fN7iVtpSQQdtMORWwVZ1JiIAKriinhD+lCHqPw9Rr252ae2TczILEmW0zcAZifPW8HfYcbFkn+h7Wv6kQQCayw==}
+    peerDependencies:
+      vue: ^3.0.0
+
+  '@vue/devtools-kit@8.0.6':
+    resolution: {integrity: sha512-9zXZPTJW72OteDXeSa5RVML3zWDCRcO5t77aJqSs228mdopYj5AiTpihozbsfFJ0IodfNs7pSgOGO3qfCuxDtw==}
+
+  '@vue/devtools-shared@8.0.6':
+    resolution: {integrity: sha512-Pp1JylTqlgMJvxW6MGyfTF8vGvlBSCAvMFaDCYa82Mgw7TT5eE5kkHgDvmOGHWeJE4zIDfCpCxHapsK2LtIAJg==}
+
+  '@vue/language-core@3.2.4':
+    resolution: {integrity: sha512-bqBGuSG4KZM45KKTXzGtoCl9cWju5jsaBKaJJe3h5hRAAWpZUuj5G+L+eI01sPIkm4H6setKRlw7E85wLdDNew==}
+
+  '@vue/reactivity@3.5.28':
+    resolution: {integrity: sha512-gr5hEsxvn+RNyu9/9o1WtdYdwDjg5FgjUSBEkZWqgTKlo/fvwZ2+8W6AfKsc9YN2k/+iHYdS9vZYAhpi10kNaw==}
+
+  '@vue/runtime-core@3.5.28':
+    resolution: {integrity: sha512-POVHTdbgnrBBIpnbYU4y7pOMNlPn2QVxVzkvEA2pEgvzbelQq4ZOUxbp2oiyo+BOtiYlm8Q44wShHJoBvDPAjQ==}
+
+  '@vue/runtime-dom@3.5.28':
+    resolution: {integrity: sha512-4SXxSF8SXYMuhAIkT+eBRqOkWEfPu6nhccrzrkioA6l0boiq7sp18HCOov9qWJA5HML61kW8p/cB4MmBiG9dSA==}
+
+  '@vue/server-renderer@3.5.28':
+    resolution: {integrity: sha512-pf+5ECKGj8fX95bNincbzJ6yp6nyzuLDhYZCeFxUNp8EBrQpPpQaLX3nNCp49+UbgbPun3CeVE+5CXVV1Xydfg==}
+    peerDependencies:
+      vue: 3.5.28
+
+  '@vue/shared@3.5.28':
+    resolution: {integrity: sha512-cfWa1fCGBxrvaHRhvV3Is0MgmrbSCxYTXCSCau2I0a1Xw1N1pHAvkWCiXPRAqjvToILvguNyEwjevUqAuBQWvQ==}
+
+  '@vue/tsconfig@0.8.1':
+    resolution: {integrity: sha512-aK7feIWPXFSUhsCP9PFqPyFOcz4ENkb8hZ2pneL6m2UjCkccvaOhC/5KCKluuBufvp2KzkbdA2W2pk20vLzu3g==}
+    peerDependencies:
+      typescript: 5.x
+      vue: ^3.4.0
+    peerDependenciesMeta:
+      typescript:
+        optional: true
+      vue:
+        optional: true
+
+  abbrev@3.0.1:
+    resolution: {integrity: sha512-AO2ac6pjRB3SJmGJo+v5/aK6Omggp6fsLrs6wN9bd35ulu4cCwaAU9+7ZhXjeqHVkaHThLuzH0nZr0YpCDhygg==}
+    engines: {node: ^18.17.0 || >=20.5.0}
+
+  abort-controller@3.0.0:
+    resolution: {integrity: sha512-h8lQ8tacZYnR3vNQTgibj+tODHI5/+l06Au2Pcriv/Gmet0eaj4TwWH41sO9wnHDiQsEj19q0drzdWdeAHtweg==}
+    engines: {node: '>=6.5'}
+
+  acorn-import-attributes@1.9.5:
+    resolution: {integrity: sha512-n02Vykv5uA3eHGM/Z2dQrcD56kL8TyDb2p1+0P83PClMnC/nc+anbQRhIOWnSq4Ke/KvDPrY3C9hDtC/A3eHnQ==}
+    peerDependencies:
+      acorn: ^8
+
+  acorn-jsx@5.3.2:
+    resolution: {integrity: sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ==}
+    peerDependencies:
+      acorn: ^6.0.0 || ^7.0.0 || ^8.0.0
+
+  acorn-loose@8.5.2:
+    resolution: {integrity: sha512-PPvV6g8UGMGgjrMu+n/f9E/tCSkNQ2Y97eFvuVdJfG11+xdIeDcLyNdC8SHcrHbRqkfwLASdplyR6B6sKM1U4A==}
+    engines: {node: '>=0.4.0'}
+
+  acorn-typescript@1.4.13:
+    resolution: {integrity: sha512-xsc9Xv0xlVfwp2o7sQ+GCQ1PgbkdcpWdTzrwXxO3xDMTAywVS3oXVOcOHuRjAPkS4P9b+yc/qNF15460v+jp4Q==}
+    peerDependencies:
+      acorn: '>=8.9.0'
+
+  acorn@8.15.0:
+    resolution: {integrity: sha512-NZyJarBfL7nWwIq+FDL6Zp/yHEhePMNnnJ0y3qfieCrmNvYct8uvtiV41UvlSe6apAfk0fY1FbWx+NwfmpvtTg==}
+    engines: {node: '>=0.4.0'}
+    hasBin: true
+
+  agent-base@7.1.4:
+    resolution: {integrity: sha512-MnA+YT8fwfJPgBx3m60MNqakm30XOkyIoH1y6huTQvC0PwZG7ki8NacLBcrPbNoo8vEZy7Jpuk7+jMO+CUovTQ==}
+    engines: {node: '>= 14'}
+
+  ajv@6.12.6:
+    resolution: {integrity: sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==}
+
+  alien-signals@3.1.2:
+    resolution: {integrity: sha512-d9dYqZTS90WLiU0I5c6DHj/HcKkF8ZyGN3G5x8wSbslulz70KOxaqCT0hQCo9KOyhVqzqGojvNdJXoTumZOtcw==}
+
+  ansi-align@3.0.1:
+    resolution: {integrity: sha512-IOfwwBF5iczOjp/WeY4YxyjqAFMQoZufdQWDd19SEExbVLNXqvpzSJ/M7Za4/sCPmQ0+GRquoA7bGcINcxew6w==}
+
+  ansi-colors@4.1.3:
+    resolution: {integrity: sha512-/6w/C21Pm1A7aZitlI5Ni/2J6FFQN8i1Cvz3kHABAAbw93v/NlvKdVOqz7CCWz/3iv/JplRSEEZ83XION15ovw==}
+    engines: {node: '>=6'}
+
+  ansi-regex@5.0.1:
+    resolution: {integrity: sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==}
+    engines: {node: '>=8'}
+
+  ansi-regex@6.2.2:
+    resolution: {integrity: sha512-Bq3SmSpyFHaWjPk8If9yc6svM8c56dB5BAtW4Qbw5jHTwwXXcTLoRMkpDJp6VL0XzlWaCHTXrkFURMYmD0sLqg==}
+    engines: {node: '>=12'}
+
+  ansi-styles@4.3.0:
+    resolution: {integrity: sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==}
+    engines: {node: '>=8'}
+
+  ansi-styles@6.2.3:
+    resolution: {integrity: sha512-4Dj6M28JB+oAH8kFkTLUo+a2jwOFkuqb3yucU0CANcRRUbxS0cP0nZYCGjcc3BNXwRIsUVmDGgzawme7zvJHvg==}
+    engines: {node: '>=12'}
+
+  ansis@4.2.0:
+    resolution: {integrity: sha512-HqZ5rWlFjGiV0tDm3UxxgNRqsOTniqoKZu0pIAfh7TZQMGuZK+hH0drySty0si0QXj1ieop4+SkSfPZBPPkHig==}
+    engines: {node: '>=14'}
+
+  any-promise@1.3.0:
+    resolution: {integrity: sha512-7UvmKalWRt1wgjL1RrGxoSJW/0QZFIegpeGvZG9kjp8vrRu55XTHbwnqq2GpXm9uLbcuhxm3IqX9OB4MZR1b2A==}
+
+  anymatch@3.1.3:
+    resolution: {integrity: sha512-KMReFUr0B4t+D+OBkjR3KYqvocp2XaSzO55UcB6mgQMd3KbcE+mWTyvVV7D/zsdEbNnV6acZUutkiHQXvTr1Rw==}
+    engines: {node: '>= 8'}
+
+  archiver-utils@5.0.2:
+    resolution: {integrity: sha512-wuLJMmIBQYCsGZgYLTy5FIB2pF6Lfb6cXMSF8Qywwk3t20zWnAi7zLcQFdKQmIB8wyZpY5ER38x08GbwtR2cLA==}
+    engines: {node: '>= 14'}
+
+  archiver@7.0.1:
+    resolution: {integrity: sha512-ZcbTaIqJOfCc03QwD468Unz/5Ir8ATtvAHsK+FdXbDIbGfihqh9mrvdcYunQzqn4HrvWWaFyaxJhGZagaJJpPQ==}
+    engines: {node: '>= 14'}
+
+  argparse@1.0.10:
+    resolution: {integrity: sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==}
+
+  argparse@2.0.1:
+    resolution: {integrity: sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==}
+
+  aria-query@5.3.2:
+    resolution: {integrity: sha512-COROpnaoap1E2F000S62r6A60uHZnmlvomhfyT2DlTcrY1OrBKn2UhH7qn5wTC9zMvD0AY7csdPSNwKP+7WiQw==}
+    engines: {node: '>= 0.4'}
+
+  array-buffer-byte-length@1.0.2:
+    resolution: {integrity: sha512-LHE+8BuR7RYGDKvnrmcuSq3tDcKv9OFEXQt/HpbZhY7V6h0zlUXutnAD82GiFx9rdieCMjkvtcsPqBwgUl1Iiw==}
+    engines: {node: '>= 0.4'}
+
+  array-includes@3.1.9:
+    resolution: {integrity: sha512-FmeCCAenzH0KH381SPT5FZmiA/TmpndpcaShhfgEN9eCVjnFBqq3l1xrI42y8+PPLI6hypzou4GXw00WHmPBLQ==}
+    engines: {node: '>= 0.4'}
+
+  array-union@2.1.0:
+    resolution: {integrity: sha512-HGyxoOTYUyCM6stUe6EJgnd4EoewAI7zMdfqO+kGjnlZmBDz/cR5pf8r/cR4Wq60sL/p0IkcjUEEPwS3GFrIyw==}
+    engines: {node: '>=8'}
+
+  array.prototype.findlast@1.2.5:
+    resolution: {integrity: sha512-CVvd6FHg1Z3POpBLxO6E6zr+rSKEQ9L6rZHAaY7lLfhKsWYUBBOuMs0e9o24oopj6H+geRCX0YJ+TJLBK2eHyQ==}
+    engines: {node: '>= 0.4'}
+
+  array.prototype.findlastindex@1.2.6:
+    resolution: {integrity: sha512-F/TKATkzseUExPlfvmwQKGITM3DGTK+vkAsCZoDc5daVygbJBnjEUCbgkAvVFsgfXfX4YIqZ/27G3k3tdXrTxQ==}
+    engines: {node: '>= 0.4'}
+
+  array.prototype.flat@1.3.3:
+    resolution: {integrity: sha512-rwG/ja1neyLqCuGZ5YYrznA62D4mZXg0i1cIskIUKSiqF3Cje9/wXAls9B9s1Wa2fomMsIv8czB8jZcPmxCXFg==}
+    engines: {node: '>= 0.4'}
+
+  array.prototype.flatmap@1.3.3:
+    resolution: {integrity: sha512-Y7Wt51eKJSyi80hFrJCePGGNo5ktJCslFuboqJsbf57CCPcm5zztluPlc4/aD8sWsKvlwatezpV4U1efk8kpjg==}
+    engines: {node: '>= 0.4'}
+
+  array.prototype.tosorted@1.1.4:
+    resolution: {integrity: sha512-p6Fx8B7b7ZhL/gmUsAy0D15WhvDccw3mnGNbZpi3pmeJdxtWsj2jEaI4Y6oo3XiHfzuSgPwKc04MYt6KgvC/wA==}
+    engines: {node: '>= 0.4'}
+
+  arraybuffer.prototype.slice@1.0.4:
+    resolution: {integrity: sha512-BNoCY6SXXPQ7gF2opIP4GBE+Xw7U+pHMYKuzjgCN3GwiaIR09UUeKfheyIry77QtrCBlC0KK0q5/TER/tYh3PQ==}
+    engines: {node: '>= 0.4'}
+
+  assertion-error@2.0.1:
+    resolution: {integrity: sha512-Izi8RQcffqCeNVgFigKli1ssklIbpHnCYc6AknXGYoB6grJqyeby7jv12JUQgmTAnIDnbck1uxksT4dzN3PWBA==}
+    engines: {node: '>=12'}
+
+  ast-kit@2.2.0:
+    resolution: {integrity: sha512-m1Q/RaVOnTp9JxPX+F+Zn7IcLYMzM8kZofDImfsKZd8MbR+ikdOzTeztStWqfrqIxZnYWryyI9ePm3NGjnZgGw==}
+    engines: {node: '>=20.19.0'}
+
+  ast-types-flow@0.0.8:
+    resolution: {integrity: sha512-OH/2E5Fg20h2aPrbe+QL8JZQFko0YZaF+j4mnQ7BGhfavO7OpSLa8a0y9sBwomHdSbkhTS8TQNayBfnW5DwbvQ==}
+
+  ast-types@0.16.1:
+    resolution: {integrity: sha512-6t10qk83GOG8p0vKmaCr8eiilZwO171AvbROMtvvNiwrTly62t+7XkA8RdIIVbpMhCASAsxgAzdRSwh6nw/5Dg==}
+    engines: {node: '>=4'}
+
+  ast-walker-scope@0.8.3:
+    resolution: {integrity: sha512-cbdCP0PGOBq0ASG+sjnKIoYkWMKhhz+F/h9pRexUdX2Hd38+WOlBkRKlqkGOSm0YQpcFMQBJeK4WspUAkwsEdg==}
+    engines: {node: '>=20.19.0'}
+
+  astring@1.9.0:
+    resolution: {integrity: sha512-LElXdjswlqjWrPpJFg1Fx4wpkOCxj1TDHlSV4PlaRxHGWko024xICaa97ZkMfs6DRKlCguiAI+rbXv5GWwXIkg==}
+    hasBin: true
+
+  async-function@1.0.0:
+    resolution: {integrity: sha512-hsU18Ae8CDTR6Kgu9DYf0EbCr/a5iGL0rytQDobUcdpYOKokk8LEjVphnXkDkgpi0wYVsqrXuP0bZxJaTqdgoA==}
+    engines: {node: '>= 0.4'}
+
+  async-sema@3.1.1:
+    resolution: {integrity: sha512-tLRNUXati5MFePdAk8dw7Qt7DpxPB60ofAgn8WRhW6a2rcimZnYBP9oxHiv0OHy+Wz7kPMG+t4LGdt31+4EmGg==}
+
+  async@3.2.6:
+    resolution: {integrity: sha512-htCUDlxyyCLMgaM3xXg0C0LW2xqfuQ6p05pCEIsXuyQ+a1koYKTuBMzRNwmybfLgvJDMd0r1LTn4+E0Ti6C2AA==}
+
+  autoprefixer@10.4.24:
+    resolution: {integrity: sha512-uHZg7N9ULTVbutaIsDRoUkoS8/h3bdsmVJYZ5l3wv8Cp/6UIIoRDm90hZ+BwxUj/hGBEzLxdHNSKuFpn8WOyZw==}
+    engines: {node: ^10 || ^12 || >=14}
+    hasBin: true
+    peerDependencies:
+      postcss: ^8.1.0
+
+  available-typed-arrays@1.0.7:
+    resolution: {integrity: sha512-wvUjBtSGN7+7SjNpq/9M2Tg350UZD3q62IFZLbRAR1bSMlCo1ZaeW+BJ+D090e4hIIZLBcTDWe4Mh4jvUDajzQ==}
+    engines: {node: '>= 0.4'}
+
+  axe-core@4.11.1:
+    resolution: {integrity: sha512-BASOg+YwO2C+346x3LZOeoovTIoTrRqEsqMa6fmfAV0P+U9mFr9NsyOEpiYvFjbc64NMrSswhV50WdXzdb/Z5A==}
+    engines: {node: '>=4'}
+
+  axobject-query@4.1.0:
+    resolution: {integrity: sha512-qIj0G9wZbMGNLjLmg1PT6v2mE9AH2zlnADJD/2tC6E00hgmhUOfEB6greHPAfLRSufHqROIUTkw6E+M3lH0PTQ==}
+    engines: {node: '>= 0.4'}
+
+  b4a@1.7.5:
+    resolution: {integrity: sha512-iEsKNwDh1wiWTps1/hdkNdmBgDlDVZP5U57ZVOlt+dNFqpc/lpPouCIxZw+DYBgc4P9NDfIZMPNR4CHNhzwLIA==}
+    peerDependencies:
+      react-native-b4a: '*'
+    peerDependenciesMeta:
+      react-native-b4a:
+        optional: true
+
+  babel-dead-code-elimination@1.0.12:
+    resolution: {integrity: sha512-GERT7L2TiYcYDtYk1IpD+ASAYXjKbLTDPhBtYj7X1NuRMDTMtAx9kyBenub1Ev41lo91OHCKdmP+egTDmfQ7Ig==}
+
+  babel-plugin-jsx-dom-expressions@0.40.5:
+    resolution: {integrity: sha512-8TFKemVLDYezqqv4mWz+PhRrkryTzivTGu0twyLrOkVZ0P63COx2Y04eVsUjFlwSOXui1z3P3Pn209dokWnirg==}
+    peerDependencies:
+      '@babel/core': ^7.20.12
+
+  babel-preset-solid@1.9.10:
+    resolution: {integrity: sha512-HCelrgua/Y+kqO8RyL04JBWS/cVdrtUv/h45GntgQY+cJl4eBcKkCDV3TdMjtKx1nXwRaR9QXslM/Npm1dxdZQ==}
+    peerDependencies:
+      '@babel/core': ^7.0.0
+      solid-js: ^1.9.10
+    peerDependenciesMeta:
+      solid-js:
+        optional: true
+
+  balanced-match@1.0.2:
+    resolution: {integrity: sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==}
+
+  balanced-match@4.0.3:
+    resolution: {integrity: sha512-1pHv8LX9CpKut1Zp4EXey7Z8OfH11ONNH6Dhi2WDUt31VVZFXZzKwXcysBgqSumFCmR+0dqjMK5v5JiFHzi0+g==}
+    engines: {node: 20 || >=22}
+
+  bare-events@2.8.2:
+    resolution: {integrity: sha512-riJjyv1/mHLIPX4RwiK+oW9/4c3TEUeORHKefKAKnZ5kyslbN+HXowtbaVEqt4IMUB7OXlfixcs6gsFeo/jhiQ==}
+    peerDependencies:
+      bare-abort-controller: '*'
+    peerDependenciesMeta:
+      bare-abort-controller:
+        optional: true
+
+  base64-js@1.5.1:
+    resolution: {integrity: sha512-AKpaYlHn8t4SVbOHCy+b5+KKgvR4vrsD8vbvrbiQJps7fKDTkjkDry6ji0rUJjC0kzbNePLwzxq8iypo41qeWA==}
+
+  baseline-browser-mapping@2.10.0:
+    resolution: {integrity: sha512-lIyg0szRfYbiy67j9KN8IyeD7q7hcmqnJ1ddWmNt19ItGpNN64mnllmxUNFIOdOm6by97jlL6wfpTTJrmnjWAA==}
+    engines: {node: '>=6.0.0'}
+    hasBin: true
+
+  better-path-resolve@1.0.0:
+    resolution: {integrity: sha512-pbnl5XzGBdrFU/wT4jqmJVPn2B6UHPBOhzMQkY/SPUPB6QtUXtmBHBIwCbXJol93mOpGMnQyP/+BB19q04xj7g==}
+    engines: {node: '>=4'}
+
+  bindings@1.5.0:
+    resolution: {integrity: sha512-p2q/t/mhvuOj/UeLlV6566GD/guowlr0hHxClI0W9m7MWYkL1F0hLo+0Aexs9HSPCtR1SXQ0TD3MMKrXZajbiQ==}
+
+  birpc@2.9.0:
+    resolution: {integrity: sha512-KrayHS5pBi69Xi9JmvoqrIgYGDkD6mcSe/i6YKi3w5kekCLzrX4+nawcXqrj2tIp50Kw/mT/s3p+GVK0A0sKxw==}
+
+  birpc@4.0.0:
+    resolution: {integrity: sha512-LShSxJP0KTmd101b6DRyGBj57LZxSDYWKitQNW/mi8GRMvZb078Uf9+pveax1DrVL89vm7mWe+TovdI/UDOuPw==}
+
+  boolbase@1.0.0:
+    resolution: {integrity: sha512-JZOSA7Mo9sNGB8+UjSgzdLtokWAky1zbztM3WRLCbZ70/3cTANmQmOdR7y2g+J0e2WXywy1yS468tY+IruqEww==}
+
+  boxen@8.0.1:
+    resolution: {integrity: sha512-F3PH5k5juxom4xktynS7MoFY+NUWH5LC4CnH11YB8NPew+HLpmBLCybSAEyb2F+4pRXhuhWqFesoQd6DAyc2hw==}
+    engines: {node: '>=18'}
+
+  brace-expansion@1.1.12:
+    resolution: {integrity: sha512-9T9UjW3r0UW5c1Q7GTwllptXwhvYmEzFhzMfZ9H7FQWt+uZePjZPjBP/W1ZEyZ1twGWom5/56TF4lPcqjnDHcg==}
+
+  brace-expansion@2.0.2:
+    resolution: {integrity: sha512-Jt0vHyM+jmUBqojB7E1NIYadt0vI0Qxjxd2TErW94wDz+E2LAm5vKMXXwg6ZZBTHPuUlDgQHKXvjGBdfcF1ZDQ==}
+
+  brace-expansion@5.0.2:
+    resolution: {integrity: sha512-Pdk8c9poy+YhOgVWw1JNN22/HcivgKWwpxKq04M/jTmHyCZn12WPJebZxdjSa5TmBqISrUSgNYU3eRORljfCCw==}
+    engines: {node: 20 || >=22}
+
+  braces@3.0.3:
+    resolution: {integrity: sha512-yQbXgO/OSZVD2IsiLlro+7Hf6Q18EJrKSEsdoMzKePKXct3gvD8oLcOQdIzGupr5Fj+EDe8gO/lxc1BzfMpxvA==}
+    engines: {node: '>=8'}
+
+  browserslist@4.28.1:
+    resolution: {integrity: sha512-ZC5Bd0LgJXgwGqUknZY/vkUQ04r8NXnJZ3yYi4vDmSiZmC/pdSN0NbNRPxZpbtO4uAfDUAFffO8IZoM3Gj8IkA==}
+    engines: {node: ^6 || ^7 || ^8 || ^9 || ^10 || ^11 || ^12 || >=13.7}
+    hasBin: true
+
+  buffer-crc32@1.0.0:
+    resolution: {integrity: sha512-Db1SbgBS/fg/392AblrMJk97KggmvYhr4pB5ZIMTWtaivCPMWLkmb7m21cJvpvgK+J3nsU2CmmixNBZx4vFj/w==}
+    engines: {node: '>=8.0.0'}
+
+  buffer-from@1.1.2:
+    resolution: {integrity: sha512-E+XQCRwSbaaiChtv6k6Dwgc+bx+Bs6vuKJHHl5kox/BaKbhiXzqQOwK4cO22yElGp2OCmjwVhT3HmxgyPGnJfQ==}
+
+  buffer@6.0.3:
+    resolution: {integrity: sha512-FTiCpNxtwiZZHEZbcbTIcZjERVICn9yq/pDFkTl95/AxzD1naBctN7YO68riM/gLSDY7sdrMby8hofADYuuqOA==}
+
+  bundle-name@4.1.0:
+    resolution: {integrity: sha512-tjwM5exMg6BGRI+kNmTntNsvdZS1X8BFYS6tnJ2hdH0kVxM6/eVZ2xy+FqStSWvYmtfFMDLIxurorHwDKfDz5Q==}
+    engines: {node: '>=18'}
+
+  bundle-require@5.1.0:
+    resolution: {integrity: sha512-3WrrOuZiyaaZPWiEt4G3+IffISVC9HYlWueJEBWED4ZH4aIAC2PnkdnuRrR94M+w6yGWn4AglWtJtBI8YqvgoA==}
+    engines: {node: ^12.20.0 || ^14.13.1 || >=16.0.0}
+    peerDependencies:
+      esbuild: '>=0.18'
+
+  c12@3.3.3:
+    resolution: {integrity: sha512-750hTRvgBy5kcMNPdh95Qo+XUBeGo8C7nsKSmedDmaQI+E0r82DwHeM6vBewDe4rGFbnxoa4V9pw+sPh5+Iz8Q==}
+    peerDependencies:
+      magicast: '*'
+    peerDependenciesMeta:
+      magicast:
+        optional: true
+
+  cac@6.7.14:
+    resolution: {integrity: sha512-b6Ilus+c3RrdDk+JhLKUAQfzzgLEPy6wcXqS7f/xe1EETvsDP6GORG7SFuOs6cID5YkqchW/LXZbX5bc8j7ZcQ==}
+    engines: {node: '>=8'}
+
+  call-bind-apply-helpers@1.0.2:
+    resolution: {integrity: sha512-Sp1ablJ0ivDkSzjcaJdxEunN5/XvksFJ2sMBFfq6x0ryhQV/2b/KwFe21cMpmHtPOSij8K99/wSfoEuTObmuMQ==}
+    engines: {node: '>= 0.4'}
+
+  call-bind@1.0.8:
+    resolution: {integrity: sha512-oKlSFMcMwpUg2ednkhQ454wfWiU/ul3CkJe/PEHcTKuiX6RpbehUiFMXu13HalGZxfUwCQzZG747YXBn1im9ww==}
+    engines: {node: '>= 0.4'}
+
+  call-bound@1.0.4:
+    resolution: {integrity: sha512-+ys997U96po4Kx/ABpBCqhA9EuxJaQWDQg7295H4hBphv3IZg0boBKuwYpt4YXp6MZ5AmZQnU/tyMTlRpaSejg==}
+    engines: {node: '>= 0.4'}
+
+  callsites@3.1.0:
+    resolution: {integrity: sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==}
+    engines: {node: '>=6'}
+
+  camelcase@8.0.0:
+    resolution: {integrity: sha512-8WB3Jcas3swSvjIeA2yvCJ+Miyz5l1ZmB6HFb9R1317dt9LCQoswg/BGrmAmkWVEszSrrg4RwmO46qIm2OEnSA==}
+    engines: {node: '>=16'}
+
+  caniuse-api@3.0.0:
+    resolution: {integrity: sha512-bsTwuIg/BZZK/vreVTYYbSWoe2F+71P7K5QGEX+pT250DZbfU1MQ5prOKpPR+LL6uWKK3KMwMCAS74QB3Um1uw==}
+
+  caniuse-lite@1.0.30001770:
+    resolution: {integrity: sha512-x/2CLQ1jHENRbHg5PSId2sXq1CIO1CISvwWAj027ltMVG2UNgW+w9oH2+HzgEIRFembL8bUlXtfbBHR1fCg2xw==}
+
+  ccount@2.0.1:
+    resolution: {integrity: sha512-eyrF0jiFpY+3drT6383f1qhkbGsLSifNAjA61IUjZjmLCWjItY6LB9ft9YhoDgwfmclB2zhu51Lc7+95b8NRAg==}
+
+  chai@6.2.2:
+    resolution: {integrity: sha512-NUPRluOfOiTKBKvWPtSD4PhFvWCqOi0BGStNWs57X9js7XGTprSmFoz5F0tWhR4WPjNeR9jXqdC7/UpSJTnlRg==}
+    engines: {node: '>=18'}
+
+  chalk@4.1.2:
+    resolution: {integrity: sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==}
+    engines: {node: '>=10'}
+
+  chalk@5.6.2:
+    resolution: {integrity: sha512-7NzBL0rN6fMUW+f7A6Io4h40qQlG+xGmtMxfbnH/K7TAtt8JQWVQK+6g0UXKMeVJoyV5EkkNsErQ8pVD3bLHbA==}
+    engines: {node: ^12.17.0 || ^14.13 || >=16.0.0}
+
+  character-entities-html4@2.1.0:
+    resolution: {integrity: sha512-1v7fgQRj6hnSwFpq1Eu0ynr/CDEw0rXo2B61qXrLNdHZmPKgb7fqS1a2JwF0rISo9q77jDI8VMEHoApn8qDoZA==}
+
+  character-entities-legacy@3.0.0:
+    resolution: {integrity: sha512-RpPp0asT/6ufRm//AJVwpViZbGM/MkjQFxJccQRHmISF/22NBtsHqAWmL+/pmkPWoIUJdWyeVleTl1wydHATVQ==}
+
+  chardet@2.1.1:
+    resolution: {integrity: sha512-PsezH1rqdV9VvyNhxxOW32/d75r01NY7TQCmOqomRo15ZSOKbpTFVsfjghxo6JloQUCGnH4k1LGu0R4yCLlWQQ==}
+
+  chokidar@4.0.3:
+    resolution: {integrity: sha512-Qgzu8kfBvo+cA4962jnP1KkS6Dop5NS6g7R5LFYJr4b8Ub94PPQXUksCw9PvXoeXPRRddRNC5C1JQUR2SMGtnA==}
+    engines: {node: '>= 14.16.0'}
+
+  chokidar@5.0.0:
+    resolution: {integrity: sha512-TQMmc3w+5AxjpL8iIiwebF73dRDF4fBIieAqGn9RGCWaEVwQ6Fb2cGe31Yns0RRIzii5goJ1Y7xbMwo1TxMplw==}
+    engines: {node: '>= 20.19.0'}
+
+  chownr@3.0.0:
+    resolution: {integrity: sha512-+IxzY9BZOQd/XuYPRmrvEVjF/nqj5kgT4kEq7VofrDoM1MxoRjEWkrCC3EtLi59TVawxTAn+orJwFQcrqEN1+g==}
+    engines: {node: '>=18'}
+
+  ci-info@3.9.0:
+    resolution: {integrity: sha512-NIxF55hv4nSqQswkAeiOi1r83xy8JldOFDTWiug55KBu9Jnblncd2U6ViHmYgHf01TPZS77NJBhBMKdWj9HQMQ==}
+    engines: {node: '>=8'}
+
+  citty@0.1.6:
+    resolution: {integrity: sha512-tskPPKEs8D2KPafUypv2gxwJP8h/OaJmC82QQGGDQcHvXX43xF2VDACcJVmZ0EuSxkpO9Kc4MlrA3q0+FG58AQ==}
+
+  citty@0.2.1:
+    resolution: {integrity: sha512-kEV95lFBhQgtogAPlQfJJ0WGVSokvLr/UEoFPiKKOXF7pl98HfUVUD0ejsuTCld/9xH9vogSywZ5KqHzXrZpqg==}
+
+  cli-boxes@3.0.0:
+    resolution: {integrity: sha512-/lzGpEWL/8PfI0BmBOPRwp0c/wFNX1RdUML3jK/RcSBA9T8mZDdQpqYBKtCFTOfQbwPqWEOpjqW+Fnayc0969g==}
+    engines: {node: '>=10'}
+
+  client-only@0.0.1:
+    resolution: {integrity: sha512-IV3Ou0jSMzZrd3pZ48nLkT9DA7Ag1pnPzaiQhpW7c3RbcqqzvzzVu+L8gfqMp/8IM2MQtSiqaCxrrcfu8I8rMA==}
+
+  clipboardy@4.0.0:
+    resolution: {integrity: sha512-5mOlNS0mhX0707P2I0aZ2V/cmHUEO/fL7VFLqszkhUsxt7RwnmrInf/eEQKlf5GzvYeHIjT+Ov1HRfNmymlG0w==}
+    engines: {node: '>=18'}
+
+  cliui@8.0.1:
+    resolution: {integrity: sha512-BSeNnyus75C4//NQ9gQt1/csTXyo/8Sb+afLAkzAptFuMsod9HFokGNudZpi/oQV73hnVK+sR+5PVRMd+Dr7YQ==}
+    engines: {node: '>=12'}
+
+  clsx@2.1.1:
+    resolution: {integrity: sha512-eYm0QWBtUrBWZWG0d386OGAw16Z995PiOVo2B7bjWSbHedGl5e0ZWaq65kOGgUSNesEIDkB9ISbTg/JK9dhCZA==}
+    engines: {node: '>=6'}
+
+  cluster-key-slot@1.1.2:
+    resolution: {integrity: sha512-RMr0FhtfXemyinomL4hrWcYJxmX6deFdCxpJzhDttxgO1+bcCnkk+9drydLVDmAMG7NE6aN/fl4F7ucU/90gAA==}
+    engines: {node: '>=0.10.0'}
+
+  color-convert@2.0.1:
+    resolution: {integrity: sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==}
+    engines: {node: '>=7.0.0'}
+
+  color-name@1.1.4:
+    resolution: {integrity: sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==}
+
+  colord@2.9.3:
+    resolution: {integrity: sha512-jeC1axXpnb0/2nn/Y1LPuLdgXBLH7aDcHu4KEKfqw3CUhX7ZpfBSlPKyqXE6btIgEzfWtrX3/tyBCaCvXvMkOw==}
+
+  colorjs.io@0.5.2:
+    resolution: {integrity: sha512-twmVoizEW7ylZSN32OgKdXRmo1qg+wT5/6C3xu5b9QsWzSFAhHLn2xd8ro0diCsKfCj1RdaTP/nrcW+vAoQPIw==}
+
+  comma-separated-tokens@2.0.3:
+    resolution: {integrity: sha512-Fu4hJdvzeylCfQPp9SGWidpzrMs7tTrlu6Vb8XGaRGck8QSNZJJp538Wrb60Lax4fPwR64ViY468OIUTbRlGZg==}
+
+  commander@11.1.0:
+    resolution: {integrity: sha512-yPVavfyCcRhmorC7rWlkHn15b4wDVgVmBA7kV4QVBsF7kv/9TKJAbAXVTxvTnwP8HHKjRCJDClKbciiYS7p0DQ==}
+    engines: {node: '>=16'}
+
+  commander@2.20.3:
+    resolution: {integrity: sha512-GpVkmM8vF2vQUkj2LvZmD35JxeJOLCwJ9cUkugyk2nuhbv3+mJvpLYYt+0+USMxE+oj+ey/lJEnhZw75x/OMcQ==}
+
+  commander@4.1.1:
+    resolution: {integrity: sha512-NOKm8xhkzAjzFx8B2v5OAHT+u5pRQc2UCa2Vq9jYL/31o2wi9mxBA7LIFs3sV5VSC49z6pEhfbMULvShKj26WA==}
+    engines: {node: '>= 6'}
+
+  commondir@1.0.1:
+    resolution: {integrity: sha512-W9pAhw0ja1Edb5GVdIF1mjZw/ASI0AlShXM83UUGe2DVr5TdAPEA1OA8m/g8zWp9x6On7gqufY+FatDbC3MDQg==}
+
+  compatx@0.2.0:
+    resolution: {integrity: sha512-6gLRNt4ygsi5NyMVhceOCFv14CIdDFN7fQjX1U4+47qVE/+kjPoXMK65KWK+dWxmFzMTuKazoQ9sch6pM0p5oA==}
+
+  compress-commons@6.0.2:
+    resolution: {integrity: sha512-6FqVXeETqWPoGcfzrXb37E50NP0LXT8kAMu5ooZayhWWdgEY4lBEEcbQNXtkuKQsGduxiIcI4gOTsxTmuq/bSg==}
+    engines: {node: '>= 14'}
+
+  concat-map@0.0.1:
+    resolution: {integrity: sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg==}
+
+  confbox@0.1.8:
+    resolution: {integrity: sha512-RMtmw0iFkeR4YV+fUOSucriAQNb9g8zFR52MWCtl+cCZOFRNL6zeB395vPzFhEjjn4fMxXudmELnl/KF/WrK6w==}
+
+  confbox@0.2.4:
+    resolution: {integrity: sha512-ysOGlgTFbN2/Y6Cg3Iye8YKulHw+R2fNXHrgSmXISQdMnomY6eNDprVdW9R5xBguEqI954+S6709UyiO7B+6OQ==}
+
+  consola@3.4.2:
+    resolution: {integrity: sha512-5IKcdX0nnYavi6G7TtOhwkYzyjfJlatbjMjuLSfE2kYT5pMDOilZ4OvMhi637CcDICTmz3wARPoyhqyX1Y+XvA==}
+    engines: {node: ^14.18.0 || >=16.10.0}
+
+  convert-source-map@2.0.0:
+    resolution: {integrity: sha512-Kvp459HrV2FEJ1CAsi1Ku+MY3kasH19TFykTz2xWmMeq6bk2NU3XXvfJ+Q61m0xktWwt+1HSYf3JZsTms3aRJg==}
+
+  cookie-es@1.2.2:
+    resolution: {integrity: sha512-+W7VmiVINB+ywl1HGXJXmrqkOhpKrIiVZV6tQuV54ZyQC7MMuBt81Vc336GMLoHBq5hV/F9eXgt5Mnx0Rha5Fg==}
+
+  cookie-es@2.0.0:
+    resolution: {integrity: sha512-RAj4E421UYRgqokKUmotqAwuplYw15qtdXfY+hGzgCJ/MBjCVZcSoHK/kH9kocfjRjcDME7IiDWR/1WX1TM2Pg==}
+
+  cookie@0.6.0:
+    resolution: {integrity: sha512-U71cyTamuh1CRNCfpGY6to28lxvNwPG4Guz/EVjgf3Jmzv0vlDp1atT9eS5dDjMYHucpHbWns6Lwf3BKz6svdw==}
+    engines: {node: '>= 0.6'}
+
+  copy-anything@4.0.5:
+    resolution: {integrity: sha512-7Vv6asjS4gMOuILabD3l739tsaxFQmC+a7pLZm02zyvs8p977bL3zEgq3yDk5rn9B0PbYgIv++jmHcuUab4RhA==}
+    engines: {node: '>=18'}
+
+  copy-paste@2.2.0:
+    resolution: {integrity: sha512-jqSL4r9DSeiIvJZStLzY/sMLt9ToTM7RsK237lYOTG+KcbQJHGala3R1TUpa8h1p9adswVgIdV4qGbseVhL4lg==}
+
+  core-util-is@1.0.3:
+    resolution: {integrity: sha512-ZQBvi1DcpJ4GDqanjucZ2Hj3wEO5pZDS89BWbkcrvdxksJorwUDDZamX9ldFkp9aw2lmBDLgkObEA4DWNJ9FYQ==}
+
+  crc-32@1.2.2:
+    resolution: {integrity: sha512-ROmzCKrTnOwybPcJApAA6WBWij23HVfGVNKqqrZpuyZOHqK2CwHSvpGuyt/UNNvaIjEd8X5IFGp4Mh+Ie1IHJQ==}
+    engines: {node: '>=0.8'}
+    hasBin: true
+
+  crc32-stream@6.0.0:
+    resolution: {integrity: sha512-piICUB6ei4IlTv1+653yq5+KoqfBYmj9bw6LqXoOneTMDXk5nM1qt12mFW1caG3LlJXEKW1Bp0WggEmIfQB34g==}
+    engines: {node: '>= 14'}
+
+  croner@9.1.0:
+    resolution: {integrity: sha512-p9nwwR4qyT5W996vBZhdvBCnMhicY5ytZkR4D1Xj0wuTDEiMnjwR57Q3RXYY/s0EpX6Ay3vgIcfaR+ewGHsi+g==}
+    engines: {node: '>=18.0'}
+
+  cross-spawn@7.0.6:
+    resolution: {integrity: sha512-uV2QOWP2nWzsy2aMp8aRibhi9dlzF5Hgh5SHaB9OiTGEyDTiJJyx0uy51QXdyWbtAHNua4XJzUKca3OzKUd3vA==}
+    engines: {node: '>= 8'}
+
+  crossws@0.3.5:
+    resolution: {integrity: sha512-ojKiDvcmByhwa8YYqbQI/hg7MEU0NC03+pSdEq4ZUnZR9xXpwk7E43SMNGkn+JxJGPFtNvQ48+vV2p+P1ml5PA==}
+
+  css-declaration-sorter@7.3.1:
+    resolution: {integrity: sha512-gz6x+KkgNCjxq3Var03pRYLhyNfwhkKF1g/yoLgDNtFvVu0/fOLV9C8fFEZRjACp/XQLumjAYo7JVjzH3wLbxA==}
+    engines: {node: ^14 || ^16 || >=18}
+    peerDependencies:
+      postcss: ^8.0.9
+
+  css-select@5.2.2:
+    resolution: {integrity: sha512-TizTzUddG/xYLA3NXodFM0fSbNizXjOKhqiQQwvhlspadZokn1KDy0NZFS0wuEubIYAV5/c1/lAr0TaaFXEXzw==}
+
+  css-tree@2.2.1:
+    resolution: {integrity: sha512-OA0mILzGc1kCOCSJerOeqDxDQ4HOh+G8NbOJFOTgOCzpw7fCBubk0fEyxp8AgOL/jvLgYA/uV0cMbe43ElF1JA==}
+    engines: {node: ^10 || ^12.20.0 || ^14.13.0 || >=15.0.0, npm: '>=7.0.0'}
+
+  css-tree@3.1.0:
+    resolution: {integrity: sha512-0eW44TGN5SQXU1mWSkKwFstI/22X2bG1nYzZTYMAWjylYURhse752YgbE4Cx46AC+bAvI+/dYTPRk1LqSUnu6w==}
+    engines: {node: ^10 || ^12.20.0 || ^14.13.0 || >=15.0.0}
+
+  css-what@6.2.2:
+    resolution: {integrity: sha512-u/O3vwbptzhMs3L1fQE82ZSLHQQfto5gyZzwteVIEyeaY5Fc7R4dapF/BvRoSYFeqfBk4m0V1Vafq5Pjv25wvA==}
+    engines: {node: '>= 6'}
+
+  cssesc@3.0.0:
+    resolution: {integrity: sha512-/Tb/JcjK111nNScGob5MNtsntNM1aCNUDipB/TkwZFhyDrrE47SOx/18wF2bbjgc3ZzCSKW1T5nt5EbFoAz/Vg==}
+    engines: {node: '>=4'}
+    hasBin: true
+
+  cssnano-preset-default@7.0.10:
+    resolution: {integrity: sha512-6ZBjW0Lf1K1Z+0OKUAUpEN62tSXmYChXWi2NAA0afxEVsj9a+MbcB1l5qel6BHJHmULai2fCGRthCeKSFbScpA==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  cssnano-utils@5.0.1:
+    resolution: {integrity: sha512-ZIP71eQgG9JwjVZsTPSqhc6GHgEr53uJ7tK5///VfyWj6Xp2DBmixWHqJgPno+PqATzn48pL42ww9x5SSGmhZg==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  cssnano@7.1.2:
+    resolution: {integrity: sha512-HYOPBsNvoiFeR1eghKD5C3ASm64v9YVyJB4Ivnl2gqKoQYvjjN/G0rztvKQq8OxocUtC6sjqY8jwYngIB4AByA==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  csso@5.0.5:
+    resolution: {integrity: sha512-0LrrStPOdJj+SPCCrGhzryycLjwcgUSHBtxNA8aIDxf0GLsRh1cKYhB00Gd1lDOS4yGH69+SNn13+TWbVHETFQ==}
+    engines: {node: ^10 || ^12.20.0 || ^14.13.0 || >=15.0.0, npm: '>=7.0.0'}
+
+  csstype@3.2.3:
+    resolution: {integrity: sha512-z1HGKcYy2xA8AGQfwrn0PAy+PB7X/GSj3UVJW9qKyn43xWa+gl5nXmU4qqLMRzWVLFC8KusUX8T/0kCiOYpAIQ==}
+
+  damerau-levenshtein@1.0.8:
+    resolution: {integrity: sha512-sdQSFB7+llfUcQHUQO3+B8ERRj0Oa4w9POWMI/puGtuf7gFywGmkaLCElnudfTiKZV+NvHqL0ifzdrI8Ro7ESA==}
+
+  data-view-buffer@1.0.2:
+    resolution: {integrity: sha512-EmKO5V3OLXh1rtK2wgXRansaK1/mtVdTUEiEI0W8RkvgT05kfxaH29PliLnpLP73yYO6142Q72QNa8Wx/A5CqQ==}
+    engines: {node: '>= 0.4'}
+
+  data-view-byte-length@1.0.2:
+    resolution: {integrity: sha512-tuhGbE6CfTM9+5ANGf+oQb72Ky/0+s3xKUpHvShfiz2RxMFgFPjsXuRLBVMtvMs15awe45SRb83D6wH4ew6wlQ==}
+    engines: {node: '>= 0.4'}
+
+  data-view-byte-offset@1.0.1:
+    resolution: {integrity: sha512-BS8PfmtDGnrgYdOonGZQdLZslWIeCGFP9tpan0hi1Co2Zr2NKADsvGYA8XxuG/4UWgJ6Cjtv+YJnB6MM69QGlQ==}
+    engines: {node: '>= 0.4'}
+
+  dax-sh@0.43.2:
+    resolution: {integrity: sha512-uULa1sSIHgXKGCqJ/pA0zsnzbHlVnuq7g8O2fkHokWFNwEGIhh5lAJlxZa1POG5En5ba7AU4KcBAvGQWMMf8rg==}
+    deprecated: This package has moved to simply be 'dax' instead of 'dax-sh'
+
+  db0@0.3.4:
+    resolution: {integrity: sha512-RiXXi4WaNzPTHEOu8UPQKMooIbqOEyqA1t7Z6MsdxSCeb8iUC9ko3LcmsLmeUt2SM5bctfArZKkRQggKZz7JNw==}
+    peerDependencies:
+      '@electric-sql/pglite': '*'
+      '@libsql/client': '*'
+      better-sqlite3: '*'
+      drizzle-orm: '*'
+      mysql2: '*'
+      sqlite3: '*'
+    peerDependenciesMeta:
+      '@electric-sql/pglite':
+        optional: true
+      '@libsql/client':
+        optional: true
+      better-sqlite3:
+        optional: true
+      drizzle-orm:
+        optional: true
+      mysql2:
+        optional: true
+      sqlite3:
+        optional: true
+
+  debug@2.6.9:
+    resolution: {integrity: sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==}
+    peerDependencies:
+      supports-color: '*'
+    peerDependenciesMeta:
+      supports-color:
+        optional: true
+
+  debug@3.2.7:
+    resolution: {integrity: sha512-CFjzYYAi4ThfiQvizrFQevTTXHtnCqWfe7x1AhgEscTz6ZbLbfoLRLPugTQyBth6f8ZERVUSyWHFD/7Wu4t1XQ==}
+    peerDependencies:
+      supports-color: '*'
+    peerDependenciesMeta:
+      supports-color:
+        optional: true
+
+  debug@4.4.3:
+    resolution: {integrity: sha512-RGwwWnwQvkVfavKVt22FGLw+xYSdzARwm0ru6DhTVA3umU5hZc28V3kO4stgYryrTlLpuvgI9GiijltAjNbcqA==}
+    engines: {node: '>=6.0'}
+    peerDependencies:
+      supports-color: '*'
+    peerDependenciesMeta:
+      supports-color:
+        optional: true
+
+  deep-is@0.1.4:
+    resolution: {integrity: sha512-oIPzksmTg4/MriiaYGO+okXDT7ztn/w3Eptv/+gSIdMdKsJo0u4CfYNFJPy+4SKMuCqGw2wxnA+URMg3t8a/bQ==}
+
+  deepmerge@4.3.1:
+    resolution: {integrity: sha512-3sUqbMEc77XqpdNO7FRyRog+eW3ph+GYCbj+rK+uYyRMuwsVy0rMiVtPn+QJlKFvWP/1PYpapqYn0Me2knFn+A==}
+    engines: {node: '>=0.10.0'}
+
+  default-browser-id@5.0.1:
+    resolution: {integrity: sha512-x1VCxdX4t+8wVfd1so/9w+vQ4vx7lKd2Qp5tDRutErwmR85OgmfX7RlLRMWafRMY7hbEiXIbudNrjOAPa/hL8Q==}
+    engines: {node: '>=18'}
+
+  default-browser@5.5.0:
+    resolution: {integrity: sha512-H9LMLr5zwIbSxrmvikGuI/5KGhZ8E2zH3stkMgM5LpOWDutGM2JZaj460Udnf1a+946zc7YBgrqEWwbk7zHvGw==}
+    engines: {node: '>=18'}
+
+  define-data-property@1.1.4:
+    resolution: {integrity: sha512-rBMvIzlpA8v6E+SJZoo++HAYqsLrkg7MSfIinMPFhmkorw7X+dOXVJQs+QT69zGkzMyfDnIMN2Wid1+NbL3T+A==}
+    engines: {node: '>= 0.4'}
+
+  define-lazy-prop@2.0.0:
+    resolution: {integrity: sha512-Ds09qNh8yw3khSjiJjiUInaGX9xlqZDY7JVryGxdxV7NPeuqQfplOpQ66yJFZut3jLa5zOwkXw1g9EI2uKh4Og==}
+    engines: {node: '>=8'}
+
+  define-lazy-prop@3.0.0:
+    resolution: {integrity: sha512-N+MeXYoqr3pOgn8xfyRPREN7gHakLYjhsHhWGT3fWAiL4IkAt0iDw14QiiEm2bE30c5XX5q0FtAA3CK5f9/BUg==}
+    engines: {node: '>=12'}
+
+  define-properties@1.2.1:
+    resolution: {integrity: sha512-8QmQKqEASLd5nx0U1B1okLElbUuuttJ/AnYmRXbbbGDWh6uS208EjD4Xqq/I9wK7u0v6O08XhTWnt5XtEbR6Dg==}
+    engines: {node: '>= 0.4'}
+
+  defu@6.1.4:
+    resolution: {integrity: sha512-mEQCMmwJu317oSz8CwdIOdwf3xMif1ttiM8LTufzc3g6kR+9Pe236twL8j3IYT1F7GfRgGcW6MWxzZjLIkuHIg==}
+
+  denque@2.1.0:
+    resolution: {integrity: sha512-HVQE3AAb/pxF8fQAoiqpvg9i3evqug3hoiwakOyZAwJm+6vZehbkYXZ0l4JxS+I3QxM97v5aaRNhj8v5oBhekw==}
+    engines: {node: '>=0.10'}
+
+  depd@2.0.0:
+    resolution: {integrity: sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw==}
+    engines: {node: '>= 0.8'}
+
+  dequal@2.0.3:
+    resolution: {integrity: sha512-0je+qPKHEMohvfRTCEo3CrPG6cAzAYgmzKyxRiYSSDkS6eGJdyVJm7WaYA5ECaAD9wLB2T4EEeymA5aFVcYXCA==}
+    engines: {node: '>=6'}
+
+  destr@2.0.5:
+    resolution: {integrity: sha512-ugFTXCtDZunbzasqBxrK93Ik/DRYsO6S/fedkWEMKqt04xZ4csmnmwGDBAb07QWNaGMAmnTIemsYZCksjATwsA==}
+
+  destroy@1.2.0:
+    resolution: {integrity: sha512-2sJGJTaXIIaR1w4iJSNoN0hnMY7Gpc/n8D4qSCJw8QqFWXf7cuAgnEHxBpweaVcPevC2l3KpjYCx3NypQQgaJg==}
+    engines: {node: '>= 0.8', npm: 1.2.8000 || >= 1.4.16}
+
+  detect-indent@6.1.0:
+    resolution: {integrity: sha512-reYkTUJAZb9gUuZ2RvVCNhVHdg62RHnJ7WJl8ftMi4diZ6NWlciOzQN88pUhSELEwflJht4oQDv0F0BMlwaYtA==}
+    engines: {node: '>=8'}
+
+  detect-libc@2.1.2:
+    resolution: {integrity: sha512-Btj2BOOO83o3WyH59e8MgXsxEQVcarkUOpEYrubB0urwnN10yQ364rsiByU11nZlqWYZm05i/of7io4mzihBtQ==}
+    engines: {node: '>=8'}
+
+  devalue@5.6.3:
+    resolution: {integrity: sha512-nc7XjUU/2Lb+SvEFVGcWLiKkzfw8+qHI7zn8WYXKkLMgfGSHbgCEaR6bJpev8Cm6Rmrb19Gfd/tZvGqx9is3wg==}
+
+  devlop@1.1.0:
+    resolution: {integrity: sha512-RWmIqhcFf1lRYBvNmr7qTNuyCt/7/ns2jbpp1+PalgE/rDQcBT0fioSMUpJ93irlUhC5hrg4cYqe6U+0ImW0rA==}
+
+  diff@8.0.3:
+    resolution: {integrity: sha512-qejHi7bcSD4hQAZE0tNAawRK1ZtafHDmMTMkrrIGgSLl7hTnQHmKCeB45xAcbfTqK2zowkM3j3bHt/4b/ARbYQ==}
+    engines: {node: '>=0.3.1'}
+
+  dir-glob@3.0.1:
+    resolution: {integrity: sha512-WkrWp9GR4KXfKGYzOLmTuGVi1UWFfws377n9cc55/tb6DuqyF6pcQ5AbiHEshaDpY9v6oaSr2XCDidGmMwdzIA==}
+    engines: {node: '>=8'}
+
+  doctrine@2.1.0:
+    resolution: {integrity: sha512-35mSku4ZXK0vfCuHEDAwt55dg2jNajHZ1odvF+8SSr82EsZY4QmXfuWso8oEd8zRhVObSN18aM0CjSdoBX7zIw==}
+    engines: {node: '>=0.10.0'}
+
+  dom-serializer@2.0.0:
+    resolution: {integrity: sha512-wIkAryiqt/nV5EQKqQpo3SToSOV9J0DnbJqwK7Wv/Trc92zIAYZ4FlMu+JPFW1DfGFt81ZTCGgDEabffXeLyJg==}
+
+  domelementtype@2.3.0:
+    resolution: {integrity: sha512-OLETBj6w0OsagBwdXnPdN0cnMfF9opN69co+7ZrbfPGrdpPVNBUj02spi6B1N7wChLQiPn4CSH/zJvXw56gmHw==}
+
+  domhandler@5.0.3:
+    resolution: {integrity: sha512-cgwlv/1iFQiFnU96XXgROh8xTeetsnJiDsTc7TYCLFd9+/WNkIqPTxiM/8pSd8VIrhXGTf1Ny1q1hquVqDJB5w==}
+    engines: {node: '>= 4'}
+
+  domutils@3.2.2:
+    resolution: {integrity: sha512-6kZKyUajlDuqlHKVX1w7gyslj9MPIXzIFiz/rGu35uC1wMi+kMhQwGhl4lt9unC9Vb9INnY9Z3/ZA3+FhASLaw==}
+
+  dot-prop@10.1.0:
+    resolution: {integrity: sha512-MVUtAugQMOff5RnBy2d9N31iG0lNwg1qAoAOn7pOK5wf94WIaE3My2p3uwTQuvS2AcqchkcR3bHByjaM0mmi7Q==}
+    engines: {node: '>=20'}
+
+  dotenv@17.3.1:
+    resolution: {integrity: sha512-IO8C/dzEb6O3F9/twg6ZLXz164a2fhTnEWb95H23Dm4OuN+92NmEAlTrupP9VW6Jm3sO26tQlqyvyi4CsnY9GA==}
+    engines: {node: '>=12'}
+
+  dunder-proto@1.0.1:
+    resolution: {integrity: sha512-KIN/nDJBQRcXw0MLVhZE9iQHmG68qAVIBg9CqmUYjmQIhgij9U5MFvrqkUL5FbtyyzZuOeOt0zdeRe4UY7ct+A==}
+    engines: {node: '>= 0.4'}
+
+  duplexer@0.1.2:
+    resolution: {integrity: sha512-jtD6YG370ZCIi/9GTaJKQxWTZD045+4R4hTk/x1UyoqadyJ9x9CgSi1RlVDQF8U2sxLLSnFkCaMihqljHIWgMg==}
+
+  eastasianwidth@0.2.0:
+    resolution: {integrity: sha512-I88TYZWc9XiYHRQ4/3c5rjjfgkjhLyW2luGIheGERbNQ6OY7yTybanSpDXZa8y7VUP9YmDcYa+eyq4ca7iLqWA==}
+
+  ee-first@1.1.1:
+    resolution: {integrity: sha512-WMwm9LhRUo+WUaRN+vRuETqG89IgZphVSNkdFgeb6sS/E4OrDIN7t48CAewSHXc6C8lefD8KKfr5vY61brQlow==}
+
+  electron-to-chromium@1.5.286:
+    resolution: {integrity: sha512-9tfDXhJ4RKFNerfjdCcZfufu49vg620741MNs26a9+bhLThdB+plgMeou98CAaHu/WATj2iHOOHTp1hWtABj2A==}
+
+  emoji-regex-xs@1.0.0:
+    resolution: {integrity: sha512-LRlerrMYoIDrT6jgpeZ2YYl/L8EulRTt5hQcYjy5AInh7HWXKimpqx68aknBFpGL2+/IcogTcaydJEgaTmOpDg==}
+
+  emoji-regex@10.6.0:
+    resolution: {integrity: sha512-toUI84YS5YmxW219erniWD0CIVOo46xGKColeNQRgOzDorgBi1v4D71/OFzgD9GO2UGKIv1C3Sp8DAn0+j5w7A==}
+
+  emoji-regex@8.0.0:
+    resolution: {integrity: sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==}
+
+  emoji-regex@9.2.2:
+    resolution: {integrity: sha512-L18DaJsXSUk2+42pv8mLs5jJT2hqFkFE4j21wOmgbUqsZ2hL72NsUU785g9RXgo3s0ZNgVl42TiHp3ZtOv/Vyg==}
+
+  encodeurl@2.0.0:
+    resolution: {integrity: sha512-Q0n9HRi4m6JuGIV1eFlmvJB7ZEVxu93IrMyiMsGC0lrMJMWzRgx6WGquyfQgZVb31vhGgXnfmPNNXmxnOkRBrg==}
+    engines: {node: '>= 0.8'}
+
+  enhanced-resolve@5.19.0:
+    resolution: {integrity: sha512-phv3E1Xl4tQOShqSte26C7Fl84EwUdZsyOuSSk9qtAGyyQs2s3jJzComh+Abf4g187lUUAvH+H26omrqia2aGg==}
+    engines: {node: '>=10.13.0'}
+
+  enquirer@2.4.1:
+    resolution: {integrity: sha512-rRqJg/6gd538VHvR3PSrdRBb/1Vy2YfzHqzvbhGIQpDRKIa4FgV/54b5Q1xYSxOOwKvjXweS26E0Q+nAMwp2pQ==}
+    engines: {node: '>=8.6'}
+
+  entities@4.5.0:
+    resolution: {integrity: sha512-V0hjH4dGPh9Ao5p0MoRY6BVqtwCjhz6vI5LT8AJ55H+4g9/4vbHx1I54fS0XuclLhDHArPQCiMjDxjaL8fPxhw==}
+    engines: {node: '>=0.12'}
+
+  entities@6.0.1:
+    resolution: {integrity: sha512-aN97NXWF6AWBTahfVOIrB/NShkzi5H7F9r1s9mD3cDj4Ko5f2qhhVoYMibXF7GlLveb/D2ioWay8lxI97Ven3g==}
+    engines: {node: '>=0.12'}
+
+  entities@7.0.1:
+    resolution: {integrity: sha512-TWrgLOFUQTH994YUyl1yT4uyavY5nNB5muff+RtWaqNVCAK408b5ZnnbNAUEWLTCpum9w6arT70i1XdQ4UeOPA==}
+    engines: {node: '>=0.12'}
+
+  error-stack-parser-es@1.0.5:
+    resolution: {integrity: sha512-5qucVt2XcuGMcEGgWI7i+yZpmpByQ8J1lHhcL7PwqCwu9FPP3VUXzT4ltHe5i2z9dePwEHcDVOAfSnHsOlCXRA==}
+
+  error-stack-parser@2.1.4:
+    resolution: {integrity: sha512-Sk5V6wVazPhq5MhpO+AUxJn5x7XSXGl1R93Vn7i+zS15KDVxQijejNCrz8340/2bgLBjR9GtEG8ZVKONDjcqGQ==}
+
+  errx@0.1.0:
+    resolution: {integrity: sha512-fZmsRiDNv07K6s2KkKFTiD2aIvECa7++PKyD5NC32tpRw46qZA3sOz+aM+/V9V0GDHxVTKLziveV4JhzBHDp9Q==}
+
+  es-abstract@1.24.1:
+    resolution: {integrity: sha512-zHXBLhP+QehSSbsS9Pt23Gg964240DPd6QCf8WpkqEXxQ7fhdZzYsocOr5u7apWonsS5EjZDmTF+/slGMyasvw==}
+    engines: {node: '>= 0.4'}
+
+  es-define-property@1.0.1:
+    resolution: {integrity: sha512-e3nRfgfUZ4rNGL232gUgX06QNyyez04KdjFrF+LTRoOXmrOgFKDg4BCdsjW8EnT69eqdYGmRpJwiPVYNrCaW3g==}
+    engines: {node: '>= 0.4'}
+
+  es-errors@1.3.0:
+    resolution: {integrity: sha512-Zf5H2Kxt2xjTvbJvP2ZWLEICxA6j+hAmMzIlypy4xcBg1vKVnx89Wy0GbS+kf5cwCVFFzdCFh2XSCFNULS6csw==}
+    engines: {node: '>= 0.4'}
+
+  es-iterator-helpers@1.2.2:
+    resolution: {integrity: sha512-BrUQ0cPTB/IwXj23HtwHjS9n7O4h9FX94b4xc5zlTHxeLgTAdzYUDyy6KdExAl9lbN5rtfe44xpjpmj9grxs5w==}
+    engines: {node: '>= 0.4'}
+
+  es-module-lexer@1.7.0:
+    resolution: {integrity: sha512-jEQoCwk8hyb2AZziIOLhDqpm5+2ww5uIE6lkO/6jcOCusfk6LhMHpXXfBLXTZ7Ydyt0j4VoUQv6uGNYbdW+kBA==}
+
+  es-module-lexer@2.0.0:
+    resolution: {integrity: sha512-5POEcUuZybH7IdmGsD8wlf0AI55wMecM9rVBTI/qEAy2c1kTOm3DjFYjrBdI2K3BaJjJYfYFeRtM0t9ssnRuxw==}
+
+  es-object-atoms@1.1.1:
+    resolution: {integrity: sha512-FGgH2h8zKNim9ljj7dankFPcICIK9Cp5bm+c2gQSYePhpaG5+esrLODihIorn+Pe6FGJzWhXQotPv73jTaldXA==}
+    engines: {node: '>= 0.4'}
+
+  es-set-tostringtag@2.1.0:
+    resolution: {integrity: sha512-j6vWzfrGVfyXxge+O0x5sh6cvxAog0a/4Rdd2K36zCMV5eJ+/+tOAngRO8cODMNWbVRdVlmGZQL2YS3yR8bIUA==}
+    engines: {node: '>= 0.4'}
+
+  es-shim-unscopables@1.1.0:
+    resolution: {integrity: sha512-d9T8ucsEhh8Bi1woXCf+TIKDIROLG5WCkxg8geBCbvk22kzwC5G2OnXVMO6FUsvQlgUUXQ2itephWDLqDzbeCw==}
+    engines: {node: '>= 0.4'}
+
+  es-to-primitive@1.3.0:
+    resolution: {integrity: sha512-w+5mJ3GuFL+NjVtJlvydShqE1eN3h3PbI7/5LAsYJP/2qtuMXjfL2LpHSRqo4b4eSF5K/DH1JXKUAHSB2UW50g==}
+    engines: {node: '>= 0.4'}
+
+  esbuild@0.25.12:
+    resolution: {integrity: sha512-bbPBYYrtZbkt6Os6FiTLCTFxvq4tt3JKall1vRwshA3fdVztsLAatFaZobhkBC8/BrPetoa0oksYoKXoG4ryJg==}
+    engines: {node: '>=18'}
+    hasBin: true
+
+  esbuild@0.27.3:
+    resolution: {integrity: sha512-8VwMnyGCONIs6cWue2IdpHxHnAjzxnw2Zr7MkVxB2vjmQ2ivqGFb4LEG3SMnv0Gb2F/G/2yA8zUaiL1gywDCCg==}
+    engines: {node: '>=18'}
+    hasBin: true
+
+  escalade@3.2.0:
+    resolution: {integrity: sha512-WUj2qlxaQtO4g6Pq5c29GTcWGDyd8itL8zTlipgECz3JesAiiOKotd8JU6otB3PACgG6xkJUyVhboMS+bje/jA==}
+    engines: {node: '>=6'}
+
+  escape-html@1.0.3:
+    resolution: {integrity: sha512-NiSupZ4OeuGwr68lGIeym/ksIZMJodUGOSCZ/FSnTxcrekbvqrgdUxlJOMpijaKZVjAJrWrGs/6Jy8OMuyj9ow==}
+
+  escape-string-regexp@4.0.0:
+    resolution: {integrity: sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==}
+    engines: {node: '>=10'}
+
+  escape-string-regexp@5.0.0:
+    resolution: {integrity: sha512-/veY75JbMK4j1yjvuUxuVsiS/hr/4iHs9FTT6cgTexxdE0Ly/glccBAkloH/DofkjRbZU3bnoj38mOmhkZ0lHw==}
+    engines: {node: '>=12'}
+
+  eslint-config-next@16.1.6:
+    resolution: {integrity: sha512-vKq40io2B0XtkkNDYyleATwblNt8xuh3FWp8SpSz3pt7P01OkBFlKsJZ2mWt5WsCySlDQLckb1zMY9yE9Qy0LA==}
+    peerDependencies:
+      eslint: '>=9.0.0'
+      typescript: '>=3.3.1'
+    peerDependenciesMeta:
+      typescript:
+        optional: true
+
+  eslint-import-resolver-node@0.3.9:
+    resolution: {integrity: sha512-WFj2isz22JahUv+B788TlO3N6zL3nNJGU8CcZbPZvVEkBPaJdCV4vy5wyghty5ROFbCRnm132v8BScu5/1BQ8g==}
+
+  eslint-import-resolver-typescript@3.10.1:
+    resolution: {integrity: sha512-A1rHYb06zjMGAxdLSkN2fXPBwuSaQ0iO5M/hdyS0Ajj1VBaRp0sPD3dn1FhME3c/JluGFbwSxyCfqdSbtQLAHQ==}
+    engines: {node: ^14.18.0 || >=16.0.0}
+    peerDependencies:
+      eslint: '*'
+      eslint-plugin-import: '*'
+      eslint-plugin-import-x: '*'
+    peerDependenciesMeta:
+      eslint-plugin-import:
+        optional: true
+      eslint-plugin-import-x:
+        optional: true
+
+  eslint-module-utils@2.12.1:
+    resolution: {integrity: sha512-L8jSWTze7K2mTg0vos/RuLRS5soomksDPoJLXIslC7c8Wmut3bx7CPpJijDcBZtxQ5lrbUdM+s0OlNbz0DCDNw==}
+    engines: {node: '>=4'}
+    peerDependencies:
+      '@typescript-eslint/parser': '*'
+      eslint: '*'
+      eslint-import-resolver-node: '*'
+      eslint-import-resolver-typescript: '*'
+      eslint-import-resolver-webpack: '*'
+    peerDependenciesMeta:
+      '@typescript-eslint/parser':
+        optional: true
+      eslint:
+        optional: true
+      eslint-import-resolver-node:
+        optional: true
+      eslint-import-resolver-typescript:
+        optional: true
+      eslint-import-resolver-webpack:
+        optional: true
+
+  eslint-plugin-import@2.32.0:
+    resolution: {integrity: sha512-whOE1HFo/qJDyX4SnXzP4N6zOWn79WhnCUY/iDR0mPfQZO8wcYE4JClzI2oZrhBnnMUCBCHZhO6VQyoBU95mZA==}
+    engines: {node: '>=4'}
+    peerDependencies:
+      '@typescript-eslint/parser': '*'
+      eslint: ^2 || ^3 || ^4 || ^5 || ^6 || ^7.2.0 || ^8 || ^9
+    peerDependenciesMeta:
+      '@typescript-eslint/parser':
+        optional: true
+
+  eslint-plugin-jsx-a11y@6.10.2:
+    resolution: {integrity: sha512-scB3nz4WmG75pV8+3eRUQOHZlNSUhFNq37xnpgRkCCELU3XMvXAxLk1eqWWyE22Ki4Q01Fnsw9BA3cJHDPgn2Q==}
+    engines: {node: '>=4.0'}
+    peerDependencies:
+      eslint: ^3 || ^4 || ^5 || ^6 || ^7 || ^8 || ^9
+
+  eslint-plugin-react-hooks@7.0.1:
+    resolution: {integrity: sha512-O0d0m04evaNzEPoSW+59Mezf8Qt0InfgGIBJnpC0h3NH/WjUAR7BIKUfysC6todmtiZ/A0oUVS8Gce0WhBrHsA==}
+    engines: {node: '>=18'}
+    peerDependencies:
+      eslint: ^3.0.0 || ^4.0.0 || ^5.0.0 || ^6.0.0 || ^7.0.0 || ^8.0.0-0 || ^9.0.0
+
+  eslint-plugin-react-refresh@0.4.26:
+    resolution: {integrity: sha512-1RETEylht2O6FM/MvgnyvT+8K21wLqDNg4qD51Zj3guhjt433XbnnkVttHMyaVyAFD03QSV4LPS5iE3VQmO7XQ==}
+    peerDependencies:
+      eslint: '>=8.40'
+
+  eslint-plugin-react@7.37.5:
+    resolution: {integrity: sha512-Qteup0SqU15kdocexFNAJMvCJEfa2xUKNV4CC1xsVMrIIqEy3SQ/rqyxCWNzfrd3/ldy6HMlD2e0JDVpDg2qIA==}
+    engines: {node: '>=4'}
+    peerDependencies:
+      eslint: ^3 || ^4 || ^5 || ^6 || ^7 || ^8 || ^9.7
+
+  eslint-scope@8.4.0:
+    resolution: {integrity: sha512-sNXOfKCn74rt8RICKMvJS7XKV/Xk9kA7DyJr8mJik3S7Cwgy3qlkkmyS2uQB3jiJg6VNdZd/pDBJu0nvG2NlTg==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+
+  eslint-visitor-keys@3.4.3:
+    resolution: {integrity: sha512-wpc+LXeiyiisxPlEkUzU6svyS1frIO3Mgxj1fdy7Pm8Ygzguax2N3Fa/D/ag1WqbOprdI+uY6wMUl8/a2G+iag==}
+    engines: {node: ^12.22.0 || ^14.17.0 || >=16.0.0}
+
+  eslint-visitor-keys@4.2.1:
+    resolution: {integrity: sha512-Uhdk5sfqcee/9H/rCOJikYz67o0a2Tw2hGRPOG2Y1R2dg7brRe1uG0yaNQDHu+TO/uQPF/5eCapvYSmHUjt7JQ==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+
+  eslint-visitor-keys@5.0.0:
+    resolution: {integrity: sha512-A0XeIi7CXU7nPlfHS9loMYEKxUaONu/hTEzHTGba9Huu94Cq1hPivf+DE5erJozZOky0LfvXAyrV/tcswpLI0Q==}
+    engines: {node: ^20.19.0 || ^22.13.0 || >=24}
+
+  eslint@9.39.2:
+    resolution: {integrity: sha512-LEyamqS7W5HB3ujJyvi0HQK/dtVINZvd5mAAp9eT5S/ujByGjiZLCzPcHVzuXbpJDJF/cxwHlfceVUDZ2lnSTw==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+    hasBin: true
+    peerDependencies:
+      jiti: '*'
+    peerDependenciesMeta:
+      jiti:
+        optional: true
+
+  esm-env@1.2.2:
+    resolution: {integrity: sha512-Epxrv+Nr/CaL4ZcFGPJIYLWFom+YeV1DqMLHJoEd9SYRxNbaFruBwfEX/kkHUJf55j2+TUbmDcmuilbP1TmXHA==}
+
+  espree@10.4.0:
+    resolution: {integrity: sha512-j6PAQ2uUr79PZhBjP5C5fhl8e39FmRnOjsD5lGnWrFU8i2G776tBK7+nP8KuQUTTyAZUwfQqXAgrVH5MbH9CYQ==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+
+  esprima@4.0.1:
+    resolution: {integrity: sha512-eGuFFw7Upda+g4p+QHvnW0RyTX/SVeJBDM/gCtMARO0cLuT2HcEKnTPvhjV6aGeqrCB/sbNop0Kszm0jsaWU4A==}
+    engines: {node: '>=4'}
+    hasBin: true
+
+  esquery@1.7.0:
+    resolution: {integrity: sha512-Ap6G0WQwcU/LHsvLwON1fAQX9Zp0A2Y6Y/cJBl9r/JbW90Zyg4/zbG6zzKa2OTALELarYHmKu0GhpM5EO+7T0g==}
+    engines: {node: '>=0.10'}
+
+  esrap@2.2.3:
+    resolution: {integrity: sha512-8fOS+GIGCQZl/ZIlhl59htOlms6U8NvX6ZYgYHpRU/b6tVSh3uHkOHZikl3D4cMbYM0JlpBe+p/BkZEi8J9XIQ==}
+
+  esrecurse@4.3.0:
+    resolution: {integrity: sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==}
+    engines: {node: '>=4.0'}
+
+  estraverse@5.3.0:
+    resolution: {integrity: sha512-MMdARuVEQziNTeJD8DgMqmhwR11BRQ/cBP+pLtYdSTnf3MIO8fFeiINEbX36ZdNlfU/7A9f3gUw49B3oQsvwBA==}
+    engines: {node: '>=4.0'}
+
+  estree-walker@2.0.2:
+    resolution: {integrity: sha512-Rfkk/Mp/DL7JVje3u18FxFujQlTNR2q6QfMSMB7AvCBx91NGj/ba3kCfza0f6dVDbw7YlRf/nDrn7pQrCCyQ/w==}
+
+  estree-walker@3.0.3:
+    resolution: {integrity: sha512-7RUKfXgSMMkzt6ZuXmqapOurLGPPfgj6l9uRZ7lRGolvk0y2yocc35LdcxKC5PQZdn2DMqioAQ2NoWcrTKmm6g==}
+
+  esutils@2.0.3:
+    resolution: {integrity: sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g==}
+    engines: {node: '>=0.10.0'}
+
+  etag@1.8.1:
+    resolution: {integrity: sha512-aIL5Fx7mawVa300al2BnEE4iNvo1qETxLrPI/o05L7z6go7fCw1J6EQmbK4FmJ2AS7kgVF/KEZWufBfdClMcPg==}
+    engines: {node: '>= 0.6'}
+
+  event-target-shim@5.0.1:
+    resolution: {integrity: sha512-i/2XbnSz/uxRCU6+NdVJgKWDTM427+MqYbkQzD321DuCQJUqOuJKIA0IM2+W2xtYHdKOmZ4dR6fExsd4SXL+WQ==}
+    engines: {node: '>=6'}
+
+  eventemitter3@4.0.7:
+    resolution: {integrity: sha512-8guHBZCwKnFhYdHr2ysuRWErTwhoN2X8XELRlrRwpmfeY2jjuUN4taQMsULKUVo1K4DvZl+0pgfyoysHxvmvEw==}
+
+  events-universal@1.0.1:
+    resolution: {integrity: sha512-LUd5euvbMLpwOF8m6ivPCbhQeSiYVNb8Vs0fQ8QjXo0JTkEHpz8pxdQf0gStltaPpw0Cca8b39KxvK9cfKRiAw==}
+
+  events@3.3.0:
+    resolution: {integrity: sha512-mQw+2fkQbALzQ7V0MY0IqdnXNOeTtP4r0lN9z7AAawCXgqea7bDii20AYrIBrFd/Hx0M2Ocz6S111CaFkUcb0Q==}
+    engines: {node: '>=0.8.x'}
+
+  execa@8.0.1:
+    resolution: {integrity: sha512-VyhnebXciFV2DESc+p6B+y0LjSm0krU4OgJN44qFAhBY0TJ+1V61tYD2+wHusZ6F9n5K+vl8k0sTy7PEfV4qpg==}
+    engines: {node: '>=16.17'}
+
+  expect-type@1.3.0:
+    resolution: {integrity: sha512-knvyeauYhqjOYvQ66MznSMs83wmHrCycNEN6Ao+2AeYEfxUIkuiVxdEa1qlGEPK+We3n0THiDciYSsCcgW/DoA==}
+    engines: {node: '>=12.0.0'}
+
+  exsolve@1.0.8:
+    resolution: {integrity: sha512-LmDxfWXwcTArk8fUEnOfSZpHOJ6zOMUJKOtFLFqJLoKJetuQG874Uc7/Kki7zFLzYybmZhp1M7+98pfMqeX8yA==}
+
+  extendable-error@0.1.7:
+    resolution: {integrity: sha512-UOiS2in6/Q0FK0R0q6UY9vYpQ21mr/Qn1KOnte7vsACuNJf514WvCCUHSRCPcgjPT2bAhNIJdlE6bVap1GKmeg==}
+
+  fast-deep-equal@3.1.3:
+    resolution: {integrity: sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==}
+
+  fast-fifo@1.3.2:
+    resolution: {integrity: sha512-/d9sfos4yxzpwkDkuN7k2SqFKtYNmCTzgfEpz82x34IM9/zc8KGxQoXg1liNC/izpRM/MBdt44Nmx41ZWqk+FQ==}
+
+  fast-glob@3.3.1:
+    resolution: {integrity: sha512-kNFPyjhh5cKjrUltxs+wFx+ZkbRaxxmZ+X0ZU31SOsxCEtP9VPgtq2teZw1DebupL5GmDaNQ6yKMMVcM41iqDg==}
+    engines: {node: '>=8.6.0'}
+
+  fast-glob@3.3.3:
+    resolution: {integrity: sha512-7MptL8U0cqcFdzIzwOTHoilX9x5BrNqye7Z/LuC7kCMRio1EMSyqRK3BEAUD7sXRq4iT4AzTVuZdhgQ2TCvYLg==}
+    engines: {node: '>=8.6.0'}
+
+  fast-json-stable-stringify@2.1.0:
+    resolution: {integrity: sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw==}
+
+  fast-levenshtein@2.0.6:
+    resolution: {integrity: sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw==}
+
+  fast-npm-meta@1.2.1:
+    resolution: {integrity: sha512-vTHOCEbzcbQEfYL0sPzcz+HF5asxoy60tPBVaiYzsCfuyhbXZCSqXL+LgPGV22nuAYimoGMeDpywMQB4aOw8HQ==}
+
+  fastq@1.20.1:
+    resolution: {integrity: sha512-GGToxJ/w1x32s/D2EKND7kTil4n8OVk/9mycTc4VDza13lOvpUZTGX3mFSCtV9ksdGBVzvsyAVLM6mHFThxXxw==}
+
+  fdir@6.5.0:
+    resolution: {integrity: sha512-tIbYtZbucOs0BRGqPJkshJUYdL+SDH7dVM8gjy+ERp3WAUjLEFJE+02kanyHtwjWOnwrKYBiwAmM0p4kLJAnXg==}
+    engines: {node: '>=12.0.0'}
+    peerDependencies:
+      picomatch: ^3 || ^4
+    peerDependenciesMeta:
+      picomatch:
+        optional: true
+
+  file-entry-cache@8.0.0:
+    resolution: {integrity: sha512-XXTUwCvisa5oacNGRP9SfNtYBNAMi+RPwBFmblZEF7N7swHYQS6/Zfk7SRwx4D5j3CH211YNRco1DEMNVfZCnQ==}
+    engines: {node: '>=16.0.0'}
+
+  file-uri-to-path@1.0.0:
+    resolution: {integrity: sha512-0Zt+s3L7Vf1biwWZ29aARiVYLx7iMGnEUl9x33fbB/j3jR81u/O2LbqK+Bm1CDSNDKVtJ/YjwY7TUd5SkeLQLw==}
+
+  fill-range@7.1.1:
+    resolution: {integrity: sha512-YsGpe3WHLK8ZYi4tWDg2Jy3ebRz2rXowDxnld4bkQB00cc/1Zw9AWnC0i9ztDJitivtQvaI9KaLyKrc+hBW0yg==}
+    engines: {node: '>=8'}
+
+  find-up@4.1.0:
+    resolution: {integrity: sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==}
+    engines: {node: '>=8'}
+
+  find-up@5.0.0:
+    resolution: {integrity: sha512-78/PXT1wlLLDgTzDs7sjq9hzz0vXD+zn+7wypEe4fXQxCmdmqfGsEPQxmiCSQI3ajFV91bVSsvNtrJRiW6nGng==}
+    engines: {node: '>=10'}
+
+  fix-dts-default-cjs-exports@1.0.1:
+    resolution: {integrity: sha512-pVIECanWFC61Hzl2+oOCtoJ3F17kglZC/6N94eRWycFgBH35hHx0Li604ZIzhseh97mf2p0cv7vVrOZGoqhlEg==}
+
+  flat-cache@4.0.1:
+    resolution: {integrity: sha512-f7ccFPK3SXFHpx15UIGyRJ/FJQctuKZ0zVuN3frBo4HnK3cay9VEW0R6yPYFHC0AgqhukPzKjq22t5DmAyqGyw==}
+    engines: {node: '>=16'}
+
+  flatted@3.3.3:
+    resolution: {integrity: sha512-GX+ysw4PBCz0PzosHDepZGANEuFCMLrnRTiEy9McGjmkCQYwRq4A/X786G/fjM/+OjsWSU1ZrY5qyARZmO/uwg==}
+
+  follow-redirects@1.15.11:
+    resolution: {integrity: sha512-deG2P0JfjrTxl50XGCDyfI97ZGVCxIpfKYmfyrQ54n5FO/0gfIES8C/Psl6kWVDolizcaaxZJnTS0QSMxvnsBQ==}
+    engines: {node: '>=4.0'}
+    peerDependencies:
+      debug: '*'
+    peerDependenciesMeta:
+      debug:
+        optional: true
+
+  for-each@0.3.5:
+    resolution: {integrity: sha512-dKx12eRCVIzqCxFGplyFKJMPvLEWgmNtUrpTiJIR5u97zEhRG8ySrtboPHZXx7daLxQVrl643cTzbab2tkQjxg==}
+    engines: {node: '>= 0.4'}
+
+  foreground-child@3.3.1:
+    resolution: {integrity: sha512-gIXjKqtFuWEgzFRJA9WCQeSJLZDjgJUOMCMzxtvFq/37KojM1BFGufqsCy0r4qSQmYLsZYMeyRqzIWOMup03sw==}
+    engines: {node: '>=14'}
+
+  fraction.js@5.3.4:
+    resolution: {integrity: sha512-1X1NTtiJphryn/uLQz3whtY6jK3fTqoE3ohKs0tT+Ujr1W59oopxmoEh7Lu5p6vBaPbgoM0bzveAW4Qi5RyWDQ==}
+
+  fresh@0.5.2:
+    resolution: {integrity: sha512-zJ2mQYM18rEFOudeV4GShTGIQ7RbzA7ozbU9I/XBpm7kqgMywgmylMwXHxZJmkVoYkna9d2pVXVXPdYTP9ej8Q==}
+    engines: {node: '>= 0.6'}
+
+  fresh@2.0.0:
+    resolution: {integrity: sha512-Rx/WycZ60HOaqLKAi6cHRKKI7zxWbJ31MhntmtwMoaTeF7XFH9hhBp8vITaMidfljRQ6eYWCKkaTK+ykVJHP2A==}
+    engines: {node: '>= 0.8'}
+
+  fs-extra@7.0.1:
+    resolution: {integrity: sha512-YJDaCJZEnBmcbw13fvdAM9AwNOJwOzrE4pqMqBq5nFiEqXUqHwlK4B+3pUw6JNvfSPtX05xFHtYy/1ni01eGCw==}
+    engines: {node: '>=6 <7 || >=8'}
+
+  fs-extra@8.1.0:
+    resolution: {integrity: sha512-yhlQgA6mnOJUKOsRUFsgJdQCvkKhcz8tlZG5HBQfReYZy46OwLcY+Zia0mtdHsOo9y/hP+CxMN0TU9QxoOtG4g==}
+    engines: {node: '>=6 <7 || >=8'}
+
+  fsevents@2.3.2:
+    resolution: {integrity: sha512-xiqMQR4xAeHTuB9uWm+fFRcIOgKBMiOBP+eXiyT7jsgVCq1bkVygt00oASowB7EdtpOHaaPgKt812P9ab+DDKA==}
+    engines: {node: ^8.16.0 || ^10.6.0 || >=11.0.0}
+    os: [darwin]
+
+  fsevents@2.3.3:
+    resolution: {integrity: sha512-5xoDfX+fL7faATnagmWPpbFtwh/R77WmMMqqHGS65C3vvB0YHrgF+B1YmZ3441tMj5n63k0212XNoJwzlhffQw==}
+    engines: {node: ^8.16.0 || ^10.6.0 || >=11.0.0}
+    os: [darwin]
+
+  function-bind@1.1.2:
+    resolution: {integrity: sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==}
+
+  function.prototype.name@1.1.8:
+    resolution: {integrity: sha512-e5iwyodOHhbMr/yNrc7fDYG4qlbIvI5gajyzPnb5TCwyhjApznQh1BMFou9b30SevY43gCJKXycoCBjMbsuW0Q==}
+    engines: {node: '>= 0.4'}
+
+  functions-have-names@1.2.3:
+    resolution: {integrity: sha512-xckBUXyTIqT97tq2x2AMb+g163b5JFysYk0x4qxNFwbfQkmNZoiRHb6sPzI9/QV33WeuvVYBUIiD4NzNIyqaRQ==}
+
+  fuse.js@7.1.0:
+    resolution: {integrity: sha512-trLf4SzuuUxfusZADLINj+dE8clK1frKdmqiJNb1Es75fmI5oY6X2mxLVUciLLjxqw/xr72Dhy+lER6dGd02FQ==}
+    engines: {node: '>=10'}
+
+  fzf@0.5.2:
+    resolution: {integrity: sha512-Tt4kuxLXFKHy8KT40zwsUPUkg1CrsgY25FxA2U/j/0WgEDCk3ddc/zLTCCcbSHX9FcKtLuVaDGtGE/STWC+j3Q==}
+
+  generator-function@2.0.1:
+    resolution: {integrity: sha512-SFdFmIJi+ybC0vjlHN0ZGVGHc3lgE0DxPAT0djjVg+kjOnSqclqmj0KQ7ykTOLP6YxoqOvuAODGdcHJn+43q3g==}
+    engines: {node: '>= 0.4'}
+
+  gensync@1.0.0-beta.2:
+    resolution: {integrity: sha512-3hN7NaskYvMDLQY55gnW3NQ+mesEAepTqlg+VEbj7zzqEMBVNhzcGYYeqFo/TlYz6eQiFcp1HcsCZO+nGgS8zg==}
+    engines: {node: '>=6.9.0'}
+
+  get-caller-file@2.0.5:
+    resolution: {integrity: sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==}
+    engines: {node: 6.* || 8.* || >= 10.*}
+
+  get-east-asian-width@1.5.0:
+    resolution: {integrity: sha512-CQ+bEO+Tva/qlmw24dCejulK5pMzVnUOFOijVogd3KQs07HnRIgp8TGipvCCRT06xeYEbpbgwaCxglFyiuIcmA==}
+    engines: {node: '>=18'}
+
+  get-intrinsic@1.3.0:
+    resolution: {integrity: sha512-9fSjSaos/fRIVIp+xSJlE6lfwhES7LNtKaCBIamHsjr2na1BiABJPo0mOjjz8GJDURarmCPGqaiVg5mfjb98CQ==}
+    engines: {node: '>= 0.4'}
+
+  get-port-please@3.2.0:
+    resolution: {integrity: sha512-I9QVvBw5U/hw3RmWpYKRumUeaDgxTPd401x364rLmWBJcOQ753eov1eTgzDqRG9bqFIfDc7gfzcQEWrUri3o1A==}
+
+  get-proto@1.0.1:
+    resolution: {integrity: sha512-sTSfBjoXBp89JvIKIefqw7U2CCebsc74kiY6awiGogKtoSGbgjYE/G/+l9sF3MWFPNc9IcoOC4ODfKHfxFmp0g==}
+    engines: {node: '>= 0.4'}
+
+  get-stream@8.0.1:
+    resolution: {integrity: sha512-VaUJspBffn/LMCJVoMvSAdmscJyS1auj5Zulnn5UoYcY531UWmdwhRWkcGKnGU93m5HSXP9LP2usOryrBtQowA==}
+    engines: {node: '>=16'}
+
+  get-symbol-description@1.1.0:
+    resolution: {integrity: sha512-w9UMqWwJxHNOvoNzSJ2oPF5wvYcvP7jUvYzhp67yEhTi17ZDBBC1z9pTdGuzjD+EFIqLSYRweZjqfiPzQ06Ebg==}
+    engines: {node: '>= 0.4'}
+
+  get-tsconfig@4.13.6:
+    resolution: {integrity: sha512-shZT/QMiSHc/YBLxxOkMtgSid5HFoauqCE3/exfsEcwg1WkeqjG+V40yBbBrsD+jW2HDXcs28xOfcbm2jI8Ddw==}
+
+  giget@2.0.0:
+    resolution: {integrity: sha512-L5bGsVkxJbJgdnwyuheIunkGatUF/zssUoxxjACCseZYAVbaqdh9Tsmmlkl8vYan09H7sbvKt4pS8GqKLBrEzA==}
+    hasBin: true
+
+  giget@3.1.2:
+    resolution: {integrity: sha512-T2qUpKBHeUTwHcIhydgnJzhL0Hj785ms+JkxaaWQH9SDM/llXeewnOkfJcFShAHjWI+26hOChwUfCoupaXLm8g==}
+    hasBin: true
+
+  glob-parent@5.1.2:
+    resolution: {integrity: sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==}
+    engines: {node: '>= 6'}
+
+  glob-parent@6.0.2:
+    resolution: {integrity: sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A==}
+    engines: {node: '>=10.13.0'}
+
+  glob@10.5.0:
+    resolution: {integrity: sha512-DfXN8DfhJ7NH3Oe7cFmu3NCu1wKbkReJ8TorzSAFbSKrlNaQSKfIzqYqVY8zlbs2NLBbWpRiU52GX2PbaBVNkg==}
+    deprecated: Old versions of glob are not supported, and contain widely publicized security vulnerabilities, which have been fixed in the current version. Please update. Support for old versions may be purchased (at exorbitant rates) by contacting i@izs.me
+    hasBin: true
+
+  glob@13.0.5:
+    resolution: {integrity: sha512-BzXxZg24Ibra1pbQ/zE7Kys4Ua1ks7Bn6pKLkVPZ9FZe4JQS6/Q7ef3LG1H+k7lUf5l4T3PLSyYyYJVYUvfgTw==}
+    engines: {node: 20 || >=22}
+
+  global-directory@4.0.1:
+    resolution: {integrity: sha512-wHTUcDUoZ1H5/0iVqEudYW4/kAlN5cZ3j/bXn0Dpbizl9iaUVeWSHqiOjsgk6OW2bkLclbBjzewBz6weQ1zA2Q==}
+    engines: {node: '>=18'}
+
+  globals@14.0.0:
+    resolution: {integrity: sha512-oahGvuMGQlPw/ivIYBjVSrWAfWLBeku5tpPE2fOPLi+WHffIWbuh2tCjhyQhTBPMf5E9jDEH4FOmTYgYwbKwtQ==}
+    engines: {node: '>=18'}
+
+  globals@16.4.0:
+    resolution: {integrity: sha512-ob/2LcVVaVGCYN+r14cnwnoDPUufjiYgSqRhiFD0Q1iI4Odora5RE8Iv1D24hAz5oMophRGkGz+yuvQmmUMnMw==}
+    engines: {node: '>=18'}
+
+  globals@16.5.0:
+    resolution: {integrity: sha512-c/c15i26VrJ4IRt5Z89DnIzCGDn9EcebibhAOjw5ibqEHsE1wLUgkPn9RDmNcUKyU87GeaL633nyJ+pplFR2ZQ==}
+    engines: {node: '>=18'}
+
+  globalthis@1.0.4:
+    resolution: {integrity: sha512-DpLKbNU4WylpxJykQujfCcwYWiV/Jhm50Goo0wrVILAv5jOr9d+H+UR3PhSCD2rCCEIg0uc+G+muBTwD54JhDQ==}
+    engines: {node: '>= 0.4'}
+
+  globby@11.1.0:
+    resolution: {integrity: sha512-jhIXaOzy1sb8IyocaruWSn1TjmnBVs8Ayhcy83rmxNJ8q2uWKCAj3CnJY+KpGSXCueAPc0i05kVvVKtP1t9S3g==}
+    engines: {node: '>=10'}
+
+  globby@16.1.1:
+    resolution: {integrity: sha512-dW7vl+yiAJSp6aCekaVnVJxurRv7DCOLyXqEG3RYMYUg7AuJ2jCqPkZTA8ooqC2vtnkaMcV5WfFBMuEnTu1OQg==}
+    engines: {node: '>=20'}
+
+  gopd@1.2.0:
+    resolution: {integrity: sha512-ZUKRh6/kUFoAiTAtTYPZJ3hw9wNxx+BIBOijnlG9PnrJsCcSjs1wyyD6vJpaYtgnzDrKYRSqf3OO6Rfa93xsRg==}
+    engines: {node: '>= 0.4'}
+
+  graceful-fs@4.2.11:
+    resolution: {integrity: sha512-RbJ5/jmFcNNCcDV5o9eTnBLJ/HszWV0P73bc+Ff4nS/rJj+YaS6IGyiOL0VoBYX+l1Wrl3k63h/KrH+nhJ0XvQ==}
+
+  gzip-size@7.0.0:
+    resolution: {integrity: sha512-O1Ld7Dr+nqPnmGpdhzLmMTQ4vAsD+rHwMm1NLUmoUFFymBOMKxCCrtDxqdBRYXdeEPEi3SyoR4TizJLQrnKBNA==}
+    engines: {node: ^12.20.0 || ^14.13.1 || >=16.0.0}
+
+  h3@1.15.3:
+    resolution: {integrity: sha512-z6GknHqyX0h9aQaTx22VZDf6QyZn+0Nh+Ym8O/u0SGSkyF5cuTJYKlc8MkzW3Nzf9LE1ivcpmYC3FUGpywhuUQ==}
+
+  h3@1.15.5:
+    resolution: {integrity: sha512-xEyq3rSl+dhGX2Lm0+eFQIAzlDN6Fs0EcC4f7BNUmzaRX/PTzeuM+Tr2lHB8FoXggsQIeXLj8EDVgs5ywxyxmg==}
+
+  has-bigints@1.1.0:
+    resolution: {integrity: sha512-R3pbpkcIqv2Pm3dUwgjclDRVmWpTJW2DcMzcIhEXEx1oh/CEMObMm3KLmRJOdvhM7o4uQBnwr8pzRK2sJWIqfg==}
+    engines: {node: '>= 0.4'}
+
+  has-flag@4.0.0:
+    resolution: {integrity: sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==}
+    engines: {node: '>=8'}
+
+  has-property-descriptors@1.0.2:
+    resolution: {integrity: sha512-55JNKuIW+vq4Ke1BjOTjM2YctQIvCT7GFzHwmfZPGo5wnrgkid0YQtnAleFSqumZm4az3n2BS+erby5ipJdgrg==}
+
+  has-proto@1.2.0:
+    resolution: {integrity: sha512-KIL7eQPfHQRC8+XluaIw7BHUwwqL19bQn4hzNgdr+1wXoU0KKj6rufu47lhY7KbJR2C6T6+PfyN0Ea7wkSS+qQ==}
+    engines: {node: '>= 0.4'}
+
+  has-symbols@1.1.0:
+    resolution: {integrity: sha512-1cDNdwJ2Jaohmb3sg4OmKaMBwuC48sYni5HUw2DvsC8LjGTLK9h+eb1X6RyuOHe4hT0ULCW68iomhjUoKUqlPQ==}
+    engines: {node: '>= 0.4'}
+
+  has-tostringtag@1.0.2:
+    resolution: {integrity: sha512-NqADB8VjPFLM2V0VvHUewwwsw0ZWBaIdgo+ieHtK3hasLz4qeCRjYcqfB6AQrBggRKppKF8L52/VqdVsO47Dlw==}
+    engines: {node: '>= 0.4'}
+
+  hasown@2.0.2:
+    resolution: {integrity: sha512-0hJU9SCPvmMzIBdZFqNPXWa6dqh7WdH0cII9y+CyS8rG3nL48Bclra9HmKhVVUHyPWNH5Y7xDwAB7bfgSjkUMQ==}
+    engines: {node: '>= 0.4'}
+
+  hast-util-to-html@9.0.5:
+    resolution: {integrity: sha512-OguPdidb+fbHQSU4Q4ZiLKnzWo8Wwsf5bZfbvu7//a9oTYoqD/fWpe96NuHkoS9h0ccGOTe0C4NGXdtS0iObOw==}
+
+  hast-util-whitespace@3.0.0:
+    resolution: {integrity: sha512-88JUN06ipLwsnv+dVn+OIYOvAuvBMy/Qoi6O7mQHxdPXpjy+Cd6xRkWwux7DKO+4sYILtLBRIKgsdpS2gQc7qw==}
+
+  hermes-estree@0.25.1:
+    resolution: {integrity: sha512-0wUoCcLp+5Ev5pDW2OriHC2MJCbwLwuRx+gAqMTOkGKJJiBCLjtrvy4PWUGn6MIVefecRpzoOZ/UV6iGdOr+Cw==}
+
+  hermes-parser@0.25.1:
+    resolution: {integrity: sha512-6pEjquH3rqaI6cYAXYPcz9MS4rY6R4ngRgrgfDshRptUZIc3lw0MCIJIGDj9++mfySOuPTHB4nrSW99BCvOPIA==}
+
+  hookable@5.5.3:
+    resolution: {integrity: sha512-Yc+BQe8SvoXH1643Qez1zqLRmbA5rCL+sSmk6TVos0LWVfNIB7PGncdlId77WzLGSIB5KaWgTaNTs2lNVEI6VQ==}
+
+  hookable@6.0.1:
+    resolution: {integrity: sha512-uKGyY8BuzN/a5gvzvA+3FVWo0+wUjgtfSdnmjtrOVwQCZPHpHDH2WRO3VZSOeluYrHoDCiXFffZXs8Dj1ULWtw==}
+
+  html-entities@2.3.3:
+    resolution: {integrity: sha512-DV5Ln36z34NNTDgnz0EWGBLZENelNAtkiFA4kyNOG2tDI6Mz1uSWiq1wAKdyjnJwyDiDO7Fa2SO1CTxPXL8VxA==}
+
+  html-to-image@1.11.13:
+    resolution: {integrity: sha512-cuOPoI7WApyhBElTTb9oqsawRvZ0rHhaHwghRLlTuffoD1B2aDemlCruLeZrUIIdvG7gs9xeELEPm6PhuASqrg==}
+
+  html-void-elements@3.0.0:
+    resolution: {integrity: sha512-bEqo66MRXsUGxWHV5IP0PUiAWwoEjba4VCzg0LjFJBpchPaTfyfCKTG6bc5F8ucKec3q5y6qOdGyYTSBEvhCrg==}
+
+  http-errors@2.0.1:
+    resolution: {integrity: sha512-4FbRdAX+bSdmo4AUFuS0WNiPz8NgFt+r8ThgNWmlrjQjt1Q7ZR9+zTlce2859x4KSXrwIsaeTqDoKQmtP8pLmQ==}
+    engines: {node: '>= 0.8'}
+
+  http-proxy@1.18.1:
+    resolution: {integrity: sha512-7mz/721AbnJwIVbnaSv1Cz3Am0ZLT/UBwkC92VlxhXv/k/BBQfM2fXElQNC27BVGr0uwUpplYPQM9LnaBMR5NQ==}
+    engines: {node: '>=8.0.0'}
+
+  http-shutdown@1.2.2:
+    resolution: {integrity: sha512-S9wWkJ/VSY9/k4qcjG318bqJNruzE4HySUhFYknwmu6LBP97KLLfwNf+n4V1BHurvFNkSKLFnK/RsuUnRTf9Vw==}
+    engines: {iojs: '>= 1.0.0', node: '>= 0.12.0'}
+
+  https-proxy-agent@7.0.6:
+    resolution: {integrity: sha512-vK9P5/iUfdl95AI+JVyUuIcVtd4ofvtrOr3HNtM2yxC9bnMbEdp3x01OhQNnjb8IJYi38VlTE3mBXwcfvywuSw==}
+    engines: {node: '>= 14'}
+
+  httpxy@0.1.7:
+    resolution: {integrity: sha512-pXNx8gnANKAndgga5ahefxc++tJvNL87CXoRwxn1cJE2ZkWEojF3tNfQIEhZX/vfpt+wzeAzpUI4qkediX1MLQ==}
+
+  human-id@4.1.3:
+    resolution: {integrity: sha512-tsYlhAYpjCKa//8rXZ9DqKEawhPoSytweBC2eNvcaDK+57RZLHGqNs3PZTQO6yekLFSuvA6AlnAfrw1uBvtb+Q==}
+    hasBin: true
+
+  human-signals@5.0.0:
+    resolution: {integrity: sha512-AXcZb6vzzrFAUE61HnN4mpLqd/cSIwNQjtNWR0euPm6y0iqx3G4gOXaIDdtdDwZmhwe82LA6+zinmW4UBWVePQ==}
+    engines: {node: '>=16.17.0'}
+
+  iconv-lite@0.4.24:
+    resolution: {integrity: sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==}
+    engines: {node: '>=0.10.0'}
+
+  iconv-lite@0.7.2:
+    resolution: {integrity: sha512-im9DjEDQ55s9fL4EYzOAv0yMqmMBSZp6G0VvFyTMPKWxiSBHUj9NW/qqLmXUwXrrM7AvqSlTCfvqRb0cM8yYqw==}
+    engines: {node: '>=0.10.0'}
+
+  ieee754@1.2.1:
+    resolution: {integrity: sha512-dcyqhDvX1C46lXZcVqCpK+FtMRQVdIMN6/Df5js2zouUsqG7I6sFxitIC+7KYK29KdXOLHdu9zL4sFnoVQnqaA==}
+
+  ignore@5.3.2:
+    resolution: {integrity: sha512-hsBTNUqQTDwkWtcdYI2i06Y/nUBEsNEDJKjWdigLvegy8kDuJAS8uRlpkkcQpyEXL0Z/pjDy5HBmMjRCJ2gq+g==}
+    engines: {node: '>= 4'}
+
+  ignore@7.0.5:
+    resolution: {integrity: sha512-Hs59xBNfUIunMFgWAbGX5cq6893IbWg4KnrjbYwX3tx0ztorVgTDA6B2sxf8ejHJ4wz8BqGUMYlnzNBer5NvGg==}
+    engines: {node: '>= 4'}
+
+  image-meta@0.2.2:
+    resolution: {integrity: sha512-3MOLanc3sb3LNGWQl1RlQlNWURE5g32aUphrDyFeCsxBTk08iE3VNe4CwsUZ0Qs1X+EfX0+r29Sxdpza4B+yRA==}
+
+  import-fresh@3.3.1:
+    resolution: {integrity: sha512-TR3KfrTZTYLPB6jUjfx6MF9WcWrHL9su5TObK4ZkYgBdWKPOFoSoQIdEuTuR82pmtxH2spWG9h6etwfr1pLBqQ==}
+    engines: {node: '>=6'}
+
+  impound@1.0.0:
+    resolution: {integrity: sha512-8lAJ+1Arw2sMaZ9HE2ZmL5zOcMnt18s6+7Xqgq2aUVy4P1nlzAyPtzCDxsk51KVFwHEEdc6OWvUyqwHwhRYaug==}
+
+  imurmurhash@0.1.4:
+    resolution: {integrity: sha512-JmXMZ6wuvDmLiHEml9ykzqO6lwFbof0GG4IkcGaENdCRDDmMVnny7s5HsIgHCbaq0w2MyPhDqkhTUgS2LU2PHA==}
+    engines: {node: '>=0.8.19'}
+
+  inherits@2.0.4:
+    resolution: {integrity: sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==}
+
+  ini@4.1.1:
+    resolution: {integrity: sha512-QQnnxNyfvmHFIsj7gkPcYymR8Jdw/o7mp5ZFihxn6h8Ci6fh3Dx4E1gPjpQEpIuPo9XVNY/ZUwh4BPMjGyL01g==}
+    engines: {node: ^14.17.0 || ^16.13.0 || >=18.0.0}
+
+  internal-slot@1.1.0:
+    resolution: {integrity: sha512-4gd7VpWNQNB4UKKCFFVcp1AVv+FMOgs9NKzjHKusc8jTMhd5eL1NqQqOpE0KzMds804/yHlglp3uxgluOqAPLw==}
+    engines: {node: '>= 0.4'}
+
+  ioredis@5.9.3:
+    resolution: {integrity: sha512-VI5tMCdeoxZWU5vjHWsiE/Su76JGhBvWF1MJnV9ZtGltHk9BmD48oDq8Tj8haZ85aceXZMxLNDQZRVo5QKNgXA==}
+    engines: {node: '>=12.22.0'}
+
+  iron-webcrypto@1.2.1:
+    resolution: {integrity: sha512-feOM6FaSr6rEABp/eDfVseKyTMDt+KGpeB35SkVn9Tyn0CqvVsY3EwI0v5i8nMHyJnzCIQf7nsy3p41TPkJZhg==}
+
+  is-array-buffer@3.0.5:
+    resolution: {integrity: sha512-DDfANUiiG2wC1qawP66qlTugJeL5HyzMpfr8lLK+jMQirGzNod0B12cFB/9q838Ru27sBwfw78/rdoU7RERz6A==}
+    engines: {node: '>= 0.4'}
+
+  is-async-function@2.1.1:
+    resolution: {integrity: sha512-9dgM/cZBnNvjzaMYHVoxxfPj2QXt22Ev7SuuPrs+xav0ukGB0S6d4ydZdEiM48kLx5kDV+QBPrpVnFyefL8kkQ==}
+    engines: {node: '>= 0.4'}
+
+  is-bigint@1.1.0:
+    resolution: {integrity: sha512-n4ZT37wG78iz03xPRKJrHTdZbe3IicyucEtdRsV5yglwc3GyUfbAfpSeD0FJ41NbUNSt5wbhqfp1fS+BgnvDFQ==}
+    engines: {node: '>= 0.4'}
+
+  is-boolean-object@1.2.2:
+    resolution: {integrity: sha512-wa56o2/ElJMYqjCjGkXri7it5FbebW5usLw/nPmCMs5DeZ7eziSYZhSmPRn0txqeW4LnAmQQU7FgqLpsEFKM4A==}
+    engines: {node: '>= 0.4'}
+
+  is-bun-module@2.0.0:
+    resolution: {integrity: sha512-gNCGbnnnnFAUGKeZ9PdbyeGYJqewpmc2aKHUEMO5nQPWU9lOmv7jcmQIv+qHD8fXW6W7qfuCwX4rY9LNRjXrkQ==}
+
+  is-callable@1.2.7:
+    resolution: {integrity: sha512-1BC0BVFhS/p0qtw6enp8e+8OD0UrK0oFLztSjNzhcKA3WDuJxxAPXzPuPtKkjEY9UUoEWlX/8fgKeu2S8i9JTA==}
+    engines: {node: '>= 0.4'}
+
+  is-core-module@2.16.1:
+    resolution: {integrity: sha512-UfoeMA6fIJ8wTYFEUjelnaGI67v6+N7qXJEvQuIGa99l4xsCruSYOVSQ0uPANn4dAzm8lkYPaKLrrijLq7x23w==}
+    engines: {node: '>= 0.4'}
+
+  is-data-view@1.0.2:
+    resolution: {integrity: sha512-RKtWF8pGmS87i2D6gqQu/l7EYRlVdfzemCJN/P3UOs//x1QE7mfhvzHIApBTRf7axvT6DMGwSwBXYCT0nfB9xw==}
+    engines: {node: '>= 0.4'}
+
+  is-date-object@1.1.0:
+    resolution: {integrity: sha512-PwwhEakHVKTdRNVOw+/Gyh0+MzlCl4R6qKvkhuvLtPMggI1WAHt9sOwZxQLSGpUaDnrdyDsomoRgNnCfKNSXXg==}
+    engines: {node: '>= 0.4'}
+
+  is-docker@2.2.1:
+    resolution: {integrity: sha512-F+i2BKsFrH66iaUFc0woD8sLy8getkwTwtOBjvs56Cx4CgJDeKQeqfz8wAYiSb8JOprWhHH5p77PbmYCvvUuXQ==}
+    engines: {node: '>=8'}
+    hasBin: true
+
+  is-docker@3.0.0:
+    resolution: {integrity: sha512-eljcgEDlEns/7AXFosB5K/2nCM4P7FQPkGc/DWLy5rmFEWvZayGrik1d9/QIY5nJ4f9YsVvBkA6kJpHn9rISdQ==}
+    engines: {node: ^12.20.0 || ^14.13.1 || >=16.0.0}
+    hasBin: true
+
+  is-extglob@2.1.1:
+    resolution: {integrity: sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==}
+    engines: {node: '>=0.10.0'}
+
+  is-finalizationregistry@1.1.1:
+    resolution: {integrity: sha512-1pC6N8qWJbWoPtEjgcL2xyhQOP491EQjeUo3qTKcmV8YSDDJrOepfG8pcC7h/QgnQHYSv0mJ3Z/ZWxmatVrysg==}
+    engines: {node: '>= 0.4'}
+
+  is-fullwidth-code-point@3.0.0:
+    resolution: {integrity: sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==}
+    engines: {node: '>=8'}
+
+  is-generator-function@1.1.2:
+    resolution: {integrity: sha512-upqt1SkGkODW9tsGNG5mtXTXtECizwtS2kA161M+gJPc1xdb/Ax629af6YrTwcOeQHbewrPNlE5Dx7kzvXTizA==}
+    engines: {node: '>= 0.4'}
+
+  is-glob@4.0.3:
+    resolution: {integrity: sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==}
+    engines: {node: '>=0.10.0'}
+
+  is-inside-container@1.0.0:
+    resolution: {integrity: sha512-KIYLCCJghfHZxqjYBE7rEy0OBuTd5xCHS7tHVgvCLkx7StIoaxwNW3hCALgEUjFfeRk+MG/Qxmp/vtETEF3tRA==}
+    engines: {node: '>=14.16'}
+    hasBin: true
+
+  is-installed-globally@1.0.0:
+    resolution: {integrity: sha512-K55T22lfpQ63N4KEN57jZUAaAYqYHEe8veb/TycJRk9DdSCLLcovXz/mL6mOnhQaZsQGwPhuFopdQIlqGSEjiQ==}
+    engines: {node: '>=18'}
+
+  is-map@2.0.3:
+    resolution: {integrity: sha512-1Qed0/Hr2m+YqxnM09CjA2d/i6YZNfF6R2oRAOj36eUdS6qIV/huPJNSEpKbupewFs+ZsJlxsjjPbc0/afW6Lw==}
+    engines: {node: '>= 0.4'}
+
+  is-module@1.0.0:
+    resolution: {integrity: sha512-51ypPSPCoTEIN9dy5Oy+h4pShgJmPCygKfyRCISBI+JoWT/2oJvK8QPxmwv7b/p239jXrm9M1mlQbyKJ5A152g==}
+
+  is-negative-zero@2.0.3:
+    resolution: {integrity: sha512-5KoIu2Ngpyek75jXodFvnafB6DJgr3u8uuK0LEZJjrU19DrMD3EVERaR8sjz8CCGgpZvxPl9SuE1GMVPFHx1mw==}
+    engines: {node: '>= 0.4'}
+
+  is-number-object@1.1.1:
+    resolution: {integrity: sha512-lZhclumE1G6VYD8VHe35wFaIif+CTy5SJIi5+3y4psDgWu4wPDoBhF8NxUOinEc7pHgiTsT6MaBb92rKhhD+Xw==}
+    engines: {node: '>= 0.4'}
+
+  is-number@7.0.0:
+    resolution: {integrity: sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==}
+    engines: {node: '>=0.12.0'}
+
+  is-path-inside@4.0.0:
+    resolution: {integrity: sha512-lJJV/5dYS+RcL8uQdBDW9c9uWFLLBNRyFhnAKXw5tVqLlKZ4RMGZKv+YQ/IA3OhD+RpbJa1LLFM1FQPGyIXvOA==}
+    engines: {node: '>=12'}
+
+  is-reference@1.2.1:
+    resolution: {integrity: sha512-U82MsXXiFIrjCK4otLT+o2NA2Cd2g5MLoOVXUZjIOhLurrRxpEXzI8O0KZHr3IjLvlAH1kTPYSuqer5T9ZVBKQ==}
+
+  is-reference@3.0.3:
+    resolution: {integrity: sha512-ixkJoqQvAP88E6wLydLGGqCJsrFUnqoH6HnaczB8XmDH1oaWU+xxdptvikTgaEhtZ53Ky6YXiBuUI2WXLMCwjw==}
+
+  is-regex@1.2.1:
+    resolution: {integrity: sha512-MjYsKHO5O7mCsmRGxWcLWheFqN9DJ/2TmngvjKXihe6efViPqc274+Fx/4fYj/r03+ESvBdTXK0V6tA3rgez1g==}
+    engines: {node: '>= 0.4'}
+
+  is-set@2.0.3:
+    resolution: {integrity: sha512-iPAjerrse27/ygGLxw+EBR9agv9Y6uLeYVJMu+QNCoouJ1/1ri0mGrcWpfCqFZuzzx3WjtwxG098X+n4OuRkPg==}
+    engines: {node: '>= 0.4'}
+
+  is-shared-array-buffer@1.0.4:
+    resolution: {integrity: sha512-ISWac8drv4ZGfwKl5slpHG9OwPNty4jOWPRIhBpxOoD+hqITiwuipOQ2bNthAzwA3B4fIjO4Nln74N0S9byq8A==}
+    engines: {node: '>= 0.4'}
+
+  is-stream@2.0.1:
+    resolution: {integrity: sha512-hFoiJiTl63nn+kstHGBtewWSKnQLpyb155KHheA1l39uvtO9nWIop1p3udqPcUd/xbF1VLMO4n7OI6p7RbngDg==}
+    engines: {node: '>=8'}
+
+  is-stream@3.0.0:
+    resolution: {integrity: sha512-LnQR4bZ9IADDRSkvpqMGvt/tEJWclzklNgSw48V5EAaAeDd6qGvN8ei6k5p0tvxSR171VmGyHuTiAOfxAbr8kA==}
+    engines: {node: ^12.20.0 || ^14.13.1 || >=16.0.0}
+
+  is-string@1.1.1:
+    resolution: {integrity: sha512-BtEeSsoaQjlSPBemMQIrY1MY0uM6vnS1g5fmufYOtnxLGUZM2178PKbhsk7Ffv58IX+ZtcvoGwccYsh0PglkAA==}
+    engines: {node: '>= 0.4'}
+
+  is-subdir@1.2.0:
+    resolution: {integrity: sha512-2AT6j+gXe/1ueqbW6fLZJiIw3F8iXGJtt0yDrZaBhAZEG1raiTxKWU+IPqMCzQAXOUCKdA4UDMgacKH25XG2Cw==}
+    engines: {node: '>=4'}
+
+  is-symbol@1.1.1:
+    resolution: {integrity: sha512-9gGx6GTtCQM73BgmHQXfDmLtfjjTUDSyoxTCbp5WtoixAhfgsDirWIcVQ/IHpvI5Vgd5i/J5F7B9cN/WlVbC/w==}
+    engines: {node: '>= 0.4'}
+
+  is-typed-array@1.1.15:
+    resolution: {integrity: sha512-p3EcsicXjit7SaskXHs1hA91QxgTw46Fv6EFKKGS5DRFLD8yKnohjF3hxoju94b/OcMZoQukzpPpBE9uLVKzgQ==}
+    engines: {node: '>= 0.4'}
+
+  is-weakmap@2.0.2:
+    resolution: {integrity: sha512-K5pXYOm9wqY1RgjpL3YTkF39tni1XajUIkawTLUo9EZEVUFga5gSQJF8nNS7ZwJQ02y+1YCNYcMh+HIf1ZqE+w==}
+    engines: {node: '>= 0.4'}
+
+  is-weakref@1.1.1:
+    resolution: {integrity: sha512-6i9mGWSlqzNMEqpCp93KwRS1uUOodk2OJ6b+sq7ZPDSy2WuI5NFIxp/254TytR8ftefexkWn5xNiHUNpPOfSew==}
+    engines: {node: '>= 0.4'}
+
+  is-weakset@2.0.4:
+    resolution: {integrity: sha512-mfcwb6IzQyOKTs84CQMrOwW4gQcaTOAWJ0zzJCl2WSPDrWk/OzDaImWFH3djXhb24g4eudZfLRozAvPGw4d9hQ==}
+    engines: {node: '>= 0.4'}
+
+  is-what@4.1.16:
+    resolution: {integrity: sha512-ZhMwEosbFJkA0YhFnNDgTM4ZxDRsS6HqTo7qsZM08fehyRYIYa0yHu5R6mgo1n/8MgaPBXiPimPD77baVFYg+A==}
+    engines: {node: '>=12.13'}
+
+  is-what@5.5.0:
+    resolution: {integrity: sha512-oG7cgbmg5kLYae2N5IVd3jm2s+vldjxJzK1pcu9LfpGuQ93MQSzo0okvRna+7y5ifrD+20FE8FvjusyGaz14fw==}
+    engines: {node: '>=18'}
+
+  is-windows@1.0.2:
+    resolution: {integrity: sha512-eXK1UInq2bPmjyX6e3VHIzMLobc4J94i4AWn+Hpq3OU5KkrRC96OAcR3PRJ/pGu6m8TRnBHP9dkXQVsT/COVIA==}
+    engines: {node: '>=0.10.0'}
+
+  is-wsl@2.2.0:
+    resolution: {integrity: sha512-fKzAra0rGJUUBwGBgNkHZuToZcn+TtXHpeCgmkMJMMYx1sQDYaCSyjJBSCa2nH1DGm7s3n1oBnohoVTBaN7Lww==}
+    engines: {node: '>=8'}
+
+  is-wsl@3.1.1:
+    resolution: {integrity: sha512-e6rvdUCiQCAuumZslxRJWR/Doq4VpPR82kqclvcS0efgt430SlGIk05vdCN58+VrzgtIcfNODjozVielycD4Sw==}
+    engines: {node: '>=16'}
+
+  is64bit@2.0.0:
+    resolution: {integrity: sha512-jv+8jaWCl0g2lSBkNSVXdzfBA0npK1HGC2KtWM9FumFRoGS94g3NbCCLVnCYHLjp4GrW2KZeeSTMo5ddtznmGw==}
+    engines: {node: '>=18'}
+
+  isarray@1.0.0:
+    resolution: {integrity: sha512-VLghIWNM6ELQzo7zwmcg0NmTVyWKYjvIeM83yjp0wRDTmUnrM678fQbcKBo6n2CJEF0szoG//ytg+TKla89ALQ==}
+
+  isarray@2.0.5:
+    resolution: {integrity: sha512-xHjhDr3cNBK0BzdUJSPXZntQUx/mwMS5Rw4A7lPJ90XGAO6ISP/ePDNuo0vhqOZU+UD5JoodwCAAoZQd3FeAKw==}
+
+  isexe@2.0.0:
+    resolution: {integrity: sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==}
+
+  isexe@3.1.5:
+    resolution: {integrity: sha512-6B3tLtFqtQS4ekarvLVMZ+X+VlvQekbe4taUkf/rhVO3d/h0M2rfARm/pXLcPEsjjMsFgrFgSrhQIxcSVrBz8w==}
+    engines: {node: '>=18'}
+
+  iterator.prototype@1.1.5:
+    resolution: {integrity: sha512-H0dkQoCa3b2VEeKQBOxFph+JAbcrQdE7KC0UkqwpLmv2EC4P41QXP+rqo9wYodACiG5/WM5s9oDApTU8utwj9g==}
+    engines: {node: '>= 0.4'}
+
+  jackspeak@3.4.3:
+    resolution: {integrity: sha512-OGlZQpz2yfahA/Rd1Y8Cd9SIEsqvXkLVoSw/cgwhnhFMDbsQFeZYoJJ7bIZBS9BcamUW96asq/npPWugM+RQBw==}
+
+  jiti@1.21.7:
+    resolution: {integrity: sha512-/imKNG4EbWNrVjoNC/1H5/9GFy+tqjGBHCaSsN+P2RnPqjsLmv6UD3Ej+Kj8nBWaRAwyk7kK5ZUc+OEatnTR3A==}
+    hasBin: true
+
+  jiti@2.6.1:
+    resolution: {integrity: sha512-ekilCSN1jwRvIbgeg/57YFh8qQDNbwDb9xT/qu2DAHbFFZUicIl4ygVaAvzveMhMVr3LnpSKTNnwt8PoOfmKhQ==}
+    hasBin: true
+
+  joycon@3.1.1:
+    resolution: {integrity: sha512-34wB/Y7MW7bzjKRjUKTa46I2Z7eV62Rkhva+KkopW7Qvv/OSWBqvkSY7vusOPrNuZcUG3tApvdVgNB8POj3SPw==}
+    engines: {node: '>=10'}
+
+  js-tokens@4.0.0:
+    resolution: {integrity: sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==}
+
+  js-tokens@9.0.1:
+    resolution: {integrity: sha512-mxa9E9ITFOt0ban3j6L5MpjwegGz6lBQmM1IJkWeBZGcMxto50+eWdjC/52xDbS2vy0k7vIMK0Fe2wfL9OQSpQ==}
+
+  js-yaml@3.14.2:
+    resolution: {integrity: sha512-PMSmkqxr106Xa156c2M265Z+FTrPl+oxd/rgOQy2tijQeK5TxQ43psO1ZCwhVOSdnn+RzkzlRz/eY4BgJBYVpg==}
+    hasBin: true
+
+  js-yaml@4.1.1:
+    resolution: {integrity: sha512-qQKT4zQxXl8lLwBtHMWwaTcGfFOZviOJet3Oy/xmGk2gZH677CJM9EvtfdSkgWcATZhj/55JZ0rmy3myCT5lsA==}
+    hasBin: true
+
+  jsesc@3.1.0:
+    resolution: {integrity: sha512-/sM3dO2FOzXjKQhJuo0Q173wf2KOo8t4I8vHy6lF9poUp7bKT0/NHE8fPX23PwfhnykfqnC2xRxOnVw5XuGIaA==}
+    engines: {node: '>=6'}
+    hasBin: true
+
+  json-buffer@3.0.1:
+    resolution: {integrity: sha512-4bV5BfR2mqfQTJm+V5tPPdf+ZpuhiIvTuAB5g8kcrXOZpTT/QwwVRWBywX1ozr6lEuPdbHxwaJlm9G6mI2sfSQ==}
+
+  json-schema-traverse@0.4.1:
+    resolution: {integrity: sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==}
+
+  json-stable-stringify-without-jsonify@1.0.1:
+    resolution: {integrity: sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw==}
+
+  json5@1.0.2:
+    resolution: {integrity: sha512-g1MWMLBiz8FKi1e4w0UyVL3w+iJceWAFBAaBnnGKOpNa5f8TLktkbre1+s6oICydWAm+HRUGTmI+//xv2hvXYA==}
+    hasBin: true
+
+  json5@2.2.3:
+    resolution: {integrity: sha512-XmOWe7eyHYH14cLdVPoyg+GOH3rYX++KpzrylJwSW98t3Nk+U8XOl8FWKOgwtzdb8lXGf6zYwDUzeHMWfxasyg==}
+    engines: {node: '>=6'}
+    hasBin: true
+
+  jsonfile@4.0.0:
+    resolution: {integrity: sha512-m6F1R3z8jjlf2imQHS2Qez5sjKWQzbuuhuJ/FKYFRZvPE3PuHcSMVZzfsLhGVOkfd20obL5SWEBew5ShlquNxg==}
+
+  jsx-ast-utils@3.3.5:
+    resolution: {integrity: sha512-ZZow9HBI5O6EPgSJLUb8n2NKgmVWTwCvHGwFuJlMjvLFqlGG6pjirPhtdsseaLZjSibD8eegzmYpUZwoIlj2cQ==}
+    engines: {node: '>=4.0'}
+
+  keyv@4.5.4:
+    resolution: {integrity: sha512-oxVHkHR/EJf2CNXnWxRLW6mg7JyCCUcG0DtEGmL2ctUo1PNTin1PUil+r/+4r5MpVgC/fn1kjsx7mjSujKqIpw==}
+
+  kleur@3.0.3:
+    resolution: {integrity: sha512-eTIzlVOSUR+JxdDFepEYcBMtZ9Qqdef+rnzWdRZuMbOywu5tO2w2N7rqjoANZ5k9vywhL6Br1VRjUIgTQx4E8w==}
+    engines: {node: '>=6'}
+
+  kleur@4.1.5:
+    resolution: {integrity: sha512-o+NO+8WrRiQEE4/7nwRJhN1HWpVmJm511pBHUxPLtp0BUISzlBplORYSmTclCnJvQq2tKu/sgl3xVpkc7ZWuQQ==}
+    engines: {node: '>=6'}
+
+  klona@2.0.6:
+    resolution: {integrity: sha512-dhG34DXATL5hSxJbIexCft8FChFXtmskoZYnoPWjXQuebWYCNkVeV3KkGegCK9CP1oswI/vQibS2GY7Em/sJJA==}
+    engines: {node: '>= 8'}
+
+  knitwork@1.3.0:
+    resolution: {integrity: sha512-4LqMNoONzR43B1W0ek0fhXMsDNW/zxa1NdFAVMY+k28pgZLovR4G3PB5MrpTxCy1QaZCqNoiaKPr5w5qZHfSNw==}
+
+  language-subtag-registry@0.3.23:
+    resolution: {integrity: sha512-0K65Lea881pHotoGEa5gDlMxt3pctLi2RplBb7Ezh4rRdLEOtgi7n4EwK9lamnUCkKBqaeKRVebTq6BAxSkpXQ==}
+
+  language-tags@1.0.9:
+    resolution: {integrity: sha512-MbjN408fEndfiQXbFQ1vnd+1NoLDsnQW41410oQBXiyXDMYH5z505juWa4KUE1LqxRC7DgOgZDbKLxHIwm27hA==}
+    engines: {node: '>=0.10'}
+
+  launch-editor@2.13.0:
+    resolution: {integrity: sha512-u+9asUHMJ99lA15VRMXw5XKfySFR9dGXwgsgS14YTbUq3GITP58mIM32At90P5fZ+MUId5Yw+IwI/yKub7jnCQ==}
+
+  lazystream@1.0.1:
+    resolution: {integrity: sha512-b94GiNHQNy6JNTrt5w6zNyffMrNkXZb3KTkCZJb2V1xaEGCk093vkZ2jk3tpaeP33/OiXC+WvK9AxUebnf5nbw==}
+    engines: {node: '>= 0.6.3'}
+
+  levn@0.4.1:
+    resolution: {integrity: sha512-+bT2uH4E5LGE7h/n3evcS/sQlJXCpIp6ym8OWJ5eV6+67Dsql/LaaT7qJBAt2rzfoa/5QBGBhxDix1dMt2kQKQ==}
+    engines: {node: '>= 0.8.0'}
+
+  lightningcss-android-arm64@1.31.1:
+    resolution: {integrity: sha512-HXJF3x8w9nQ4jbXRiNppBCqeZPIAfUo8zE/kOEGbW5NZvGc/K7nMxbhIr+YlFlHW5mpbg/YFPdbnCh1wAXCKFg==}
+    engines: {node: '>= 12.0.0'}
+    cpu: [arm64]
+    os: [android]
+
+  lightningcss-darwin-arm64@1.31.1:
+    resolution: {integrity: sha512-02uTEqf3vIfNMq3h/z2cJfcOXnQ0GRwQrkmPafhueLb2h7mqEidiCzkE4gBMEH65abHRiQvhdcQ+aP0D0g67sg==}
+    engines: {node: '>= 12.0.0'}
+    cpu: [arm64]
+    os: [darwin]
+
+  lightningcss-darwin-x64@1.31.1:
+    resolution: {integrity: sha512-1ObhyoCY+tGxtsz1lSx5NXCj3nirk0Y0kB/g8B8DT+sSx4G9djitg9ejFnjb3gJNWo7qXH4DIy2SUHvpoFwfTA==}
+    engines: {node: '>= 12.0.0'}
+    cpu: [x64]
+    os: [darwin]
+
+  lightningcss-freebsd-x64@1.31.1:
+    resolution: {integrity: sha512-1RINmQKAItO6ISxYgPwszQE1BrsVU5aB45ho6O42mu96UiZBxEXsuQ7cJW4zs4CEodPUioj/QrXW1r9pLUM74A==}
+    engines: {node: '>= 12.0.0'}
+    cpu: [x64]
+    os: [freebsd]
+
+  lightningcss-linux-arm-gnueabihf@1.31.1:
+    resolution: {integrity: sha512-OOCm2//MZJ87CdDK62rZIu+aw9gBv4azMJuA8/KB74wmfS3lnC4yoPHm0uXZ/dvNNHmnZnB8XLAZzObeG0nS1g==}
+    engines: {node: '>= 12.0.0'}
+    cpu: [arm]
+    os: [linux]
+
+  lightningcss-linux-arm64-gnu@1.31.1:
+    resolution: {integrity: sha512-WKyLWztD71rTnou4xAD5kQT+982wvca7E6QoLpoawZ1gP9JM0GJj4Tp5jMUh9B3AitHbRZ2/H3W5xQmdEOUlLg==}
+    engines: {node: '>= 12.0.0'}
+    cpu: [arm64]
+    os: [linux]
+    libc: [glibc]
+
+  lightningcss-linux-arm64-musl@1.31.1:
+    resolution: {integrity: sha512-mVZ7Pg2zIbe3XlNbZJdjs86YViQFoJSpc41CbVmKBPiGmC4YrfeOyz65ms2qpAobVd7WQsbW4PdsSJEMymyIMg==}
+    engines: {node: '>= 12.0.0'}
+    cpu: [arm64]
+    os: [linux]
+    libc: [musl]
+
+  lightningcss-linux-x64-gnu@1.31.1:
+    resolution: {integrity: sha512-xGlFWRMl+0KvUhgySdIaReQdB4FNudfUTARn7q0hh/V67PVGCs3ADFjw+6++kG1RNd0zdGRlEKa+T13/tQjPMA==}
+    engines: {node: '>= 12.0.0'}
+    cpu: [x64]
+    os: [linux]
+    libc: [glibc]
+
+  lightningcss-linux-x64-musl@1.31.1:
+    resolution: {integrity: sha512-eowF8PrKHw9LpoZii5tdZwnBcYDxRw2rRCyvAXLi34iyeYfqCQNA9rmUM0ce62NlPhCvof1+9ivRaTY6pSKDaA==}
+    engines: {node: '>= 12.0.0'}
+    cpu: [x64]
+    os: [linux]
+    libc: [musl]
+
+  lightningcss-win32-arm64-msvc@1.31.1:
+    resolution: {integrity: sha512-aJReEbSEQzx1uBlQizAOBSjcmr9dCdL3XuC/6HLXAxmtErsj2ICo5yYggg1qOODQMtnjNQv2UHb9NpOuFtYe4w==}
+    engines: {node: '>= 12.0.0'}
+    cpu: [arm64]
+    os: [win32]
+
+  lightningcss-win32-x64-msvc@1.31.1:
+    resolution: {integrity: sha512-I9aiFrbd7oYHwlnQDqr1Roz+fTz61oDDJX7n9tYF9FJymH1cIN1DtKw3iYt6b8WZgEjoNwVSncwF4wx/ZedMhw==}
+    engines: {node: '>= 12.0.0'}
+    cpu: [x64]
+    os: [win32]
+
+  lightningcss@1.31.1:
+    resolution: {integrity: sha512-l51N2r93WmGUye3WuFoN5k10zyvrVs0qfKBhyC5ogUQ6Ew6JUSswh78mbSO+IU3nTWsyOArqPCcShdQSadghBQ==}
+    engines: {node: '>= 12.0.0'}
+
+  lilconfig@3.1.3:
+    resolution: {integrity: sha512-/vlFKAoH5Cgt3Ie+JLhRbwOsCQePABiU3tJ1egGvyQ+33R/vcwM2Zl2QR/LzjsBeItPt3oSVXapn+m4nQDvpzw==}
+    engines: {node: '>=14'}
+
+  lines-and-columns@1.2.4:
+    resolution: {integrity: sha512-7ylylesZQ/PV29jhEDl3Ufjo6ZX7gCqJr5F7PKrqc93v7fzSymt1BpwEU8nAUXs8qzzvqhbjhK5QZg6Mt/HkBg==}
+
+  listhen@1.9.0:
+    resolution: {integrity: sha512-I8oW2+QL5KJo8zXNWX046M134WchxsXC7SawLPvRQpogCbkyQIaFxPE89A2HiwR7vAK2Dm2ERBAmyjTYGYEpBg==}
+    hasBin: true
+
+  load-tsconfig@0.2.5:
+    resolution: {integrity: sha512-IXO6OCs9yg8tMKzfPZ1YmheJbZCiEsnBdcB03l0OcfK9prKnJb96siuHCr5Fl37/yo9DnKU+TLpxzTUspw9shg==}
+    engines: {node: ^12.20.0 || ^14.13.1 || >=16.0.0}
+
+  local-pkg@1.1.2:
+    resolution: {integrity: sha512-arhlxbFRmoQHl33a0Zkle/YWlmNwoyt6QNZEIJcqNbdrsix5Lvc4HyyI3EnwxTYlZYc32EbYrQ8SzEZ7dqgg9A==}
+    engines: {node: '>=14'}
+
+  locate-character@3.0.0:
+    resolution: {integrity: sha512-SW13ws7BjaeJ6p7Q6CO2nchbYEc3X3J6WrmTTDto7yMPqVSZTUyY5Tjbid+Ab8gLnATtygYtiDIJGQRRn2ZOiA==}
+
+  locate-path@5.0.0:
+    resolution: {integrity: sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g==}
+    engines: {node: '>=8'}
+
+  locate-path@6.0.0:
+    resolution: {integrity: sha512-iPZK6eYjbxRu3uB4/WZ3EsEIMJFMqAoopl3R+zuq0UjcAm/MO6KCweDgPfP3elTztoKP3KtnVHxTn2NHBSDVUw==}
+    engines: {node: '>=10'}
+
+  lodash.defaults@4.2.0:
+    resolution: {integrity: sha512-qjxPLHd3r5DnsdGacqOMU6pb/avJzdh9tFX2ymgoZE27BmjXrNy/y4LoaiTeAb+O3gL8AfpJGtqfX/ae2leYYQ==}
+
+  lodash.isarguments@3.1.0:
+    resolution: {integrity: sha512-chi4NHZlZqZD18a0imDHnZPrDeBbTtVN7GXMwuGdRH9qotxAjYs3aVLKc7zNOG9eddR5Ksd8rvFEBc9SsggPpg==}
+
+  lodash.memoize@4.1.2:
+    resolution: {integrity: sha512-t7j+NzmgnQzTAYXcsHYLgimltOV1MXHtlOWf6GjL9Kj8GK5FInw5JotxvbOs+IvV1/Dzo04/fCGfLVs7aXb4Ag==}
+
+  lodash.merge@4.6.2:
+    resolution: {integrity: sha512-0KpjqXRVvrYyCsX1swR/XTK0va6VQkQM6MNo7PqW77ByjAhoARA8EfrP1N4+KlKj8YS0ZUCtRT/YUuhyYDujIQ==}
+
+  lodash.sortby@4.7.0:
+    resolution: {integrity: sha512-HDWXG8isMntAyRF5vZ7xKuEvOhT4AhlRt/3czTSjvGUxjYCBVRQY48ViDHyfYz9VIoBkW4TMGQNapx+l3RUwdA==}
+
+  lodash.startcase@4.4.0:
+    resolution: {integrity: sha512-+WKqsK294HMSc2jEbNgpHpd0JfIBhp7rEV4aqXWqFr6AlXov+SlcgB1Fv01y2kGe3Gc8nMW7VA0SrGuSkRfIEg==}
+
+  lodash.uniq@4.5.0:
+    resolution: {integrity: sha512-xfBaXQd9ryd9dlSDvnvI0lvxfLJlYAZzXomUYzLKtUeOQvOP5piqAWuGtrhWeqaXK9hhoM/iyJc5AV+XfsX3HQ==}
+
+  lodash@4.17.23:
+    resolution: {integrity: sha512-LgVTMpQtIopCi79SJeDiP0TfWi5CNEc/L/aRdTh3yIvmZXTnheWpKjSZhnvMl8iXbC1tFg9gdHHDMLoV7CnG+w==}
+
+  loose-envify@1.4.0:
+    resolution: {integrity: sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==}
+    hasBin: true
+
+  lru-cache@10.4.3:
+    resolution: {integrity: sha512-JNAzZcXrCt42VGLuYz0zfAzDfAvJWW6AfYlDBQyDV5DClI2m5sAmK+OIO7s59XfsRsWHp02jAJrRadPRGTt6SQ==}
+
+  lru-cache@11.2.6:
+    resolution: {integrity: sha512-ESL2CrkS/2wTPfuend7Zhkzo2u0daGJ/A2VucJOgQ/C48S/zB8MMeMHSGKYpXhIjbPxfuezITkaBH1wqv00DDQ==}
+    engines: {node: 20 || >=22}
+
+  lru-cache@5.1.1:
+    resolution: {integrity: sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==}
+
+  magic-regexp@0.10.0:
+    resolution: {integrity: sha512-Uly1Bu4lO1hwHUW0CQeSWuRtzCMNO00CmXtS8N6fyvB3B979GOEEeAkiTUDsmbYLAbvpUS/Kt5c4ibosAzVyVg==}
+
+  magic-string-ast@1.0.3:
+    resolution: {integrity: sha512-CvkkH1i81zl7mmb94DsRiFeG9V2fR2JeuK8yDgS8oiZSFa++wWLEgZ5ufEOyLHbvSbD1gTRKv9NdX69Rnvr9JA==}
+    engines: {node: '>=20.19.0'}
+
+  magic-string@0.30.21:
+    resolution: {integrity: sha512-vd2F4YUyEXKGcLHoq+TEyCjxueSeHnFxyyjNp80yg0XV4vUhnDer/lvvlqM/arB5bXQN5K2/3oinyCRyx8T2CQ==}
+
+  magicast@0.2.11:
+    resolution: {integrity: sha512-6saXbRDA1HMkqbsvHOU6HBjCVgZT460qheRkLhJQHWAbhXoWESI3Kn/dGGXyKs15FFKR85jsUqFx2sMK0wy/5g==}
+
+  magicast@0.5.2:
+    resolution: {integrity: sha512-E3ZJh4J3S9KfwdjZhe2afj6R9lGIN5Pher1pF39UGrXRqq/VDaGVIGN13BjHd2u8B61hArAGOnso7nBOouW3TQ==}
+
+  math-intrinsics@1.1.0:
+    resolution: {integrity: sha512-/IXtbwEk5HTPyEwyKX6hGkYXxM9nbj64B+ilVJnC/R6B0pH5G4V3b0pVbL7DBj4tkhBAppbQUlf6F6Xl9LHu1g==}
+    engines: {node: '>= 0.4'}
+
+  md4w@0.2.7:
+    resolution: {integrity: sha512-lFM7vwk3d4MzkV2mija7aPkK6OjKXZDQsH2beX+e2cvccBoqc6RraheMtAO0Wcr/gjj5L+WS5zhb+06AmuGZrg==}
+
+  mdast-util-to-hast@13.2.1:
+    resolution: {integrity: sha512-cctsq2wp5vTsLIcaymblUriiTcZd0CwWtCbLvrOzYCDZoWyMNV8sZ7krj09FSnsiJi3WVsHLM4k6Dq/yaPyCXA==}
+
+  mdbox@0.1.1:
+    resolution: {integrity: sha512-jvLISenzbLRPWWamTG3THlhTcMbKWzJQNyTi61AVXhCBOC+gsldNTUfUNH8d3Vay83zGehFw3wZpF3xChzkTIQ==}
+
+  mdn-data@2.0.28:
+    resolution: {integrity: sha512-aylIc7Z9y4yzHYAJNuESG3hfhC+0Ibp/MAMiaOZgNv4pmEdFyfZhhhny4MNiAfWdBQ1RQ2mfDWmM1x8SvGyp8g==}
+
+  mdn-data@2.12.2:
+    resolution: {integrity: sha512-IEn+pegP1aManZuckezWCO+XZQDplx1366JoVhTpMpBB1sPey/SbveZQUosKiKiGYjg1wH4pMlNgXbCiYgihQA==}
+
+  merge-anything@5.1.7:
+    resolution: {integrity: sha512-eRtbOb1N5iyH0tkQDAoQ4Ipsp/5qSR79Dzrz8hEPxRX10RWWR/iQXdoKmBSRCThY1Fh5EhISDtpSc93fpxUniQ==}
+    engines: {node: '>=12.13'}
+
+  merge-stream@2.0.0:
+    resolution: {integrity: sha512-abv/qOcuPfk3URPfDzmZU1LKmuw8kT+0nIHvKrKgFrwifol/doWcdA4ZqsWQ8ENrFKkd67Mfpo/LovbIUsbt3w==}
+
+  merge2@1.4.1:
+    resolution: {integrity: sha512-8q7VEgMJW4J8tcfVPy8g09NcQwZdbwFEqhe/WZkoIzjn/3TGDwtOCYtXGxA3O8tPzpczCCDgv+P2P5y00ZJOOg==}
+    engines: {node: '>= 8'}
+
+  micromark-util-character@2.1.1:
+    resolution: {integrity: sha512-wv8tdUTJ3thSFFFJKtpYKOYiGP2+v96Hvk4Tu8KpCAsTMs6yi+nVmGh1syvSCsaxz45J6Jbw+9DD6g97+NV67Q==}
+
+  micromark-util-encode@2.0.1:
+    resolution: {integrity: sha512-c3cVx2y4KqUnwopcO9b/SCdo2O67LwJJ/UyqGfbigahfegL9myoEFoDYZgkT7f36T0bLrM9hZTAaAyH+PCAXjw==}
+
+  micromark-util-sanitize-uri@2.0.1:
+    resolution: {integrity: sha512-9N9IomZ/YuGGZZmQec1MbgxtlgougxTodVwDzzEouPKo3qFWvymFHWcnDi2vzV1ff6kas9ucW+o3yzJK9YB1AQ==}
+
+  micromark-util-symbol@2.0.1:
+    resolution: {integrity: sha512-vs5t8Apaud9N28kgCrRUdEed4UJ+wWNvicHLPxCa9ENlYuAY31M0ETy5y1vA33YoNPDFTghEbnh6efaE8h4x0Q==}
+
+  micromark-util-types@2.0.2:
+    resolution: {integrity: sha512-Yw0ECSpJoViF1qTU4DC6NwtC4aWGt1EkzaQB8KPPyCRR8z9TWeV0HbEFGTO+ZY1wB22zmxnJqhPyTpOVCpeHTA==}
+
+  micromatch@4.0.8:
+    resolution: {integrity: sha512-PXwfBhYu0hBCPw8Dn0E+WDYb7af3dSLVWKi3HGv84IdF4TyFoC0ysxFd0Goxw7nSv4T/PzEJQxsYsEiFCKo2BA==}
+    engines: {node: '>=8.6'}
+
+  mime-db@1.54.0:
+    resolution: {integrity: sha512-aU5EJuIN2WDemCcAp2vFBfp/m4EAhWJnUNSSw0ixs7/kXbd6Pg64EmwJkNdFhB8aWt1sH2CTXrLxo/iAGV3oPQ==}
+    engines: {node: '>= 0.6'}
+
+  mime-types@3.0.2:
+    resolution: {integrity: sha512-Lbgzdk0h4juoQ9fCKXW4by0UJqj+nOOrI9MJ1sSj4nI8aI2eo1qmvQEie4VD1glsS250n15LsWsYtCugiStS5A==}
+    engines: {node: '>=18'}
+
+  mime@1.6.0:
+    resolution: {integrity: sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==}
+    engines: {node: '>=4'}
+    hasBin: true
+
+  mime@3.0.0:
+    resolution: {integrity: sha512-jSCU7/VB1loIWBZe14aEYHU/+1UMEHoaO7qxCOVJOw9GgH72VAWppxNcjU+x9a2k3GSIBXNKxXQFqRvvZ7vr3A==}
+    engines: {node: '>=10.0.0'}
+    hasBin: true
+
+  mime@4.1.0:
+    resolution: {integrity: sha512-X5ju04+cAzsojXKes0B/S4tcYtFAJ6tTMuSPBEn9CPGlrWr8Fiw7qYeLT0XyH80HSoAoqWCaz+MWKh22P7G1cw==}
+    engines: {node: '>=16'}
+    hasBin: true
+
+  mimic-fn@4.0.0:
+    resolution: {integrity: sha512-vqiC06CuhBTUdZH+RYl8sFrL096vA45Ok5ISO6sE/Mr1jRbGH4Csnhi8f3wKVl7x8mO4Au7Ir9D3Oyv1VYMFJw==}
+    engines: {node: '>=12'}
+
+  minimatch@10.2.1:
+    resolution: {integrity: sha512-MClCe8IL5nRRmawL6ib/eT4oLyeKMGCghibcDWK+J0hh0Q8kqSdia6BvbRMVk6mPa6WqUa5uR2oxt6C5jd533A==}
+    engines: {node: 20 || >=22}
+
+  minimatch@3.1.2:
+    resolution: {integrity: sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==}
+
+  minimatch@5.1.6:
+    resolution: {integrity: sha512-lKwV/1brpG6mBUFHtb7NUmtABCb2WZZmm2wNiOA5hAb8VdCS4B3dtMWyvcoViccwAW/COERjXLt0zP1zXUN26g==}
+    engines: {node: '>=10'}
+
+  minimatch@9.0.5:
+    resolution: {integrity: sha512-G6T0ZX48xgozx7587koeX9Ys2NYy6Gmv//P89sEte9V9whIapMNF4idKxnW2QtCcLiTWlb/wfCabAtAFWhhBow==}
+    engines: {node: '>=16 || 14 >=14.17'}
+
+  minimist@1.2.8:
+    resolution: {integrity: sha512-2yyAR8qBkN3YuheJanUpWC5U3bb5osDywNB8RzDVlDwDHbocAJveqqj1u8+SVD7jkWT4yvsHCpWqqWqAxb0zCA==}
+
+  minipass@7.1.3:
+    resolution: {integrity: sha512-tEBHqDnIoM/1rXME1zgka9g6Q2lcoCkxHLuc7ODJ5BxbP5d4c2Z5cGgtXAku59200Cx7diuHTOYfSBD8n6mm8A==}
+    engines: {node: '>=16 || 14 >=14.17'}
+
+  minizlib@3.1.0:
+    resolution: {integrity: sha512-KZxYo1BUkWD2TVFLr0MQoM8vUUigWD3LlD83a/75BqC+4qE0Hb1Vo5v1FgcfaNXvfXzr+5EhQ6ing/CaBijTlw==}
+    engines: {node: '>= 18'}
+
+  mitt@3.0.1:
+    resolution: {integrity: sha512-vKivATfr97l2/QBCYAkXYDbrIWPM2IIKEl7YPhjCvKlG3kE2gm+uBo6nEXK3M5/Ffh/FLpKExzOQ3JJoJGFKBw==}
+
+  mlly@1.8.0:
+    resolution: {integrity: sha512-l8D9ODSRWLe2KHJSifWGwBqpTZXIXTeo8mlKjY+E2HAakaTeNpqAyBZ8GSqLzHgw4XmHmC8whvpjJNMbFZN7/g==}
+
+  mocked-exports@0.1.1:
+    resolution: {integrity: sha512-aF7yRQr/Q0O2/4pIXm6PZ5G+jAd7QS4Yu8m+WEeEHGnbo+7mE36CbLSDQiXYV8bVL3NfmdeqPJct0tUlnjVSnA==}
+
+  mri@1.2.0:
+    resolution: {integrity: sha512-tzzskb3bG8LvYGFF/mDTpq3jpI6Q9wc3LEmBaghu+DdCssd1FakN7Bc0hVNmEyGq1bq3RgfkCb3cmQLpNPOroA==}
+    engines: {node: '>=4'}
+
+  mrmime@2.0.1:
+    resolution: {integrity: sha512-Y3wQdFg2Va6etvQ5I82yUhGdsKrcYox6p7FfL1LbK2J4V01F9TGlepTIhnK24t7koZibmg82KGglhA1XK5IsLQ==}
+    engines: {node: '>=10'}
+
+  ms@2.0.0:
+    resolution: {integrity: sha512-Tpp60P6IUJDTuOq/5Z8cdskzJujfwqfOTkrwIwj7IRISpnkJnT6SyJ4PCPnGMoFjC9ddhal5KVIYtAt97ix05A==}
+
+  ms@2.1.3:
+    resolution: {integrity: sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==}
+
+  muggle-string@0.4.1:
+    resolution: {integrity: sha512-VNTrAak/KhO2i8dqqnqnAHOa3cYBwXEZe9h+D5h/1ZqFSTEFHdM65lR7RoIqq3tBBYavsOXV84NoHXZ0AkPyqQ==}
+
+  mz@2.7.0:
+    resolution: {integrity: sha512-z81GNO7nnYMEhrGh9LeymoE4+Yr0Wn5McHIZMK5cfQCl+NDX08sCZgUc9/6MHni9IWuFLm1Z3HTCXu2z9fN62Q==}
+
+  nanoid@3.3.11:
+    resolution: {integrity: sha512-N8SpfPUnUp1bK+PMYW8qSWdl9U+wwNWI4QKxOYDy9JAro3WMX7p2OeVRF9v+347pnakNevPmiHhNmZ2HbFA76w==}
+    engines: {node: ^10 || ^12 || ^13.7 || ^14 || >=15.0.1}
+    hasBin: true
+
+  nanoid@5.1.6:
+    resolution: {integrity: sha512-c7+7RQ+dMB5dPwwCp4ee1/iV/q2P6aK1mTZcfr1BTuVlyW9hJYiMPybJCcnBlQtuSmTIWNeazm/zqNoZSSElBg==}
+    engines: {node: ^18 || >=20}
+    hasBin: true
+
+  nanotar@0.2.1:
+    resolution: {integrity: sha512-MUrzzDUcIOPbv7ubhDV/L4CIfVTATd9XhDE2ixFeCrM5yp9AlzUpn91JrnN0HD6hksdxvz9IW9aKANz0Bta0GA==}
+
+  napi-postinstall@0.3.4:
+    resolution: {integrity: sha512-PHI5f1O0EP5xJ9gQmFGMS6IZcrVvTjpXjz7Na41gTE7eE2hK11lg04CECCYEEjdc17EV4DO+fkGEtt7TpTaTiQ==}
+    engines: {node: ^12.20.0 || ^14.18.0 || >=16.0.0}
+    hasBin: true
+
+  natural-compare@1.4.0:
+    resolution: {integrity: sha512-OWND8ei3VtNC9h7V60qff3SVobHr996CTwgxubgyQYEpg290h9J0buyECNNJexkFm5sOajh5G116RYA1c8ZMSw==}
+
+  next@16.1.6:
+    resolution: {integrity: sha512-hkyRkcu5x/41KoqnROkfTm2pZVbKxvbZRuNvKXLRXxs3VfyO0WhY50TQS40EuKO9SW3rBj/sF3WbVwDACeMZyw==}
+    engines: {node: '>=20.9.0'}
+    hasBin: true
+    peerDependencies:
+      '@opentelemetry/api': ^1.1.0
+      '@playwright/test': ^1.51.1
+      babel-plugin-react-compiler: '*'
+      react: ^18.2.0 || 19.0.0-rc-de68d2f4-20241204 || ^19.0.0
+      react-dom: ^18.2.0 || 19.0.0-rc-de68d2f4-20241204 || ^19.0.0
+      sass: ^1.3.0
+    peerDependenciesMeta:
+      '@opentelemetry/api':
+        optional: true
+      '@playwright/test':
+        optional: true
+      babel-plugin-react-compiler:
+        optional: true
+      sass:
+        optional: true
+
+  nitropack@2.13.1:
+    resolution: {integrity: sha512-2dDj89C4wC2uzG7guF3CnyG+zwkZosPEp7FFBGHB3AJo11AywOolWhyQJFHDzve8COvGxJaqscye9wW2IrUsNw==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    hasBin: true
+    peerDependencies:
+      xml2js: ^0.6.2
+    peerDependenciesMeta:
+      xml2js:
+        optional: true
+
+  node-addon-api@7.1.1:
+    resolution: {integrity: sha512-5m3bsyrjFWE1xf7nz7YXdN4udnVtXK6/Yfgn5qnahL6bCkf2yKt4k3nuTKAtT4r3IG8JNR2ncsIMdZuAzJjHQQ==}
+
+  node-exports-info@1.6.0:
+    resolution: {integrity: sha512-pyFS63ptit/P5WqUkt+UUfe+4oevH+bFeIiPPdfb0pFeYEu/1ELnJu5l+5EcTKYL5M7zaAa7S8ddywgXypqKCw==}
+    engines: {node: '>= 0.4'}
+
+  node-fetch-native@1.6.7:
+    resolution: {integrity: sha512-g9yhqoedzIUm0nTnTqAQvueMPVOuIY16bqgAJJC8XOOubYFNwz6IER9qs0Gq2Xd0+CecCKFjtdDTMA4u4xG06Q==}
+
+  node-fetch@2.7.0:
+    resolution: {integrity: sha512-c4FRfUm/dbcWZ7U+1Wq0AwCyFL+3nt2bEw05wfxSz+DWpWsitgmSgYmy2dQdWyKC1694ELPqMs/YzUSNozLt8A==}
+    engines: {node: 4.x || >=6.0.0}
+    peerDependencies:
+      encoding: ^0.1.0
+    peerDependenciesMeta:
+      encoding:
+        optional: true
+
+  node-forge@1.3.3:
+    resolution: {integrity: sha512-rLvcdSyRCyouf6jcOIPe/BgwG/d7hKjzMKOas33/pHEr6gbq18IK9zV7DiPvzsz0oBJPme6qr6H6kGZuI9/DZg==}
+    engines: {node: '>= 6.13.0'}
+
+  node-gyp-build@4.8.4:
+    resolution: {integrity: sha512-LA4ZjwlnUblHVgq0oBF3Jl/6h/Nvs5fzBLwdEF4nuxnFdsfajde4WfxtJr3CaiH+F6ewcIB/q4jQ4UzPyid+CQ==}
+    hasBin: true
+
+  node-mock-http@1.0.4:
+    resolution: {integrity: sha512-8DY+kFsDkNXy1sJglUfuODx1/opAGJGyrTuFqEoN90oRc2Vk0ZbD4K2qmKXBBEhZQzdKHIVfEJpDU8Ak2NJEvQ==}
+
+  node-releases@2.0.27:
+    resolution: {integrity: sha512-nmh3lCkYZ3grZvqcCH+fjmQ7X+H0OeZgP40OierEaAptX4XofMh5kwNbWh7lBduUzCcV/8kZ+NDLCwm2iorIlA==}
+
+  nopt@8.1.0:
+    resolution: {integrity: sha512-ieGu42u/Qsa4TFktmaKEwM6MQH0pOWnaB3htzh0JRtx84+Mebc0cbZYN5bC+6WTZ4+77xrL9Pn5m7CV6VIkV7A==}
+    engines: {node: ^18.17.0 || >=20.5.0}
+    hasBin: true
+
+  normalize-path@3.0.0:
+    resolution: {integrity: sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==}
+    engines: {node: '>=0.10.0'}
+
+  npm-run-path@5.3.0:
+    resolution: {integrity: sha512-ppwTtiJZq0O/ai0z7yfudtBpWIoxM8yE6nHi1X47eFR2EWORqfbu6CnPlNsjeN683eT0qG6H/Pyf9fCcvjnnnQ==}
+    engines: {node: ^12.20.0 || ^14.13.1 || >=16.0.0}
+
+  npm-run-path@6.0.0:
+    resolution: {integrity: sha512-9qny7Z9DsQU8Ou39ERsPU4OZQlSTP47ShQzuKZ6PRXpYLtIFgl/DEBYEXKlvcEa+9tHVcK8CF81Y2V72qaZhWA==}
+    engines: {node: '>=18'}
+
+  nth-check@2.1.1:
+    resolution: {integrity: sha512-lqjrjmaOoAnWfMmBPL+XNnynZh2+swxiX3WUE0s4yEHI6m+AwrK2UZOimIRl3X/4QctVqS8AiZjFqyOGrMXb/w==}
+
+  nuxt@4.3.1:
+    resolution: {integrity: sha512-bl+0rFcT5Ax16aiWFBFPyWcsTob19NTZaDL5P6t0MQdK63AtgS6fN6fwvwdbXtnTk6/YdCzlmuLzXhSM22h0OA==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    hasBin: true
+    peerDependencies:
+      '@parcel/watcher': ^2.1.0
+      '@types/node': '>=18.12.0'
+    peerDependenciesMeta:
+      '@parcel/watcher':
+        optional: true
+      '@types/node':
+        optional: true
+
+  nypm@0.6.5:
+    resolution: {integrity: sha512-K6AJy1GMVyfyMXRVB88700BJqNUkByijGJM8kEHpLdcAt+vSQAVfkWWHYzuRXHSY6xA2sNc5RjTj0p9rE2izVQ==}
+    engines: {node: '>=18'}
+    hasBin: true
+
+  object-assign@4.1.1:
+    resolution: {integrity: sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==}
+    engines: {node: '>=0.10.0'}
+
+  object-inspect@1.13.4:
+    resolution: {integrity: sha512-W67iLl4J2EXEGTbfeHCffrjDfitvLANg0UlX3wFUUSTx92KXRFegMHUVgSqE+wvhAbi4WqjGg9czysTV2Epbew==}
+    engines: {node: '>= 0.4'}
+
+  object-keys@1.1.1:
+    resolution: {integrity: sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA==}
+    engines: {node: '>= 0.4'}
+
+  object.assign@4.1.7:
+    resolution: {integrity: sha512-nK28WOo+QIjBkDduTINE4JkF/UJJKyf2EJxvJKfblDpyg0Q+pkOHNTL0Qwy6NP6FhE/EnzV73BxxqcJaXY9anw==}
+    engines: {node: '>= 0.4'}
+
+  object.entries@1.1.9:
+    resolution: {integrity: sha512-8u/hfXFRBD1O0hPUjioLhoWFHRmt6tKA4/vZPyckBr18l1KE9uHrFaFaUi8MDRTpi4uak2goyPTSNJLXX2k2Hw==}
+    engines: {node: '>= 0.4'}
+
+  object.fromentries@2.0.8:
+    resolution: {integrity: sha512-k6E21FzySsSK5a21KRADBd/NGneRegFO5pLHfdQLpRDETUNJueLXs3WCzyQ3tFRDYgbq3KHGXfTbi2bs8WQ6rQ==}
+    engines: {node: '>= 0.4'}
+
+  object.groupby@1.0.3:
+    resolution: {integrity: sha512-+Lhy3TQTuzXI5hevh8sBGqbmurHbbIjAi0Z4S63nthVLmLxfbj4T54a4CfZrXIrt9iP4mVAPYMo/v99taj3wjQ==}
+    engines: {node: '>= 0.4'}
+
+  object.values@1.2.1:
+    resolution: {integrity: sha512-gXah6aZrcUxjWg2zR2MwouP2eHlCBzdV4pygudehaKXSGW4v2AsRQUK+lwwXhii6KFZcunEnmSUoYp5CXibxtA==}
+    engines: {node: '>= 0.4'}
+
+  obug@2.1.1:
+    resolution: {integrity: sha512-uTqF9MuPraAQ+IsnPf366RG4cP9RtUi7MLO1N3KEc+wb0a6yKpeL0lmk2IB1jY5KHPAlTc6T/JRdC/YqxHNwkQ==}
+
+  ofetch@1.5.1:
+    resolution: {integrity: sha512-2W4oUZlVaqAPAil6FUg/difl6YhqhUR7x2eZY4bQCko22UXg3hptq9KLQdqFClV+Wu85UX7hNtdGTngi/1BxcA==}
+
+  ofetch@2.0.0-alpha.3:
+    resolution: {integrity: sha512-zpYTCs2byOuft65vI3z43Dd6iSdFbOZZLb9/d21aCpx2rGastVU9dOCv0lu4ykc1Ur1anAYjDi3SUvR0vq50JA==}
+
+  ohash@2.0.11:
+    resolution: {integrity: sha512-RdR9FQrFwNBNXAr4GixM8YaRZRJ5PUWbKYbE5eOsrwAjJW0q2REGcf79oYPsLyskQCZG1PLN+S/K1V00joZAoQ==}
+
+  on-change@6.0.2:
+    resolution: {integrity: sha512-08+12qcOVEA0fS9g/VxKS27HaT94nRutUT77J2dr8zv/unzXopvhBuF8tNLWsoLQ5IgrQ6eptGeGqUYat82U1w==}
+    engines: {node: '>=20'}
+
+  on-finished@2.4.1:
+    resolution: {integrity: sha512-oVlzkg3ENAhCk2zdv7IJwd/QUD4z2RxRwpkcGY8psCVcCYZNq4wYnVWALHM+brtuJjePWiYF/ClmuDr8Ch5+kg==}
+    engines: {node: '>= 0.8'}
+
+  onetime@6.0.0:
+    resolution: {integrity: sha512-1FlR+gjXK7X+AsAHso35MnyN5KqGwJRi/31ft6x0M194ht7S+rWAvd7PHss9xSKMzE0asv1pyIHaJYq+BbacAQ==}
+    engines: {node: '>=12'}
+
+  oniguruma-to-es@2.3.0:
+    resolution: {integrity: sha512-bwALDxriqfKGfUufKGGepCzu9x7nJQuoRoAFp4AnwehhC2crqrDIAP/uN2qdlsAvSMpeRC3+Yzhqc7hLmle5+g==}
+
+  open@10.2.0:
+    resolution: {integrity: sha512-YgBpdJHPyQ2UE5x+hlSXcnejzAvD0b22U2OuAP+8OnlJT+PjWPxtgmGqKKc+RgTM63U9gN0YzrYc71R2WT/hTA==}
+    engines: {node: '>=18'}
+
+  open@8.4.2:
+    resolution: {integrity: sha512-7x81NCL719oNbsq/3mh+hVrAWmFuEYUqrq/Iw3kUzH8ReypT9QQ0BLoJS7/G9k6N81XjW4qHWtjWwe/9eLy1EQ==}
+    engines: {node: '>=12'}
+
+  optionator@0.9.4:
+    resolution: {integrity: sha512-6IpQ7mKUxRcZNLIObR0hz7lxsapSSIYNZJwXPGeF0mTVqGKFIXj1DQcMoT22S3ROcLyY/rz0PWaWZ9ayWmad9g==}
+    engines: {node: '>= 0.8.0'}
+
+  outdent@0.5.0:
+    resolution: {integrity: sha512-/jHxFIzoMXdqPzTaCpFzAAWhpkSjZPF4Vsn6jAfNpmbH/ymsmd7Qc6VE9BGn0L6YMj6uwpQLxCECpus4ukKS9Q==}
+
+  own-keys@1.0.1:
+    resolution: {integrity: sha512-qFOyK5PjiWZd+QQIh+1jhdb9LpxTF0qs7Pm8o5QHYZ0M3vKqSqzsZaEB6oWlxZ+q2sJBMI/Ktgd2N5ZwQoRHfg==}
+    engines: {node: '>= 0.4'}
+
+  oxc-minify@0.112.0:
+    resolution: {integrity: sha512-rkVSeeIRSt+RYI9uX6xonBpLUpvZyegxIg0UL87ev7YAfUqp7IIZlRjkgQN5Us1lyXD//TOo0Dcuuro/TYOWoQ==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+
+  oxc-parser@0.112.0:
+    resolution: {integrity: sha512-7rQ3QdJwobMQLMZwQaPuPYMEF2fDRZwf51lZ//V+bA37nejjKW5ifMHbbCwvA889Y4RLhT+/wLJpPRhAoBaZYw==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+
+  oxc-transform@0.112.0:
+    resolution: {integrity: sha512-cIRRvZgrHfsAHrkt8LWdAX4+Do8R0MzQSfeo9yzErzHeYiuyNiP4PCTPbOy/wBXL4MYzt3ebrBa5jt3akQkKAg==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+
+  oxc-walker@0.7.0:
+    resolution: {integrity: sha512-54B4KUhrzbzc4sKvKwVYm7E2PgeROpGba0/2nlNZMqfDyca+yOor5IMb4WLGBatGDT0nkzYdYuzylg7n3YfB7A==}
+    peerDependencies:
+      oxc-parser: '>=0.98.0'
+
+  p-filter@2.1.0:
+    resolution: {integrity: sha512-ZBxxZ5sL2HghephhpGAQdoskxplTwr7ICaehZwLIlfL6acuVgZPm8yBNuRAFBGEqtD/hmUeq9eqLg2ys9Xr/yw==}
+    engines: {node: '>=8'}
+
+  p-limit@2.3.0:
+    resolution: {integrity: sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w==}
+    engines: {node: '>=6'}
+
+  p-limit@3.1.0:
+    resolution: {integrity: sha512-TYOanM3wGwNGsZN2cVTYPArw454xnXj5qmWF1bEoAc4+cU/ol7GVh7odevjp1FNHduHc3KZMcFduxU5Xc6uJRQ==}
+    engines: {node: '>=10'}
+
+  p-locate@4.1.0:
+    resolution: {integrity: sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A==}
+    engines: {node: '>=8'}
+
+  p-locate@5.0.0:
+    resolution: {integrity: sha512-LaNjtRWUBY++zB5nE/NwcaoMylSPk+S+ZHNB1TzdbMJMny6dynpAGt7X/tl/QYq3TIeE6nxHppbo2LGymrG5Pw==}
+    engines: {node: '>=10'}
+
+  p-map@2.1.0:
+    resolution: {integrity: sha512-y3b8Kpd8OAN444hxfBbFfj1FY/RjtTd8tzYwhUqNYXx0fXx2iX4maP4Qr6qhIKbQXI02wTLAda4fYUbDagTUFw==}
+    engines: {node: '>=6'}
+
+  p-try@2.2.0:
+    resolution: {integrity: sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==}
+    engines: {node: '>=6'}
+
+  package-json-from-dist@1.0.1:
+    resolution: {integrity: sha512-UEZIS3/by4OC8vL3P2dTXRETpebLI2NiI5vIrjaD/5UtrkFX/tNbwjTSRAGC/+7CAo2pIcBaRgWmcBBHcsaCIw==}
+
+  package-manager-detector@0.2.11:
+    resolution: {integrity: sha512-BEnLolu+yuz22S56CU1SUKq3XC3PkwD5wv4ikR4MfGvnRVcmzXR9DwSlW2fEamyTPyXHomBJRzgapeuBvRNzJQ==}
+
+  parent-module@1.0.1:
+    resolution: {integrity: sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==}
+    engines: {node: '>=6'}
+
+  parse5@7.3.0:
+    resolution: {integrity: sha512-IInvU7fabl34qmi9gY8XOVxhYyMyuH2xUNpb2q8/Y+7552KlejkRvqvD19nMoUW/uQGGbqNpA6Tufu5FL5BZgw==}
+
+  parseurl@1.3.3:
+    resolution: {integrity: sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==}
+    engines: {node: '>= 0.8'}
+
+  path-browserify@1.0.1:
+    resolution: {integrity: sha512-b7uo2UCUOYZcnF/3ID0lulOJi/bafxa1xPe7ZPsammBSpjSWQkjNxlt635YGS2MiR9GjvuXCtz2emr3jbsz98g==}
+
+  path-exists@4.0.0:
+    resolution: {integrity: sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==}
+    engines: {node: '>=8'}
+
+  path-key@3.1.1:
+    resolution: {integrity: sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==}
+    engines: {node: '>=8'}
+
+  path-key@4.0.0:
+    resolution: {integrity: sha512-haREypq7xkM7ErfgIyA0z+Bj4AGKlMSdlQE2jvJo6huWD1EdkKYV+G/T4nq0YEF2vgTT8kqMFKo1uHn950r4SQ==}
+    engines: {node: '>=12'}
+
+  path-parse@1.0.7:
+    resolution: {integrity: sha512-LDJzPVEEEPR+y48z93A0Ed0yXb8pAByGWo/k5YYdYgpY2/2EsOsksJrq7lOHxryrVOn1ejG6oAp8ahvOIQD8sw==}
+
+  path-scurry@1.11.1:
+    resolution: {integrity: sha512-Xa4Nw17FS9ApQFJ9umLiJS4orGjm7ZzwUrwamcGQuHSzDyth9boKDaycYdDcZDuqYATXw4HFXgaqWTctW/v1HA==}
+    engines: {node: '>=16 || 14 >=14.18'}
+
+  path-scurry@2.0.1:
+    resolution: {integrity: sha512-oWyT4gICAu+kaA7QWk/jvCHWarMKNs6pXOGWKDTr7cw4IGcUbW+PeTfbaQiLGheFRpjo6O9J0PmyMfQPjH71oA==}
+    engines: {node: 20 || >=22}
+
+  path-to-regexp@6.3.0:
+    resolution: {integrity: sha512-Yhpw4T9C6hPpgPeA28us07OJeqZ5EzQTkbfwuhsUg0c237RomFoETJgmp2sa3F/41gfLE6G5cqcYwznmeEeOlQ==}
+
+  path-type@4.0.0:
+    resolution: {integrity: sha512-gDKb8aZMDeD/tZWs9P6+q0J9Mwkdl6xMV8TjnGP3qJVJ06bdMgkbBlLU8IdfOsIsFz2BW1rNVT3XuNEl8zPAvw==}
+    engines: {node: '>=8'}
+
+  pathe@1.1.2:
+    resolution: {integrity: sha512-whLdWMYL2TwI08hn8/ZqAbrVemu0LNaNNJZX73O6qaIdCTfXutsLhMkjdENX0qhsQ9uIimo4/aQOmXkoon2nDQ==}
+
+  pathe@2.0.3:
+    resolution: {integrity: sha512-WUjGcAqP1gQacoQe+OBJsFA7Ld4DyXuUIjZ5cc75cLHvJ7dtNsTugphxIADwspS+AraAUePCKrSVtPLFj/F88w==}
+
+  perfect-debounce@2.1.0:
+    resolution: {integrity: sha512-LjgdTytVFXeUgtHZr9WYViYSM/g8MkcTPYDlPa3cDqMirHjKiSZPYd6DoL7pK8AJQr+uWkQvCjHNdiMqsrJs+g==}
+
+  picocolors@1.1.1:
+    resolution: {integrity: sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA==}
+
+  picomatch@2.3.1:
+    resolution: {integrity: sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==}
+    engines: {node: '>=8.6'}
+
+  picomatch@4.0.3:
+    resolution: {integrity: sha512-5gTmgEY/sqK6gFXLIsQNH19lWb4ebPDLA4SdLP7dsWkIXHWlG66oPuVvXSGFPppYZz8ZDZq0dYYrbHfBCVUb1Q==}
+    engines: {node: '>=12'}
+
+  pify@4.0.1:
+    resolution: {integrity: sha512-uB80kBFb/tfd68bVleG9T5GGsGPjJrLAUpR5PZIrhBnIaRTQRjqdJSsIKkOP6OAIFbj7GOrcudc5pNjZ+geV2g==}
+    engines: {node: '>=6'}
+
+  pirates@4.0.7:
+    resolution: {integrity: sha512-TfySrs/5nm8fQJDcBDuUng3VOUKsd7S+zqvbOTiGXHfxX4wK31ard+hoNuvkicM/2YFzlpDgABOevKSsB4G/FA==}
+    engines: {node: '>= 6'}
+
+  pkg-types@1.3.1:
+    resolution: {integrity: sha512-/Jm5M4RvtBFVkKWRu2BLUTNP8/M2a+UwuAX+ae4770q1qVGtfjG+WTCupoZixokjmHiry8uI+dlY8KXYV5HVVQ==}
+
+  pkg-types@2.3.0:
+    resolution: {integrity: sha512-SIqCzDRg0s9npO5XQ3tNZioRY1uK06lA41ynBC1YmFTmnY6FjUjVt6s4LoADmwoig1qqD0oK8h1p/8mlMx8Oig==}
+
+  playwright-core@1.58.2:
+    resolution: {integrity: sha512-yZkEtftgwS8CsfYo7nm0KE8jsvm6i/PTgVtB8DL726wNf6H2IMsDuxCpJj59KDaxCtSnrWan2AeDqM7JBaultg==}
+    engines: {node: '>=18'}
+    hasBin: true
+
+  playwright@1.58.2:
+    resolution: {integrity: sha512-vA30H8Nvkq/cPBnNw4Q8TWz1EJyqgpuinBcHET0YVJVFldr8JDNiU9LaWAE1KqSkRYazuaBhTpB5ZzShOezQ6A==}
+    engines: {node: '>=18'}
+    hasBin: true
+
+  possible-typed-array-names@1.1.0:
+    resolution: {integrity: sha512-/+5VFTchJDoVj3bhoqi6UeymcD00DAwb1nJwamzPvHEszJ4FpF6SNNbUbOS8yI56qHzdV8eK0qEfOSiodkTdxg==}
+    engines: {node: '>= 0.4'}
+
+  postcss-calc@10.1.1:
+    resolution: {integrity: sha512-NYEsLHh8DgG/PRH2+G9BTuUdtf9ViS+vdoQ0YA5OQdGsfN4ztiwtDWNtBl9EKeqNMFnIu8IKZ0cLxEQ5r5KVMw==}
+    engines: {node: ^18.12 || ^20.9 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.38
+
+  postcss-colormin@7.0.5:
+    resolution: {integrity: sha512-ekIBP/nwzRWhEMmIxHHbXHcMdzd1HIUzBECaj5KEdLz9DVP2HzT065sEhvOx1dkLjYW7jyD0CngThx6bpFi2fA==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-convert-values@7.0.8:
+    resolution: {integrity: sha512-+XNKuPfkHTCEo499VzLMYn94TiL3r9YqRE3Ty+jP7UX4qjewUONey1t7CG21lrlTLN07GtGM8MqFVp86D4uKJg==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-discard-comments@7.0.5:
+    resolution: {integrity: sha512-IR2Eja8WfYgN5n32vEGSctVQ1+JARfu4UH8M7bgGh1bC+xI/obsPJXaBpQF7MAByvgwZinhpHpdrmXtvVVlKcQ==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-discard-duplicates@7.0.2:
+    resolution: {integrity: sha512-eTonaQvPZ/3i1ASDHOKkYwAybiM45zFIc7KXils4mQmHLqIswXD9XNOKEVxtTFnsmwYzF66u4LMgSr0abDlh5w==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-discard-empty@7.0.1:
+    resolution: {integrity: sha512-cFrJKZvcg/uxB6Ijr4l6qmn3pXQBna9zyrPC+sK0zjbkDUZew+6xDltSF7OeB7rAtzaaMVYSdbod+sZOCWnMOg==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-discard-overridden@7.0.1:
+    resolution: {integrity: sha512-7c3MMjjSZ/qYrx3uc1940GSOzN1Iqjtlqe8uoSg+qdVPYyRb0TILSqqmtlSFuE4mTDECwsm397Ya7iXGzfF7lg==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-load-config@6.0.1:
+    resolution: {integrity: sha512-oPtTM4oerL+UXmx+93ytZVN82RrlY/wPUV8IeDxFrzIjXOLF1pN+EmKPLbubvKHT2HC20xXsCAH2Z+CKV6Oz/g==}
+    engines: {node: '>= 18'}
+    peerDependencies:
+      jiti: '>=1.21.0'
+      postcss: '>=8.0.9'
+      tsx: ^4.8.1
+      yaml: ^2.4.2
+    peerDependenciesMeta:
+      jiti:
+        optional: true
+      postcss:
+        optional: true
+      tsx:
+        optional: true
+      yaml:
+        optional: true
+
+  postcss-merge-longhand@7.0.5:
+    resolution: {integrity: sha512-Kpu5v4Ys6QI59FxmxtNB/iHUVDn9Y9sYw66D6+SZoIk4QTz1prC4aYkhIESu+ieG1iylod1f8MILMs1Em3mmIw==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-merge-rules@7.0.7:
+    resolution: {integrity: sha512-njWJrd/Ms6XViwowaaCc+/vqhPG3SmXn725AGrnl+BgTuRPEacjiLEaGq16J6XirMJbtKkTwnt67SS+e2WGoew==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-minify-font-values@7.0.1:
+    resolution: {integrity: sha512-2m1uiuJeTplll+tq4ENOQSzB8LRnSUChBv7oSyFLsJRtUgAAJGP6LLz0/8lkinTgxrmJSPOEhgY1bMXOQ4ZXhQ==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-minify-gradients@7.0.1:
+    resolution: {integrity: sha512-X9JjaysZJwlqNkJbUDgOclyG3jZEpAMOfof6PUZjPnPrePnPG62pS17CjdM32uT1Uq1jFvNSff9l7kNbmMSL2A==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-minify-params@7.0.5:
+    resolution: {integrity: sha512-FGK9ky02h6Ighn3UihsyeAH5XmLEE2MSGH5Tc4tXMFtEDx7B+zTG6hD/+/cT+fbF7PbYojsmmWjyTwFwW1JKQQ==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-minify-selectors@7.0.5:
+    resolution: {integrity: sha512-x2/IvofHcdIrAm9Q+p06ZD1h6FPcQ32WtCRVodJLDR+WMn8EVHI1kvLxZuGKz/9EY5nAmI6lIQIrpo4tBy5+ug==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-normalize-charset@7.0.1:
+    resolution: {integrity: sha512-sn413ofhSQHlZFae//m9FTOfkmiZ+YQXsbosqOWRiVQncU2BA3daX3n0VF3cG6rGLSFVc5Di/yns0dFfh8NFgQ==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-normalize-display-values@7.0.1:
+    resolution: {integrity: sha512-E5nnB26XjSYz/mGITm6JgiDpAbVuAkzXwLzRZtts19jHDUBFxZ0BkXAehy0uimrOjYJbocby4FVswA/5noOxrQ==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-normalize-positions@7.0.1:
+    resolution: {integrity: sha512-pB/SzrIP2l50ZIYu+yQZyMNmnAcwyYb9R1fVWPRxm4zcUFCY2ign7rcntGFuMXDdd9L2pPNUgoODDk91PzRZuQ==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-normalize-repeat-style@7.0.1:
+    resolution: {integrity: sha512-NsSQJ8zj8TIDiF0ig44Byo3Jk9e4gNt9x2VIlJudnQQ5DhWAHJPF4Tr1ITwyHio2BUi/I6Iv0HRO7beHYOloYQ==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-normalize-string@7.0.1:
+    resolution: {integrity: sha512-QByrI7hAhsoze992kpbMlJSbZ8FuCEc1OT9EFbZ6HldXNpsdpZr+YXC5di3UEv0+jeZlHbZcoCADgb7a+lPmmQ==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-normalize-timing-functions@7.0.1:
+    resolution: {integrity: sha512-bHifyuuSNdKKsnNJ0s8fmfLMlvsQwYVxIoUBnowIVl2ZAdrkYQNGVB4RxjfpvkMjipqvbz0u7feBZybkl/6NJg==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-normalize-unicode@7.0.5:
+    resolution: {integrity: sha512-X6BBwiRxVaFHrb2WyBMddIeB5HBjJcAaUHyhLrM2FsxSq5TFqcHSsK7Zu1otag+o0ZphQGJewGH1tAyrD0zX1Q==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-normalize-url@7.0.1:
+    resolution: {integrity: sha512-sUcD2cWtyK1AOL/82Fwy1aIVm/wwj5SdZkgZ3QiUzSzQQofrbq15jWJ3BA7Z+yVRwamCjJgZJN0I9IS7c6tgeQ==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-normalize-whitespace@7.0.1:
+    resolution: {integrity: sha512-vsbgFHMFQrJBJKrUFJNZ2pgBeBkC2IvvoHjz1to0/0Xk7sII24T0qFOiJzG6Fu3zJoq/0yI4rKWi7WhApW+EFA==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-ordered-values@7.0.2:
+    resolution: {integrity: sha512-AMJjt1ECBffF7CEON/Y0rekRLS6KsePU6PRP08UqYW4UGFRnTXNrByUzYK1h8AC7UWTZdQ9O3Oq9kFIhm0SFEw==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-reduce-initial@7.0.5:
+    resolution: {integrity: sha512-RHagHLidG8hTZcnr4FpyMB2jtgd/OcyAazjMhoy5qmWJOx1uxKh4ntk0Pb46ajKM0rkf32lRH4C8c9qQiPR6IA==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-reduce-transforms@7.0.1:
+    resolution: {integrity: sha512-MhyEbfrm+Mlp/36hvZ9mT9DaO7dbncU0CvWI8V93LRkY6IYlu38OPg3FObnuKTUxJ4qA8HpurdQOo5CyqqO76g==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-selector-parser@7.1.1:
+    resolution: {integrity: sha512-orRsuYpJVw8LdAwqqLykBj9ecS5/cRHlI5+nvTo8LcCKmzDmqVORXtOIYEEQuL9D4BxtA1lm5isAqzQZCoQ6Eg==}
+    engines: {node: '>=4'}
+
+  postcss-svgo@7.1.0:
+    resolution: {integrity: sha512-KnAlfmhtoLz6IuU3Sij2ycusNs4jPW+QoFE5kuuUOK8awR6tMxZQrs5Ey3BUz7nFCzT3eqyFgqkyrHiaU2xx3w==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >= 18}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-unique-selectors@7.0.4:
+    resolution: {integrity: sha512-pmlZjsmEAG7cHd7uK3ZiNSW6otSZ13RHuZ/4cDN/bVglS5EpF2r2oxY99SuOHa8m7AWoBCelTS3JPpzsIs8skQ==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  postcss-value-parser@4.2.0:
+    resolution: {integrity: sha512-1NNCs6uurfkVbeXG4S8JFT9t19m45ICnif8zWLd5oPSZ50QnwMfK+H3jv408d4jw/7Bttv5axS5IiHoLaVNHeQ==}
+
+  postcss@8.4.31:
+    resolution: {integrity: sha512-PS08Iboia9mts/2ygV3eLpY5ghnUcfLV/EXTOW1E2qYxJKGGBUtNjN76FYHnMs36RmARn41bC0AZmn+rR0OVpQ==}
+    engines: {node: ^10 || ^12 || >=14}
+
+  postcss@8.5.6:
+    resolution: {integrity: sha512-3Ybi1tAuwAP9s0r1UQ2J4n5Y0G05bJkpUIO0/bI9MhwmD70S5aTWbXGBwxHrelT+XM1k6dM0pk+SwNkpTRN7Pg==}
+    engines: {node: ^10 || ^12 || >=14}
+
+  prelude-ls@1.2.1:
+    resolution: {integrity: sha512-vkcDPrRZo1QZLbn5RLGPpg/WmIQ65qoWWhcGKf/b5eplkkarX0m9z8ppCat4mlOqUsWpyNuYgO3VRyrYHSzX5g==}
+    engines: {node: '>= 0.8.0'}
+
+  prettier@2.8.8:
+    resolution: {integrity: sha512-tdN8qQGvNjw4CHbY+XXk0JgCXn9QiF21a55rBe5LJAU+kDyC4WQn4+awm2Xfk2lQMk5fKup9XgzTZtGkjBdP9Q==}
+    engines: {node: '>=10.13.0'}
+    hasBin: true
+
+  pretty-bytes@7.1.0:
+    resolution: {integrity: sha512-nODzvTiYVRGRqAOvE84Vk5JDPyyxsVk0/fbA/bq7RqlnhksGpset09XTxbpvLTIjoaF7K8Z8DG8yHtKGTPSYRw==}
+    engines: {node: '>=20'}
+
+  process-nextick-args@2.0.1:
+    resolution: {integrity: sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==}
+
+  process@0.11.10:
+    resolution: {integrity: sha512-cdGef/drWFoydD1JsMzuFf8100nZl+GT+yacc2bEced5f9Rjk4z+WtFUTBu9PhOi9j/jfmBPu0mMEY4wIdAF8A==}
+    engines: {node: '>= 0.6.0'}
+
+  prompts@2.4.2:
+    resolution: {integrity: sha512-NxNv/kLguCA7p3jE8oL2aEBsrJWgAakBpgmgK6lpPWV+WuOmY6r2/zbAVnP+T8bQlA0nzHXSJSJW0Hq7ylaD2Q==}
+    engines: {node: '>= 6'}
+
+  prop-types@15.8.1:
+    resolution: {integrity: sha512-oj87CgZICdulUohogVAR7AjlC0327U4el4L6eAvOqCeudMDVU0NThNaV+b9Df4dXgSP1gXMTnPdhfe/2qDH5cg==}
+
+  property-information@7.1.0:
+    resolution: {integrity: sha512-TwEZ+X+yCJmYfL7TPUOcvBZ4QfoT5YenQiJuX//0th53DE6w0xxLEtfK3iyryQFddXuvkIk51EEgrJQ0WJkOmQ==}
+
+  punycode@2.3.1:
+    resolution: {integrity: sha512-vYt7UD1U9Wg6138shLtLOvdAu+8DsC/ilFtEVHcH+wydcSpNE20AfSOduf6MkRFahL5FY7X1oU7nKVZFtfq8Fg==}
+    engines: {node: '>=6'}
+
+  quansync@0.2.11:
+    resolution: {integrity: sha512-AifT7QEbW9Nri4tAwR5M/uzpBuqfZf+zwaEM/QkzEjj7NBuFD2rBuy0K3dE+8wltbezDV7JMA0WfnCPYRSYbXA==}
+
+  queue-microtask@1.2.3:
+    resolution: {integrity: sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A==}
+
+  radix3@1.1.2:
+    resolution: {integrity: sha512-b484I/7b8rDEdSDKckSSBA8knMpcdsXudlE/LNL639wFoHKwLbEkQFZHWEYwDC0wa0FKUcCY+GAF73Z7wxNVFA==}
+
+  randombytes@2.1.0:
+    resolution: {integrity: sha512-vYl3iOX+4CKUWuxGi9Ukhie6fsqXqS9FE2Zaic4tNFD2N2QQaXOMFbuKK4QmDHC0JO6B1Zp41J0LpT0oR68amQ==}
+
+  range-parser@1.2.1:
+    resolution: {integrity: sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==}
+    engines: {node: '>= 0.6'}
+
+  rc9@2.1.2:
+    resolution: {integrity: sha512-btXCnMmRIBINM2LDZoEmOogIZU7Qe7zn4BpomSKZ/ykbLObuBdvG+mFq11DL6fjH1DRwHhrlgtYWG96bJiC7Cg==}
+
+  rc9@3.0.0:
+    resolution: {integrity: sha512-MGOue0VqscKWQ104udASX/3GYDcKyPI4j4F8gu/jHHzglpmy9a/anZK3PNe8ug6aZFl+9GxLtdhe3kVZuMaQbA==}
+
+  react-dom@19.2.4:
+    resolution: {integrity: sha512-AXJdLo8kgMbimY95O2aKQqsz2iWi9jMgKJhRBAxECE4IFxfcazB2LmzloIoibJI3C12IlY20+KFaLv+71bUJeQ==}
+    peerDependencies:
+      react: ^19.2.4
+
+  react-is@16.13.1:
+    resolution: {integrity: sha512-24e6ynE2H+OKt4kqsOvNd8kBpV65zoxbA4BVsEOB3ARVWQki/DHzaUoC5KuON/BiccDaCCTZBuOcfZs70kR8bQ==}
+
+  react-refresh@0.18.0:
+    resolution: {integrity: sha512-QgT5//D3jfjJb6Gsjxv0Slpj23ip+HtOpnNgnb2S5zU3CB26G/IDPGoy4RJB42wzFE46DRsstbW6tKHoKbhAxw==}
+    engines: {node: '>=0.10.0'}
+
+  react@19.2.4:
+    resolution: {integrity: sha512-9nfp2hYpCwOjAN+8TZFGhtWEwgvWHXqESH8qT89AT/lWklpLON22Lc8pEtnpsZz7VmawabSU0gCjnj8aC0euHQ==}
+    engines: {node: '>=0.10.0'}
+
+  read-yaml-file@1.1.0:
+    resolution: {integrity: sha512-VIMnQi/Z4HT2Fxuwg5KrY174U1VdUIASQVWXXyqtNRtxSr9IYkn1rsI6Tb6HsrHCmB7gVpNwX6JxPTHcH6IoTA==}
+    engines: {node: '>=6'}
+
+  readable-stream@2.3.8:
+    resolution: {integrity: sha512-8p0AUk4XODgIewSi0l8Epjs+EVnWiK7NoDIEGU0HhE7+ZyY8D1IMY7odu5lRrFXGg71L15KG8QrPmum45RTtdA==}
+
+  readable-stream@4.7.0:
+    resolution: {integrity: sha512-oIGGmcpTLwPga8Bn6/Z75SVaH1z5dUut2ibSyAMVhmUggWpmDn2dapB0n7f8nwaSiRtepAsfJyfXIO5DCVAODg==}
+    engines: {node: ^12.22.0 || ^14.17.0 || >=16.0.0}
+
+  readdir-glob@1.1.3:
+    resolution: {integrity: sha512-v05I2k7xN8zXvPD9N+z/uhXPaj0sUFCe2rcWZIpBsqxfP7xXFQ0tipAd/wjj1YxWyWtUS5IDJpOG82JKt2EAVA==}
+
+  readdirp@4.1.2:
+    resolution: {integrity: sha512-GDhwkLfywWL2s6vEjyhri+eXmfH6j1L7JE27WhqLeYzoh/A3DBaYGEj2H/HFZCn/kMfim73FXxEJTw06WtxQwg==}
+    engines: {node: '>= 14.18.0'}
+
+  readdirp@5.0.0:
+    resolution: {integrity: sha512-9u/XQ1pvrQtYyMpZe7DXKv2p5CNvyVwzUB6uhLAnQwHMSgKMBR62lc7AHljaeteeHXn11XTAaLLUVZYVZyuRBQ==}
+    engines: {node: '>= 20.19.0'}
+
+  recast@0.23.11:
+    resolution: {integrity: sha512-YTUo+Flmw4ZXiWfQKGcwwc11KnoRAYgzAE2E7mXKCjSviTKShtxBsN6YUUBB2gtaBzKzeKunxhUwNHQuRryhWA==}
+    engines: {node: '>= 4'}
+
+  redis-errors@1.2.0:
+    resolution: {integrity: sha512-1qny3OExCf0UvUV/5wpYKf2YwPcOqXzkwKKSmKHiE6ZMQs5heeE/c8eXK+PNllPvmjgAbfnsbpkGZWy8cBpn9w==}
+    engines: {node: '>=4'}
+
+  redis-parser@3.0.0:
+    resolution: {integrity: sha512-DJnGAeenTdpMEH6uAJRK/uiyEIH9WVsUmoLwzudwGJUwZPp80PDBWPHXSAGNPwNvIXAbe7MSUB1zQFugFml66A==}
+    engines: {node: '>=4'}
+
+  reflect.getprototypeof@1.0.10:
+    resolution: {integrity: sha512-00o4I+DVrefhv+nX0ulyi3biSHCPDe+yLv5o/p6d/UVlirijB8E16FtfwSAi4g3tcqrQ4lRAqQSoFEZJehYEcw==}
+    engines: {node: '>= 0.4'}
+
+  regex-recursion@5.1.1:
+    resolution: {integrity: sha512-ae7SBCbzVNrIjgSbh7wMznPcQel1DNlDtzensnFxpiNpXt1U2ju/bHugH422r+4LAVS1FpW1YCwilmnNsjum9w==}
+
+  regex-utilities@2.3.0:
+    resolution: {integrity: sha512-8VhliFJAWRaUiVvREIiW2NXXTmHs4vMNnSzuJVhscgmGav3g9VDxLrQndI3dZZVVdp0ZO/5v0xmX516/7M9cng==}
+
+  regex@5.1.1:
+    resolution: {integrity: sha512-dN5I359AVGPnwzJm2jN1k0W9LPZ+ePvoOeVMMfqIMFz53sSwXkxaJoxr50ptnsC771lK95BnTrVSZxq0b9yCGw==}
+
+  regexp-tree@0.1.27:
+    resolution: {integrity: sha512-iETxpjK6YoRWJG5o6hXLwvjYAoW+FEZn9os0PD/b6AP6xQwsa/Y7lCVgIixBbUPMfhu+i2LtdeAqVTgGlQarfA==}
+    hasBin: true
+
+  regexp.prototype.flags@1.5.4:
+    resolution: {integrity: sha512-dYqgNSZbDwkaJ2ceRd9ojCGjBq+mOm9LmtXnAnEGyHhN/5R7iDW2TRw3h+o/jCFxus3P2LfWIIiwowAjANm7IA==}
+    engines: {node: '>= 0.4'}
+
+  require-directory@2.1.1:
+    resolution: {integrity: sha512-fGxEI7+wsG9xrvdjsrlmL22OMTTiHRwAMroiEeMgq8gzoLC/PQr7RsRDSTLUg/bZAZtF+TVIkHc6/4RIKrui+Q==}
+    engines: {node: '>=0.10.0'}
+
+  requires-port@1.0.0:
+    resolution: {integrity: sha512-KigOCHcocU3XODJxsu8i/j8T9tzT4adHiecwORRQ0ZZFcp7ahwXuRU1m+yuO90C5ZUyGeGfocHDI14M3L3yDAQ==}
+
+  resolve-from@4.0.0:
+    resolution: {integrity: sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==}
+    engines: {node: '>=4'}
+
+  resolve-from@5.0.0:
+    resolution: {integrity: sha512-qYg9KP24dD5qka9J47d0aVky0N+b4fTU89LN9iDnjB5waksiC49rvMB0PrUJQGoTmH50XPiqOvAjDfaijGxYZw==}
+    engines: {node: '>=8'}
+
+  resolve-pkg-maps@1.0.0:
+    resolution: {integrity: sha512-seS2Tj26TBVOC2NIc2rOe2y2ZO7efxITtLZcGSOnHHNOQ7CkiUBfw0Iw2ck6xkIhPwLhKNLS8BO+hEpngQlqzw==}
+
+  resolve@1.22.11:
+    resolution: {integrity: sha512-RfqAvLnMl313r7c9oclB1HhUEAezcpLjz95wFH4LVuhk9JF/r22qmVP9AMmOU4vMX7Q8pN8jwNg/CSpdFnMjTQ==}
+    engines: {node: '>= 0.4'}
+    hasBin: true
+
+  resolve@2.0.0-next.6:
+    resolution: {integrity: sha512-3JmVl5hMGtJ3kMmB3zi3DL25KfkCEyy3Tw7Gmw7z5w8M9WlwoPFnIvwChzu1+cF3iaK3sp18hhPz8ANeimdJfA==}
+    engines: {node: '>= 0.4'}
+    hasBin: true
+
+  reusify@1.1.0:
+    resolution: {integrity: sha512-g6QUff04oZpHs0eG5p83rFLhHeV00ug/Yf9nZM6fLeUrPguBTkTQOdpAWWspMh55TZfVQDPaN3NQJfbVRAxdIw==}
+    engines: {iojs: '>=1.0.0', node: '>=0.10.0'}
+
+  rfdc@1.4.1:
+    resolution: {integrity: sha512-q1b3N5QkRUWUl7iyylaaj3kOpIT0N2i9MqIEQXP73GVsN9cw3fdx8X63cEmWhJGi2PPCF23Ijp7ktmd39rawIA==}
+
+  rollup-plugin-visualizer@6.0.5:
+    resolution: {integrity: sha512-9+HlNgKCVbJDs8tVtjQ43US12eqaiHyyiLMdBwQ7vSZPiHMysGNo2E88TAp1si5wx8NAoYriI2A5kuKfIakmJg==}
+    engines: {node: '>=18'}
+    hasBin: true
+    peerDependencies:
+      rolldown: 1.x || ^1.0.0-beta
+      rollup: 2.x || 3.x || 4.x
+    peerDependenciesMeta:
+      rolldown:
+        optional: true
+      rollup:
+        optional: true
+
+  rollup@4.57.1:
+    resolution: {integrity: sha512-oQL6lgK3e2QZeQ7gcgIkS2YZPg5slw37hYufJ3edKlfQSGGm8ICoxswK15ntSzF/a8+h7ekRy7k7oWc3BQ7y8A==}
+    engines: {node: '>=18.0.0', npm: '>=8.0.0'}
+    hasBin: true
+
+  rou3@0.7.12:
+    resolution: {integrity: sha512-iFE4hLDuloSWcD7mjdCDhx2bKcIsYbtOTpfH5MHHLSKMOUyjqQXTeZVa289uuwEGEKFoE/BAPbhaU4B774nceg==}
+
+  run-applescript@7.1.0:
+    resolution: {integrity: sha512-DPe5pVFaAsinSaV6QjQ6gdiedWDcRCbUuiQfQa2wmWV7+xC9bGulGI8+TdRmoFkAPaBXk8CrAbnlY2ISniJ47Q==}
+    engines: {node: '>=18'}
+
+  run-parallel@1.2.0:
+    resolution: {integrity: sha512-5l4VyZR86LZ/lDxZTR6jqL8AFE2S0IFLMP26AbjsLVADxHdhB/c0GUsH+y39UfCi3dzz8OlQuPmnaJOMoDHQBA==}
+
+  sade@1.8.1:
+    resolution: {integrity: sha512-xal3CZX1Xlo/k4ApwCFrHVACi9fBqJ7V+mwhBsuf/1IOKbBy098Fex+Wa/5QMubw09pSZ/u8EY8PWgevJsXp1A==}
+    engines: {node: '>=6'}
+
+  safe-array-concat@1.1.3:
+    resolution: {integrity: sha512-AURm5f0jYEOydBj7VQlVvDrjeFgthDdEF5H1dP+6mNpoXOMo1quQqJ4wvJDyRZ9+pO3kGWoOdmV08cSv2aJV6Q==}
+    engines: {node: '>=0.4'}
+
+  safe-buffer@5.1.2:
+    resolution: {integrity: sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==}
+
+  safe-buffer@5.2.1:
+    resolution: {integrity: sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==}
+
+  safe-push-apply@1.0.0:
+    resolution: {integrity: sha512-iKE9w/Z7xCzUMIZqdBsp6pEQvwuEebH4vdpjcDWnyzaI6yl6O9FHvVpmGelvEHNsoY6wGblkxR6Zty/h00WiSA==}
+    engines: {node: '>= 0.4'}
+
+  safe-regex-test@1.1.0:
+    resolution: {integrity: sha512-x/+Cz4YrimQxQccJf5mKEbIa1NzeCRNI5Ecl/ekmlYaampdNLPalVyIcCZNNH3MvmqBugV5TMYZXv0ljslUlaw==}
+    engines: {node: '>= 0.4'}
+
+  safer-buffer@2.1.2:
+    resolution: {integrity: sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==}
+
+  sax@1.4.4:
+    resolution: {integrity: sha512-1n3r/tGXO6b6VXMdFT54SHzT9ytu9yr7TaELowdYpMqY/Ao7EnlQGmAQ1+RatX7Tkkdm6hONI2owqNx2aZj5Sw==}
+    engines: {node: '>=11.0.0'}
+
+  scheduler@0.27.0:
+    resolution: {integrity: sha512-eNv+WrVbKu1f3vbYJT/xtiF5syA5HPIMtf9IgY/nKg0sWqzAUEvqY/xm7OcZc/qafLx/iO9FgOmeSAp4v5ti/Q==}
+
+  scule@1.3.0:
+    resolution: {integrity: sha512-6FtHJEvt+pVMIB9IBY+IcCJ6Z5f1iQnytgyfKMhDKgmzYG+TeH/wx1y3l27rshSbLiSanrR9ffZDrEsmjlQF2g==}
+
+  semver@6.3.1:
+    resolution: {integrity: sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==}
+    hasBin: true
+
+  semver@7.7.4:
+    resolution: {integrity: sha512-vFKC2IEtQnVhpT78h1Yp8wzwrf8CM+MzKMHGJZfBtzhZNycRFnXsHk6E5TxIkkMsgNS7mdX3AGB7x2QM2di4lA==}
+    engines: {node: '>=10'}
+    hasBin: true
+
+  send@0.19.2:
+    resolution: {integrity: sha512-VMbMxbDeehAxpOtWJXlcUS5E8iXh6QmN+BkRX1GARS3wRaXEEgzCcB10gTQazO42tpNIya8xIyNx8fll1OFPrg==}
+    engines: {node: '>= 0.8.0'}
+
+  send@1.2.1:
+    resolution: {integrity: sha512-1gnZf7DFcoIcajTjTwjwuDjzuz4PPcY2StKPlsGAQ1+YH20IRVrBaXSWmdjowTJ6u8Rc01PoYOGHXfP1mYcZNQ==}
+    engines: {node: '>= 18'}
+
+  serialize-javascript@6.0.2:
+    resolution: {integrity: sha512-Saa1xPByTTq2gdeFZYLLo+RFE35NHZkAbqZeWNd3BpzppeVisAqpDjcp8dyf6uIvEqJRd46jemmyA4iFIeVk8g==}
+
+  seroval-plugins@1.5.0:
+    resolution: {integrity: sha512-EAHqADIQondwRZIdeW2I636zgsODzoBDwb3PT/+7TLDWyw1Dy/Xv7iGUIEXXav7usHDE9HVhOU61irI3EnyyHA==}
+    engines: {node: '>=10'}
+    peerDependencies:
+      seroval: ^1.0
+
+  seroval@1.5.0:
+    resolution: {integrity: sha512-OE4cvmJ1uSPrKorFIH9/w/Qwuvi/IMcGbv5RKgcJ/zjA/IohDLU6SVaxFN9FwajbP7nsX0dQqMDes1whk3y+yw==}
+    engines: {node: '>=10'}
+
+  serve-placeholder@2.0.2:
+    resolution: {integrity: sha512-/TMG8SboeiQbZJWRlfTCqMs2DD3SZgWp0kDQePz9yUuCnDfDh/92gf7/PxGhzXTKBIPASIHxFcZndoNbp6QOLQ==}
+
+  serve-static@1.16.3:
+    resolution: {integrity: sha512-x0RTqQel6g5SY7Lg6ZreMmsOzncHFU7nhnRWkKgWuMTu5NN0DR5oruckMqRvacAN9d5w6ARnRBXl9xhDCgfMeA==}
+    engines: {node: '>= 0.8.0'}
+
+  serve-static@2.2.1:
+    resolution: {integrity: sha512-xRXBn0pPqQTVQiC8wyQrKs2MOlX24zQ0POGaj0kultvoOCstBQM5yvOhAVSUwOMjQtTvsPWoNCHfPGwaaQJhTw==}
+    engines: {node: '>= 18'}
+
+  set-cookie-parser@3.0.1:
+    resolution: {integrity: sha512-n7Z7dXZhJbwuAHhNzkTti6Aw9QDDjZtm3JTpTGATIdNzdQz5GuFs22w90BcvF4INfnrL5xrX3oGsuqO5Dx3A1Q==}
+
+  set-function-length@1.2.2:
+    resolution: {integrity: sha512-pgRc4hJ4/sNjWCSS9AmnS40x3bNMDTknHgL5UaMBTMyJnU90EgWh1Rz+MC9eFu4BuN/UwZjKQuY/1v3rM7HMfg==}
+    engines: {node: '>= 0.4'}
+
+  set-function-name@2.0.2:
+    resolution: {integrity: sha512-7PGFlmtwsEADb0WYyvCMa1t+yke6daIG4Wirafur5kcf+MhUnPms1UeR0CKQdTZD81yESwMHbtn+TR+dMviakQ==}
+    engines: {node: '>= 0.4'}
+
+  set-proto@1.0.0:
+    resolution: {integrity: sha512-RJRdvCo6IAnPdsvP/7m6bsQqNnn1FCBX5ZNtFL98MmFF/4xAIJTIg1YbHW5DC2W5SKZanrC6i4HsJqlajw/dZw==}
+    engines: {node: '>= 0.4'}
+
+  setprototypeof@1.2.0:
+    resolution: {integrity: sha512-E5LDX7Wrp85Kil5bhZv46j8jOeboKq5JMmYM3gVGdGH8xFpPWXUMsNrlODCrkoxMEeNi/XZIwuRvY4XNwYMJpw==}
+
+  sharp@0.34.5:
+    resolution: {integrity: sha512-Ou9I5Ft9WNcCbXrU9cMgPBcCK8LiwLqcbywW3t4oDV37n1pzpuNLsYiAV8eODnjbtQlSDwZ2cUEeQz4E54Hltg==}
+    engines: {node: ^18.17.0 || ^20.3.0 || >=21.0.0}
+
+  shebang-command@2.0.0:
+    resolution: {integrity: sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==}
+    engines: {node: '>=8'}
+
+  shebang-regex@3.0.0:
+    resolution: {integrity: sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==}
+    engines: {node: '>=8'}
+
+  shell-quote@1.8.3:
+    resolution: {integrity: sha512-ObmnIF4hXNg1BqhnHmgbDETF8dLPCggZWBjkQfhZpbszZnYur5DUljTcCHii5LC3J5E0yeO/1LIMyH+UvHQgyw==}
+    engines: {node: '>= 0.4'}
+
+  shiki@1.29.2:
+    resolution: {integrity: sha512-njXuliz/cP+67jU2hukkxCNuH1yUi4QfdZZY+sMr5PPrIyXSu5iTb/qYC4BiWWB0vZ+7TbdvYUCeL23zpwCfbg==}
+
+  side-channel-list@1.0.0:
+    resolution: {integrity: sha512-FCLHtRD/gnpCiCHEiJLOwdmFP+wzCmDEkc9y7NsYxeF4u7Btsn1ZuwgwJGxImImHicJArLP4R0yX4c2KCrMrTA==}
+    engines: {node: '>= 0.4'}
+
+  side-channel-map@1.0.1:
+    resolution: {integrity: sha512-VCjCNfgMsby3tTdo02nbjtM/ewra6jPHmpThenkTYh8pG9ucZ/1P8So4u4FGBek/BjpOVsDCMoLA/iuBKIFXRA==}
+    engines: {node: '>= 0.4'}
+
+  side-channel-weakmap@1.0.2:
+    resolution: {integrity: sha512-WPS/HvHQTYnHisLo9McqBHOJk2FkHO/tlpvldyrnem4aeQp4hai3gythswg6p01oSoTl58rcpiFAjF2br2Ak2A==}
+    engines: {node: '>= 0.4'}
+
+  side-channel@1.1.0:
+    resolution: {integrity: sha512-ZX99e6tRweoUXqR+VBrslhda51Nh5MTQwou5tnUDgbtyM0dBgmhEDtWGP/xbKn6hqfPRHujUNwz5fy/wbbhnpw==}
+    engines: {node: '>= 0.4'}
+
+  siginfo@2.0.0:
+    resolution: {integrity: sha512-ybx0WO1/8bSBLEWXZvEd7gMW3Sn3JFlW3TvX1nREbDLRNQNaeNN8WK0meBwPdAaOI7TtRRRJn/Es1zhrrCHu7g==}
+
+  signal-exit@4.1.0:
+    resolution: {integrity: sha512-bzyZ1e88w9O1iNJbKnOlvYTrWPDl46O1bG0D3XInv+9tkPrxrN8jUUTiFlDkkmKWgn1M6CfIA13SuGqOa9Korw==}
+    engines: {node: '>=14'}
+
+  simple-git@3.31.1:
+    resolution: {integrity: sha512-oiWP4Q9+kO8q9hHqkX35uuHmxiEbZNTrZ5IPxgMGrJwN76pzjm/jabkZO0ItEcqxAincqGAzL3QHSaHt4+knBg==}
+
+  sirv@3.0.2:
+    resolution: {integrity: sha512-2wcC/oGxHis/BoHkkPwldgiPSYcpZK3JU28WoMVv55yHJgcZ8rlXvuG9iZggz+sU1d4bRgIGASwyWqjxu3FM0g==}
+    engines: {node: '>=18'}
+
+  sisteransi@1.0.5:
+    resolution: {integrity: sha512-bLGGlR1QxBcynn2d5YmDX4MGjlZvy2MRBDRNHLJ8VI6l6+9FUiyTFNJ0IveOSP0bcXgVDPRcfGqA0pjaqUpfVg==}
+
+  slash@3.0.0:
+    resolution: {integrity: sha512-g9Q1haeby36OSStwb4ntCGGGaKsaVSjQ68fBxoQcutl5fS1vuY18H3wSt3jFyFtrkx+Kz0V1G85A4MyAdDMi2Q==}
+    engines: {node: '>=8'}
+
+  slash@5.1.0:
+    resolution: {integrity: sha512-ZA6oR3T/pEyuqwMgAKT0/hAv8oAXckzbkmR0UkUosQ+Mc4RxGoJkRmwHgHufaenlyAgE1Mxgpdcrf75y6XcnDg==}
+    engines: {node: '>=14.16'}
+
+  smob@1.6.1:
+    resolution: {integrity: sha512-KAkBqZl3c2GvNgNhcoyJae1aKldDW0LO279wF9bk1PnluRTETKBq0WyzRXxEhoQLk56yHaOY4JCBEKDuJIET5g==}
+    engines: {node: '>=20.0.0'}
+
+  solid-js@1.9.11:
+    resolution: {integrity: sha512-WEJtcc5mkh/BnHA6Yrg4whlF8g6QwpmXXRg4P2ztPmcKeHHlH4+djYecBLhSpecZY2RRECXYUwIc/C2r3yzQ4Q==}
+
+  solid-refresh@0.6.3:
+    resolution: {integrity: sha512-F3aPsX6hVw9ttm5LYlth8Q15x6MlI/J3Dn+o3EQyRTtTxidepSTwAYdozt01/YA+7ObcciagGEyXIopGZzQtbA==}
+    peerDependencies:
+      solid-js: ^1.3
+
+  solid-use@0.9.1:
+    resolution: {integrity: sha512-UwvXDVPlrrbj/9ewG9ys5uL2IO4jSiwys2KPzK4zsnAcmEl7iDafZWW1Mo4BSEWOmQCGK6IvpmGHo1aou8iOFw==}
+    engines: {node: '>=10'}
+    peerDependencies:
+      solid-js: ^1.7
+
+  source-map-js@1.2.1:
+    resolution: {integrity: sha512-UXWMKhLOwVKb728IUtQPXxfYU+usdybtUrK/8uGE8CQMvrhOpwvzDBwj0QhSL7MQc7vIsISBG8VQ8+IDQxpfQA==}
+    engines: {node: '>=0.10.0'}
+
+  source-map-support@0.5.21:
+    resolution: {integrity: sha512-uBHU3L3czsIyYXKX88fdrGovxdSCoTGDRZ6SYXtSRxLZUzHg5P/66Ht6uoUlHu9EZod+inXhKo3qQgwXUT/y1w==}
+
+  source-map@0.6.1:
+    resolution: {integrity: sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==}
+    engines: {node: '>=0.10.0'}
+
+  source-map@0.7.6:
+    resolution: {integrity: sha512-i5uvt8C3ikiWeNZSVZNWcfZPItFQOsYTUAOkcUPGd8DqDy1uOUikjt5dG+uRlwyvR108Fb9DOd4GvXfT0N2/uQ==}
+    engines: {node: '>= 12'}
+
+  source-map@0.8.0-beta.0:
+    resolution: {integrity: sha512-2ymg6oRBpebeZi9UUNsgQ89bhx01TcTkmNTGnNO88imTmbSgy4nfujrgVEFKWpMTEGA11EDkTt7mqObTPdigIA==}
+    engines: {node: '>= 8'}
+    deprecated: The work that was done in this beta branch won't be included in future versions
+
+  space-separated-tokens@2.0.2:
+    resolution: {integrity: sha512-PEGlAwrG8yXGXRjW32fGbg66JAlOAwbObuqVoJpv/mRgoWDQfgH1wDPvtzWyUSNAXBGSk8h755YDbbcEy3SH2Q==}
+
+  spawndamnit@3.0.1:
+    resolution: {integrity: sha512-MmnduQUuHCoFckZoWnXsTg7JaiLBJrKFj9UI2MbRPGaJeVpsLcVBu6P/IGZovziM/YBsellCmsprgNA+w0CzVg==}
+
+  speakingurl@14.0.1:
+    resolution: {integrity: sha512-1POYv7uv2gXoyGFpBCmpDVSNV74IfsWlDW216UPjbWufNf+bSU6GdbDsxdcxtfwb4xlI3yxzOTKClUosxARYrQ==}
+    engines: {node: '>=0.10.0'}
+
+  sprintf-js@1.0.3:
+    resolution: {integrity: sha512-D9cPgkvLlV3t3IzL0D0YLvGA9Ahk4PcvVwUbN0dSGr1aP0Nrt4AEnTUbuGvquEC0mA64Gqt1fzirlRs5ibXx8g==}
+
+  srvx@0.11.7:
+    resolution: {integrity: sha512-p9qj9wkv/MqG1VoJpOsqXv1QcaVcYRk7ifsC6i3TEwDXFyugdhJN4J3KzQPZq2IJJ2ZCt7ASOB++85pEK38jRw==}
+    engines: {node: '>=20.16.0'}
+    hasBin: true
+
+  stable-hash@0.0.5:
+    resolution: {integrity: sha512-+L3ccpzibovGXFK+Ap/f8LOS0ahMrHTf3xu7mMLSpEGU0EO9ucaysSylKo9eRDFNhWve/y275iPmIZ4z39a9iA==}
+
+  stackback@0.0.2:
+    resolution: {integrity: sha512-1XMJE5fQo1jGH6Y/7ebnwPOBEkIEnT4QF32d5R1+VXdXveM0IBMJt8zfaxX1P3QhVwrYe+576+jkANtSS2mBbw==}
+
+  stackframe@1.3.4:
+    resolution: {integrity: sha512-oeVtt7eWQS+Na6F//S4kJ2K2VbRlS9D43mAlMyVpVWovy9o+jfgH8O9agzANzaiLjclA0oYzUXEM4PurhSUChw==}
+
+  standard-as-callback@2.1.0:
+    resolution: {integrity: sha512-qoRRSyROncaz1z0mvYqIE4lCd9p2R90i6GxW3uZv5ucSu8tU7B5HXUP1gG8pVZsYNVaXjk8ClXHPttLyxAL48A==}
+
+  statuses@2.0.2:
+    resolution: {integrity: sha512-DvEy55V3DB7uknRo+4iOGT5fP1slR8wQohVdknigZPMpMstaKJQWhwiYBACJE3Ul2pTnATihhBYnRhZQHGBiRw==}
+    engines: {node: '>= 0.8'}
+
+  std-env@3.10.0:
+    resolution: {integrity: sha512-5GS12FdOZNliM5mAOxFRg7Ir0pWz8MdpYm6AY6VPkGpbA7ZzmbzNcBJQ0GPvvyWgcY7QAhCgf9Uy89I03faLkg==}
+
+  stop-iteration-iterator@1.1.0:
+    resolution: {integrity: sha512-eLoXW/DHyl62zxY4SCaIgnRhuMr6ri4juEYARS8E6sCEqzKpOiE521Ucofdx+KnDZl5xmvGYaaKCk5FEOxJCoQ==}
+    engines: {node: '>= 0.4'}
+
+  streamx@2.23.0:
+    resolution: {integrity: sha512-kn+e44esVfn2Fa/O0CPFcex27fjIL6MkVae0Mm6q+E6f0hWv578YCERbv+4m02cjxvDsPKLnmxral/rR6lBMAg==}
+
+  string-width@4.2.3:
+    resolution: {integrity: sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==}
+    engines: {node: '>=8'}
+
+  string-width@5.1.2:
+    resolution: {integrity: sha512-HnLOCR3vjcY8beoNLtcjZ5/nxn2afmME6lhrDrebokqMap+XbeW8n9TXpPDOqdGK5qcI3oT0GKTW6wC7EMiVqA==}
+    engines: {node: '>=12'}
+
+  string-width@7.2.0:
+    resolution: {integrity: sha512-tsaTIkKW9b4N+AEj+SVA+WhJzV7/zMhcSu78mLKWSk7cXMOSHsBKFWUs0fWwq8QyK3MgJBQRX6Gbi4kYbdvGkQ==}
+    engines: {node: '>=18'}
+
+  string.prototype.includes@2.0.1:
+    resolution: {integrity: sha512-o7+c9bW6zpAdJHTtujeePODAhkuicdAryFsfVKwA+wGw89wJ4GTY484WTucM9hLtDEOpOvI+aHnzqnC5lHp4Rg==}
+    engines: {node: '>= 0.4'}
+
+  string.prototype.matchall@4.0.12:
+    resolution: {integrity: sha512-6CC9uyBL+/48dYizRf7H7VAYCMCNTBeM78x/VTUe9bFEaxBepPJDa1Ow99LqI/1yF7kuy7Q3cQsYMrcjGUcskA==}
+    engines: {node: '>= 0.4'}
+
+  string.prototype.repeat@1.0.0:
+    resolution: {integrity: sha512-0u/TldDbKD8bFCQ/4f5+mNRrXwZ8hg2w7ZR8wa16e8z9XpePWl3eGEcUD0OXpEH/VJH/2G3gjUtR3ZOiBe2S/w==}
+
+  string.prototype.trim@1.2.10:
+    resolution: {integrity: sha512-Rs66F0P/1kedk5lyYyH9uBzuiI/kNRmwJAR9quK6VOtIpZ2G+hMZd+HQbbv25MgCA6gEffoMZYxlTod4WcdrKA==}
+    engines: {node: '>= 0.4'}
+
+  string.prototype.trimend@1.0.9:
+    resolution: {integrity: sha512-G7Ok5C6E/j4SGfyLCloXTrngQIQU3PWtXGst3yM7Bea9FRURf1S42ZHlZZtsNque2FN2PoUhfZXYLNWwEr4dLQ==}
+    engines: {node: '>= 0.4'}
+
+  string.prototype.trimstart@1.0.8:
+    resolution: {integrity: sha512-UXSH262CSZY1tfu3G3Secr6uGLCFVPMhIqHjlgCUtCCcgihYc/xKs9djMTMUOb2j1mVSeU8EU6NWc/iQKU6Gfg==}
+    engines: {node: '>= 0.4'}
+
+  string_decoder@1.1.1:
+    resolution: {integrity: sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==}
+
+  string_decoder@1.3.0:
+    resolution: {integrity: sha512-hkRX8U1WjJFd8LsDJ2yQ/wWWxaopEsABU1XfkM8A+j0+85JAGppt16cr1Whg6KIbb4okU6Mql6BOj+uup/wKeA==}
+
+  stringify-entities@4.0.4:
+    resolution: {integrity: sha512-IwfBptatlO+QCJUo19AqvrPNqlVMpW9YEL2LIVY+Rpv2qsjCGxaDLNRgeGsQWJhfItebuJhsGSLjaBbNSQ+ieg==}
+
+  strip-ansi@6.0.1:
+    resolution: {integrity: sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==}
+    engines: {node: '>=8'}
+
+  strip-ansi@7.1.2:
+    resolution: {integrity: sha512-gmBGslpoQJtgnMAvOVqGZpEz9dyoKTCzy2nfz/n8aIFhN/jCE/rCmcxabB6jOOHV+0WNnylOxaxBQPSvcWklhA==}
+    engines: {node: '>=12'}
+
+  strip-bom@3.0.0:
+    resolution: {integrity: sha512-vavAMRXOgBVNF6nyEEmL3DBK19iRpDcoIwW+swQ+CbGiu7lju6t+JklA1MHweoWtadgt4ISVUsXLyDq34ddcwA==}
+    engines: {node: '>=4'}
+
+  strip-final-newline@3.0.0:
+    resolution: {integrity: sha512-dOESqjYr96iWYylGObzd39EuNTa5VJxyvVAEm5Jnh7KGo75V43Hk1odPQkNDyXNmUR6k+gEiDVXnjB8HJ3crXw==}
+    engines: {node: '>=12'}
+
+  strip-json-comments@3.1.1:
+    resolution: {integrity: sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==}
+    engines: {node: '>=8'}
+
+  strip-literal@3.1.0:
+    resolution: {integrity: sha512-8r3mkIM/2+PpjHoOtiAW8Rg3jJLHaV7xPwG+YRGrv6FP0wwk/toTpATxWYOW0BKdWwl82VT2tFYi5DlROa0Mxg==}
+
+  structured-clone-es@1.0.0:
+    resolution: {integrity: sha512-FL8EeKFFyNQv5cMnXI31CIMCsFarSVI2bF0U0ImeNE3g/F1IvJQyqzOXxPBRXiwQfyBTlbNe88jh1jFW0O/jiQ==}
+
+  styled-jsx@5.1.6:
+    resolution: {integrity: sha512-qSVyDTeMotdvQYoHWLNGwRFJHC+i+ZvdBRYosOFgC+Wg1vx4frN2/RG/NA7SYqqvKNLf39P2LSRA2pu6n0XYZA==}
+    engines: {node: '>= 12.0.0'}
+    peerDependencies:
+      '@babel/core': '*'
+      babel-plugin-macros: '*'
+      react: '>= 16.8.0 || 17.x.x || ^18.0.0-0 || ^19.0.0-0'
+    peerDependenciesMeta:
+      '@babel/core':
+        optional: true
+      babel-plugin-macros:
+        optional: true
+
+  stylehacks@7.0.7:
+    resolution: {integrity: sha512-bJkD0JkEtbRrMFtwgpJyBbFIwfDDONQ1Ov3sDLZQP8HuJ73kBOyx66H4bOcAbVWmnfLdvQ0AJwXxOMkpujcO6g==}
+    engines: {node: ^18.12.0 || ^20.9.0 || >=22.0}
+    peerDependencies:
+      postcss: ^8.4.32
+
+  sucrase@3.35.1:
+    resolution: {integrity: sha512-DhuTmvZWux4H1UOnWMB3sk0sbaCVOoQZjv8u1rDoTV0HTdGem9hkAZtl4JZy8P2z4Bg0nT+YMeOFyVr4zcG5Tw==}
+    engines: {node: '>=16 || 14 >=14.17'}
+    hasBin: true
+
+  superjson@2.2.6:
+    resolution: {integrity: sha512-H+ue8Zo4vJmV2nRjpx86P35lzwDT3nItnIsocgumgr0hHMQ+ZGq5vrERg9kJBo5AWGmxZDhzDo+WVIJqkB0cGA==}
+    engines: {node: '>=16'}
+
+  supports-color@10.2.2:
+    resolution: {integrity: sha512-SS+jx45GF1QjgEXQx4NJZV9ImqmO2NPz5FNsIHrsDjh2YsHnawpan7SNQ1o8NuhrbHZy9AZhIoCUiCeaW/C80g==}
+    engines: {node: '>=18'}
+
+  supports-color@7.2.0:
+    resolution: {integrity: sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==}
+    engines: {node: '>=8'}
+
+  supports-preserve-symlinks-flag@1.0.0:
+    resolution: {integrity: sha512-ot0WnXS9fgdkgIcePe6RHNk1WA8+muPa6cSjeR3V8K27q9BB1rTE3R1p7Hv0z1ZyAc8s6Vvv8DIyWf681MAt0w==}
+    engines: {node: '>= 0.4'}
+
+  svelte-check@4.3.6:
+    resolution: {integrity: sha512-uBkz96ElE3G4pt9E1Tw0xvBfIUQkeH794kDQZdAUk795UVMr+NJZpuFSS62vcmO/DuSalK83LyOwhgWq8YGU1Q==}
+    engines: {node: '>= 18.0.0'}
+    hasBin: true
+    peerDependencies:
+      svelte: ^4.0.0 || ^5.0.0-next.0
+      typescript: '>=5.0.0'
+
+  svelte@5.53.0:
+    resolution: {integrity: sha512-7dhHkSamGS2vtoBmIW2hRab+gl5Z60alEHZB4910ePqqJNxAWnDAxsofVmlZ2tREmWyHNE+A1nCKwICAquoD2A==}
+    engines: {node: '>=18'}
+
+  svgo@4.0.0:
+    resolution: {integrity: sha512-VvrHQ+9uniE+Mvx3+C9IEe/lWasXCU0nXMY2kZeLrHNICuRiC8uMPyM14UEaMOFA5mhyQqEkB02VoQ16n3DLaw==}
+    engines: {node: '>=16'}
+    hasBin: true
+
+  system-architecture@0.1.0:
+    resolution: {integrity: sha512-ulAk51I9UVUyJgxlv9M6lFot2WP3e7t8Kz9+IS6D4rVba1tR9kON+Ey69f+1R4Q8cd45Lod6a4IcJIxnzGc/zA==}
+    engines: {node: '>=18'}
+
+  tagged-tag@1.0.0:
+    resolution: {integrity: sha512-yEFYrVhod+hdNyx7g5Bnkkb0G6si8HJurOoOEgC8B/O0uXLHlaey/65KRv6cuWBNhBgHKAROVpc7QyYqE5gFng==}
+    engines: {node: '>=20'}
+
+  tailwindcss@4.2.0:
+    resolution: {integrity: sha512-yYzTZ4++b7fNYxFfpnberEEKu43w44aqDMNM9MHMmcKuCH7lL8jJ4yJ7LGHv7rSwiqM0nkiobF9I6cLlpS2P7Q==}
+
+  tapable@2.3.0:
+    resolution: {integrity: sha512-g9ljZiwki/LfxmQADO3dEY1CbpmXT5Hm2fJ+QaGKwSXUylMybePR7/67YW7jOrrvjEgL1Fmz5kzyAjWVWLlucg==}
+    engines: {node: '>=6'}
+
+  tar-stream@3.1.7:
+    resolution: {integrity: sha512-qJj60CXt7IU1Ffyc3NJMjh6EkuCFej46zUqJ4J7pqYlThyd9bO0XBTmcOIhSzZJVWfsLks0+nle/j538YAW9RQ==}
+
+  tar@7.5.9:
+    resolution: {integrity: sha512-BTLcK0xsDh2+PUe9F6c2TlRp4zOOBMTkoQHQIWSIzI0R7KG46uEwq4OPk2W7bZcprBMsuaeFsqwYr7pjh6CuHg==}
+    engines: {node: '>=18'}
+
+  term-size@2.2.1:
+    resolution: {integrity: sha512-wK0Ri4fOGjv/XPy8SBHZChl8CM7uMc5VML7SqiQ0zG7+J5Vr+RMQDoHa2CNT6KHUnTGIXH34UDMkPzAUyapBZg==}
+    engines: {node: '>=8'}
+
+  terracotta@1.1.0:
+    resolution: {integrity: sha512-kfQciWUBUBgYkXu7gh3CK3FAJng/iqZslAaY08C+k1Hdx17aVEpcFFb/WPaysxAfcupNH3y53s/pc53xxZauww==}
+    engines: {node: '>=10'}
+    peerDependencies:
+      solid-js: ^1.8
+
+  terser@5.46.0:
+    resolution: {integrity: sha512-jTwoImyr/QbOWFFso3YoU3ik0jBBDJ6JTOQiy/J2YxVJdZCc+5u7skhNwiOR3FQIygFqVUPHl7qbbxtjW2K3Qg==}
+    engines: {node: '>=10'}
+    hasBin: true
+
+  text-decoder@1.2.7:
+    resolution: {integrity: sha512-vlLytXkeP4xvEq2otHeJfSQIRyWxo/oZGEbXrtEEF9Hnmrdly59sUbzZ/QgyWuLYHctCHxFF4tRQZNQ9k60ExQ==}
+
+  thenify-all@1.6.0:
+    resolution: {integrity: sha512-RNxQH/qI8/t3thXJDwcstUO4zeqo64+Uy/+sNVRBx4Xn2OX+OZ9oP+iJnNFqplFra2ZUVeKCSa2oVWi3T4uVmA==}
+    engines: {node: '>=0.8'}
+
+  thenify@3.3.1:
+    resolution: {integrity: sha512-RVZSIV5IG10Hk3enotrhvz0T9em6cyHBLkH/YAZuKqd8hRkKhSfCGIcP2KUY0EPxndzANBmNllzWPwak+bheSw==}
+
+  tiny-invariant@1.3.3:
+    resolution: {integrity: sha512-+FbBPE1o9QAYvviau/qC5SE3caw21q3xkvWKBtja5vgqOWIHHJ3ioaq1VPfn/Szqctz2bU/oYeKd9/z5BL+PVg==}
+
+  tinybench@2.9.0:
+    resolution: {integrity: sha512-0+DUvqWMValLmha6lr4kD8iAMK1HzV0/aKnCtWb9v9641TnP/MFb7Pc2bxoxQjTXAErryXVgUOfv2YqNllqGeg==}
+
+  tinyexec@0.3.2:
+    resolution: {integrity: sha512-KQQR9yN7R5+OSwaK0XQoj22pwHoTlgYqmUscPYoknOoWCWfj/5/ABTMRi69FrKU5ffPVh5QcFikpWJI/P1ocHA==}
+
+  tinyexec@1.0.2:
+    resolution: {integrity: sha512-W/KYk+NFhkmsYpuHq5JykngiOCnxeVL8v8dFnqxSD8qEEdRfXk1SDM6JzNqcERbcGYj9tMrDQBYV9cjgnunFIg==}
+    engines: {node: '>=18'}
+
+  tinyglobby@0.2.15:
+    resolution: {integrity: sha512-j2Zq4NyQYG5XMST4cbs02Ak8iJUdxRM0XI5QyxXuZOzKOINmWurp3smXu3y5wDcJrptwpSjgXHzIQxR0omXljQ==}
+    engines: {node: '>=12.0.0'}
+
+  tinyrainbow@3.0.3:
+    resolution: {integrity: sha512-PSkbLUoxOFRzJYjjxHJt9xro7D+iilgMX/C9lawzVuYiIdcihh9DXmVibBe8lmcFrRi/VzlPjBxbN7rH24q8/Q==}
+    engines: {node: '>=14.0.0'}
+
+  to-regex-range@5.0.1:
+    resolution: {integrity: sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==}
+    engines: {node: '>=8.0'}
+
+  toidentifier@1.0.1:
+    resolution: {integrity: sha512-o5sSPKEkg/DIQNmH43V0/uerLrpzVedkUh8tGNvaeXpfpuwjKenlSox/2O/BTlZUtEe+JG7s5YhEz608PlAHRA==}
+    engines: {node: '>=0.6'}
+
+  totalist@3.0.1:
+    resolution: {integrity: sha512-sf4i37nQ2LBx4m3wB74y+ubopq6W/dIzXg0FDGjsYnZHVa1Da8FH853wlL2gtUhg+xJXjfk3kUZS3BRoQeoQBQ==}
+    engines: {node: '>=6'}
+
+  tr46@0.0.3:
+    resolution: {integrity: sha512-N3WMsuqV66lT30CrXNbEjx4GEwlow3v6rr4mCcv6prnfwhS01rkgyFdjPNBYd9br7LpXV1+Emh01fHnq2Gdgrw==}
+
+  tr46@1.0.1:
+    resolution: {integrity: sha512-dTpowEjclQ7Kgx5SdBkqRzVhERQXov8/l9Ft9dVM9fmg0W0KQSVaXX9T4i6twCPNtYiZM53lpSSUAwJbFPOHxA==}
+
+  tree-kill@1.2.2:
+    resolution: {integrity: sha512-L0Orpi8qGpRG//Nd+H90vFB+3iHnue1zSSGmNOOCh1GLJ7rUKVwV2HvijphGQS2UmhUZewS9VgvxYIdgr+fG1A==}
+    hasBin: true
+
+  trim-lines@3.0.1:
+    resolution: {integrity: sha512-kRj8B+YHZCc9kQYdWfJB2/oUl9rA99qbowYYBtr4ui4mZyAQ2JpvVBd/6U2YloATfqBhBTSMhTpgBHtU0Mf3Rg==}
+
+  ts-api-utils@2.4.0:
+    resolution: {integrity: sha512-3TaVTaAv2gTiMB35i3FiGJaRfwb3Pyn/j3m/bfAvGe8FB7CF6u+LMYqYlDh7reQf7UNvoTvdfAqHGmPGOSsPmA==}
+    engines: {node: '>=18.12'}
+    peerDependencies:
+      typescript: '>=4.8.4'
+
+  ts-interface-checker@0.1.13:
+    resolution: {integrity: sha512-Y/arvbn+rrz3JCKl9C4kVNfTfSm2/mEp5FSz5EsZSANGPSlQrpRI5M4PKF+mJnE52jOO90PnPSc3Ur3bTQw0gA==}
+
+  tsconfig-paths@3.15.0:
+    resolution: {integrity: sha512-2Ac2RgzDe/cn48GvOe3M+o82pEFewD3UPbyoUHHdKasHwJKjds4fLXWf/Ux5kATBKN20oaFGu+jbElp1pos0mg==}
+
+  tslib@2.8.1:
+    resolution: {integrity: sha512-oJFu94HQb+KVduSUQL7wnpmqnfmLsOA/nAh6b6EH0wCEoK0/mPeXU6c3wKDV83MkOuHPRHtSXKKU99IBazS/2w==}
+
+  tsup@8.5.0:
+    resolution: {integrity: sha512-VmBp77lWNQq6PfuMqCHD3xWl22vEoWsKajkF8t+yMBawlUS8JzEI+vOVMeuNZIuMML8qXRizFKi9oD5glKQVcQ==}
+    engines: {node: '>=18'}
+    hasBin: true
+    peerDependencies:
+      '@microsoft/api-extractor': ^7.36.0
+      '@swc/core': ^1
+      postcss: ^8.4.12
+      typescript: '>=4.5.0'
+    peerDependenciesMeta:
+      '@microsoft/api-extractor':
+        optional: true
+      '@swc/core':
+        optional: true
+      postcss:
+        optional: true
+      typescript:
+        optional: true
+
+  tsx@4.20.6:
+    resolution: {integrity: sha512-ytQKuwgmrrkDTFP4LjR0ToE2nqgy886GpvRSpU0JAnrdBYppuY5rLkRUYPU1yCryb24SsKBTL/hlDQAEFVwtZg==}
+    engines: {node: '>=18.0.0'}
+    hasBin: true
+
+  type-check@0.4.0:
+    resolution: {integrity: sha512-XleUoc9uwGXqjWwXaUTZAmzMcFZ5858QA2vvx1Ur5xIcixXIP+8LnFDgRplU30us6teqdlskFfu+ae4K79Ooew==}
+    engines: {node: '>= 0.8.0'}
+
+  type-fest@4.41.0:
+    resolution: {integrity: sha512-TeTSQ6H5YHvpqVwBRcnLDCBnDOHWYu7IvGbHT6N8AOymcr9PJGjc1GTtiWZTYg0NCgYwvnYWEkVChQAr9bjfwA==}
+    engines: {node: '>=16'}
+
+  type-fest@5.4.4:
+    resolution: {integrity: sha512-JnTrzGu+zPV3aXIUhnyWJj4z/wigMsdYajGLIYakqyOW1nPllzXEJee0QQbHj+CTIQtXGlAjuK0UY+2xTyjVAw==}
+    engines: {node: '>=20'}
+
+  type-level-regexp@0.1.17:
+    resolution: {integrity: sha512-wTk4DH3cxwk196uGLK/E9pE45aLfeKJacKmcEgEOA/q5dnPGNxXt0cfYdFxb57L+sEpf1oJH4Dnx/pnRcku9jg==}
+
+  typed-array-buffer@1.0.3:
+    resolution: {integrity: sha512-nAYYwfY3qnzX30IkA6AQZjVbtK6duGontcQm1WSG1MD94YLqK0515GNApXkoxKOWMusVssAHWLh9SeaoefYFGw==}
+    engines: {node: '>= 0.4'}
+
+  typed-array-byte-length@1.0.3:
+    resolution: {integrity: sha512-BaXgOuIxz8n8pIq3e7Atg/7s+DpiYrxn4vdot3w9KbnBhcRQq6o3xemQdIfynqSeXeDrF32x+WvfzmOjPiY9lg==}
+    engines: {node: '>= 0.4'}
+
+  typed-array-byte-offset@1.0.4:
+    resolution: {integrity: sha512-bTlAFB/FBYMcuX81gbL4OcpH5PmlFHqlCCpAl8AlEzMz5k53oNDvN8p1PNOWLEmI2x4orp3raOFB51tv9X+MFQ==}
+    engines: {node: '>= 0.4'}
+
+  typed-array-length@1.0.7:
+    resolution: {integrity: sha512-3KS2b+kL7fsuk/eJZ7EQdnEmQoaho/r6KUef7hxvltNA5DR8NAUM+8wJMbJyZ4G9/7i3v5zPBIMN5aybAh2/Jg==}
+    engines: {node: '>= 0.4'}
+
+  typescript-eslint@8.56.0:
+    resolution: {integrity: sha512-c7toRLrotJ9oixgdW7liukZpsnq5CZ7PuKztubGYlNppuTqhIoWfhgHo/7EU0v06gS2l/x0i2NEFK1qMIf0rIg==}
+    engines: {node: ^18.18.0 || ^20.9.0 || >=21.1.0}
+    peerDependencies:
+      eslint: ^8.57.0 || ^9.0.0 || ^10.0.0
+      typescript: '>=4.8.4 <6.0.0'
+
+  typescript@5.9.3:
+    resolution: {integrity: sha512-jl1vZzPDinLr9eUt3J/t7V6FgNEw9QjvBPdysz9KfQDD41fQrC2Y4vKQdiaUpFT4bXlb1RHhLpp8wtm6M5TgSw==}
+    engines: {node: '>=14.17'}
+    hasBin: true
+
+  ufo@1.6.3:
+    resolution: {integrity: sha512-yDJTmhydvl5lJzBmy/hyOAA0d+aqCBuwl818haVdYCRrWV84o7YyeVm4QlVHStqNrrJSTb6jKuFAVqAFsr+K3Q==}
+
+  ultrahtml@1.6.0:
+    resolution: {integrity: sha512-R9fBn90VTJrqqLDwyMph+HGne8eqY1iPfYhPzZrvKpIfwkWZbcYlfpsb8B9dTvBfpy1/hqAD7Wi8EKfP9e8zdw==}
+
+  unbox-primitive@1.1.0:
+    resolution: {integrity: sha512-nWJ91DjeOkej/TA8pXQ3myruKpKEYgqvpw9lz4OPHj/NWFNluYrjbz9j01CJ8yKQd2g4jFoOkINCTW2I5LEEyw==}
+    engines: {node: '>= 0.4'}
+
+  uncrypto@0.1.3:
+    resolution: {integrity: sha512-Ql87qFHB3s/De2ClA9e0gsnS6zXG27SkTiSJwjCc9MebbfapQfuPzumMIUMi38ezPZVNFcHI9sUIepeQfw8J8Q==}
+
+  unctx@2.5.0:
+    resolution: {integrity: sha512-p+Rz9x0R7X+CYDkT+Xg8/GhpcShTlU8n+cf9OtOEf7zEQsNcCZO1dPKNRDqvUTaq+P32PMMkxWHwfrxkqfqAYg==}
+
+  undici-types@5.28.4:
+    resolution: {integrity: sha512-3OeMF5Lyowe8VW0skf5qaIE7Or3yS9LS7fvMUI0gg4YxpIBVg0L8BxCmROw2CcYhSkpR68Epz7CGc8MPj94Uww==}
+
+  undici-types@6.21.0:
+    resolution: {integrity: sha512-iwDZqg0QAGrg9Rav5H4n0M64c3mkR59cJ6wQp+7C4nI0gsmExaedaYLNO44eT4AtBBwjbTiGPMlt2Md0T9H9JQ==}
+
+  undici-types@7.10.0:
+    resolution: {integrity: sha512-t5Fy/nfn+14LuOc2KNYg75vZqClpAiqscVvMygNnlsHBFpSXdJaYtXMcdNLpl/Qvc3P2cB3s6lOV51nqsFq4ag==}
+
+  undici-types@7.16.0:
+    resolution: {integrity: sha512-Zz+aZWSj8LE6zoxD+xrjh4VfkIG8Ya6LvYkZqtUQGJPZjYl53ypCaUwWqo7eI0x66KBGeRo+mlBEkMSeSZ38Nw==}
+
+  unenv@1.10.0:
+    resolution: {integrity: sha512-wY5bskBQFL9n3Eca5XnhH6KbUo/tfvkwm9OpcdCvLaeA7piBNbavbOKJySEwQ1V0RH6HvNlSAFRTpvTqgKRQXQ==}
+
+  unenv@2.0.0-rc.24:
+    resolution: {integrity: sha512-i7qRCmY42zmCwnYlh9H2SvLEypEFGye5iRmEMKjcGi7zk9UquigRjFtTLz0TYqr0ZGLZhaMHl/foy1bZR+Cwlw==}
+
+  unhead@2.1.4:
+    resolution: {integrity: sha512-+5091sJqtNNmgfQ07zJOgUnMIMKzVKAWjeMlSrTdSGPB6JSozhpjUKuMfWEoLxlMAfhIvgOU8Me0XJvmMA/0fA==}
+
+  unicorn-magic@0.3.0:
+    resolution: {integrity: sha512-+QBBXBCvifc56fsbuxZQ6Sic3wqqc3WWaqxs58gvJrcOuN83HGTCwz3oS5phzU9LthRNE9VrJCFCLUgHeeFnfA==}
+    engines: {node: '>=18'}
+
+  unicorn-magic@0.4.0:
+    resolution: {integrity: sha512-wH590V9VNgYH9g3lH9wWjTrUoKsjLF6sGLjhR4sH1LWpLmCOH0Zf7PukhDA8BiS7KHe4oPNkcTHqYkj7SOGUOw==}
+    engines: {node: '>=20'}
+
+  unimport@5.6.0:
+    resolution: {integrity: sha512-8rqAmtJV8o60x46kBAJKtHpJDJWkA2xcBqWKPI14MgUb05o1pnpnCnXSxedUXyeq7p8fR5g3pTo2BaswZ9lD9A==}
+    engines: {node: '>=18.12.0'}
+
+  unist-util-is@6.0.1:
+    resolution: {integrity: sha512-LsiILbtBETkDz8I9p1dQ0uyRUWuaQzd/cuEeS1hoRSyW5E5XGmTzlwY1OrNzzakGowI9Dr/I8HVaw4hTtnxy8g==}
+
+  unist-util-position@5.0.0:
+    resolution: {integrity: sha512-fucsC7HjXvkB5R3kTCO7kUjRdrS0BJt3M/FPxmHMBOm8JQi2BsHAHFsy27E0EolP8rp0NzXsJ+jNPyDWvOJZPA==}
+
+  unist-util-stringify-position@4.0.0:
+    resolution: {integrity: sha512-0ASV06AAoKCDkS2+xw5RXJywruurpbC4JZSm7nr7MOt1ojAzvyyaO+UxZf18j8FCF6kmzCZKcAgN/yu2gm2XgQ==}
+
+  unist-util-visit-parents@6.0.2:
+    resolution: {integrity: sha512-goh1s1TBrqSqukSc8wrjwWhL0hiJxgA8m4kFxGlQ+8FYQ3C/m11FcTs4YYem7V664AhHVvgoQLk890Ssdsr2IQ==}
+
+  unist-util-visit@5.1.0:
+    resolution: {integrity: sha512-m+vIdyeCOpdr/QeQCu2EzxX/ohgS8KbnPDgFni4dQsfSCtpz8UqDyY5GjRru8PDKuYn7Fq19j1CQ+nJSsGKOzg==}
+
+  universalify@0.1.2:
+    resolution: {integrity: sha512-rBJeI5CXAlmy1pV+617WB9J63U6XcazHHF2f2dbJix4XzpUF0RS3Zbj0FGIOCAva5P/d/GBOYaACQ1w+0azUkg==}
+    engines: {node: '>= 4.0.0'}
+
+  unplugin-utils@0.2.5:
+    resolution: {integrity: sha512-gwXJnPRewT4rT7sBi/IvxKTjsms7jX7QIDLOClApuZwR49SXbrB1z2NLUZ+vDHyqCj/n58OzRRqaW+B8OZi8vg==}
+    engines: {node: '>=18.12.0'}
+
+  unplugin-utils@0.3.1:
+    resolution: {integrity: sha512-5lWVjgi6vuHhJ526bI4nlCOmkCIF3nnfXkCMDeMJrtdvxTs6ZFCM8oNufGTsDbKv/tJ/xj8RpvXjRuPBZJuJog==}
+    engines: {node: '>=20.19.0'}
+
+  unplugin-vue-router@0.19.2:
+    resolution: {integrity: sha512-u5dgLBarxE5cyDK/hzJGfpCTLIAyiTXGlo85COuD4Nssj6G7NxS+i9mhCWz/1p/ud1eMwdcUbTXehQe41jYZUA==}
+    peerDependencies:
+      '@vue/compiler-sfc': ^3.5.17
+      vue-router: ^4.6.0
+    peerDependenciesMeta:
+      vue-router:
+        optional: true
+
+  unplugin@2.3.11:
+    resolution: {integrity: sha512-5uKD0nqiYVzlmCRs01Fhs2BdkEgBS3SAVP6ndrBsuK42iC2+JHyxM05Rm9G8+5mkmRtzMZGY8Ct5+mliZxU/Ww==}
+    engines: {node: '>=18.12.0'}
+
+  unplugin@3.0.0:
+    resolution: {integrity: sha512-0Mqk3AT2TZCXWKdcoaufeXNukv2mTrEZExeXlHIOZXdqYoHHr4n51pymnwV8x2BOVxwXbK2HLlI7usrqMpycdg==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+
+  unrs-resolver@1.11.1:
+    resolution: {integrity: sha512-bSjt9pjaEBnNiGgc9rUiHGKv5l4/TGzDmYw3RhnkJGtLhbnnA/5qJj7x3dNDCRx/PJxu774LlH8lCOlB4hEfKg==}
+
+  unstorage@1.17.4:
+    resolution: {integrity: sha512-fHK0yNg38tBiJKp/Vgsq4j0JEsCmgqH58HAn707S7zGkArbZsVr/CwINoi+nh3h98BRCwKvx1K3Xg9u3VV83sw==}
+    peerDependencies:
+      '@azure/app-configuration': ^1.8.0
+      '@azure/cosmos': ^4.2.0
+      '@azure/data-tables': ^13.3.0
+      '@azure/identity': ^4.6.0
+      '@azure/keyvault-secrets': ^4.9.0
+      '@azure/storage-blob': ^12.26.0
+      '@capacitor/preferences': ^6 || ^7 || ^8
+      '@deno/kv': '>=0.9.0'
+      '@netlify/blobs': ^6.5.0 || ^7.0.0 || ^8.1.0 || ^9.0.0 || ^10.0.0
+      '@planetscale/database': ^1.19.0
+      '@upstash/redis': ^1.34.3
+      '@vercel/blob': '>=0.27.1'
+      '@vercel/functions': ^2.2.12 || ^3.0.0
+      '@vercel/kv': ^1 || ^2 || ^3
+      aws4fetch: ^1.0.20
+      db0: '>=0.2.1'
+      idb-keyval: ^6.2.1
+      ioredis: ^5.4.2
+      uploadthing: ^7.4.4
+    peerDependenciesMeta:
+      '@azure/app-configuration':
+        optional: true
+      '@azure/cosmos':
+        optional: true
+      '@azure/data-tables':
+        optional: true
+      '@azure/identity':
+        optional: true
+      '@azure/keyvault-secrets':
+        optional: true
+      '@azure/storage-blob':
+        optional: true
+      '@capacitor/preferences':
+        optional: true
+      '@deno/kv':
+        optional: true
+      '@netlify/blobs':
+        optional: true
+      '@planetscale/database':
+        optional: true
+      '@upstash/redis':
+        optional: true
+      '@vercel/blob':
+        optional: true
+      '@vercel/functions':
+        optional: true
+      '@vercel/kv':
+        optional: true
+      aws4fetch:
+        optional: true
+      db0:
+        optional: true
+      idb-keyval:
+        optional: true
+      ioredis:
+        optional: true
+      uploadthing:
+        optional: true
+
+  untun@0.1.3:
+    resolution: {integrity: sha512-4luGP9LMYszMRZwsvyUd9MrxgEGZdZuZgpVQHEEX0lCYFESasVRvZd0EYpCkOIbJKHMuv0LskpXc/8Un+MJzEQ==}
+    hasBin: true
+
+  untyped@2.0.0:
+    resolution: {integrity: sha512-nwNCjxJTjNuLCgFr42fEak5OcLuB3ecca+9ksPFNvtfYSLpjf+iJqSIaSnIile6ZPbKYxI5k2AfXqeopGudK/g==}
+    hasBin: true
+
+  unwasm@0.5.3:
+    resolution: {integrity: sha512-keBgTSfp3r6+s9ZcSma+0chwxQdmLbB5+dAD9vjtB21UTMYuKAxHXCU1K2CbCtnP09EaWeRvACnXk0EJtUx+hw==}
+
+  update-browserslist-db@1.2.3:
+    resolution: {integrity: sha512-Js0m9cx+qOgDxo0eMiFGEueWztz+d4+M3rGlmKPT+T4IS/jP4ylw3Nwpu6cpTTP8R1MAC1kF4VbdLt3ARf209w==}
+    hasBin: true
+    peerDependencies:
+      browserslist: '>= 4.21.0'
+
+  uqr@0.1.2:
+    resolution: {integrity: sha512-MJu7ypHq6QasgF5YRTjqscSzQp/W11zoUk6kvmlH+fmWEs63Y0Eib13hYFwAzagRJcVY8WVnlV+eBDUGMJ5IbA==}
+
+  uri-js@4.4.1:
+    resolution: {integrity: sha512-7rKUyy33Q1yc98pQ1DAmLtwX109F7TIfWlW1Ydo8Wl1ii1SeHieeh0HHfPeL2fMXK6z0s8ecKs9frCuLJvndBg==}
+
+  util-deprecate@1.0.2:
+    resolution: {integrity: sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw==}
+
+  utopia-core@1.6.0:
+    resolution: {integrity: sha512-1t74XWRugoMxwbPufCBlBRBfp4ebwXh9dLRoEEywAroO3prOQUyGykX4G4o5kHyX5PbfB3Zly1AjP2epeq6ycA==}
+
+  vfile-message@4.0.3:
+    resolution: {integrity: sha512-QTHzsGd1EhbZs4AsQ20JX1rC3cOlt/IWJruk893DfLRr57lcnOeMaWG4K0JrRta4mIJZKth2Au3mM3u03/JWKw==}
+
+  vfile@6.0.3:
+    resolution: {integrity: sha512-KzIbH/9tXat2u30jf+smMwFCsno4wHVdNmzFyL+T/L3UGqqk6JKfVqOFOZEpZSHADH1k40ab6NUIXZq422ov3Q==}
+
+  vinxi@0.5.11:
+    resolution: {integrity: sha512-82Qm+EG/b2PRFBvXBbz1lgWBGcd9totIL6SJhnrZYfakjloTVG9+5l6gfO6dbCCtztm5pqWFzLY0qpZ3H3ww/w==}
+    hasBin: true
+
+  vite-dev-rpc@1.1.0:
+    resolution: {integrity: sha512-pKXZlgoXGoE8sEKiKJSng4hI1sQ4wi5YT24FCrwrLt6opmkjlqPPVmiPWWJn8M8byMxRGzp1CrFuqQs4M/Z39A==}
+    peerDependencies:
+      vite: ^2.9.0 || ^3.0.0-0 || ^4.0.0-0 || ^5.0.0-0 || ^6.0.1 || ^7.0.0-0
+
+  vite-hot-client@2.1.0:
+    resolution: {integrity: sha512-7SpgZmU7R+dDnSmvXE1mfDtnHLHQSisdySVR7lO8ceAXvM0otZeuQQ6C8LrS5d/aYyP/QZ0hI0L+dIPrm4YlFQ==}
+    peerDependencies:
+      vite: ^2.6.0 || ^3.0.0 || ^4.0.0 || ^5.0.0-0 || ^6.0.0-0 || ^7.0.0-0
+
+  vite-node@5.3.0:
+    resolution: {integrity: sha512-8f20COPYJujc3OKPX6OuyBy3ZIv2det4eRRU4GY1y2MjbeGSUmPjedxg1b72KnTagCofwvZ65ThzjxDW2AtQFQ==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    hasBin: true
+
+  vite-plugin-checker@0.12.0:
+    resolution: {integrity: sha512-CmdZdDOGss7kdQwv73UyVgLPv0FVYe5czAgnmRX2oKljgEvSrODGuClaV3PDR2+3ou7N/OKGauDDBjy2MB07Rg==}
+    engines: {node: '>=16.11'}
+    peerDependencies:
+      '@biomejs/biome': '>=1.7'
+      eslint: '>=9.39.1'
+      meow: ^13.2.0
+      optionator: ^0.9.4
+      oxlint: '>=1'
+      stylelint: '>=16'
+      typescript: '*'
+      vite: '>=5.4.21'
+      vls: '*'
+      vti: '*'
+      vue-tsc: ~2.2.10 || ^3.0.0
+    peerDependenciesMeta:
+      '@biomejs/biome':
+        optional: true
+      eslint:
+        optional: true
+      meow:
+        optional: true
+      optionator:
+        optional: true
+      oxlint:
+        optional: true
+      stylelint:
+        optional: true
+      typescript:
+        optional: true
+      vls:
+        optional: true
+      vti:
+        optional: true
+      vue-tsc:
+        optional: true
+
+  vite-plugin-inspect@11.3.3:
+    resolution: {integrity: sha512-u2eV5La99oHoYPHE6UvbwgEqKKOQGz86wMg40CCosP6q8BkB6e5xPneZfYagK4ojPJSj5anHCrnvC20DpwVdRA==}
+    engines: {node: '>=14'}
+    peerDependencies:
+      '@nuxt/kit': '*'
+      vite: ^6.0.0 || ^7.0.0-0
+    peerDependenciesMeta:
+      '@nuxt/kit':
+        optional: true
+
+  vite-plugin-solid@2.11.10:
+    resolution: {integrity: sha512-Yr1dQybmtDtDAHkii6hXuc1oVH9CPcS/Zb2jN/P36qqcrkNnVPsMTzQ06jyzFPFjj3U1IYKMVt/9ZqcwGCEbjw==}
+    peerDependencies:
+      '@testing-library/jest-dom': ^5.16.6 || ^5.17.0 || ^6.*
+      solid-js: ^1.7.2
+      vite: ^3.0.0 || ^4.0.0 || ^5.0.0 || ^6.0.0 || ^7.0.0
+    peerDependenciesMeta:
+      '@testing-library/jest-dom':
+        optional: true
+
+  vite-plugin-vue-tracer@1.2.0:
+    resolution: {integrity: sha512-a9Z/TLpxwmoE9kIcv28wqQmiszM7ec4zgndXWEsVD/2lEZLRGzcg7ONXmplzGF/UP5W59QNtS809OdywwpUWQQ==}
+    peerDependencies:
+      vite: ^6.0.0 || ^7.0.0
+      vue: ^3.5.0
+
+  vite@6.4.1:
+    resolution: {integrity: sha512-+Oxm7q9hDoLMyJOYfUYBuHQo+dkAloi33apOPP56pzj+vsdJDzr+j1NISE5pyaAuKL4A3UD34qd0lx5+kfKp2g==}
+    engines: {node: ^18.0.0 || ^20.0.0 || >=22.0.0}
+    hasBin: true
+    peerDependencies:
+      '@types/node': ^18.0.0 || ^20.0.0 || >=22.0.0
+      jiti: '>=1.21.0'
+      less: '*'
+      lightningcss: ^1.21.0
+      sass: '*'
+      sass-embedded: '*'
+      stylus: '*'
+      sugarss: '*'
+      terser: ^5.16.0
+      tsx: ^4.8.1
+      yaml: ^2.4.2
+    peerDependenciesMeta:
+      '@types/node':
+        optional: true
+      jiti:
+        optional: true
+      less:
+        optional: true
+      lightningcss:
+        optional: true
+      sass:
+        optional: true
+      sass-embedded:
+        optional: true
+      stylus:
+        optional: true
+      sugarss:
+        optional: true
+      terser:
+        optional: true
+      tsx:
+        optional: true
+      yaml:
+        optional: true
+
+  vite@7.3.1:
+    resolution: {integrity: sha512-w+N7Hifpc3gRjZ63vYBXA56dvvRlNWRczTdmCBBa+CotUzAPf5b7YMdMR/8CQoeYE5LX3W4wj6RYTgonm1b9DA==}
+    engines: {node: ^20.19.0 || >=22.12.0}
+    hasBin: true
+    peerDependencies:
+      '@types/node': ^20.19.0 || >=22.12.0
+      jiti: '>=1.21.0'
+      less: ^4.0.0
+      lightningcss: ^1.21.0
+      sass: ^1.70.0
+      sass-embedded: ^1.70.0
+      stylus: '>=0.54.8'
+      sugarss: ^5.0.0
+      terser: ^5.16.0
+      tsx: ^4.8.1
+      yaml: ^2.4.2
+    peerDependenciesMeta:
+      '@types/node':
+        optional: true
+      jiti:
+        optional: true
+      less:
+        optional: true
+      lightningcss:
+        optional: true
+      sass:
+        optional: true
+      sass-embedded:
+        optional: true
+      stylus:
+        optional: true
+      sugarss:
+        optional: true
+      terser:
+        optional: true
+      tsx:
+        optional: true
+      yaml:
+        optional: true
+
+  vitefu@1.1.1:
+    resolution: {integrity: sha512-B/Fegf3i8zh0yFbpzZ21amWzHmuNlLlmJT6n7bu5e+pCHUKQIfXSYokrqOBGEMMe9UG2sostKQF9mml/vYaWJQ==}
+    peerDependencies:
+      vite: ^3.0.0 || ^4.0.0 || ^5.0.0 || ^6.0.0 || ^7.0.0-beta.0
+    peerDependenciesMeta:
+      vite:
+        optional: true
+
+  vitest@4.0.18:
+    resolution: {integrity: sha512-hOQuK7h0FGKgBAas7v0mSAsnvrIgAvWmRFjmzpJ7SwFHH3g1k2u37JtYwOwmEKhK6ZO3v9ggDBBm0La1LCK4uQ==}
+    engines: {node: ^20.0.0 || ^22.0.0 || >=24.0.0}
+    hasBin: true
+    peerDependencies:
+      '@edge-runtime/vm': '*'
+      '@opentelemetry/api': ^1.9.0
+      '@types/node': ^20.0.0 || ^22.0.0 || >=24.0.0
+      '@vitest/browser-playwright': 4.0.18
+      '@vitest/browser-preview': 4.0.18
+      '@vitest/browser-webdriverio': 4.0.18
+      '@vitest/ui': 4.0.18
+      happy-dom: '*'
+      jsdom: '*'
+    peerDependenciesMeta:
+      '@edge-runtime/vm':
+        optional: true
+      '@opentelemetry/api':
+        optional: true
+      '@types/node':
+        optional: true
+      '@vitest/browser-playwright':
+        optional: true
+      '@vitest/browser-preview':
+        optional: true
+      '@vitest/browser-webdriverio':
+        optional: true
+      '@vitest/ui':
+        optional: true
+      happy-dom:
+        optional: true
+      jsdom:
+        optional: true
+
+  vscode-uri@3.1.0:
+    resolution: {integrity: sha512-/BpdSx+yCQGnCvecbyXdxHDkuk55/G3xwnC0GqY4gmQ3j+A+g8kzzgB4Nk/SINjqn6+waqw3EgbVF2QKExkRxQ==}
+
+  vue-bundle-renderer@2.2.0:
+    resolution: {integrity: sha512-sz/0WEdYH1KfaOm0XaBmRZOWgYTEvUDt6yPYaUzl4E52qzgWLlknaPPTTZmp6benaPTlQAI/hN1x3tAzZygycg==}
+
+  vue-devtools-stub@0.1.0:
+    resolution: {integrity: sha512-RutnB7X8c5hjq39NceArgXg28WZtZpGc3+J16ljMiYnFhKvd8hITxSWQSQ5bvldxMDU6gG5mkxl1MTQLXckVSQ==}
+
+  vue-router@4.6.4:
+    resolution: {integrity: sha512-Hz9q5sa33Yhduglwz6g9skT8OBPii+4bFn88w6J+J4MfEo4KRRpmiNG/hHHkdbRFlLBOqxN8y8gf2Fb0MTUgVg==}
+    peerDependencies:
+      vue: ^3.5.0
+
+  vue-tsc@3.2.4:
+    resolution: {integrity: sha512-xj3YCvSLNDKt1iF9OcImWHhmYcihVu9p4b9s4PGR/qp6yhW+tZJaypGxHScRyOrdnHvaOeF+YkZOdKwbgGvp5g==}
+    hasBin: true
+    peerDependencies:
+      typescript: '>=5.0.0'
+
+  vue@3.5.28:
+    resolution: {integrity: sha512-BRdrNfeoccSoIZeIhyPBfvWSLFP4q8J3u8Ju8Ug5vu3LdD+yTM13Sg4sKtljxozbnuMu1NB1X5HBHRYUzFocKg==}
+    peerDependencies:
+      typescript: '*'
+    peerDependenciesMeta:
+      typescript:
+        optional: true
+
+  webidl-conversions@3.0.1:
+    resolution: {integrity: sha512-2JAn3z8AR6rjK8Sm8orRC0h/bcl/DqL7tRPdGZ4I1CjdF+EaMLmYxBHyXuKL849eucPFhvBoxMsflfOb8kxaeQ==}
+
+  webidl-conversions@4.0.2:
+    resolution: {integrity: sha512-YQ+BmxuTgd6UXZW3+ICGfyqRyHXVlD5GtQr5+qjiNW7bF0cqrzX500HVXPBOvgXb5YnzDd+h0zqyv61KUD7+Sg==}
+
+  webpack-virtual-modules@0.6.2:
+    resolution: {integrity: sha512-66/V2i5hQanC51vBQKPH4aI8NMAcBW59FVBs+rC7eGHupMyfn34q7rZIE+ETlJ+XTevqfUhVVBgSUNSW2flEUQ==}
+
+  whatwg-url@5.0.0:
+    resolution: {integrity: sha512-saE57nupxk6v3HY35+jzBwYa0rKSy0XR8JSxZPwgLr7ys0IBzhGviA1/TUGJLmSVqs8pb9AnvICXEuOHLprYTw==}
+
+  whatwg-url@7.1.0:
+    resolution: {integrity: sha512-WUu7Rg1DroM7oQvGWfOiAK21n74Gg+T4elXEQYkOhtyLeWiJFoOGLXPKI/9gzIie9CtwVLm8wtw6YJdKyxSjeg==}
+
+  which-boxed-primitive@1.1.1:
+    resolution: {integrity: sha512-TbX3mj8n0odCBFVlY8AxkqcHASw3L60jIuF8jFP78az3C2YhmGvqbHBpAjTRH2/xqYunrJ9g1jSyjCjpoWzIAA==}
+    engines: {node: '>= 0.4'}
+
+  which-builtin-type@1.2.1:
+    resolution: {integrity: sha512-6iBczoX+kDQ7a3+YJBnh3T+KZRxM/iYNPXicqk66/Qfm1b93iu+yOImkg0zHbj5LNOcNv1TEADiZ0xa34B4q6Q==}
+    engines: {node: '>= 0.4'}
+
+  which-collection@1.0.2:
+    resolution: {integrity: sha512-K4jVyjnBdgvc86Y6BkaLZEN933SwYOuBFkdmBu9ZfkcAbdVbpITnDmjvZ/aQjRXQrv5EPkTnD1s39GiiqbngCw==}
+    engines: {node: '>= 0.4'}
+
+  which-typed-array@1.1.20:
+    resolution: {integrity: sha512-LYfpUkmqwl0h9A2HL09Mms427Q1RZWuOHsukfVcKRq9q95iQxdw0ix1JQrqbcDR9PH1QDwf5Qo8OZb5lksZ8Xg==}
+    engines: {node: '>= 0.4'}
+
+  which@2.0.2:
+    resolution: {integrity: sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==}
+    engines: {node: '>= 8'}
+    hasBin: true
+
+  which@4.0.0:
+    resolution: {integrity: sha512-GlaYyEb07DPxYCKhKzplCWBJtvxZcZMrL+4UkrTSJHHPyZU4mYYTv3qaOe77H7EODLSSopAUFAc6W8U4yqvscg==}
+    engines: {node: ^16.13.0 || >=18.0.0}
+    hasBin: true
+
+  which@5.0.0:
+    resolution: {integrity: sha512-JEdGzHwwkrbWoGOlIHqQ5gtprKGOenpDHpxE9zVR1bWbOtYRyPPHMe9FaP6x61CmNaTThSkb0DAJte5jD+DmzQ==}
+    engines: {node: ^18.17.0 || >=20.5.0}
+    hasBin: true
+
+  why-is-node-running@2.3.0:
+    resolution: {integrity: sha512-hUrmaWBdVDcxvYqnyh09zunKzROWjbZTiNy8dBEjkS7ehEDQibXJ7XvlmtbwuTclUiIyN+CyXQD4Vmko8fNm8w==}
+    engines: {node: '>=8'}
+    hasBin: true
+
+  widest-line@5.0.0:
+    resolution: {integrity: sha512-c9bZp7b5YtRj2wOe6dlj32MK+Bx/M/d+9VB2SHM1OtsUHR0aV0tdP6DWh/iMt0kWi1t5g1Iudu6hQRNd1A4PVA==}
+    engines: {node: '>=18'}
+
+  word-wrap@1.2.5:
+    resolution: {integrity: sha512-BN22B5eaMMI9UMtjrGd5g5eCYPpCPDUy0FJXbYsaT5zYxjFOckS53SQDE3pWkVoWpHXVb3BrYcEN4Twa55B5cA==}
+    engines: {node: '>=0.10.0'}
+
+  wrap-ansi@7.0.0:
+    resolution: {integrity: sha512-YVGIj2kamLSTxw6NsZjoBxfSwsn0ycdesmc4p+Q21c5zPuZ1pl+NfxVdxPtdHvmNVOQ6XSYG4AUtyt/Fi7D16Q==}
+    engines: {node: '>=10'}
+
+  wrap-ansi@8.1.0:
+    resolution: {integrity: sha512-si7QWI6zUMq56bESFvagtmzMdGOtoxfR+Sez11Mobfc7tm+VkUckk9bW2UeffTGVUbOksxmSw0AA2gs8g71NCQ==}
+    engines: {node: '>=12'}
+
+  wrap-ansi@9.0.2:
+    resolution: {integrity: sha512-42AtmgqjV+X1VpdOfyTGOYRi0/zsoLqtXQckTmqTeybT+BDIbM/Guxo7x3pE2vtpr1ok6xRqM9OpBe+Jyoqyww==}
+    engines: {node: '>=18'}
+
+  ws@8.19.0:
+    resolution: {integrity: sha512-blAT2mjOEIi0ZzruJfIhb3nps74PRWTCz1IjglWEEpQl5XS/UNama6u2/rjFkDDouqr4L67ry+1aGIALViWjDg==}
+    engines: {node: '>=10.0.0'}
+    peerDependencies:
+      bufferutil: ^4.0.1
+      utf-8-validate: '>=5.0.2'
+    peerDependenciesMeta:
+      bufferutil:
+        optional: true
+      utf-8-validate:
+        optional: true
+
+  wsl-utils@0.1.0:
+    resolution: {integrity: sha512-h3Fbisa2nKGPxCpm89Hk33lBLsnaGBvctQopaBSOW/uIs6FTe1ATyAnKFJrzVs9vpGdsTe73WF3V4lIsk4Gacw==}
+    engines: {node: '>=18'}
+
+  y18n@5.0.8:
+    resolution: {integrity: sha512-0pfFzegeDWJHJIAmTLRP2DwHjdF5s7jo9tuztdQxAhINCdvS+3nGINqPd00AphqJR/0LhANUS6/+7SCb98YOfA==}
+    engines: {node: '>=10'}
+
+  yallist@3.1.1:
+    resolution: {integrity: sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==}
+
+  yallist@5.0.0:
+    resolution: {integrity: sha512-YgvUTfwqyc7UXVMrB+SImsVYSmTS8X/tSrtdNZMImM+n7+QTriRXyXim0mBrTXNeqzVF0KWGgHPeiyViFFrNDw==}
+    engines: {node: '>=18'}
+
+  yaml@2.8.2:
+    resolution: {integrity: sha512-mplynKqc1C2hTVYxd0PU2xQAc22TI1vShAYGksCCfxbn/dFwnHTNi1bvYsBTkhdUNtGIf5xNOg938rrSSYvS9A==}
+    engines: {node: '>= 14.6'}
+    hasBin: true
+
+  yargs-parser@21.1.1:
+    resolution: {integrity: sha512-tVpsJW7DdjecAiFpbIB1e3qxIQsE6NoPc5/eTdrbbIC4h0LVsWhnoa3g+m2HclBIujHzsxZ4VJVA+GUuc2/LBw==}
+    engines: {node: '>=12'}
+
+  yargs@17.7.2:
+    resolution: {integrity: sha512-7dSzzRQ++CKnNI/krKnYRV7JKKPUXMEh61soaHKg9mrWEhzFWhFnxPxGl+69cD1Ou63C13NUPCnmIcrvqCuM6w==}
+    engines: {node: '>=12'}
+
+  yocto-queue@0.1.0:
+    resolution: {integrity: sha512-rVksvsnNCdJ/ohGc6xgPwyN8eheCxsiLM8mxuE/t/mOVqJewPuO1miLpTHQiRgTKCLexL4MeAFVagts7HmNZ2Q==}
+    engines: {node: '>=10'}
+
+  youch-core@0.3.3:
+    resolution: {integrity: sha512-ho7XuGjLaJ2hWHoK8yFnsUGy2Y5uDpqSTq1FkHLK4/oqKtyUU1AFbOOxY4IpC9f0fTLjwYbslUz0Po5BpD1wrA==}
+
+  youch@4.1.0-beta.14:
+    resolution: {integrity: sha512-VqcHA/HqOxaBMjBQCYz1h8jYdAAeLm6cVLmefijJjMY4aovOfKkqMry7amNX3JiN4hXArb7ZVYBNpjEVkV3r/A==}
+
+  zimmerframe@1.1.4:
+    resolution: {integrity: sha512-B58NGBEoc8Y9MWWCQGl/gq9xBCe4IiKM0a2x7GZdQKOW5Exr8S1W24J6OgM1njK8xCRGvAJIL/MxXHf6SkmQKQ==}
+
+  zip-stream@6.0.1:
+    resolution: {integrity: sha512-zK7YHHz4ZXpW89AHXUPbQVGKI7uvkd3hzusTdotCg1UxyaVtg0zFJSTfW/Dq5f7OBBVnq6cZIaC8Ti4hb6dtCA==}
+    engines: {node: '>= 14'}
+
+  zod-validation-error@4.0.2:
+    resolution: {integrity: sha512-Q6/nZLe6jxuU80qb/4uJ4t5v2VEZ44lzQjPDhYJNztRQ4wyWc6VF3D3Kb/fAuPetZQnhS3hnajCf9CsWesghLQ==}
+    engines: {node: '>=18.0.0'}
+    peerDependencies:
+      zod: ^3.25.0 || ^4.0.0
+
+  zod@4.3.6:
+    resolution: {integrity: sha512-rftlrkhHZOcjDwkGlnUtZZkvaPHCsDATp4pGpuOOMDaTdDDXF91wuVDJoWoPsKX/3YPQ5fHuF3STjcYyKr+Qhg==}
+
+  zwitch@2.0.4:
+    resolution: {integrity: sha512-bXE4cR/kVZhKZX/RjPEflHaKVhUVl85noU3v6b8apfQEc1x4A+zBxjZ4lN8LqGd6WZ3dl98pY4o717VFmoPp+A==}
+
+snapshots:
+
+  '@alloc/quick-lru@5.2.0': {}
+
+  '@babel/code-frame@7.26.2':
+    dependencies:
+      '@babel/helper-validator-identifier': 7.28.5
+      js-tokens: 4.0.0
+      picocolors: 1.1.1
+
+  '@babel/code-frame@7.29.0':
+    dependencies:
+      '@babel/helper-validator-identifier': 7.28.5
+      js-tokens: 4.0.0
+      picocolors: 1.1.1
+
+  '@babel/compat-data@7.29.0': {}
+
+  '@babel/core@7.29.0':
+    dependencies:
+      '@babel/code-frame': 7.29.0
+      '@babel/generator': 7.29.1
+      '@babel/helper-compilation-targets': 7.28.6
+      '@babel/helper-module-transforms': 7.28.6(@babel/core@7.29.0)
+      '@babel/helpers': 7.28.6
+      '@babel/parser': 7.29.0
+      '@babel/template': 7.28.6
+      '@babel/traverse': 7.29.0
+      '@babel/types': 7.29.0
+      '@jridgewell/remapping': 2.3.5
+      convert-source-map: 2.0.0
+      debug: 4.4.3
+      gensync: 1.0.0-beta.2
+      json5: 2.2.3
+      semver: 6.3.1
+    transitivePeerDependencies:
+      - supports-color
+
+  '@babel/generator@7.29.1':
+    dependencies:
+      '@babel/parser': 7.29.0
+      '@babel/types': 7.29.0
+      '@jridgewell/gen-mapping': 0.3.13
+      '@jridgewell/trace-mapping': 0.3.31
+      jsesc: 3.1.0
+
+  '@babel/helper-annotate-as-pure@7.27.3':
+    dependencies:
+      '@babel/types': 7.29.0
+
+  '@babel/helper-compilation-targets@7.28.6':
+    dependencies:
+      '@babel/compat-data': 7.29.0
+      '@babel/helper-validator-option': 7.27.1
+      browserslist: 4.28.1
+      lru-cache: 5.1.1
+      semver: 6.3.1
+
+  '@babel/helper-create-class-features-plugin@7.28.6(@babel/core@7.29.0)':
+    dependencies:
+      '@babel/core': 7.29.0
+      '@babel/helper-annotate-as-pure': 7.27.3
+      '@babel/helper-member-expression-to-functions': 7.28.5
+      '@babel/helper-optimise-call-expression': 7.27.1
+      '@babel/helper-replace-supers': 7.28.6(@babel/core@7.29.0)
+      '@babel/helper-skip-transparent-expression-wrappers': 7.27.1
+      '@babel/traverse': 7.29.0
+      semver: 6.3.1
+    transitivePeerDependencies:
+      - supports-color
+
+  '@babel/helper-globals@7.28.0': {}
+
+  '@babel/helper-member-expression-to-functions@7.28.5':
+    dependencies:
+      '@babel/traverse': 7.29.0
+      '@babel/types': 7.29.0
+    transitivePeerDependencies:
+      - supports-color
+
+  '@babel/helper-module-imports@7.18.6':
+    dependencies:
+      '@babel/types': 7.29.0
+
+  '@babel/helper-module-imports@7.28.6':
+    dependencies:
+      '@babel/traverse': 7.29.0
+      '@babel/types': 7.29.0
+    transitivePeerDependencies:
+      - supports-color
+
+  '@babel/helper-module-transforms@7.28.6(@babel/core@7.29.0)':
+    dependencies:
+      '@babel/core': 7.29.0
+      '@babel/helper-module-imports': 7.28.6
+      '@babel/helper-validator-identifier': 7.28.5
+      '@babel/traverse': 7.29.0
+    transitivePeerDependencies:
+      - supports-color
+
+  '@babel/helper-optimise-call-expression@7.27.1':
+    dependencies:
+      '@babel/types': 7.29.0
+
+  '@babel/helper-plugin-utils@7.28.6': {}
+
+  '@babel/helper-replace-supers@7.28.6(@babel/core@7.29.0)':
+    dependencies:
+      '@babel/core': 7.29.0
+      '@babel/helper-member-expression-to-functions': 7.28.5
+      '@babel/helper-optimise-call-expression': 7.27.1
+      '@babel/traverse': 7.29.0
+    transitivePeerDependencies:
+      - supports-color
+
+  '@babel/helper-skip-transparent-expression-wrappers@7.27.1':
+    dependencies:
+      '@babel/traverse': 7.29.0
+      '@babel/types': 7.29.0
+    transitivePeerDependencies:
+      - supports-color
+
+  '@babel/helper-string-parser@7.27.1': {}
+
+  '@babel/helper-validator-identifier@7.28.5': {}
+
+  '@babel/helper-validator-option@7.27.1': {}
+
+  '@babel/helpers@7.28.6':
+    dependencies:
+      '@babel/template': 7.28.6
+      '@babel/types': 7.29.0
+
+  '@babel/parser@7.29.0':
+    dependencies:
+      '@babel/types': 7.29.0
+
+  '@babel/plugin-syntax-jsx@7.28.6(@babel/core@7.29.0)':
+    dependencies:
+      '@babel/core': 7.29.0
+      '@babel/helper-plugin-utils': 7.28.6
+
+  '@babel/plugin-syntax-typescript@7.28.6(@babel/core@7.29.0)':
+    dependencies:
+      '@babel/core': 7.29.0
+      '@babel/helper-plugin-utils': 7.28.6
+
+  '@babel/plugin-transform-react-jsx-self@7.27.1(@babel/core@7.29.0)':
+    dependencies:
+      '@babel/core': 7.29.0
+      '@babel/helper-plugin-utils': 7.28.6
+
+  '@babel/plugin-transform-react-jsx-source@7.27.1(@babel/core@7.29.0)':
+    dependencies:
+      '@babel/core': 7.29.0
+      '@babel/helper-plugin-utils': 7.28.6
+
+  '@babel/plugin-transform-typescript@7.28.6(@babel/core@7.29.0)':
+    dependencies:
+      '@babel/core': 7.29.0
+      '@babel/helper-annotate-as-pure': 7.27.3
+      '@babel/helper-create-class-features-plugin': 7.28.6(@babel/core@7.29.0)
+      '@babel/helper-plugin-utils': 7.28.6
+      '@babel/helper-skip-transparent-expression-wrappers': 7.27.1
+      '@babel/plugin-syntax-typescript': 7.28.6(@babel/core@7.29.0)
+    transitivePeerDependencies:
+      - supports-color
+
+  '@babel/runtime@7.28.6': {}
+
+  '@babel/template@7.28.6':
+    dependencies:
+      '@babel/code-frame': 7.29.0
+      '@babel/parser': 7.29.0
+      '@babel/types': 7.29.0
+
+  '@babel/traverse@7.29.0':
+    dependencies:
+      '@babel/code-frame': 7.29.0
+      '@babel/generator': 7.29.1
+      '@babel/helper-globals': 7.28.0
+      '@babel/parser': 7.29.0
+      '@babel/template': 7.28.6
+      '@babel/types': 7.29.0
+      debug: 4.4.3
+    transitivePeerDependencies:
+      - supports-color
+
+  '@babel/types@7.29.0':
+    dependencies:
+      '@babel/helper-string-parser': 7.27.1
+      '@babel/helper-validator-identifier': 7.28.5
+
+  '@biomejs/biome@2.4.2':
+    optionalDependencies:
+      '@biomejs/cli-darwin-arm64': 2.4.2
+      '@biomejs/cli-darwin-x64': 2.4.2
+      '@biomejs/cli-linux-arm64': 2.4.2
+      '@biomejs/cli-linux-arm64-musl': 2.4.2
+      '@biomejs/cli-linux-x64': 2.4.2
+      '@biomejs/cli-linux-x64-musl': 2.4.2
+      '@biomejs/cli-win32-arm64': 2.4.2
+      '@biomejs/cli-win32-x64': 2.4.2
+
+  '@biomejs/cli-darwin-arm64@2.4.2':
+    optional: true
+
+  '@biomejs/cli-darwin-x64@2.4.2':
+    optional: true
+
+  '@biomejs/cli-linux-arm64-musl@2.4.2':
+    optional: true
+
+  '@biomejs/cli-linux-arm64@2.4.2':
+    optional: true
+
+  '@biomejs/cli-linux-x64-musl@2.4.2':
+    optional: true
+
+  '@biomejs/cli-linux-x64@2.4.2':
+    optional: true
+
+  '@biomejs/cli-win32-arm64@2.4.2':
+    optional: true
+
+  '@biomejs/cli-win32-x64@2.4.2':
+    optional: true
+
+  '@bomb.sh/tab@0.0.12(cac@6.7.14)(citty@0.2.1)':
+    optionalDependencies:
+      cac: 6.7.14
+      citty: 0.2.1
+
+  '@changesets/apply-release-plan@7.0.14':
+    dependencies:
+      '@changesets/config': 3.1.2
+      '@changesets/get-version-range-type': 0.4.0
+      '@changesets/git': 3.0.4
+      '@changesets/should-skip-package': 0.1.2
+      '@changesets/types': 6.1.0
+      '@manypkg/get-packages': 1.1.3
+      detect-indent: 6.1.0
+      fs-extra: 7.0.1
+      lodash.startcase: 4.4.0
+      outdent: 0.5.0
+      prettier: 2.8.8
+      resolve-from: 5.0.0
+      semver: 7.7.4
+
+  '@changesets/assemble-release-plan@6.0.9':
+    dependencies:
+      '@changesets/errors': 0.2.0
+      '@changesets/get-dependents-graph': 2.1.3
+      '@changesets/should-skip-package': 0.1.2
+      '@changesets/types': 6.1.0
+      '@manypkg/get-packages': 1.1.3
+      semver: 7.7.4
+
+  '@changesets/changelog-git@0.2.1':
+    dependencies:
+      '@changesets/types': 6.1.0
+
+  '@changesets/cli@2.29.7(@types/node@24.10.13)':
+    dependencies:
+      '@changesets/apply-release-plan': 7.0.14
+      '@changesets/assemble-release-plan': 6.0.9
+      '@changesets/changelog-git': 0.2.1
+      '@changesets/config': 3.1.2
+      '@changesets/errors': 0.2.0
+      '@changesets/get-dependents-graph': 2.1.3
+      '@changesets/get-release-plan': 4.0.14
+      '@changesets/git': 3.0.4
+      '@changesets/logger': 0.1.1
+      '@changesets/pre': 2.0.2
+      '@changesets/read': 0.6.6
+      '@changesets/should-skip-package': 0.1.2
+      '@changesets/types': 6.1.0
+      '@changesets/write': 0.4.0
+      '@inquirer/external-editor': 1.0.3(@types/node@24.10.13)
+      '@manypkg/get-packages': 1.1.3
+      ansi-colors: 4.1.3
+      ci-info: 3.9.0
+      enquirer: 2.4.1
+      fs-extra: 7.0.1
+      mri: 1.2.0
+      p-limit: 2.3.0
+      package-manager-detector: 0.2.11
+      picocolors: 1.1.1
+      resolve-from: 5.0.0
+      semver: 7.7.4
+      spawndamnit: 3.0.1
+      term-size: 2.2.1
+    transitivePeerDependencies:
+      - '@types/node'
+
+  '@changesets/config@3.1.2':
+    dependencies:
+      '@changesets/errors': 0.2.0
+      '@changesets/get-dependents-graph': 2.1.3
+      '@changesets/logger': 0.1.1
+      '@changesets/types': 6.1.0
+      '@manypkg/get-packages': 1.1.3
+      fs-extra: 7.0.1
+      micromatch: 4.0.8
+
+  '@changesets/errors@0.2.0':
+    dependencies:
+      extendable-error: 0.1.7
+
+  '@changesets/get-dependents-graph@2.1.3':
+    dependencies:
+      '@changesets/types': 6.1.0
+      '@manypkg/get-packages': 1.1.3
+      picocolors: 1.1.1
+      semver: 7.7.4
+
+  '@changesets/get-release-plan@4.0.14':
+    dependencies:
+      '@changesets/assemble-release-plan': 6.0.9
+      '@changesets/config': 3.1.2
+      '@changesets/pre': 2.0.2
+      '@changesets/read': 0.6.6
+      '@changesets/types': 6.1.0
+      '@manypkg/get-packages': 1.1.3
+
+  '@changesets/get-version-range-type@0.4.0': {}
+
+  '@changesets/git@3.0.4':
+    dependencies:
+      '@changesets/errors': 0.2.0
+      '@manypkg/get-packages': 1.1.3
+      is-subdir: 1.2.0
+      micromatch: 4.0.8
+      spawndamnit: 3.0.1
+
+  '@changesets/logger@0.1.1':
+    dependencies:
+      picocolors: 1.1.1
+
+  '@changesets/parse@0.4.2':
+    dependencies:
+      '@changesets/types': 6.1.0
+      js-yaml: 4.1.1
+
+  '@changesets/pre@2.0.2':
+    dependencies:
+      '@changesets/errors': 0.2.0
+      '@changesets/types': 6.1.0
+      '@manypkg/get-packages': 1.1.3
+      fs-extra: 7.0.1
+
+  '@changesets/read@0.6.6':
+    dependencies:
+      '@changesets/git': 3.0.4
+      '@changesets/logger': 0.1.1
+      '@changesets/parse': 0.4.2
+      '@changesets/types': 6.1.0
+      fs-extra: 7.0.1
+      p-filter: 2.1.0
+      picocolors: 1.1.1
+
+  '@changesets/should-skip-package@0.1.2':
+    dependencies:
+      '@changesets/types': 6.1.0
+      '@manypkg/get-packages': 1.1.3
+
+  '@changesets/types@4.1.0': {}
+
+  '@changesets/types@6.1.0': {}
+
+  '@changesets/write@0.4.0':
+    dependencies:
+      '@changesets/types': 6.1.0
+      fs-extra: 7.0.1
+      human-id: 4.1.3
+      prettier: 2.8.8
+
+  '@clack/core@1.0.1':
+    dependencies:
+      picocolors: 1.1.1
+      sisteransi: 1.0.5
+
+  '@clack/prompts@1.0.1':
+    dependencies:
+      '@clack/core': 1.0.1
+      picocolors: 1.1.1
+      sisteransi: 1.0.5
+
+  '@cloudflare/kv-asset-handler@0.4.2': {}
+
+  '@deno/shim-deno-test@0.5.0': {}
+
+  '@deno/shim-deno@0.19.2':
+    dependencies:
+      '@deno/shim-deno-test': 0.5.0
+      which: 4.0.0
+
+  '@dxup/nuxt@0.3.2(magicast@0.5.2)':
+    dependencies:
+      '@dxup/unimport': 0.1.2
+      '@nuxt/kit': 4.3.1(magicast@0.5.2)
+      chokidar: 5.0.0
+      pathe: 2.0.3
+      tinyglobby: 0.2.15
+    transitivePeerDependencies:
+      - magicast
+
+  '@dxup/unimport@0.1.2': {}
+
+  '@emnapi/core@1.8.1':
+    dependencies:
+      '@emnapi/wasi-threads': 1.1.0
+      tslib: 2.8.1
+    optional: true
+
+  '@emnapi/runtime@1.8.1':
+    dependencies:
+      tslib: 2.8.1
+    optional: true
+
+  '@emnapi/wasi-threads@1.1.0':
+    dependencies:
+      tslib: 2.8.1
+    optional: true
+
+  '@esbuild/aix-ppc64@0.25.12':
+    optional: true
+
+  '@esbuild/aix-ppc64@0.27.3':
+    optional: true
+
+  '@esbuild/android-arm64@0.25.12':
+    optional: true
+
+  '@esbuild/android-arm64@0.27.3':
+    optional: true
+
+  '@esbuild/android-arm@0.25.12':
+    optional: true
+
+  '@esbuild/android-arm@0.27.3':
+    optional: true
+
+  '@esbuild/android-x64@0.25.12':
+    optional: true
+
+  '@esbuild/android-x64@0.27.3':
+    optional: true
+
+  '@esbuild/darwin-arm64@0.25.12':
+    optional: true
+
+  '@esbuild/darwin-arm64@0.27.3':
+    optional: true
+
+  '@esbuild/darwin-x64@0.25.12':
+    optional: true
+
+  '@esbuild/darwin-x64@0.27.3':
+    optional: true
+
+  '@esbuild/freebsd-arm64@0.25.12':
+    optional: true
+
+  '@esbuild/freebsd-arm64@0.27.3':
+    optional: true
+
+  '@esbuild/freebsd-x64@0.25.12':
+    optional: true
+
+  '@esbuild/freebsd-x64@0.27.3':
+    optional: true
+
+  '@esbuild/linux-arm64@0.25.12':
+    optional: true
+
+  '@esbuild/linux-arm64@0.27.3':
+    optional: true
+
+  '@esbuild/linux-arm@0.25.12':
+    optional: true
+
+  '@esbuild/linux-arm@0.27.3':
+    optional: true
+
+  '@esbuild/linux-ia32@0.25.12':
+    optional: true
+
+  '@esbuild/linux-ia32@0.27.3':
+    optional: true
+
+  '@esbuild/linux-loong64@0.25.12':
+    optional: true
+
+  '@esbuild/linux-loong64@0.27.3':
+    optional: true
+
+  '@esbuild/linux-mips64el@0.25.12':
+    optional: true
+
+  '@esbuild/linux-mips64el@0.27.3':
+    optional: true
+
+  '@esbuild/linux-ppc64@0.25.12':
+    optional: true
+
+  '@esbuild/linux-ppc64@0.27.3':
+    optional: true
+
+  '@esbuild/linux-riscv64@0.25.12':
+    optional: true
+
+  '@esbuild/linux-riscv64@0.27.3':
+    optional: true
+
+  '@esbuild/linux-s390x@0.25.12':
+    optional: true
+
+  '@esbuild/linux-s390x@0.27.3':
+    optional: true
+
+  '@esbuild/linux-x64@0.25.12':
+    optional: true
+
+  '@esbuild/linux-x64@0.27.3':
+    optional: true
+
+  '@esbuild/netbsd-arm64@0.25.12':
+    optional: true
+
+  '@esbuild/netbsd-arm64@0.27.3':
+    optional: true
+
+  '@esbuild/netbsd-x64@0.25.12':
+    optional: true
+
+  '@esbuild/netbsd-x64@0.27.3':
+    optional: true
+
+  '@esbuild/openbsd-arm64@0.25.12':
+    optional: true
+
+  '@esbuild/openbsd-arm64@0.27.3':
+    optional: true
+
+  '@esbuild/openbsd-x64@0.25.12':
+    optional: true
+
+  '@esbuild/openbsd-x64@0.27.3':
+    optional: true
+
+  '@esbuild/openharmony-arm64@0.25.12':
+    optional: true
+
+  '@esbuild/openharmony-arm64@0.27.3':
+    optional: true
+
+  '@esbuild/sunos-x64@0.25.12':
+    optional: true
+
+  '@esbuild/sunos-x64@0.27.3':
+    optional: true
+
+  '@esbuild/win32-arm64@0.25.12':
+    optional: true
+
+  '@esbuild/win32-arm64@0.27.3':
+    optional: true
+
+  '@esbuild/win32-ia32@0.25.12':
+    optional: true
+
+  '@esbuild/win32-ia32@0.27.3':
+    optional: true
+
+  '@esbuild/win32-x64@0.25.12':
+    optional: true
+
+  '@esbuild/win32-x64@0.27.3':
+    optional: true
+
+  '@eslint-community/eslint-utils@4.9.1(eslint@9.39.2(jiti@2.6.1))':
+    dependencies:
+      eslint: 9.39.2(jiti@2.6.1)
+      eslint-visitor-keys: 3.4.3
+
+  '@eslint-community/regexpp@4.12.2': {}
+
+  '@eslint/config-array@0.21.1':
+    dependencies:
+      '@eslint/object-schema': 2.1.7
+      debug: 4.4.3
+      minimatch: 3.1.2
+    transitivePeerDependencies:
+      - supports-color
+
+  '@eslint/config-helpers@0.4.2':
+    dependencies:
+      '@eslint/core': 0.17.0
+
+  '@eslint/core@0.17.0':
+    dependencies:
+      '@types/json-schema': 7.0.15
+
+  '@eslint/eslintrc@3.3.3':
+    dependencies:
+      ajv: 6.12.6
+      debug: 4.4.3
+      espree: 10.4.0
+      globals: 14.0.0
+      ignore: 5.3.2
+      import-fresh: 3.3.1
+      js-yaml: 4.1.1
+      minimatch: 3.1.2
+      strip-json-comments: 3.1.1
+    transitivePeerDependencies:
+      - supports-color
+
+  '@eslint/js@9.39.2': {}
+
+  '@eslint/object-schema@2.1.7': {}
+
+  '@eslint/plugin-kit@0.4.1':
+    dependencies:
+      '@eslint/core': 0.17.0
+      levn: 0.4.1
+
+  '@humanfs/core@0.19.1': {}
+
+  '@humanfs/node@0.16.7':
+    dependencies:
+      '@humanfs/core': 0.19.1
+      '@humanwhocodes/retry': 0.4.3
+
+  '@humanwhocodes/module-importer@1.0.1': {}
+
+  '@humanwhocodes/retry@0.4.3': {}
+
+  '@img/colour@1.0.0':
+    optional: true
+
+  '@img/sharp-darwin-arm64@0.34.5':
+    optionalDependencies:
+      '@img/sharp-libvips-darwin-arm64': 1.2.4
+    optional: true
+
+  '@img/sharp-darwin-x64@0.34.5':
+    optionalDependencies:
+      '@img/sharp-libvips-darwin-x64': 1.2.4
+    optional: true
+
+  '@img/sharp-libvips-darwin-arm64@1.2.4':
+    optional: true
+
+  '@img/sharp-libvips-darwin-x64@1.2.4':
+    optional: true
+
+  '@img/sharp-libvips-linux-arm64@1.2.4':
+    optional: true
+
+  '@img/sharp-libvips-linux-arm@1.2.4':
+    optional: true
+
+  '@img/sharp-libvips-linux-ppc64@1.2.4':
+    optional: true
+
+  '@img/sharp-libvips-linux-riscv64@1.2.4':
+    optional: true
+
+  '@img/sharp-libvips-linux-s390x@1.2.4':
+    optional: true
+
+  '@img/sharp-libvips-linux-x64@1.2.4':
+    optional: true
+
+  '@img/sharp-libvips-linuxmusl-arm64@1.2.4':
+    optional: true
+
+  '@img/sharp-libvips-linuxmusl-x64@1.2.4':
+    optional: true
+
+  '@img/sharp-linux-arm64@0.34.5':
+    optionalDependencies:
+      '@img/sharp-libvips-linux-arm64': 1.2.4
+    optional: true
+
+  '@img/sharp-linux-arm@0.34.5':
+    optionalDependencies:
+      '@img/sharp-libvips-linux-arm': 1.2.4
+    optional: true
+
+  '@img/sharp-linux-ppc64@0.34.5':
+    optionalDependencies:
+      '@img/sharp-libvips-linux-ppc64': 1.2.4
+    optional: true
+
+  '@img/sharp-linux-riscv64@0.34.5':
+    optionalDependencies:
+      '@img/sharp-libvips-linux-riscv64': 1.2.4
+    optional: true
+
+  '@img/sharp-linux-s390x@0.34.5':
+    optionalDependencies:
+      '@img/sharp-libvips-linux-s390x': 1.2.4
+    optional: true
+
+  '@img/sharp-linux-x64@0.34.5':
+    optionalDependencies:
+      '@img/sharp-libvips-linux-x64': 1.2.4
+    optional: true
+
+  '@img/sharp-linuxmusl-arm64@0.34.5':
+    optionalDependencies:
+      '@img/sharp-libvips-linuxmusl-arm64': 1.2.4
+    optional: true
+
+  '@img/sharp-linuxmusl-x64@0.34.5':
+    optionalDependencies:
+      '@img/sharp-libvips-linuxmusl-x64': 1.2.4
+    optional: true
+
+  '@img/sharp-wasm32@0.34.5':
+    dependencies:
+      '@emnapi/runtime': 1.8.1
+    optional: true
+
+  '@img/sharp-win32-arm64@0.34.5':
+    optional: true
+
+  '@img/sharp-win32-ia32@0.34.5':
+    optional: true
+
+  '@img/sharp-win32-x64@0.34.5':
+    optional: true
+
+  '@inquirer/external-editor@1.0.3(@types/node@24.10.13)':
+    dependencies:
+      chardet: 2.1.1
+      iconv-lite: 0.7.2
+    optionalDependencies:
+      '@types/node': 24.10.13
+
+  '@ioredis/commands@1.5.0': {}
+
+  '@isaacs/cliui@8.0.2':
+    dependencies:
+      string-width: 5.1.2
+      string-width-cjs: string-width@4.2.3
+      strip-ansi: 7.1.2
+      strip-ansi-cjs: strip-ansi@6.0.1
+      wrap-ansi: 8.1.0
+      wrap-ansi-cjs: wrap-ansi@7.0.0
+
+  '@isaacs/fs-minipass@4.0.1':
+    dependencies:
+      minipass: 7.1.3
+
+  '@jridgewell/gen-mapping@0.3.13':
+    dependencies:
+      '@jridgewell/sourcemap-codec': 1.5.5
+      '@jridgewell/trace-mapping': 0.3.31
+
+  '@jridgewell/remapping@2.3.5':
+    dependencies:
+      '@jridgewell/gen-mapping': 0.3.13
+      '@jridgewell/trace-mapping': 0.3.31
+
+  '@jridgewell/resolve-uri@3.1.2': {}
+
+  '@jridgewell/source-map@0.3.11':
+    dependencies:
+      '@jridgewell/gen-mapping': 0.3.13
+      '@jridgewell/trace-mapping': 0.3.31
+
+  '@jridgewell/sourcemap-codec@1.5.5': {}
+
+  '@jridgewell/trace-mapping@0.3.31':
+    dependencies:
+      '@jridgewell/resolve-uri': 3.1.2
+      '@jridgewell/sourcemap-codec': 1.5.5
+
+  '@kwsites/file-exists@1.1.1':
+    dependencies:
+      debug: 4.4.3
+    transitivePeerDependencies:
+      - supports-color
+
+  '@kwsites/promise-deferred@1.1.1': {}
+
+  '@manypkg/find-root@1.1.0':
+    dependencies:
+      '@babel/runtime': 7.28.6
+      '@types/node': 12.20.55
+      find-up: 4.1.0
+      fs-extra: 8.1.0
+
+  '@manypkg/get-packages@1.1.3':
+    dependencies:
+      '@babel/runtime': 7.28.6
+      '@changesets/types': 4.1.0
+      '@manypkg/find-root': 1.1.0
+      fs-extra: 8.1.0
+      globby: 11.1.0
+      read-yaml-file: 1.1.0
+
+  '@mapbox/node-pre-gyp@2.0.3':
+    dependencies:
+      consola: 3.4.2
+      detect-libc: 2.1.2
+      https-proxy-agent: 7.0.6
+      node-fetch: 2.7.0
+      nopt: 8.1.0
+      semver: 7.7.4
+      tar: 7.5.9
+    transitivePeerDependencies:
+      - encoding
+      - supports-color
+
+  '@napi-rs/wasm-runtime@0.2.12':
+    dependencies:
+      '@emnapi/core': 1.8.1
+      '@emnapi/runtime': 1.8.1
+      '@tybys/wasm-util': 0.10.1
+    optional: true
+
+  '@napi-rs/wasm-runtime@1.1.1':
+    dependencies:
+      '@emnapi/core': 1.8.1
+      '@emnapi/runtime': 1.8.1
+      '@tybys/wasm-util': 0.10.1
+    optional: true
+
+  '@next/env@16.1.6': {}
+
+  '@next/eslint-plugin-next@16.1.6':
+    dependencies:
+      fast-glob: 3.3.1
+
+  '@next/swc-darwin-arm64@16.1.6':
+    optional: true
+
+  '@next/swc-darwin-x64@16.1.6':
+    optional: true
+
+  '@next/swc-linux-arm64-gnu@16.1.6':
+    optional: true
+
+  '@next/swc-linux-arm64-musl@16.1.6':
+    optional: true
+
+  '@next/swc-linux-x64-gnu@16.1.6':
+    optional: true
+
+  '@next/swc-linux-x64-musl@16.1.6':
+    optional: true
+
+  '@next/swc-win32-arm64-msvc@16.1.6':
+    optional: true
+
+  '@next/swc-win32-x64-msvc@16.1.6':
+    optional: true
+
+  '@nodelib/fs.scandir@2.1.5':
+    dependencies:
+      '@nodelib/fs.stat': 2.0.5
+      run-parallel: 1.2.0
+
+  '@nodelib/fs.stat@2.0.5': {}
+
+  '@nodelib/fs.walk@1.2.8':
+    dependencies:
+      '@nodelib/fs.scandir': 2.1.5
+      fastq: 1.20.1
+
+  '@nolyfill/is-core-module@1.0.39': {}
+
+  '@nuxt/cli@3.33.1(@nuxt/schema@4.3.1)(cac@6.7.14)(magicast@0.5.2)':
+    dependencies:
+      '@bomb.sh/tab': 0.0.12(cac@6.7.14)(citty@0.2.1)
+      '@clack/prompts': 1.0.1
+      c12: 3.3.3(magicast@0.5.2)
+      citty: 0.2.1
+      confbox: 0.2.4
+      consola: 3.4.2
+      copy-paste: 2.2.0
+      debug: 4.4.3
+      defu: 6.1.4
+      exsolve: 1.0.8
+      fuse.js: 7.1.0
+      fzf: 0.5.2
+      giget: 3.1.2
+      jiti: 2.6.1
+      listhen: 1.9.0
+      nypm: 0.6.5
+      ofetch: 1.5.1
+      ohash: 2.0.11
+      pathe: 2.0.3
+      perfect-debounce: 2.1.0
+      pkg-types: 2.3.0
+      scule: 1.3.0
+      semver: 7.7.4
+      srvx: 0.11.7
+      std-env: 3.10.0
+      tinyexec: 1.0.2
+      ufo: 1.6.3
+      youch: 4.1.0-beta.14
+    optionalDependencies:
+      '@nuxt/schema': 4.3.1
+    transitivePeerDependencies:
+      - cac
+      - commander
+      - magicast
+      - supports-color
+
+  '@nuxt/devalue@2.0.2': {}
+
+  '@nuxt/devtools-kit@3.2.1(magicast@0.5.2)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))':
+    dependencies:
+      '@nuxt/kit': 4.3.1(magicast@0.5.2)
+      execa: 8.0.1
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+    transitivePeerDependencies:
+      - magicast
+
+  '@nuxt/devtools-wizard@3.2.1':
+    dependencies:
+      consola: 3.4.2
+      diff: 8.0.3
+      execa: 8.0.1
+      magicast: 0.5.2
+      pathe: 2.0.3
+      pkg-types: 2.3.0
+      prompts: 2.4.2
+      semver: 7.7.4
+
+  '@nuxt/devtools@3.2.1(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue@3.5.28(typescript@5.9.3))':
+    dependencies:
+      '@nuxt/devtools-kit': 3.2.1(magicast@0.5.2)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      '@nuxt/devtools-wizard': 3.2.1
+      '@nuxt/kit': 4.3.1(magicast@0.5.2)
+      '@vue/devtools-core': 8.0.6(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue@3.5.28(typescript@5.9.3))
+      '@vue/devtools-kit': 8.0.6
+      birpc: 4.0.0
+      consola: 3.4.2
+      destr: 2.0.5
+      error-stack-parser-es: 1.0.5
+      execa: 8.0.1
+      fast-npm-meta: 1.2.1
+      get-port-please: 3.2.0
+      hookable: 6.0.1
+      image-meta: 0.2.2
+      is-installed-globally: 1.0.0
+      launch-editor: 2.13.0
+      local-pkg: 1.1.2
+      magicast: 0.5.2
+      nypm: 0.6.5
+      ohash: 2.0.11
+      pathe: 2.0.3
+      perfect-debounce: 2.1.0
+      pkg-types: 2.3.0
+      semver: 7.7.4
+      simple-git: 3.31.1
+      sirv: 3.0.2
+      structured-clone-es: 1.0.0
+      tinyglobby: 0.2.15
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+      vite-plugin-inspect: 11.3.3(@nuxt/kit@4.3.1(magicast@0.5.2))(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      vite-plugin-vue-tracer: 1.2.0(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue@3.5.28(typescript@5.9.3))
+      which: 5.0.0
+      ws: 8.19.0
+    transitivePeerDependencies:
+      - bufferutil
+      - supports-color
+      - utf-8-validate
+      - vue
+
+  '@nuxt/kit@4.3.1(magicast@0.5.2)':
+    dependencies:
+      c12: 3.3.3(magicast@0.5.2)
+      consola: 3.4.2
+      defu: 6.1.4
+      destr: 2.0.5
+      errx: 0.1.0
+      exsolve: 1.0.8
+      ignore: 7.0.5
+      jiti: 2.6.1
+      klona: 2.0.6
+      mlly: 1.8.0
+      ohash: 2.0.11
+      pathe: 2.0.3
+      pkg-types: 2.3.0
+      rc9: 3.0.0
+      scule: 1.3.0
+      semver: 7.7.4
+      tinyglobby: 0.2.15
+      ufo: 1.6.3
+      unctx: 2.5.0
+      untyped: 2.0.0
+    transitivePeerDependencies:
+      - magicast
+
+  '@nuxt/nitro-server@4.3.1(db0@0.3.4)(ioredis@5.9.3)(magicast@0.5.2)(nuxt@4.3.1(@biomejs/biome@2.4.2)(@parcel/watcher@2.5.6)(@types/node@24.10.13)(@vue/compiler-sfc@3.5.28)(cac@6.7.14)(db0@0.3.4)(eslint@9.39.2(jiti@2.6.1))(ioredis@5.9.3)(lightningcss@1.31.1)(magicast@0.5.2)(optionator@0.9.4)(rollup@4.57.1)(terser@5.46.0)(tsx@4.20.6)(typescript@5.9.3)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue-tsc@3.2.4(typescript@5.9.3))(yaml@2.8.2))(typescript@5.9.3)':
+    dependencies:
+      '@nuxt/devalue': 2.0.2
+      '@nuxt/kit': 4.3.1(magicast@0.5.2)
+      '@unhead/vue': 2.1.4(vue@3.5.28(typescript@5.9.3))
+      '@vue/shared': 3.5.28
+      consola: 3.4.2
+      defu: 6.1.4
+      destr: 2.0.5
+      devalue: 5.6.3
+      errx: 0.1.0
+      escape-string-regexp: 5.0.0
+      exsolve: 1.0.8
+      h3: 1.15.5
+      impound: 1.0.0
+      klona: 2.0.6
+      mocked-exports: 0.1.1
+      nitropack: 2.13.1
+      nuxt: 4.3.1(@biomejs/biome@2.4.2)(@parcel/watcher@2.5.6)(@types/node@24.10.13)(@vue/compiler-sfc@3.5.28)(cac@6.7.14)(db0@0.3.4)(eslint@9.39.2(jiti@2.6.1))(ioredis@5.9.3)(lightningcss@1.31.1)(magicast@0.5.2)(optionator@0.9.4)(rollup@4.57.1)(terser@5.46.0)(tsx@4.20.6)(typescript@5.9.3)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue-tsc@3.2.4(typescript@5.9.3))(yaml@2.8.2)
+      ohash: 2.0.11
+      pathe: 2.0.3
+      pkg-types: 2.3.0
+      rou3: 0.7.12
+      std-env: 3.10.0
+      ufo: 1.6.3
+      unctx: 2.5.0
+      unstorage: 1.17.4(db0@0.3.4)(ioredis@5.9.3)
+      vue: 3.5.28(typescript@5.9.3)
+      vue-bundle-renderer: 2.2.0
+      vue-devtools-stub: 0.1.0
+    transitivePeerDependencies:
+      - '@azure/app-configuration'
+      - '@azure/cosmos'
+      - '@azure/data-tables'
+      - '@azure/identity'
+      - '@azure/keyvault-secrets'
+      - '@azure/storage-blob'
+      - '@capacitor/preferences'
+      - '@deno/kv'
+      - '@electric-sql/pglite'
+      - '@libsql/client'
+      - '@netlify/blobs'
+      - '@planetscale/database'
+      - '@upstash/redis'
+      - '@vercel/blob'
+      - '@vercel/functions'
+      - '@vercel/kv'
+      - aws4fetch
+      - bare-abort-controller
+      - better-sqlite3
+      - db0
+      - drizzle-orm
+      - encoding
+      - idb-keyval
+      - ioredis
+      - magicast
+      - mysql2
+      - react-native-b4a
+      - rolldown
+      - sqlite3
+      - supports-color
+      - typescript
+      - uploadthing
+      - xml2js
+
+  '@nuxt/schema@4.3.1':
+    dependencies:
+      '@vue/shared': 3.5.28
+      defu: 6.1.4
+      pathe: 2.0.3
+      pkg-types: 2.3.0
+      std-env: 3.10.0
+
+  '@nuxt/telemetry@2.7.0(@nuxt/kit@4.3.1(magicast@0.5.2))':
+    dependencies:
+      '@nuxt/kit': 4.3.1(magicast@0.5.2)
+      citty: 0.2.1
+      consola: 3.4.2
+      ofetch: 2.0.0-alpha.3
+      rc9: 3.0.0
+      std-env: 3.10.0
+
+  '@nuxt/vite-builder@4.3.1(@biomejs/biome@2.4.2)(@types/node@24.10.13)(eslint@9.39.2(jiti@2.6.1))(lightningcss@1.31.1)(magicast@0.5.2)(nuxt@4.3.1(@biomejs/biome@2.4.2)(@parcel/watcher@2.5.6)(@types/node@24.10.13)(@vue/compiler-sfc@3.5.28)(cac@6.7.14)(db0@0.3.4)(eslint@9.39.2(jiti@2.6.1))(ioredis@5.9.3)(lightningcss@1.31.1)(magicast@0.5.2)(optionator@0.9.4)(rollup@4.57.1)(terser@5.46.0)(tsx@4.20.6)(typescript@5.9.3)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue-tsc@3.2.4(typescript@5.9.3))(yaml@2.8.2))(optionator@0.9.4)(rollup@4.57.1)(terser@5.46.0)(tsx@4.20.6)(typescript@5.9.3)(vue-tsc@3.2.4(typescript@5.9.3))(vue@3.5.28(typescript@5.9.3))(yaml@2.8.2)':
+    dependencies:
+      '@nuxt/kit': 4.3.1(magicast@0.5.2)
+      '@rollup/plugin-replace': 6.0.3(rollup@4.57.1)
+      '@vitejs/plugin-vue': 6.0.4(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue@3.5.28(typescript@5.9.3))
+      '@vitejs/plugin-vue-jsx': 5.1.4(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue@3.5.28(typescript@5.9.3))
+      autoprefixer: 10.4.24(postcss@8.5.6)
+      consola: 3.4.2
+      cssnano: 7.1.2(postcss@8.5.6)
+      defu: 6.1.4
+      esbuild: 0.27.3
+      escape-string-regexp: 5.0.0
+      exsolve: 1.0.8
+      get-port-please: 3.2.0
+      jiti: 2.6.1
+      knitwork: 1.3.0
+      magic-string: 0.30.21
+      mlly: 1.8.0
+      mocked-exports: 0.1.1
+      nuxt: 4.3.1(@biomejs/biome@2.4.2)(@parcel/watcher@2.5.6)(@types/node@24.10.13)(@vue/compiler-sfc@3.5.28)(cac@6.7.14)(db0@0.3.4)(eslint@9.39.2(jiti@2.6.1))(ioredis@5.9.3)(lightningcss@1.31.1)(magicast@0.5.2)(optionator@0.9.4)(rollup@4.57.1)(terser@5.46.0)(tsx@4.20.6)(typescript@5.9.3)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue-tsc@3.2.4(typescript@5.9.3))(yaml@2.8.2)
+      pathe: 2.0.3
+      pkg-types: 2.3.0
+      postcss: 8.5.6
+      rollup-plugin-visualizer: 6.0.5(rollup@4.57.1)
+      seroval: 1.5.0
+      std-env: 3.10.0
+      ufo: 1.6.3
+      unenv: 2.0.0-rc.24
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+      vite-node: 5.3.0(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+      vite-plugin-checker: 0.12.0(@biomejs/biome@2.4.2)(eslint@9.39.2(jiti@2.6.1))(optionator@0.9.4)(typescript@5.9.3)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue-tsc@3.2.4(typescript@5.9.3))
+      vue: 3.5.28(typescript@5.9.3)
+      vue-bundle-renderer: 2.2.0
+    transitivePeerDependencies:
+      - '@biomejs/biome'
+      - '@types/node'
+      - eslint
+      - less
+      - lightningcss
+      - magicast
+      - meow
+      - optionator
+      - oxlint
+      - rollup
+      - sass
+      - sass-embedded
+      - stylelint
+      - stylus
+      - sugarss
+      - supports-color
+      - terser
+      - tsx
+      - typescript
+      - vls
+      - vti
+      - vue-tsc
+      - yaml
+
+  '@oxc-minify/binding-android-arm-eabi@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-android-arm64@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-darwin-arm64@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-darwin-x64@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-freebsd-x64@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-linux-arm-gnueabihf@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-linux-arm-musleabihf@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-linux-arm64-gnu@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-linux-arm64-musl@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-linux-ppc64-gnu@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-linux-riscv64-gnu@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-linux-riscv64-musl@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-linux-s390x-gnu@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-linux-x64-gnu@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-linux-x64-musl@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-openharmony-arm64@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-wasm32-wasi@0.112.0':
+    dependencies:
+      '@napi-rs/wasm-runtime': 1.1.1
+    optional: true
+
+  '@oxc-minify/binding-win32-arm64-msvc@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-win32-ia32-msvc@0.112.0':
+    optional: true
+
+  '@oxc-minify/binding-win32-x64-msvc@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-android-arm-eabi@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-android-arm64@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-darwin-arm64@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-darwin-x64@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-freebsd-x64@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-linux-arm-gnueabihf@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-linux-arm-musleabihf@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-linux-arm64-gnu@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-linux-arm64-musl@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-linux-ppc64-gnu@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-linux-riscv64-gnu@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-linux-riscv64-musl@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-linux-s390x-gnu@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-linux-x64-gnu@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-linux-x64-musl@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-openharmony-arm64@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-wasm32-wasi@0.112.0':
+    dependencies:
+      '@napi-rs/wasm-runtime': 1.1.1
+    optional: true
+
+  '@oxc-parser/binding-win32-arm64-msvc@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-win32-ia32-msvc@0.112.0':
+    optional: true
+
+  '@oxc-parser/binding-win32-x64-msvc@0.112.0':
+    optional: true
+
+  '@oxc-project/types@0.112.0': {}
+
+  '@oxc-transform/binding-android-arm-eabi@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-android-arm64@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-darwin-arm64@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-darwin-x64@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-freebsd-x64@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-linux-arm-gnueabihf@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-linux-arm-musleabihf@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-linux-arm64-gnu@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-linux-arm64-musl@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-linux-ppc64-gnu@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-linux-riscv64-gnu@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-linux-riscv64-musl@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-linux-s390x-gnu@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-linux-x64-gnu@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-linux-x64-musl@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-openharmony-arm64@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-wasm32-wasi@0.112.0':
+    dependencies:
+      '@napi-rs/wasm-runtime': 1.1.1
+    optional: true
+
+  '@oxc-transform/binding-win32-arm64-msvc@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-win32-ia32-msvc@0.112.0':
+    optional: true
+
+  '@oxc-transform/binding-win32-x64-msvc@0.112.0':
+    optional: true
+
+  '@parcel/watcher-android-arm64@2.5.6':
+    optional: true
+
+  '@parcel/watcher-darwin-arm64@2.5.6':
+    optional: true
+
+  '@parcel/watcher-darwin-x64@2.5.6':
+    optional: true
+
+  '@parcel/watcher-freebsd-x64@2.5.6':
+    optional: true
+
+  '@parcel/watcher-linux-arm-glibc@2.5.6':
+    optional: true
+
+  '@parcel/watcher-linux-arm-musl@2.5.6':
+    optional: true
+
+  '@parcel/watcher-linux-arm64-glibc@2.5.6':
+    optional: true
+
+  '@parcel/watcher-linux-arm64-musl@2.5.6':
+    optional: true
+
+  '@parcel/watcher-linux-x64-glibc@2.5.6':
+    optional: true
+
+  '@parcel/watcher-linux-x64-musl@2.5.6':
+    optional: true
+
+  '@parcel/watcher-wasm@2.3.0':
+    dependencies:
+      is-glob: 4.0.3
+      micromatch: 4.0.8
+
+  '@parcel/watcher-wasm@2.5.6':
+    dependencies:
+      is-glob: 4.0.3
+      picomatch: 4.0.3
+
+  '@parcel/watcher-win32-arm64@2.5.6':
+    optional: true
+
+  '@parcel/watcher-win32-ia32@2.5.6':
+    optional: true
+
+  '@parcel/watcher-win32-x64@2.5.6':
+    optional: true
+
+  '@parcel/watcher@2.5.6':
+    dependencies:
+      detect-libc: 2.1.2
+      is-glob: 4.0.3
+      node-addon-api: 7.1.1
+      picomatch: 4.0.3
+    optionalDependencies:
+      '@parcel/watcher-android-arm64': 2.5.6
+      '@parcel/watcher-darwin-arm64': 2.5.6
+      '@parcel/watcher-darwin-x64': 2.5.6
+      '@parcel/watcher-freebsd-x64': 2.5.6
+      '@parcel/watcher-linux-arm-glibc': 2.5.6
+      '@parcel/watcher-linux-arm-musl': 2.5.6
+      '@parcel/watcher-linux-arm64-glibc': 2.5.6
+      '@parcel/watcher-linux-arm64-musl': 2.5.6
+      '@parcel/watcher-linux-x64-glibc': 2.5.6
+      '@parcel/watcher-linux-x64-musl': 2.5.6
+      '@parcel/watcher-win32-arm64': 2.5.6
+      '@parcel/watcher-win32-ia32': 2.5.6
+      '@parcel/watcher-win32-x64': 2.5.6
+
+  '@pkgjs/parseargs@0.11.0':
+    optional: true
+
+  '@playwright/test@1.58.2':
+    dependencies:
+      playwright: 1.58.2
+
+  '@polka/url@1.0.0-next.29': {}
+
+  '@poppinss/colors@4.1.6':
+    dependencies:
+      kleur: 4.1.5
+
+  '@poppinss/dumper@0.6.5':
+    dependencies:
+      '@poppinss/colors': 4.1.6
+      '@sindresorhus/is': 7.2.0
+      supports-color: 10.2.2
+
+  '@poppinss/exception@1.2.3': {}
+
+  '@rolldown/pluginutils@1.0.0-rc.2': {}
+
+  '@rolldown/pluginutils@1.0.0-rc.3': {}
+
+  '@rolldown/pluginutils@1.0.0-rc.5': {}
+
+  '@rollup/plugin-alias@6.0.0(rollup@4.57.1)':
+    optionalDependencies:
+      rollup: 4.57.1
+
+  '@rollup/plugin-commonjs@29.0.0(rollup@4.57.1)':
+    dependencies:
+      '@rollup/pluginutils': 5.3.0(rollup@4.57.1)
+      commondir: 1.0.1
+      estree-walker: 2.0.2
+      fdir: 6.5.0(picomatch@4.0.3)
+      is-reference: 1.2.1
+      magic-string: 0.30.21
+      picomatch: 4.0.3
+    optionalDependencies:
+      rollup: 4.57.1
+
+  '@rollup/plugin-inject@5.0.5(rollup@4.57.1)':
+    dependencies:
+      '@rollup/pluginutils': 5.3.0(rollup@4.57.1)
+      estree-walker: 2.0.2
+      magic-string: 0.30.21
+    optionalDependencies:
+      rollup: 4.57.1
+
+  '@rollup/plugin-json@6.1.0(rollup@4.57.1)':
+    dependencies:
+      '@rollup/pluginutils': 5.3.0(rollup@4.57.1)
+    optionalDependencies:
+      rollup: 4.57.1
+
+  '@rollup/plugin-node-resolve@16.0.3(rollup@4.57.1)':
+    dependencies:
+      '@rollup/pluginutils': 5.3.0(rollup@4.57.1)
+      '@types/resolve': 1.20.2
+      deepmerge: 4.3.1
+      is-module: 1.0.0
+      resolve: 1.22.11
+    optionalDependencies:
+      rollup: 4.57.1
+
+  '@rollup/plugin-replace@6.0.3(rollup@4.57.1)':
+    dependencies:
+      '@rollup/pluginutils': 5.3.0(rollup@4.57.1)
+      magic-string: 0.30.21
+    optionalDependencies:
+      rollup: 4.57.1
+
+  '@rollup/plugin-terser@0.4.4(rollup@4.57.1)':
+    dependencies:
+      serialize-javascript: 6.0.2
+      smob: 1.6.1
+      terser: 5.46.0
+    optionalDependencies:
+      rollup: 4.57.1
+
+  '@rollup/pluginutils@5.3.0(rollup@4.57.1)':
+    dependencies:
+      '@types/estree': 1.0.8
+      estree-walker: 2.0.2
+      picomatch: 4.0.3
+    optionalDependencies:
+      rollup: 4.57.1
+
+  '@rollup/rollup-android-arm-eabi@4.57.1':
+    optional: true
+
+  '@rollup/rollup-android-arm64@4.57.1':
+    optional: true
+
+  '@rollup/rollup-darwin-arm64@4.57.1':
+    optional: true
+
+  '@rollup/rollup-darwin-x64@4.57.1':
+    optional: true
+
+  '@rollup/rollup-freebsd-arm64@4.57.1':
+    optional: true
+
+  '@rollup/rollup-freebsd-x64@4.57.1':
+    optional: true
+
+  '@rollup/rollup-linux-arm-gnueabihf@4.57.1':
+    optional: true
+
+  '@rollup/rollup-linux-arm-musleabihf@4.57.1':
+    optional: true
+
+  '@rollup/rollup-linux-arm64-gnu@4.57.1':
+    optional: true
+
+  '@rollup/rollup-linux-arm64-musl@4.57.1':
+    optional: true
+
+  '@rollup/rollup-linux-loong64-gnu@4.57.1':
+    optional: true
+
+  '@rollup/rollup-linux-loong64-musl@4.57.1':
+    optional: true
+
+  '@rollup/rollup-linux-ppc64-gnu@4.57.1':
+    optional: true
+
+  '@rollup/rollup-linux-ppc64-musl@4.57.1':
+    optional: true
+
+  '@rollup/rollup-linux-riscv64-gnu@4.57.1':
+    optional: true
+
+  '@rollup/rollup-linux-riscv64-musl@4.57.1':
+    optional: true
+
+  '@rollup/rollup-linux-s390x-gnu@4.57.1':
+    optional: true
+
+  '@rollup/rollup-linux-x64-gnu@4.57.1':
+    optional: true
+
+  '@rollup/rollup-linux-x64-musl@4.57.1':
+    optional: true
+
+  '@rollup/rollup-openbsd-x64@4.57.1':
+    optional: true
+
+  '@rollup/rollup-openharmony-arm64@4.57.1':
+    optional: true
+
+  '@rollup/rollup-win32-arm64-msvc@4.57.1':
+    optional: true
+
+  '@rollup/rollup-win32-ia32-msvc@4.57.1':
+    optional: true
+
+  '@rollup/rollup-win32-x64-gnu@4.57.1':
+    optional: true
+
+  '@rollup/rollup-win32-x64-msvc@4.57.1':
+    optional: true
+
+  '@rtsao/scc@1.1.0': {}
+
+  '@shikijs/core@1.29.2':
+    dependencies:
+      '@shikijs/engine-javascript': 1.29.2
+      '@shikijs/engine-oniguruma': 1.29.2
+      '@shikijs/types': 1.29.2
+      '@shikijs/vscode-textmate': 10.0.2
+      '@types/hast': 3.0.4
+      hast-util-to-html: 9.0.5
+
+  '@shikijs/engine-javascript@1.29.2':
+    dependencies:
+      '@shikijs/types': 1.29.2
+      '@shikijs/vscode-textmate': 10.0.2
+      oniguruma-to-es: 2.3.0
+
+  '@shikijs/engine-oniguruma@1.29.2':
+    dependencies:
+      '@shikijs/types': 1.29.2
+      '@shikijs/vscode-textmate': 10.0.2
+
+  '@shikijs/langs@1.29.2':
+    dependencies:
+      '@shikijs/types': 1.29.2
+
+  '@shikijs/themes@1.29.2':
+    dependencies:
+      '@shikijs/types': 1.29.2
+
+  '@shikijs/types@1.29.2':
+    dependencies:
+      '@shikijs/vscode-textmate': 10.0.2
+      '@types/hast': 3.0.4
+
+  '@shikijs/vscode-textmate@10.0.2': {}
+
+  '@sindresorhus/is@7.2.0': {}
+
+  '@sindresorhus/merge-streams@4.0.0': {}
+
+  '@solidjs/router@0.15.4(solid-js@1.9.11)':
+    dependencies:
+      solid-js: 1.9.11
+
+  '@solidjs/start@1.2.1(solid-js@1.9.11)(vinxi@0.5.11(@types/node@24.10.13)(db0@0.3.4)(ioredis@5.9.3)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))':
+    dependencies:
+      '@tanstack/server-functions-plugin': 1.121.21(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      '@vinxi/plugin-directives': 0.5.1(vinxi@0.5.11(@types/node@24.10.13)(db0@0.3.4)(ioredis@5.9.3)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      '@vinxi/server-components': 0.5.1(vinxi@0.5.11(@types/node@24.10.13)(db0@0.3.4)(ioredis@5.9.3)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      cookie-es: 2.0.0
+      defu: 6.1.4
+      error-stack-parser: 2.1.4
+      html-to-image: 1.11.13
+      radix3: 1.1.2
+      seroval: 1.5.0
+      seroval-plugins: 1.5.0(seroval@1.5.0)
+      shiki: 1.29.2
+      source-map-js: 1.2.1
+      terracotta: 1.1.0(solid-js@1.9.11)
+      tinyglobby: 0.2.15
+      vinxi: 0.5.11(@types/node@24.10.13)(db0@0.3.4)(ioredis@5.9.3)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+      vite-plugin-solid: 2.11.10(solid-js@1.9.11)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+    transitivePeerDependencies:
+      - '@testing-library/jest-dom'
+      - solid-js
+      - supports-color
+      - vite
+
+  '@speed-highlight/core@1.2.14': {}
+
+  '@standard-schema/spec@1.1.0': {}
+
+  '@sveltejs/acorn-typescript@1.0.9(acorn@8.15.0)':
+    dependencies:
+      acorn: 8.15.0
+
+  '@sveltejs/adapter-auto@7.0.1(@sveltejs/kit@2.52.2(@sveltejs/vite-plugin-svelte@6.2.4(svelte@5.53.0)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)))(svelte@5.53.0)(typescript@5.9.3)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)))':
+    dependencies:
+      '@sveltejs/kit': 2.52.2(@sveltejs/vite-plugin-svelte@6.2.4(svelte@5.53.0)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)))(svelte@5.53.0)(typescript@5.9.3)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+
+  '@sveltejs/kit@2.52.2(@sveltejs/vite-plugin-svelte@6.2.4(svelte@5.53.0)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)))(svelte@5.53.0)(typescript@5.9.3)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))':
+    dependencies:
+      '@standard-schema/spec': 1.1.0
+      '@sveltejs/acorn-typescript': 1.0.9(acorn@8.15.0)
+      '@sveltejs/vite-plugin-svelte': 6.2.4(svelte@5.53.0)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      '@types/cookie': 0.6.0
+      acorn: 8.15.0
+      cookie: 0.6.0
+      devalue: 5.6.3
+      esm-env: 1.2.2
+      kleur: 4.1.5
+      magic-string: 0.30.21
+      mrmime: 2.0.1
+      set-cookie-parser: 3.0.1
+      sirv: 3.0.2
+      svelte: 5.53.0
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+    optionalDependencies:
+      typescript: 5.9.3
+
+  '@sveltejs/vite-plugin-svelte-inspector@5.0.2(@sveltejs/vite-plugin-svelte@6.2.4(svelte@5.53.0)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)))(svelte@5.53.0)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))':
+    dependencies:
+      '@sveltejs/vite-plugin-svelte': 6.2.4(svelte@5.53.0)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      obug: 2.1.1
+      svelte: 5.53.0
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+
+  '@sveltejs/vite-plugin-svelte@6.2.4(svelte@5.53.0)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))':
+    dependencies:
+      '@sveltejs/vite-plugin-svelte-inspector': 5.0.2(@sveltejs/vite-plugin-svelte@6.2.4(svelte@5.53.0)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)))(svelte@5.53.0)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      deepmerge: 4.3.1
+      magic-string: 0.30.21
+      obug: 2.1.1
+      svelte: 5.53.0
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+      vitefu: 1.1.1(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+
+  '@swc/helpers@0.5.15':
+    dependencies:
+      tslib: 2.8.1
+
+  '@tailwindcss/node@4.2.0':
+    dependencies:
+      '@jridgewell/remapping': 2.3.5
+      enhanced-resolve: 5.19.0
+      jiti: 2.6.1
+      lightningcss: 1.31.1
+      magic-string: 0.30.21
+      source-map-js: 1.2.1
+      tailwindcss: 4.2.0
+
+  '@tailwindcss/oxide-android-arm64@4.2.0':
+    optional: true
+
+  '@tailwindcss/oxide-darwin-arm64@4.2.0':
+    optional: true
+
+  '@tailwindcss/oxide-darwin-x64@4.2.0':
+    optional: true
+
+  '@tailwindcss/oxide-freebsd-x64@4.2.0':
+    optional: true
+
+  '@tailwindcss/oxide-linux-arm-gnueabihf@4.2.0':
+    optional: true
+
+  '@tailwindcss/oxide-linux-arm64-gnu@4.2.0':
+    optional: true
+
+  '@tailwindcss/oxide-linux-arm64-musl@4.2.0':
+    optional: true
+
+  '@tailwindcss/oxide-linux-x64-gnu@4.2.0':
+    optional: true
+
+  '@tailwindcss/oxide-linux-x64-musl@4.2.0':
+    optional: true
+
+  '@tailwindcss/oxide-wasm32-wasi@4.2.0':
+    optional: true
+
+  '@tailwindcss/oxide-win32-arm64-msvc@4.2.0':
+    optional: true
+
+  '@tailwindcss/oxide-win32-x64-msvc@4.2.0':
+    optional: true
+
+  '@tailwindcss/oxide@4.2.0':
+    optionalDependencies:
+      '@tailwindcss/oxide-android-arm64': 4.2.0
+      '@tailwindcss/oxide-darwin-arm64': 4.2.0
+      '@tailwindcss/oxide-darwin-x64': 4.2.0
+      '@tailwindcss/oxide-freebsd-x64': 4.2.0
+      '@tailwindcss/oxide-linux-arm-gnueabihf': 4.2.0
+      '@tailwindcss/oxide-linux-arm64-gnu': 4.2.0
+      '@tailwindcss/oxide-linux-arm64-musl': 4.2.0
+      '@tailwindcss/oxide-linux-x64-gnu': 4.2.0
+      '@tailwindcss/oxide-linux-x64-musl': 4.2.0
+      '@tailwindcss/oxide-wasm32-wasi': 4.2.0
+      '@tailwindcss/oxide-win32-arm64-msvc': 4.2.0
+      '@tailwindcss/oxide-win32-x64-msvc': 4.2.0
+
+  '@tailwindcss/postcss@4.2.0':
+    dependencies:
+      '@alloc/quick-lru': 5.2.0
+      '@tailwindcss/node': 4.2.0
+      '@tailwindcss/oxide': 4.2.0
+      postcss: 8.5.6
+      tailwindcss: 4.2.0
+
+  '@tailwindcss/vite@4.2.0(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))':
+    dependencies:
+      '@tailwindcss/node': 4.2.0
+      '@tailwindcss/oxide': 4.2.0
+      tailwindcss: 4.2.0
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+
+  '@tanstack/directive-functions-plugin@1.121.21(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))':
+    dependencies:
+      '@babel/code-frame': 7.26.2
+      '@babel/core': 7.29.0
+      '@babel/traverse': 7.29.0
+      '@babel/types': 7.29.0
+      '@tanstack/router-utils': 1.158.0
+      babel-dead-code-elimination: 1.0.12
+      tiny-invariant: 1.3.3
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+    transitivePeerDependencies:
+      - supports-color
+
+  '@tanstack/router-utils@1.158.0':
+    dependencies:
+      '@babel/core': 7.29.0
+      '@babel/generator': 7.29.1
+      '@babel/parser': 7.29.0
+      '@babel/types': 7.29.0
+      ansis: 4.2.0
+      babel-dead-code-elimination: 1.0.12
+      diff: 8.0.3
+      pathe: 2.0.3
+      tinyglobby: 0.2.15
+    transitivePeerDependencies:
+      - supports-color
+
+  '@tanstack/server-functions-plugin@1.121.21(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))':
+    dependencies:
+      '@babel/code-frame': 7.26.2
+      '@babel/core': 7.29.0
+      '@babel/plugin-syntax-jsx': 7.28.6(@babel/core@7.29.0)
+      '@babel/plugin-syntax-typescript': 7.28.6(@babel/core@7.29.0)
+      '@babel/template': 7.28.6
+      '@babel/traverse': 7.29.0
+      '@babel/types': 7.29.0
+      '@tanstack/directive-functions-plugin': 1.121.21(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      babel-dead-code-elimination: 1.0.12
+      tiny-invariant: 1.3.3
+    transitivePeerDependencies:
+      - supports-color
+      - vite
+
+  '@tsconfig/svelte@5.0.8': {}
+
+  '@tybys/wasm-util@0.10.1':
+    dependencies:
+      tslib: 2.8.1
+    optional: true
+
+  '@types/babel__core@7.20.5':
+    dependencies:
+      '@babel/parser': 7.29.0
+      '@babel/types': 7.29.0
+      '@types/babel__generator': 7.27.0
+      '@types/babel__template': 7.4.4
+      '@types/babel__traverse': 7.28.0
+
+  '@types/babel__generator@7.27.0':
+    dependencies:
+      '@babel/types': 7.29.0
+
+  '@types/babel__template@7.4.4':
+    dependencies:
+      '@babel/parser': 7.29.0
+      '@babel/types': 7.29.0
+
+  '@types/babel__traverse@7.28.0':
+    dependencies:
+      '@babel/types': 7.29.0
+
+  '@types/braces@3.0.5': {}
+
+  '@types/chai@5.2.3':
+    dependencies:
+      '@types/deep-eql': 4.0.2
+      assertion-error: 2.0.1
+
+  '@types/cookie@0.6.0': {}
+
+  '@types/deep-eql@4.0.2': {}
+
+  '@types/estree@1.0.8': {}
+
+  '@types/hast@3.0.4':
+    dependencies:
+      '@types/unist': 3.0.3
+
+  '@types/json-schema@7.0.15': {}
+
+  '@types/json5@0.0.29': {}
+
+  '@types/mdast@4.0.4':
+    dependencies:
+      '@types/unist': 3.0.3
+
+  '@types/micromatch@4.0.10':
+    dependencies:
+      '@types/braces': 3.0.5
+
+  '@types/node@12.20.55': {}
+
+  '@types/node@20.19.33':
+    dependencies:
+      undici-types: 6.21.0
+
+  '@types/node@24.10.13':
+    dependencies:
+      undici-types: 7.16.0
+
+  '@types/node@24.3.0':
+    dependencies:
+      undici-types: 7.10.0
+
+  '@types/react-dom@19.2.3(@types/react@19.2.14)':
+    dependencies:
+      '@types/react': 19.2.14
+
+  '@types/react@19.2.14':
+    dependencies:
+      csstype: 3.2.3
+
+  '@types/resolve@1.20.2': {}
+
+  '@types/trusted-types@2.0.7': {}
+
+  '@types/unist@3.0.3': {}
+
+  '@typescript-eslint/eslint-plugin@8.56.0(@typescript-eslint/parser@8.56.0(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3))(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3)':
+    dependencies:
+      '@eslint-community/regexpp': 4.12.2
+      '@typescript-eslint/parser': 8.56.0(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3)
+      '@typescript-eslint/scope-manager': 8.56.0
+      '@typescript-eslint/type-utils': 8.56.0(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3)
+      '@typescript-eslint/utils': 8.56.0(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3)
+      '@typescript-eslint/visitor-keys': 8.56.0
+      eslint: 9.39.2(jiti@2.6.1)
+      ignore: 7.0.5
+      natural-compare: 1.4.0
+      ts-api-utils: 2.4.0(typescript@5.9.3)
+      typescript: 5.9.3
+    transitivePeerDependencies:
+      - supports-color
+
+  '@typescript-eslint/parser@8.56.0(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3)':
+    dependencies:
+      '@typescript-eslint/scope-manager': 8.56.0
+      '@typescript-eslint/types': 8.56.0
+      '@typescript-eslint/typescript-estree': 8.56.0(typescript@5.9.3)
+      '@typescript-eslint/visitor-keys': 8.56.0
+      debug: 4.4.3
+      eslint: 9.39.2(jiti@2.6.1)
+      typescript: 5.9.3
+    transitivePeerDependencies:
+      - supports-color
+
+  '@typescript-eslint/project-service@8.56.0(typescript@5.9.3)':
+    dependencies:
+      '@typescript-eslint/tsconfig-utils': 8.56.0(typescript@5.9.3)
+      '@typescript-eslint/types': 8.56.0
+      debug: 4.4.3
+      typescript: 5.9.3
+    transitivePeerDependencies:
+      - supports-color
+
+  '@typescript-eslint/scope-manager@8.56.0':
+    dependencies:
+      '@typescript-eslint/types': 8.56.0
+      '@typescript-eslint/visitor-keys': 8.56.0
+
+  '@typescript-eslint/tsconfig-utils@8.56.0(typescript@5.9.3)':
+    dependencies:
+      typescript: 5.9.3
+
+  '@typescript-eslint/type-utils@8.56.0(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3)':
+    dependencies:
+      '@typescript-eslint/types': 8.56.0
+      '@typescript-eslint/typescript-estree': 8.56.0(typescript@5.9.3)
+      '@typescript-eslint/utils': 8.56.0(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3)
+      debug: 4.4.3
+      eslint: 9.39.2(jiti@2.6.1)
+      ts-api-utils: 2.4.0(typescript@5.9.3)
+      typescript: 5.9.3
+    transitivePeerDependencies:
+      - supports-color
+
+  '@typescript-eslint/types@8.56.0': {}
+
+  '@typescript-eslint/typescript-estree@8.56.0(typescript@5.9.3)':
+    dependencies:
+      '@typescript-eslint/project-service': 8.56.0(typescript@5.9.3)
+      '@typescript-eslint/tsconfig-utils': 8.56.0(typescript@5.9.3)
+      '@typescript-eslint/types': 8.56.0
+      '@typescript-eslint/visitor-keys': 8.56.0
+      debug: 4.4.3
+      minimatch: 9.0.5
+      semver: 7.7.4
+      tinyglobby: 0.2.15
+      ts-api-utils: 2.4.0(typescript@5.9.3)
+      typescript: 5.9.3
+    transitivePeerDependencies:
+      - supports-color
+
+  '@typescript-eslint/utils@8.56.0(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3)':
+    dependencies:
+      '@eslint-community/eslint-utils': 4.9.1(eslint@9.39.2(jiti@2.6.1))
+      '@typescript-eslint/scope-manager': 8.56.0
+      '@typescript-eslint/types': 8.56.0
+      '@typescript-eslint/typescript-estree': 8.56.0(typescript@5.9.3)
+      eslint: 9.39.2(jiti@2.6.1)
+      typescript: 5.9.3
+    transitivePeerDependencies:
+      - supports-color
+
+  '@typescript-eslint/visitor-keys@8.56.0':
+    dependencies:
+      '@typescript-eslint/types': 8.56.0
+      eslint-visitor-keys: 5.0.0
+
+  '@ungap/structured-clone@1.3.0': {}
+
+  '@unhead/vue@2.1.4(vue@3.5.28(typescript@5.9.3))':
+    dependencies:
+      hookable: 6.0.1
+      unhead: 2.1.4
+      vue: 3.5.28(typescript@5.9.3)
+
+  '@unrs/resolver-binding-android-arm-eabi@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-android-arm64@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-darwin-arm64@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-darwin-x64@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-freebsd-x64@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-linux-arm-gnueabihf@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-linux-arm-musleabihf@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-linux-arm64-gnu@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-linux-arm64-musl@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-linux-ppc64-gnu@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-linux-riscv64-gnu@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-linux-riscv64-musl@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-linux-s390x-gnu@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-linux-x64-gnu@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-linux-x64-musl@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-wasm32-wasi@1.11.1':
+    dependencies:
+      '@napi-rs/wasm-runtime': 0.2.12
+    optional: true
+
+  '@unrs/resolver-binding-win32-arm64-msvc@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-win32-ia32-msvc@1.11.1':
+    optional: true
+
+  '@unrs/resolver-binding-win32-x64-msvc@1.11.1':
+    optional: true
+
+  '@vercel/nft@1.3.1(rollup@4.57.1)':
+    dependencies:
+      '@mapbox/node-pre-gyp': 2.0.3
+      '@rollup/pluginutils': 5.3.0(rollup@4.57.1)
+      acorn: 8.15.0
+      acorn-import-attributes: 1.9.5(acorn@8.15.0)
+      async-sema: 3.1.1
+      bindings: 1.5.0
+      estree-walker: 2.0.2
+      glob: 13.0.5
+      graceful-fs: 4.2.11
+      node-gyp-build: 4.8.4
+      picomatch: 4.0.3
+      resolve-from: 5.0.0
+    transitivePeerDependencies:
+      - encoding
+      - rollup
+      - supports-color
+
+  '@vinxi/listhen@1.5.6':
+    dependencies:
+      '@parcel/watcher': 2.5.6
+      '@parcel/watcher-wasm': 2.3.0
+      citty: 0.1.6
+      clipboardy: 4.0.0
+      consola: 3.4.2
+      defu: 6.1.4
+      get-port-please: 3.2.0
+      h3: 1.15.5
+      http-shutdown: 1.2.2
+      jiti: 1.21.7
+      mlly: 1.8.0
+      node-forge: 1.3.3
+      pathe: 1.1.2
+      std-env: 3.10.0
+      ufo: 1.6.3
+      untun: 0.1.3
+      uqr: 0.1.2
+
+  '@vinxi/plugin-directives@0.5.1(vinxi@0.5.11(@types/node@24.10.13)(db0@0.3.4)(ioredis@5.9.3)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))':
+    dependencies:
+      '@babel/parser': 7.29.0
+      acorn: 8.15.0
+      acorn-jsx: 5.3.2(acorn@8.15.0)
+      acorn-loose: 8.5.2
+      acorn-typescript: 1.4.13(acorn@8.15.0)
+      astring: 1.9.0
+      magicast: 0.2.11
+      recast: 0.23.11
+      tslib: 2.8.1
+      vinxi: 0.5.11(@types/node@24.10.13)(db0@0.3.4)(ioredis@5.9.3)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+
+  '@vinxi/server-components@0.5.1(vinxi@0.5.11(@types/node@24.10.13)(db0@0.3.4)(ioredis@5.9.3)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))':
+    dependencies:
+      '@vinxi/plugin-directives': 0.5.1(vinxi@0.5.11(@types/node@24.10.13)(db0@0.3.4)(ioredis@5.9.3)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      acorn: 8.15.0
+      acorn-loose: 8.5.2
+      acorn-typescript: 1.4.13(acorn@8.15.0)
+      astring: 1.9.0
+      magicast: 0.2.11
+      recast: 0.23.11
+      vinxi: 0.5.11(@types/node@24.10.13)(db0@0.3.4)(ioredis@5.9.3)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+
+  '@vitejs/plugin-react@5.1.4(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))':
+    dependencies:
+      '@babel/core': 7.29.0
+      '@babel/plugin-transform-react-jsx-self': 7.27.1(@babel/core@7.29.0)
+      '@babel/plugin-transform-react-jsx-source': 7.27.1(@babel/core@7.29.0)
+      '@rolldown/pluginutils': 1.0.0-rc.3
+      '@types/babel__core': 7.20.5
+      react-refresh: 0.18.0
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+    transitivePeerDependencies:
+      - supports-color
+
+  '@vitejs/plugin-vue-jsx@5.1.4(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue@3.5.28(typescript@5.9.3))':
+    dependencies:
+      '@babel/core': 7.29.0
+      '@babel/plugin-syntax-typescript': 7.28.6(@babel/core@7.29.0)
+      '@babel/plugin-transform-typescript': 7.28.6(@babel/core@7.29.0)
+      '@rolldown/pluginutils': 1.0.0-rc.5
+      '@vue/babel-plugin-jsx': 2.0.1(@babel/core@7.29.0)
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+      vue: 3.5.28(typescript@5.9.3)
+    transitivePeerDependencies:
+      - supports-color
+
+  '@vitejs/plugin-vue@6.0.4(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue@3.5.28(typescript@5.9.3))':
+    dependencies:
+      '@rolldown/pluginutils': 1.0.0-rc.2
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+      vue: 3.5.28(typescript@5.9.3)
+
+  '@vitest/expect@4.0.18':
+    dependencies:
+      '@standard-schema/spec': 1.1.0
+      '@types/chai': 5.2.3
+      '@vitest/spy': 4.0.18
+      '@vitest/utils': 4.0.18
+      chai: 6.2.2
+      tinyrainbow: 3.0.3
+
+  '@vitest/mocker@4.0.18(vite@7.3.1(@types/node@24.3.0)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))':
+    dependencies:
+      '@vitest/spy': 4.0.18
+      estree-walker: 3.0.3
+      magic-string: 0.30.21
+    optionalDependencies:
+      vite: 7.3.1(@types/node@24.3.0)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+
+  '@vitest/pretty-format@4.0.18':
+    dependencies:
+      tinyrainbow: 3.0.3
+
+  '@vitest/runner@4.0.18':
+    dependencies:
+      '@vitest/utils': 4.0.18
+      pathe: 2.0.3
+
+  '@vitest/snapshot@4.0.18':
+    dependencies:
+      '@vitest/pretty-format': 4.0.18
+      magic-string: 0.30.21
+      pathe: 2.0.3
+
+  '@vitest/spy@4.0.18': {}
+
+  '@vitest/utils@4.0.18':
+    dependencies:
+      '@vitest/pretty-format': 4.0.18
+      tinyrainbow: 3.0.3
+
+  '@volar/language-core@2.4.27':
+    dependencies:
+      '@volar/source-map': 2.4.27
+
+  '@volar/source-map@2.4.27': {}
+
+  '@volar/typescript@2.4.27':
+    dependencies:
+      '@volar/language-core': 2.4.27
+      path-browserify: 1.0.1
+      vscode-uri: 3.1.0
+
+  '@vue-macros/common@3.1.2(vue@3.5.28(typescript@5.9.3))':
+    dependencies:
+      '@vue/compiler-sfc': 3.5.28
+      ast-kit: 2.2.0
+      local-pkg: 1.1.2
+      magic-string-ast: 1.0.3
+      unplugin-utils: 0.3.1
+    optionalDependencies:
+      vue: 3.5.28(typescript@5.9.3)
+
+  '@vue/babel-helper-vue-transform-on@2.0.1': {}
+
+  '@vue/babel-plugin-jsx@2.0.1(@babel/core@7.29.0)':
+    dependencies:
+      '@babel/helper-module-imports': 7.28.6
+      '@babel/helper-plugin-utils': 7.28.6
+      '@babel/plugin-syntax-jsx': 7.28.6(@babel/core@7.29.0)
+      '@babel/template': 7.28.6
+      '@babel/traverse': 7.29.0
+      '@babel/types': 7.29.0
+      '@vue/babel-helper-vue-transform-on': 2.0.1
+      '@vue/babel-plugin-resolve-type': 2.0.1(@babel/core@7.29.0)
+      '@vue/shared': 3.5.28
+    optionalDependencies:
+      '@babel/core': 7.29.0
+    transitivePeerDependencies:
+      - supports-color
+
+  '@vue/babel-plugin-resolve-type@2.0.1(@babel/core@7.29.0)':
+    dependencies:
+      '@babel/code-frame': 7.29.0
+      '@babel/core': 7.29.0
+      '@babel/helper-module-imports': 7.28.6
+      '@babel/helper-plugin-utils': 7.28.6
+      '@babel/parser': 7.29.0
+      '@vue/compiler-sfc': 3.5.28
+    transitivePeerDependencies:
+      - supports-color
+
+  '@vue/compiler-core@3.5.28':
+    dependencies:
+      '@babel/parser': 7.29.0
+      '@vue/shared': 3.5.28
+      entities: 7.0.1
+      estree-walker: 2.0.2
+      source-map-js: 1.2.1
+
+  '@vue/compiler-dom@3.5.28':
+    dependencies:
+      '@vue/compiler-core': 3.5.28
+      '@vue/shared': 3.5.28
+
+  '@vue/compiler-sfc@3.5.28':
+    dependencies:
+      '@babel/parser': 7.29.0
+      '@vue/compiler-core': 3.5.28
+      '@vue/compiler-dom': 3.5.28
+      '@vue/compiler-ssr': 3.5.28
+      '@vue/shared': 3.5.28
+      estree-walker: 2.0.2
+      magic-string: 0.30.21
+      postcss: 8.5.6
+      source-map-js: 1.2.1
+
+  '@vue/compiler-ssr@3.5.28':
+    dependencies:
+      '@vue/compiler-dom': 3.5.28
+      '@vue/shared': 3.5.28
+
+  '@vue/devtools-api@6.6.4': {}
+
+  '@vue/devtools-core@8.0.6(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue@3.5.28(typescript@5.9.3))':
+    dependencies:
+      '@vue/devtools-kit': 8.0.6
+      '@vue/devtools-shared': 8.0.6
+      mitt: 3.0.1
+      nanoid: 5.1.6
+      pathe: 2.0.3
+      vite-hot-client: 2.1.0(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      vue: 3.5.28(typescript@5.9.3)
+    transitivePeerDependencies:
+      - vite
+
+  '@vue/devtools-kit@8.0.6':
+    dependencies:
+      '@vue/devtools-shared': 8.0.6
+      birpc: 2.9.0
+      hookable: 5.5.3
+      mitt: 3.0.1
+      perfect-debounce: 2.1.0
+      speakingurl: 14.0.1
+      superjson: 2.2.6
+
+  '@vue/devtools-shared@8.0.6':
+    dependencies:
+      rfdc: 1.4.1
+
+  '@vue/language-core@3.2.4':
+    dependencies:
+      '@volar/language-core': 2.4.27
+      '@vue/compiler-dom': 3.5.28
+      '@vue/shared': 3.5.28
+      alien-signals: 3.1.2
+      muggle-string: 0.4.1
+      path-browserify: 1.0.1
+      picomatch: 4.0.3
+
+  '@vue/reactivity@3.5.28':
+    dependencies:
+      '@vue/shared': 3.5.28
+
+  '@vue/runtime-core@3.5.28':
+    dependencies:
+      '@vue/reactivity': 3.5.28
+      '@vue/shared': 3.5.28
+
+  '@vue/runtime-dom@3.5.28':
+    dependencies:
+      '@vue/reactivity': 3.5.28
+      '@vue/runtime-core': 3.5.28
+      '@vue/shared': 3.5.28
+      csstype: 3.2.3
+
+  '@vue/server-renderer@3.5.28(vue@3.5.28(typescript@5.9.3))':
+    dependencies:
+      '@vue/compiler-ssr': 3.5.28
+      '@vue/shared': 3.5.28
+      vue: 3.5.28(typescript@5.9.3)
+
+  '@vue/shared@3.5.28': {}
+
+  '@vue/tsconfig@0.8.1(typescript@5.9.3)(vue@3.5.28(typescript@5.9.3))':
+    optionalDependencies:
+      typescript: 5.9.3
+      vue: 3.5.28(typescript@5.9.3)
+
+  abbrev@3.0.1: {}
+
+  abort-controller@3.0.0:
+    dependencies:
+      event-target-shim: 5.0.1
+
+  acorn-import-attributes@1.9.5(acorn@8.15.0):
+    dependencies:
+      acorn: 8.15.0
+
+  acorn-jsx@5.3.2(acorn@8.15.0):
+    dependencies:
+      acorn: 8.15.0
+
+  acorn-loose@8.5.2:
+    dependencies:
+      acorn: 8.15.0
+
+  acorn-typescript@1.4.13(acorn@8.15.0):
+    dependencies:
+      acorn: 8.15.0
+
+  acorn@8.15.0: {}
+
+  agent-base@7.1.4: {}
+
+  ajv@6.12.6:
+    dependencies:
+      fast-deep-equal: 3.1.3
+      fast-json-stable-stringify: 2.1.0
+      json-schema-traverse: 0.4.1
+      uri-js: 4.4.1
+
+  alien-signals@3.1.2: {}
+
+  ansi-align@3.0.1:
+    dependencies:
+      string-width: 4.2.3
+
+  ansi-colors@4.1.3: {}
+
+  ansi-regex@5.0.1: {}
+
+  ansi-regex@6.2.2: {}
+
+  ansi-styles@4.3.0:
+    dependencies:
+      color-convert: 2.0.1
+
+  ansi-styles@6.2.3: {}
+
+  ansis@4.2.0: {}
+
+  any-promise@1.3.0: {}
+
+  anymatch@3.1.3:
+    dependencies:
+      normalize-path: 3.0.0
+      picomatch: 2.3.1
+
+  archiver-utils@5.0.2:
+    dependencies:
+      glob: 10.5.0
+      graceful-fs: 4.2.11
+      is-stream: 2.0.1
+      lazystream: 1.0.1
+      lodash: 4.17.23
+      normalize-path: 3.0.0
+      readable-stream: 4.7.0
+
+  archiver@7.0.1:
+    dependencies:
+      archiver-utils: 5.0.2
+      async: 3.2.6
+      buffer-crc32: 1.0.0
+      readable-stream: 4.7.0
+      readdir-glob: 1.1.3
+      tar-stream: 3.1.7
+      zip-stream: 6.0.1
+    transitivePeerDependencies:
+      - bare-abort-controller
+      - react-native-b4a
+
+  argparse@1.0.10:
+    dependencies:
+      sprintf-js: 1.0.3
+
+  argparse@2.0.1: {}
+
+  aria-query@5.3.2: {}
+
+  array-buffer-byte-length@1.0.2:
+    dependencies:
+      call-bound: 1.0.4
+      is-array-buffer: 3.0.5
+
+  array-includes@3.1.9:
+    dependencies:
+      call-bind: 1.0.8
+      call-bound: 1.0.4
+      define-properties: 1.2.1
+      es-abstract: 1.24.1
+      es-object-atoms: 1.1.1
+      get-intrinsic: 1.3.0
+      is-string: 1.1.1
+      math-intrinsics: 1.1.0
+
+  array-union@2.1.0: {}
+
+  array.prototype.findlast@1.2.5:
+    dependencies:
+      call-bind: 1.0.8
+      define-properties: 1.2.1
+      es-abstract: 1.24.1
+      es-errors: 1.3.0
+      es-object-atoms: 1.1.1
+      es-shim-unscopables: 1.1.0
+
+  array.prototype.findlastindex@1.2.6:
+    dependencies:
+      call-bind: 1.0.8
+      call-bound: 1.0.4
+      define-properties: 1.2.1
+      es-abstract: 1.24.1
+      es-errors: 1.3.0
+      es-object-atoms: 1.1.1
+      es-shim-unscopables: 1.1.0
+
+  array.prototype.flat@1.3.3:
+    dependencies:
+      call-bind: 1.0.8
+      define-properties: 1.2.1
+      es-abstract: 1.24.1
+      es-shim-unscopables: 1.1.0
+
+  array.prototype.flatmap@1.3.3:
+    dependencies:
+      call-bind: 1.0.8
+      define-properties: 1.2.1
+      es-abstract: 1.24.1
+      es-shim-unscopables: 1.1.0
+
+  array.prototype.tosorted@1.1.4:
+    dependencies:
+      call-bind: 1.0.8
+      define-properties: 1.2.1
+      es-abstract: 1.24.1
+      es-errors: 1.3.0
+      es-shim-unscopables: 1.1.0
+
+  arraybuffer.prototype.slice@1.0.4:
+    dependencies:
+      array-buffer-byte-length: 1.0.2
+      call-bind: 1.0.8
+      define-properties: 1.2.1
+      es-abstract: 1.24.1
+      es-errors: 1.3.0
+      get-intrinsic: 1.3.0
+      is-array-buffer: 3.0.5
+
+  assertion-error@2.0.1: {}
+
+  ast-kit@2.2.0:
+    dependencies:
+      '@babel/parser': 7.29.0
+      pathe: 2.0.3
+
+  ast-types-flow@0.0.8: {}
+
+  ast-types@0.16.1:
+    dependencies:
+      tslib: 2.8.1
+
+  ast-walker-scope@0.8.3:
+    dependencies:
+      '@babel/parser': 7.29.0
+      ast-kit: 2.2.0
+
+  astring@1.9.0: {}
+
+  async-function@1.0.0: {}
+
+  async-sema@3.1.1: {}
+
+  async@3.2.6: {}
+
+  autoprefixer@10.4.24(postcss@8.5.6):
+    dependencies:
+      browserslist: 4.28.1
+      caniuse-lite: 1.0.30001770
+      fraction.js: 5.3.4
+      picocolors: 1.1.1
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+
+  available-typed-arrays@1.0.7:
+    dependencies:
+      possible-typed-array-names: 1.1.0
+
+  axe-core@4.11.1: {}
+
+  axobject-query@4.1.0: {}
+
+  b4a@1.7.5: {}
+
+  babel-dead-code-elimination@1.0.12:
+    dependencies:
+      '@babel/core': 7.29.0
+      '@babel/parser': 7.29.0
+      '@babel/traverse': 7.29.0
+      '@babel/types': 7.29.0
+    transitivePeerDependencies:
+      - supports-color
+
+  babel-plugin-jsx-dom-expressions@0.40.5(@babel/core@7.29.0):
+    dependencies:
+      '@babel/core': 7.29.0
+      '@babel/helper-module-imports': 7.18.6
+      '@babel/plugin-syntax-jsx': 7.28.6(@babel/core@7.29.0)
+      '@babel/types': 7.29.0
+      html-entities: 2.3.3
+      parse5: 7.3.0
+
+  babel-preset-solid@1.9.10(@babel/core@7.29.0)(solid-js@1.9.11):
+    dependencies:
+      '@babel/core': 7.29.0
+      babel-plugin-jsx-dom-expressions: 0.40.5(@babel/core@7.29.0)
+    optionalDependencies:
+      solid-js: 1.9.11
+
+  balanced-match@1.0.2: {}
+
+  balanced-match@4.0.3: {}
+
+  bare-events@2.8.2: {}
+
+  base64-js@1.5.1: {}
+
+  baseline-browser-mapping@2.10.0: {}
+
+  better-path-resolve@1.0.0:
+    dependencies:
+      is-windows: 1.0.2
+
+  bindings@1.5.0:
+    dependencies:
+      file-uri-to-path: 1.0.0
+
+  birpc@2.9.0: {}
+
+  birpc@4.0.0: {}
+
+  boolbase@1.0.0: {}
+
+  boxen@8.0.1:
+    dependencies:
+      ansi-align: 3.0.1
+      camelcase: 8.0.0
+      chalk: 5.6.2
+      cli-boxes: 3.0.0
+      string-width: 7.2.0
+      type-fest: 4.41.0
+      widest-line: 5.0.0
+      wrap-ansi: 9.0.2
+
+  brace-expansion@1.1.12:
+    dependencies:
+      balanced-match: 1.0.2
+      concat-map: 0.0.1
+
+  brace-expansion@2.0.2:
+    dependencies:
+      balanced-match: 1.0.2
+
+  brace-expansion@5.0.2:
+    dependencies:
+      balanced-match: 4.0.3
+
+  braces@3.0.3:
+    dependencies:
+      fill-range: 7.1.1
+
+  browserslist@4.28.1:
+    dependencies:
+      baseline-browser-mapping: 2.10.0
+      caniuse-lite: 1.0.30001770
+      electron-to-chromium: 1.5.286
+      node-releases: 2.0.27
+      update-browserslist-db: 1.2.3(browserslist@4.28.1)
+
+  buffer-crc32@1.0.0: {}
+
+  buffer-from@1.1.2: {}
+
+  buffer@6.0.3:
+    dependencies:
+      base64-js: 1.5.1
+      ieee754: 1.2.1
+
+  bundle-name@4.1.0:
+    dependencies:
+      run-applescript: 7.1.0
+
+  bundle-require@5.1.0(esbuild@0.25.12):
+    dependencies:
+      esbuild: 0.25.12
+      load-tsconfig: 0.2.5
+
+  c12@3.3.3(magicast@0.5.2):
+    dependencies:
+      chokidar: 5.0.0
+      confbox: 0.2.4
+      defu: 6.1.4
+      dotenv: 17.3.1
+      exsolve: 1.0.8
+      giget: 2.0.0
+      jiti: 2.6.1
+      ohash: 2.0.11
+      pathe: 2.0.3
+      perfect-debounce: 2.1.0
+      pkg-types: 2.3.0
+      rc9: 2.1.2
+    optionalDependencies:
+      magicast: 0.5.2
+
+  cac@6.7.14: {}
+
+  call-bind-apply-helpers@1.0.2:
+    dependencies:
+      es-errors: 1.3.0
+      function-bind: 1.1.2
+
+  call-bind@1.0.8:
+    dependencies:
+      call-bind-apply-helpers: 1.0.2
+      es-define-property: 1.0.1
+      get-intrinsic: 1.3.0
+      set-function-length: 1.2.2
+
+  call-bound@1.0.4:
+    dependencies:
+      call-bind-apply-helpers: 1.0.2
+      get-intrinsic: 1.3.0
+
+  callsites@3.1.0: {}
+
+  camelcase@8.0.0: {}
+
+  caniuse-api@3.0.0:
+    dependencies:
+      browserslist: 4.28.1
+      caniuse-lite: 1.0.30001770
+      lodash.memoize: 4.1.2
+      lodash.uniq: 4.5.0
+
+  caniuse-lite@1.0.30001770: {}
+
+  ccount@2.0.1: {}
+
+  chai@6.2.2: {}
+
+  chalk@4.1.2:
+    dependencies:
+      ansi-styles: 4.3.0
+      supports-color: 7.2.0
+
+  chalk@5.6.2: {}
+
+  character-entities-html4@2.1.0: {}
+
+  character-entities-legacy@3.0.0: {}
+
+  chardet@2.1.1: {}
+
+  chokidar@4.0.3:
+    dependencies:
+      readdirp: 4.1.2
+
+  chokidar@5.0.0:
+    dependencies:
+      readdirp: 5.0.0
+
+  chownr@3.0.0: {}
+
+  ci-info@3.9.0: {}
+
+  citty@0.1.6:
+    dependencies:
+      consola: 3.4.2
+
+  citty@0.2.1: {}
+
+  cli-boxes@3.0.0: {}
+
+  client-only@0.0.1: {}
+
+  clipboardy@4.0.0:
+    dependencies:
+      execa: 8.0.1
+      is-wsl: 3.1.1
+      is64bit: 2.0.0
+
+  cliui@8.0.1:
+    dependencies:
+      string-width: 4.2.3
+      strip-ansi: 6.0.1
+      wrap-ansi: 7.0.0
+
+  clsx@2.1.1: {}
+
+  cluster-key-slot@1.1.2: {}
+
+  color-convert@2.0.1:
+    dependencies:
+      color-name: 1.1.4
+
+  color-name@1.1.4: {}
+
+  colord@2.9.3: {}
+
+  colorjs.io@0.5.2: {}
+
+  comma-separated-tokens@2.0.3: {}
+
+  commander@11.1.0: {}
+
+  commander@2.20.3: {}
+
+  commander@4.1.1: {}
+
+  commondir@1.0.1: {}
+
+  compatx@0.2.0: {}
+
+  compress-commons@6.0.2:
+    dependencies:
+      crc-32: 1.2.2
+      crc32-stream: 6.0.0
+      is-stream: 2.0.1
+      normalize-path: 3.0.0
+      readable-stream: 4.7.0
+
+  concat-map@0.0.1: {}
+
+  confbox@0.1.8: {}
+
+  confbox@0.2.4: {}
+
+  consola@3.4.2: {}
+
+  convert-source-map@2.0.0: {}
+
+  cookie-es@1.2.2: {}
+
+  cookie-es@2.0.0: {}
+
+  cookie@0.6.0: {}
+
+  copy-anything@4.0.5:
+    dependencies:
+      is-what: 5.5.0
+
+  copy-paste@2.2.0:
+    dependencies:
+      iconv-lite: 0.4.24
+
+  core-util-is@1.0.3: {}
+
+  crc-32@1.2.2: {}
+
+  crc32-stream@6.0.0:
+    dependencies:
+      crc-32: 1.2.2
+      readable-stream: 4.7.0
+
+  croner@9.1.0: {}
+
+  cross-spawn@7.0.6:
+    dependencies:
+      path-key: 3.1.1
+      shebang-command: 2.0.0
+      which: 2.0.2
+
+  crossws@0.3.5:
+    dependencies:
+      uncrypto: 0.1.3
+
+  css-declaration-sorter@7.3.1(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+
+  css-select@5.2.2:
+    dependencies:
+      boolbase: 1.0.0
+      css-what: 6.2.2
+      domhandler: 5.0.3
+      domutils: 3.2.2
+      nth-check: 2.1.1
+
+  css-tree@2.2.1:
+    dependencies:
+      mdn-data: 2.0.28
+      source-map-js: 1.2.1
+
+  css-tree@3.1.0:
+    dependencies:
+      mdn-data: 2.12.2
+      source-map-js: 1.2.1
+
+  css-what@6.2.2: {}
+
+  cssesc@3.0.0: {}
+
+  cssnano-preset-default@7.0.10(postcss@8.5.6):
+    dependencies:
+      browserslist: 4.28.1
+      css-declaration-sorter: 7.3.1(postcss@8.5.6)
+      cssnano-utils: 5.0.1(postcss@8.5.6)
+      postcss: 8.5.6
+      postcss-calc: 10.1.1(postcss@8.5.6)
+      postcss-colormin: 7.0.5(postcss@8.5.6)
+      postcss-convert-values: 7.0.8(postcss@8.5.6)
+      postcss-discard-comments: 7.0.5(postcss@8.5.6)
+      postcss-discard-duplicates: 7.0.2(postcss@8.5.6)
+      postcss-discard-empty: 7.0.1(postcss@8.5.6)
+      postcss-discard-overridden: 7.0.1(postcss@8.5.6)
+      postcss-merge-longhand: 7.0.5(postcss@8.5.6)
+      postcss-merge-rules: 7.0.7(postcss@8.5.6)
+      postcss-minify-font-values: 7.0.1(postcss@8.5.6)
+      postcss-minify-gradients: 7.0.1(postcss@8.5.6)
+      postcss-minify-params: 7.0.5(postcss@8.5.6)
+      postcss-minify-selectors: 7.0.5(postcss@8.5.6)
+      postcss-normalize-charset: 7.0.1(postcss@8.5.6)
+      postcss-normalize-display-values: 7.0.1(postcss@8.5.6)
+      postcss-normalize-positions: 7.0.1(postcss@8.5.6)
+      postcss-normalize-repeat-style: 7.0.1(postcss@8.5.6)
+      postcss-normalize-string: 7.0.1(postcss@8.5.6)
+      postcss-normalize-timing-functions: 7.0.1(postcss@8.5.6)
+      postcss-normalize-unicode: 7.0.5(postcss@8.5.6)
+      postcss-normalize-url: 7.0.1(postcss@8.5.6)
+      postcss-normalize-whitespace: 7.0.1(postcss@8.5.6)
+      postcss-ordered-values: 7.0.2(postcss@8.5.6)
+      postcss-reduce-initial: 7.0.5(postcss@8.5.6)
+      postcss-reduce-transforms: 7.0.1(postcss@8.5.6)
+      postcss-svgo: 7.1.0(postcss@8.5.6)
+      postcss-unique-selectors: 7.0.4(postcss@8.5.6)
+
+  cssnano-utils@5.0.1(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+
+  cssnano@7.1.2(postcss@8.5.6):
+    dependencies:
+      cssnano-preset-default: 7.0.10(postcss@8.5.6)
+      lilconfig: 3.1.3
+      postcss: 8.5.6
+
+  csso@5.0.5:
+    dependencies:
+      css-tree: 2.2.1
+
+  csstype@3.2.3: {}
+
+  damerau-levenshtein@1.0.8: {}
+
+  data-view-buffer@1.0.2:
+    dependencies:
+      call-bound: 1.0.4
+      es-errors: 1.3.0
+      is-data-view: 1.0.2
+
+  data-view-byte-length@1.0.2:
+    dependencies:
+      call-bound: 1.0.4
+      es-errors: 1.3.0
+      is-data-view: 1.0.2
+
+  data-view-byte-offset@1.0.1:
+    dependencies:
+      call-bound: 1.0.4
+      es-errors: 1.3.0
+      is-data-view: 1.0.2
+
+  dax-sh@0.43.2:
+    dependencies:
+      '@deno/shim-deno': 0.19.2
+      undici-types: 5.28.4
+
+  db0@0.3.4: {}
+
+  debug@2.6.9:
+    dependencies:
+      ms: 2.0.0
+
+  debug@3.2.7:
+    dependencies:
+      ms: 2.1.3
+
+  debug@4.4.3:
+    dependencies:
+      ms: 2.1.3
+
+  deep-is@0.1.4: {}
+
+  deepmerge@4.3.1: {}
+
+  default-browser-id@5.0.1: {}
+
+  default-browser@5.5.0:
+    dependencies:
+      bundle-name: 4.1.0
+      default-browser-id: 5.0.1
+
+  define-data-property@1.1.4:
+    dependencies:
+      es-define-property: 1.0.1
+      es-errors: 1.3.0
+      gopd: 1.2.0
+
+  define-lazy-prop@2.0.0: {}
+
+  define-lazy-prop@3.0.0: {}
+
+  define-properties@1.2.1:
+    dependencies:
+      define-data-property: 1.1.4
+      has-property-descriptors: 1.0.2
+      object-keys: 1.1.1
+
+  defu@6.1.4: {}
+
+  denque@2.1.0: {}
+
+  depd@2.0.0: {}
+
+  dequal@2.0.3: {}
+
+  destr@2.0.5: {}
+
+  destroy@1.2.0: {}
+
+  detect-indent@6.1.0: {}
+
+  detect-libc@2.1.2: {}
+
+  devalue@5.6.3: {}
+
+  devlop@1.1.0:
+    dependencies:
+      dequal: 2.0.3
+
+  diff@8.0.3: {}
+
+  dir-glob@3.0.1:
+    dependencies:
+      path-type: 4.0.0
+
+  doctrine@2.1.0:
+    dependencies:
+      esutils: 2.0.3
+
+  dom-serializer@2.0.0:
+    dependencies:
+      domelementtype: 2.3.0
+      domhandler: 5.0.3
+      entities: 4.5.0
+
+  domelementtype@2.3.0: {}
+
+  domhandler@5.0.3:
+    dependencies:
+      domelementtype: 2.3.0
+
+  domutils@3.2.2:
+    dependencies:
+      dom-serializer: 2.0.0
+      domelementtype: 2.3.0
+      domhandler: 5.0.3
+
+  dot-prop@10.1.0:
+    dependencies:
+      type-fest: 5.4.4
+
+  dotenv@17.3.1: {}
+
+  dunder-proto@1.0.1:
+    dependencies:
+      call-bind-apply-helpers: 1.0.2
+      es-errors: 1.3.0
+      gopd: 1.2.0
+
+  duplexer@0.1.2: {}
+
+  eastasianwidth@0.2.0: {}
+
+  ee-first@1.1.1: {}
+
+  electron-to-chromium@1.5.286: {}
+
+  emoji-regex-xs@1.0.0: {}
+
+  emoji-regex@10.6.0: {}
+
+  emoji-regex@8.0.0: {}
+
+  emoji-regex@9.2.2: {}
+
+  encodeurl@2.0.0: {}
+
+  enhanced-resolve@5.19.0:
+    dependencies:
+      graceful-fs: 4.2.11
+      tapable: 2.3.0
+
+  enquirer@2.4.1:
+    dependencies:
+      ansi-colors: 4.1.3
+      strip-ansi: 6.0.1
+
+  entities@4.5.0: {}
+
+  entities@6.0.1: {}
+
+  entities@7.0.1: {}
+
+  error-stack-parser-es@1.0.5: {}
+
+  error-stack-parser@2.1.4:
+    dependencies:
+      stackframe: 1.3.4
+
+  errx@0.1.0: {}
+
+  es-abstract@1.24.1:
+    dependencies:
+      array-buffer-byte-length: 1.0.2
+      arraybuffer.prototype.slice: 1.0.4
+      available-typed-arrays: 1.0.7
+      call-bind: 1.0.8
+      call-bound: 1.0.4
+      data-view-buffer: 1.0.2
+      data-view-byte-length: 1.0.2
+      data-view-byte-offset: 1.0.1
+      es-define-property: 1.0.1
+      es-errors: 1.3.0
+      es-object-atoms: 1.1.1
+      es-set-tostringtag: 2.1.0
+      es-to-primitive: 1.3.0
+      function.prototype.name: 1.1.8
+      get-intrinsic: 1.3.0
+      get-proto: 1.0.1
+      get-symbol-description: 1.1.0
+      globalthis: 1.0.4
+      gopd: 1.2.0
+      has-property-descriptors: 1.0.2
+      has-proto: 1.2.0
+      has-symbols: 1.1.0
+      hasown: 2.0.2
+      internal-slot: 1.1.0
+      is-array-buffer: 3.0.5
+      is-callable: 1.2.7
+      is-data-view: 1.0.2
+      is-negative-zero: 2.0.3
+      is-regex: 1.2.1
+      is-set: 2.0.3
+      is-shared-array-buffer: 1.0.4
+      is-string: 1.1.1
+      is-typed-array: 1.1.15
+      is-weakref: 1.1.1
+      math-intrinsics: 1.1.0
+      object-inspect: 1.13.4
+      object-keys: 1.1.1
+      object.assign: 4.1.7
+      own-keys: 1.0.1
+      regexp.prototype.flags: 1.5.4
+      safe-array-concat: 1.1.3
+      safe-push-apply: 1.0.0
+      safe-regex-test: 1.1.0
+      set-proto: 1.0.0
+      stop-iteration-iterator: 1.1.0
+      string.prototype.trim: 1.2.10
+      string.prototype.trimend: 1.0.9
+      string.prototype.trimstart: 1.0.8
+      typed-array-buffer: 1.0.3
+      typed-array-byte-length: 1.0.3
+      typed-array-byte-offset: 1.0.4
+      typed-array-length: 1.0.7
+      unbox-primitive: 1.1.0
+      which-typed-array: 1.1.20
+
+  es-define-property@1.0.1: {}
+
+  es-errors@1.3.0: {}
+
+  es-iterator-helpers@1.2.2:
+    dependencies:
+      call-bind: 1.0.8
+      call-bound: 1.0.4
+      define-properties: 1.2.1
+      es-abstract: 1.24.1
+      es-errors: 1.3.0
+      es-set-tostringtag: 2.1.0
+      function-bind: 1.1.2
+      get-intrinsic: 1.3.0
+      globalthis: 1.0.4
+      gopd: 1.2.0
+      has-property-descriptors: 1.0.2
+      has-proto: 1.2.0
+      has-symbols: 1.1.0
+      internal-slot: 1.1.0
+      iterator.prototype: 1.1.5
+      safe-array-concat: 1.1.3
+
+  es-module-lexer@1.7.0: {}
+
+  es-module-lexer@2.0.0: {}
+
+  es-object-atoms@1.1.1:
+    dependencies:
+      es-errors: 1.3.0
+
+  es-set-tostringtag@2.1.0:
+    dependencies:
+      es-errors: 1.3.0
+      get-intrinsic: 1.3.0
+      has-tostringtag: 1.0.2
+      hasown: 2.0.2
+
+  es-shim-unscopables@1.1.0:
+    dependencies:
+      hasown: 2.0.2
+
+  es-to-primitive@1.3.0:
+    dependencies:
+      is-callable: 1.2.7
+      is-date-object: 1.1.0
+      is-symbol: 1.1.1
+
+  esbuild@0.25.12:
+    optionalDependencies:
+      '@esbuild/aix-ppc64': 0.25.12
+      '@esbuild/android-arm': 0.25.12
+      '@esbuild/android-arm64': 0.25.12
+      '@esbuild/android-x64': 0.25.12
+      '@esbuild/darwin-arm64': 0.25.12
+      '@esbuild/darwin-x64': 0.25.12
+      '@esbuild/freebsd-arm64': 0.25.12
+      '@esbuild/freebsd-x64': 0.25.12
+      '@esbuild/linux-arm': 0.25.12
+      '@esbuild/linux-arm64': 0.25.12
+      '@esbuild/linux-ia32': 0.25.12
+      '@esbuild/linux-loong64': 0.25.12
+      '@esbuild/linux-mips64el': 0.25.12
+      '@esbuild/linux-ppc64': 0.25.12
+      '@esbuild/linux-riscv64': 0.25.12
+      '@esbuild/linux-s390x': 0.25.12
+      '@esbuild/linux-x64': 0.25.12
+      '@esbuild/netbsd-arm64': 0.25.12
+      '@esbuild/netbsd-x64': 0.25.12
+      '@esbuild/openbsd-arm64': 0.25.12
+      '@esbuild/openbsd-x64': 0.25.12
+      '@esbuild/openharmony-arm64': 0.25.12
+      '@esbuild/sunos-x64': 0.25.12
+      '@esbuild/win32-arm64': 0.25.12
+      '@esbuild/win32-ia32': 0.25.12
+      '@esbuild/win32-x64': 0.25.12
+
+  esbuild@0.27.3:
+    optionalDependencies:
+      '@esbuild/aix-ppc64': 0.27.3
+      '@esbuild/android-arm': 0.27.3
+      '@esbuild/android-arm64': 0.27.3
+      '@esbuild/android-x64': 0.27.3
+      '@esbuild/darwin-arm64': 0.27.3
+      '@esbuild/darwin-x64': 0.27.3
+      '@esbuild/freebsd-arm64': 0.27.3
+      '@esbuild/freebsd-x64': 0.27.3
+      '@esbuild/linux-arm': 0.27.3
+      '@esbuild/linux-arm64': 0.27.3
+      '@esbuild/linux-ia32': 0.27.3
+      '@esbuild/linux-loong64': 0.27.3
+      '@esbuild/linux-mips64el': 0.27.3
+      '@esbuild/linux-ppc64': 0.27.3
+      '@esbuild/linux-riscv64': 0.27.3
+      '@esbuild/linux-s390x': 0.27.3
+      '@esbuild/linux-x64': 0.27.3
+      '@esbuild/netbsd-arm64': 0.27.3
+      '@esbuild/netbsd-x64': 0.27.3
+      '@esbuild/openbsd-arm64': 0.27.3
+      '@esbuild/openbsd-x64': 0.27.3
+      '@esbuild/openharmony-arm64': 0.27.3
+      '@esbuild/sunos-x64': 0.27.3
+      '@esbuild/win32-arm64': 0.27.3
+      '@esbuild/win32-ia32': 0.27.3
+      '@esbuild/win32-x64': 0.27.3
+
+  escalade@3.2.0: {}
+
+  escape-html@1.0.3: {}
+
+  escape-string-regexp@4.0.0: {}
+
+  escape-string-regexp@5.0.0: {}
+
+  eslint-config-next@16.1.6(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3):
+    dependencies:
+      '@next/eslint-plugin-next': 16.1.6
+      eslint: 9.39.2(jiti@2.6.1)
+      eslint-import-resolver-node: 0.3.9
+      eslint-import-resolver-typescript: 3.10.1(eslint-plugin-import@2.32.0)(eslint@9.39.2(jiti@2.6.1))
+      eslint-plugin-import: 2.32.0(eslint-import-resolver-typescript@3.10.1)(eslint@9.39.2(jiti@2.6.1))
+      eslint-plugin-jsx-a11y: 6.10.2(eslint@9.39.2(jiti@2.6.1))
+      eslint-plugin-react: 7.37.5(eslint@9.39.2(jiti@2.6.1))
+      eslint-plugin-react-hooks: 7.0.1(eslint@9.39.2(jiti@2.6.1))
+      globals: 16.4.0
+      typescript-eslint: 8.56.0(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3)
+    optionalDependencies:
+      typescript: 5.9.3
+    transitivePeerDependencies:
+      - '@typescript-eslint/parser'
+      - eslint-import-resolver-webpack
+      - eslint-plugin-import-x
+      - supports-color
+
+  eslint-import-resolver-node@0.3.9:
+    dependencies:
+      debug: 3.2.7
+      is-core-module: 2.16.1
+      resolve: 1.22.11
+    transitivePeerDependencies:
+      - supports-color
+
+  eslint-import-resolver-typescript@3.10.1(eslint-plugin-import@2.32.0)(eslint@9.39.2(jiti@2.6.1)):
+    dependencies:
+      '@nolyfill/is-core-module': 1.0.39
+      debug: 4.4.3
+      eslint: 9.39.2(jiti@2.6.1)
+      get-tsconfig: 4.13.6
+      is-bun-module: 2.0.0
+      stable-hash: 0.0.5
+      tinyglobby: 0.2.15
+      unrs-resolver: 1.11.1
+    optionalDependencies:
+      eslint-plugin-import: 2.32.0(eslint-import-resolver-typescript@3.10.1)(eslint@9.39.2(jiti@2.6.1))
+    transitivePeerDependencies:
+      - supports-color
+
+  eslint-module-utils@2.12.1(eslint-import-resolver-node@0.3.9)(eslint-import-resolver-typescript@3.10.1)(eslint@9.39.2(jiti@2.6.1)):
+    dependencies:
+      debug: 3.2.7
+    optionalDependencies:
+      eslint: 9.39.2(jiti@2.6.1)
+      eslint-import-resolver-node: 0.3.9
+      eslint-import-resolver-typescript: 3.10.1(eslint-plugin-import@2.32.0)(eslint@9.39.2(jiti@2.6.1))
+    transitivePeerDependencies:
+      - supports-color
+
+  eslint-plugin-import@2.32.0(eslint-import-resolver-typescript@3.10.1)(eslint@9.39.2(jiti@2.6.1)):
+    dependencies:
+      '@rtsao/scc': 1.1.0
+      array-includes: 3.1.9
+      array.prototype.findlastindex: 1.2.6
+      array.prototype.flat: 1.3.3
+      array.prototype.flatmap: 1.3.3
+      debug: 3.2.7
+      doctrine: 2.1.0
+      eslint: 9.39.2(jiti@2.6.1)
+      eslint-import-resolver-node: 0.3.9
+      eslint-module-utils: 2.12.1(eslint-import-resolver-node@0.3.9)(eslint-import-resolver-typescript@3.10.1)(eslint@9.39.2(jiti@2.6.1))
+      hasown: 2.0.2
+      is-core-module: 2.16.1
+      is-glob: 4.0.3
+      minimatch: 3.1.2
+      object.fromentries: 2.0.8
+      object.groupby: 1.0.3
+      object.values: 1.2.1
+      semver: 6.3.1
+      string.prototype.trimend: 1.0.9
+      tsconfig-paths: 3.15.0
+    transitivePeerDependencies:
+      - eslint-import-resolver-typescript
+      - eslint-import-resolver-webpack
+      - supports-color
+
+  eslint-plugin-jsx-a11y@6.10.2(eslint@9.39.2(jiti@2.6.1)):
+    dependencies:
+      aria-query: 5.3.2
+      array-includes: 3.1.9
+      array.prototype.flatmap: 1.3.3
+      ast-types-flow: 0.0.8
+      axe-core: 4.11.1
+      axobject-query: 4.1.0
+      damerau-levenshtein: 1.0.8
+      emoji-regex: 9.2.2
+      eslint: 9.39.2(jiti@2.6.1)
+      hasown: 2.0.2
+      jsx-ast-utils: 3.3.5
+      language-tags: 1.0.9
+      minimatch: 3.1.2
+      object.fromentries: 2.0.8
+      safe-regex-test: 1.1.0
+      string.prototype.includes: 2.0.1
+
+  eslint-plugin-react-hooks@7.0.1(eslint@9.39.2(jiti@2.6.1)):
+    dependencies:
+      '@babel/core': 7.29.0
+      '@babel/parser': 7.29.0
+      eslint: 9.39.2(jiti@2.6.1)
+      hermes-parser: 0.25.1
+      zod: 4.3.6
+      zod-validation-error: 4.0.2(zod@4.3.6)
+    transitivePeerDependencies:
+      - supports-color
+
+  eslint-plugin-react-refresh@0.4.26(eslint@9.39.2(jiti@2.6.1)):
+    dependencies:
+      eslint: 9.39.2(jiti@2.6.1)
+
+  eslint-plugin-react@7.37.5(eslint@9.39.2(jiti@2.6.1)):
+    dependencies:
+      array-includes: 3.1.9
+      array.prototype.findlast: 1.2.5
+      array.prototype.flatmap: 1.3.3
+      array.prototype.tosorted: 1.1.4
+      doctrine: 2.1.0
+      es-iterator-helpers: 1.2.2
+      eslint: 9.39.2(jiti@2.6.1)
+      estraverse: 5.3.0
+      hasown: 2.0.2
+      jsx-ast-utils: 3.3.5
+      minimatch: 3.1.2
+      object.entries: 1.1.9
+      object.fromentries: 2.0.8
+      object.values: 1.2.1
+      prop-types: 15.8.1
+      resolve: 2.0.0-next.6
+      semver: 6.3.1
+      string.prototype.matchall: 4.0.12
+      string.prototype.repeat: 1.0.0
+
+  eslint-scope@8.4.0:
+    dependencies:
+      esrecurse: 4.3.0
+      estraverse: 5.3.0
+
+  eslint-visitor-keys@3.4.3: {}
+
+  eslint-visitor-keys@4.2.1: {}
+
+  eslint-visitor-keys@5.0.0: {}
+
+  eslint@9.39.2(jiti@2.6.1):
+    dependencies:
+      '@eslint-community/eslint-utils': 4.9.1(eslint@9.39.2(jiti@2.6.1))
+      '@eslint-community/regexpp': 4.12.2
+      '@eslint/config-array': 0.21.1
+      '@eslint/config-helpers': 0.4.2
+      '@eslint/core': 0.17.0
+      '@eslint/eslintrc': 3.3.3
+      '@eslint/js': 9.39.2
+      '@eslint/plugin-kit': 0.4.1
+      '@humanfs/node': 0.16.7
+      '@humanwhocodes/module-importer': 1.0.1
+      '@humanwhocodes/retry': 0.4.3
+      '@types/estree': 1.0.8
+      ajv: 6.12.6
+      chalk: 4.1.2
+      cross-spawn: 7.0.6
+      debug: 4.4.3
+      escape-string-regexp: 4.0.0
+      eslint-scope: 8.4.0
+      eslint-visitor-keys: 4.2.1
+      espree: 10.4.0
+      esquery: 1.7.0
+      esutils: 2.0.3
+      fast-deep-equal: 3.1.3
+      file-entry-cache: 8.0.0
+      find-up: 5.0.0
+      glob-parent: 6.0.2
+      ignore: 5.3.2
+      imurmurhash: 0.1.4
+      is-glob: 4.0.3
+      json-stable-stringify-without-jsonify: 1.0.1
+      lodash.merge: 4.6.2
+      minimatch: 3.1.2
+      natural-compare: 1.4.0
+      optionator: 0.9.4
+    optionalDependencies:
+      jiti: 2.6.1
+    transitivePeerDependencies:
+      - supports-color
+
+  esm-env@1.2.2: {}
+
+  espree@10.4.0:
+    dependencies:
+      acorn: 8.15.0
+      acorn-jsx: 5.3.2(acorn@8.15.0)
+      eslint-visitor-keys: 4.2.1
+
+  esprima@4.0.1: {}
+
+  esquery@1.7.0:
+    dependencies:
+      estraverse: 5.3.0
+
+  esrap@2.2.3:
+    dependencies:
+      '@jridgewell/sourcemap-codec': 1.5.5
+
+  esrecurse@4.3.0:
+    dependencies:
+      estraverse: 5.3.0
+
+  estraverse@5.3.0: {}
+
+  estree-walker@2.0.2: {}
+
+  estree-walker@3.0.3:
+    dependencies:
+      '@types/estree': 1.0.8
+
+  esutils@2.0.3: {}
+
+  etag@1.8.1: {}
+
+  event-target-shim@5.0.1: {}
+
+  eventemitter3@4.0.7: {}
+
+  events-universal@1.0.1:
+    dependencies:
+      bare-events: 2.8.2
+    transitivePeerDependencies:
+      - bare-abort-controller
+
+  events@3.3.0: {}
+
+  execa@8.0.1:
+    dependencies:
+      cross-spawn: 7.0.6
+      get-stream: 8.0.1
+      human-signals: 5.0.0
+      is-stream: 3.0.0
+      merge-stream: 2.0.0
+      npm-run-path: 5.3.0
+      onetime: 6.0.0
+      signal-exit: 4.1.0
+      strip-final-newline: 3.0.0
+
+  expect-type@1.3.0: {}
+
+  exsolve@1.0.8: {}
+
+  extendable-error@0.1.7: {}
+
+  fast-deep-equal@3.1.3: {}
+
+  fast-fifo@1.3.2: {}
+
+  fast-glob@3.3.1:
+    dependencies:
+      '@nodelib/fs.stat': 2.0.5
+      '@nodelib/fs.walk': 1.2.8
+      glob-parent: 5.1.2
+      merge2: 1.4.1
+      micromatch: 4.0.8
+
+  fast-glob@3.3.3:
+    dependencies:
+      '@nodelib/fs.stat': 2.0.5
+      '@nodelib/fs.walk': 1.2.8
+      glob-parent: 5.1.2
+      merge2: 1.4.1
+      micromatch: 4.0.8
+
+  fast-json-stable-stringify@2.1.0: {}
+
+  fast-levenshtein@2.0.6: {}
+
+  fast-npm-meta@1.2.1: {}
+
+  fastq@1.20.1:
+    dependencies:
+      reusify: 1.1.0
+
+  fdir@6.5.0(picomatch@4.0.3):
+    optionalDependencies:
+      picomatch: 4.0.3
+
+  file-entry-cache@8.0.0:
+    dependencies:
+      flat-cache: 4.0.1
+
+  file-uri-to-path@1.0.0: {}
+
+  fill-range@7.1.1:
+    dependencies:
+      to-regex-range: 5.0.1
+
+  find-up@4.1.0:
+    dependencies:
+      locate-path: 5.0.0
+      path-exists: 4.0.0
+
+  find-up@5.0.0:
+    dependencies:
+      locate-path: 6.0.0
+      path-exists: 4.0.0
+
+  fix-dts-default-cjs-exports@1.0.1:
+    dependencies:
+      magic-string: 0.30.21
+      mlly: 1.8.0
+      rollup: 4.57.1
+
+  flat-cache@4.0.1:
+    dependencies:
+      flatted: 3.3.3
+      keyv: 4.5.4
+
+  flatted@3.3.3: {}
+
+  follow-redirects@1.15.11: {}
+
+  for-each@0.3.5:
+    dependencies:
+      is-callable: 1.2.7
+
+  foreground-child@3.3.1:
+    dependencies:
+      cross-spawn: 7.0.6
+      signal-exit: 4.1.0
+
+  fraction.js@5.3.4: {}
+
+  fresh@0.5.2: {}
+
+  fresh@2.0.0: {}
+
+  fs-extra@7.0.1:
+    dependencies:
+      graceful-fs: 4.2.11
+      jsonfile: 4.0.0
+      universalify: 0.1.2
+
+  fs-extra@8.1.0:
+    dependencies:
+      graceful-fs: 4.2.11
+      jsonfile: 4.0.0
+      universalify: 0.1.2
+
+  fsevents@2.3.2:
+    optional: true
+
+  fsevents@2.3.3:
+    optional: true
+
+  function-bind@1.1.2: {}
+
+  function.prototype.name@1.1.8:
+    dependencies:
+      call-bind: 1.0.8
+      call-bound: 1.0.4
+      define-properties: 1.2.1
+      functions-have-names: 1.2.3
+      hasown: 2.0.2
+      is-callable: 1.2.7
+
+  functions-have-names@1.2.3: {}
+
+  fuse.js@7.1.0: {}
+
+  fzf@0.5.2: {}
+
+  generator-function@2.0.1: {}
+
+  gensync@1.0.0-beta.2: {}
+
+  get-caller-file@2.0.5: {}
+
+  get-east-asian-width@1.5.0: {}
+
+  get-intrinsic@1.3.0:
+    dependencies:
+      call-bind-apply-helpers: 1.0.2
+      es-define-property: 1.0.1
+      es-errors: 1.3.0
+      es-object-atoms: 1.1.1
+      function-bind: 1.1.2
+      get-proto: 1.0.1
+      gopd: 1.2.0
+      has-symbols: 1.1.0
+      hasown: 2.0.2
+      math-intrinsics: 1.1.0
+
+  get-port-please@3.2.0: {}
+
+  get-proto@1.0.1:
+    dependencies:
+      dunder-proto: 1.0.1
+      es-object-atoms: 1.1.1
+
+  get-stream@8.0.1: {}
+
+  get-symbol-description@1.1.0:
+    dependencies:
+      call-bound: 1.0.4
+      es-errors: 1.3.0
+      get-intrinsic: 1.3.0
+
+  get-tsconfig@4.13.6:
+    dependencies:
+      resolve-pkg-maps: 1.0.0
+
+  giget@2.0.0:
+    dependencies:
+      citty: 0.1.6
+      consola: 3.4.2
+      defu: 6.1.4
+      node-fetch-native: 1.6.7
+      nypm: 0.6.5
+      pathe: 2.0.3
+
+  giget@3.1.2: {}
+
+  glob-parent@5.1.2:
+    dependencies:
+      is-glob: 4.0.3
+
+  glob-parent@6.0.2:
+    dependencies:
+      is-glob: 4.0.3
+
+  glob@10.5.0:
+    dependencies:
+      foreground-child: 3.3.1
+      jackspeak: 3.4.3
+      minimatch: 9.0.5
+      minipass: 7.1.3
+      package-json-from-dist: 1.0.1
+      path-scurry: 1.11.1
+
+  glob@13.0.5:
+    dependencies:
+      minimatch: 10.2.1
+      minipass: 7.1.3
+      path-scurry: 2.0.1
+
+  global-directory@4.0.1:
+    dependencies:
+      ini: 4.1.1
+
+  globals@14.0.0: {}
+
+  globals@16.4.0: {}
+
+  globals@16.5.0: {}
+
+  globalthis@1.0.4:
+    dependencies:
+      define-properties: 1.2.1
+      gopd: 1.2.0
+
+  globby@11.1.0:
+    dependencies:
+      array-union: 2.1.0
+      dir-glob: 3.0.1
+      fast-glob: 3.3.3
+      ignore: 5.3.2
+      merge2: 1.4.1
+      slash: 3.0.0
+
+  globby@16.1.1:
+    dependencies:
+      '@sindresorhus/merge-streams': 4.0.0
+      fast-glob: 3.3.3
+      ignore: 7.0.5
+      is-path-inside: 4.0.0
+      slash: 5.1.0
+      unicorn-magic: 0.4.0
+
+  gopd@1.2.0: {}
+
+  graceful-fs@4.2.11: {}
+
+  gzip-size@7.0.0:
+    dependencies:
+      duplexer: 0.1.2
+
+  h3@1.15.3:
+    dependencies:
+      cookie-es: 1.2.2
+      crossws: 0.3.5
+      defu: 6.1.4
+      destr: 2.0.5
+      iron-webcrypto: 1.2.1
+      node-mock-http: 1.0.4
+      radix3: 1.1.2
+      ufo: 1.6.3
+      uncrypto: 0.1.3
+
+  h3@1.15.5:
+    dependencies:
+      cookie-es: 1.2.2
+      crossws: 0.3.5
+      defu: 6.1.4
+      destr: 2.0.5
+      iron-webcrypto: 1.2.1
+      node-mock-http: 1.0.4
+      radix3: 1.1.2
+      ufo: 1.6.3
+      uncrypto: 0.1.3
+
+  has-bigints@1.1.0: {}
+
+  has-flag@4.0.0: {}
+
+  has-property-descriptors@1.0.2:
+    dependencies:
+      es-define-property: 1.0.1
+
+  has-proto@1.2.0:
+    dependencies:
+      dunder-proto: 1.0.1
+
+  has-symbols@1.1.0: {}
+
+  has-tostringtag@1.0.2:
+    dependencies:
+      has-symbols: 1.1.0
+
+  hasown@2.0.2:
+    dependencies:
+      function-bind: 1.1.2
+
+  hast-util-to-html@9.0.5:
+    dependencies:
+      '@types/hast': 3.0.4
+      '@types/unist': 3.0.3
+      ccount: 2.0.1
+      comma-separated-tokens: 2.0.3
+      hast-util-whitespace: 3.0.0
+      html-void-elements: 3.0.0
+      mdast-util-to-hast: 13.2.1
+      property-information: 7.1.0
+      space-separated-tokens: 2.0.2
+      stringify-entities: 4.0.4
+      zwitch: 2.0.4
+
+  hast-util-whitespace@3.0.0:
+    dependencies:
+      '@types/hast': 3.0.4
+
+  hermes-estree@0.25.1: {}
+
+  hermes-parser@0.25.1:
+    dependencies:
+      hermes-estree: 0.25.1
+
+  hookable@5.5.3: {}
+
+  hookable@6.0.1: {}
+
+  html-entities@2.3.3: {}
+
+  html-to-image@1.11.13: {}
+
+  html-void-elements@3.0.0: {}
+
+  http-errors@2.0.1:
+    dependencies:
+      depd: 2.0.0
+      inherits: 2.0.4
+      setprototypeof: 1.2.0
+      statuses: 2.0.2
+      toidentifier: 1.0.1
+
+  http-proxy@1.18.1:
+    dependencies:
+      eventemitter3: 4.0.7
+      follow-redirects: 1.15.11
+      requires-port: 1.0.0
+    transitivePeerDependencies:
+      - debug
+
+  http-shutdown@1.2.2: {}
+
+  https-proxy-agent@7.0.6:
+    dependencies:
+      agent-base: 7.1.4
+      debug: 4.4.3
+    transitivePeerDependencies:
+      - supports-color
+
+  httpxy@0.1.7: {}
+
+  human-id@4.1.3: {}
+
+  human-signals@5.0.0: {}
+
+  iconv-lite@0.4.24:
+    dependencies:
+      safer-buffer: 2.1.2
+
+  iconv-lite@0.7.2:
+    dependencies:
+      safer-buffer: 2.1.2
+
+  ieee754@1.2.1: {}
+
+  ignore@5.3.2: {}
+
+  ignore@7.0.5: {}
+
+  image-meta@0.2.2: {}
+
+  import-fresh@3.3.1:
+    dependencies:
+      parent-module: 1.0.1
+      resolve-from: 4.0.0
+
+  impound@1.0.0:
+    dependencies:
+      exsolve: 1.0.8
+      mocked-exports: 0.1.1
+      pathe: 2.0.3
+      unplugin: 2.3.11
+      unplugin-utils: 0.2.5
+
+  imurmurhash@0.1.4: {}
+
+  inherits@2.0.4: {}
+
+  ini@4.1.1: {}
+
+  internal-slot@1.1.0:
+    dependencies:
+      es-errors: 1.3.0
+      hasown: 2.0.2
+      side-channel: 1.1.0
+
+  ioredis@5.9.3:
+    dependencies:
+      '@ioredis/commands': 1.5.0
+      cluster-key-slot: 1.1.2
+      debug: 4.4.3
+      denque: 2.1.0
+      lodash.defaults: 4.2.0
+      lodash.isarguments: 3.1.0
+      redis-errors: 1.2.0
+      redis-parser: 3.0.0
+      standard-as-callback: 2.1.0
+    transitivePeerDependencies:
+      - supports-color
+
+  iron-webcrypto@1.2.1: {}
+
+  is-array-buffer@3.0.5:
+    dependencies:
+      call-bind: 1.0.8
+      call-bound: 1.0.4
+      get-intrinsic: 1.3.0
+
+  is-async-function@2.1.1:
+    dependencies:
+      async-function: 1.0.0
+      call-bound: 1.0.4
+      get-proto: 1.0.1
+      has-tostringtag: 1.0.2
+      safe-regex-test: 1.1.0
+
+  is-bigint@1.1.0:
+    dependencies:
+      has-bigints: 1.1.0
+
+  is-boolean-object@1.2.2:
+    dependencies:
+      call-bound: 1.0.4
+      has-tostringtag: 1.0.2
+
+  is-bun-module@2.0.0:
+    dependencies:
+      semver: 7.7.4
+
+  is-callable@1.2.7: {}
+
+  is-core-module@2.16.1:
+    dependencies:
+      hasown: 2.0.2
+
+  is-data-view@1.0.2:
+    dependencies:
+      call-bound: 1.0.4
+      get-intrinsic: 1.3.0
+      is-typed-array: 1.1.15
+
+  is-date-object@1.1.0:
+    dependencies:
+      call-bound: 1.0.4
+      has-tostringtag: 1.0.2
+
+  is-docker@2.2.1: {}
+
+  is-docker@3.0.0: {}
+
+  is-extglob@2.1.1: {}
+
+  is-finalizationregistry@1.1.1:
+    dependencies:
+      call-bound: 1.0.4
+
+  is-fullwidth-code-point@3.0.0: {}
+
+  is-generator-function@1.1.2:
+    dependencies:
+      call-bound: 1.0.4
+      generator-function: 2.0.1
+      get-proto: 1.0.1
+      has-tostringtag: 1.0.2
+      safe-regex-test: 1.1.0
+
+  is-glob@4.0.3:
+    dependencies:
+      is-extglob: 2.1.1
+
+  is-inside-container@1.0.0:
+    dependencies:
+      is-docker: 3.0.0
+
+  is-installed-globally@1.0.0:
+    dependencies:
+      global-directory: 4.0.1
+      is-path-inside: 4.0.0
+
+  is-map@2.0.3: {}
+
+  is-module@1.0.0: {}
+
+  is-negative-zero@2.0.3: {}
+
+  is-number-object@1.1.1:
+    dependencies:
+      call-bound: 1.0.4
+      has-tostringtag: 1.0.2
+
+  is-number@7.0.0: {}
+
+  is-path-inside@4.0.0: {}
+
+  is-reference@1.2.1:
+    dependencies:
+      '@types/estree': 1.0.8
+
+  is-reference@3.0.3:
+    dependencies:
+      '@types/estree': 1.0.8
+
+  is-regex@1.2.1:
+    dependencies:
+      call-bound: 1.0.4
+      gopd: 1.2.0
+      has-tostringtag: 1.0.2
+      hasown: 2.0.2
+
+  is-set@2.0.3: {}
+
+  is-shared-array-buffer@1.0.4:
+    dependencies:
+      call-bound: 1.0.4
+
+  is-stream@2.0.1: {}
+
+  is-stream@3.0.0: {}
+
+  is-string@1.1.1:
+    dependencies:
+      call-bound: 1.0.4
+      has-tostringtag: 1.0.2
+
+  is-subdir@1.2.0:
+    dependencies:
+      better-path-resolve: 1.0.0
+
+  is-symbol@1.1.1:
+    dependencies:
+      call-bound: 1.0.4
+      has-symbols: 1.1.0
+      safe-regex-test: 1.1.0
+
+  is-typed-array@1.1.15:
+    dependencies:
+      which-typed-array: 1.1.20
+
+  is-weakmap@2.0.2: {}
+
+  is-weakref@1.1.1:
+    dependencies:
+      call-bound: 1.0.4
+
+  is-weakset@2.0.4:
+    dependencies:
+      call-bound: 1.0.4
+      get-intrinsic: 1.3.0
+
+  is-what@4.1.16: {}
+
+  is-what@5.5.0: {}
+
+  is-windows@1.0.2: {}
+
+  is-wsl@2.2.0:
+    dependencies:
+      is-docker: 2.2.1
+
+  is-wsl@3.1.1:
+    dependencies:
+      is-inside-container: 1.0.0
+
+  is64bit@2.0.0:
+    dependencies:
+      system-architecture: 0.1.0
+
+  isarray@1.0.0: {}
+
+  isarray@2.0.5: {}
+
+  isexe@2.0.0: {}
+
+  isexe@3.1.5: {}
+
+  iterator.prototype@1.1.5:
+    dependencies:
+      define-data-property: 1.1.4
+      es-object-atoms: 1.1.1
+      get-intrinsic: 1.3.0
+      get-proto: 1.0.1
+      has-symbols: 1.1.0
+      set-function-name: 2.0.2
+
+  jackspeak@3.4.3:
+    dependencies:
+      '@isaacs/cliui': 8.0.2
+    optionalDependencies:
+      '@pkgjs/parseargs': 0.11.0
+
+  jiti@1.21.7: {}
+
+  jiti@2.6.1: {}
+
+  joycon@3.1.1: {}
+
+  js-tokens@4.0.0: {}
+
+  js-tokens@9.0.1: {}
+
+  js-yaml@3.14.2:
+    dependencies:
+      argparse: 1.0.10
+      esprima: 4.0.1
+
+  js-yaml@4.1.1:
+    dependencies:
+      argparse: 2.0.1
+
+  jsesc@3.1.0: {}
+
+  json-buffer@3.0.1: {}
+
+  json-schema-traverse@0.4.1: {}
+
+  json-stable-stringify-without-jsonify@1.0.1: {}
+
+  json5@1.0.2:
+    dependencies:
+      minimist: 1.2.8
+
+  json5@2.2.3: {}
+
+  jsonfile@4.0.0:
+    optionalDependencies:
+      graceful-fs: 4.2.11
+
+  jsx-ast-utils@3.3.5:
+    dependencies:
+      array-includes: 3.1.9
+      array.prototype.flat: 1.3.3
+      object.assign: 4.1.7
+      object.values: 1.2.1
+
+  keyv@4.5.4:
+    dependencies:
+      json-buffer: 3.0.1
+
+  kleur@3.0.3: {}
+
+  kleur@4.1.5: {}
+
+  klona@2.0.6: {}
+
+  knitwork@1.3.0: {}
+
+  language-subtag-registry@0.3.23: {}
+
+  language-tags@1.0.9:
+    dependencies:
+      language-subtag-registry: 0.3.23
+
+  launch-editor@2.13.0:
+    dependencies:
+      picocolors: 1.1.1
+      shell-quote: 1.8.3
+
+  lazystream@1.0.1:
+    dependencies:
+      readable-stream: 2.3.8
+
+  levn@0.4.1:
+    dependencies:
+      prelude-ls: 1.2.1
+      type-check: 0.4.0
+
+  lightningcss-android-arm64@1.31.1:
+    optional: true
+
+  lightningcss-darwin-arm64@1.31.1:
+    optional: true
+
+  lightningcss-darwin-x64@1.31.1:
+    optional: true
+
+  lightningcss-freebsd-x64@1.31.1:
+    optional: true
+
+  lightningcss-linux-arm-gnueabihf@1.31.1:
+    optional: true
+
+  lightningcss-linux-arm64-gnu@1.31.1:
+    optional: true
+
+  lightningcss-linux-arm64-musl@1.31.1:
+    optional: true
+
+  lightningcss-linux-x64-gnu@1.31.1:
+    optional: true
+
+  lightningcss-linux-x64-musl@1.31.1:
+    optional: true
+
+  lightningcss-win32-arm64-msvc@1.31.1:
+    optional: true
+
+  lightningcss-win32-x64-msvc@1.31.1:
+    optional: true
+
+  lightningcss@1.31.1:
+    dependencies:
+      detect-libc: 2.1.2
+    optionalDependencies:
+      lightningcss-android-arm64: 1.31.1
+      lightningcss-darwin-arm64: 1.31.1
+      lightningcss-darwin-x64: 1.31.1
+      lightningcss-freebsd-x64: 1.31.1
+      lightningcss-linux-arm-gnueabihf: 1.31.1
+      lightningcss-linux-arm64-gnu: 1.31.1
+      lightningcss-linux-arm64-musl: 1.31.1
+      lightningcss-linux-x64-gnu: 1.31.1
+      lightningcss-linux-x64-musl: 1.31.1
+      lightningcss-win32-arm64-msvc: 1.31.1
+      lightningcss-win32-x64-msvc: 1.31.1
+
+  lilconfig@3.1.3: {}
+
+  lines-and-columns@1.2.4: {}
+
+  listhen@1.9.0:
+    dependencies:
+      '@parcel/watcher': 2.5.6
+      '@parcel/watcher-wasm': 2.5.6
+      citty: 0.1.6
+      clipboardy: 4.0.0
+      consola: 3.4.2
+      crossws: 0.3.5
+      defu: 6.1.4
+      get-port-please: 3.2.0
+      h3: 1.15.5
+      http-shutdown: 1.2.2
+      jiti: 2.6.1
+      mlly: 1.8.0
+      node-forge: 1.3.3
+      pathe: 1.1.2
+      std-env: 3.10.0
+      ufo: 1.6.3
+      untun: 0.1.3
+      uqr: 0.1.2
+
+  load-tsconfig@0.2.5: {}
+
+  local-pkg@1.1.2:
+    dependencies:
+      mlly: 1.8.0
+      pkg-types: 2.3.0
+      quansync: 0.2.11
+
+  locate-character@3.0.0: {}
+
+  locate-path@5.0.0:
+    dependencies:
+      p-locate: 4.1.0
+
+  locate-path@6.0.0:
+    dependencies:
+      p-locate: 5.0.0
+
+  lodash.defaults@4.2.0: {}
+
+  lodash.isarguments@3.1.0: {}
+
+  lodash.memoize@4.1.2: {}
+
+  lodash.merge@4.6.2: {}
+
+  lodash.sortby@4.7.0: {}
+
+  lodash.startcase@4.4.0: {}
+
+  lodash.uniq@4.5.0: {}
+
+  lodash@4.17.23: {}
+
+  loose-envify@1.4.0:
+    dependencies:
+      js-tokens: 4.0.0
+
+  lru-cache@10.4.3: {}
+
+  lru-cache@11.2.6: {}
+
+  lru-cache@5.1.1:
+    dependencies:
+      yallist: 3.1.1
+
+  magic-regexp@0.10.0:
+    dependencies:
+      estree-walker: 3.0.3
+      magic-string: 0.30.21
+      mlly: 1.8.0
+      regexp-tree: 0.1.27
+      type-level-regexp: 0.1.17
+      ufo: 1.6.3
+      unplugin: 2.3.11
+
+  magic-string-ast@1.0.3:
+    dependencies:
+      magic-string: 0.30.21
+
+  magic-string@0.30.21:
+    dependencies:
+      '@jridgewell/sourcemap-codec': 1.5.5
+
+  magicast@0.2.11:
+    dependencies:
+      '@babel/parser': 7.29.0
+      '@babel/types': 7.29.0
+      recast: 0.23.11
+
+  magicast@0.5.2:
+    dependencies:
+      '@babel/parser': 7.29.0
+      '@babel/types': 7.29.0
+      source-map-js: 1.2.1
+
+  math-intrinsics@1.1.0: {}
+
+  md4w@0.2.7: {}
+
+  mdast-util-to-hast@13.2.1:
+    dependencies:
+      '@types/hast': 3.0.4
+      '@types/mdast': 4.0.4
+      '@ungap/structured-clone': 1.3.0
+      devlop: 1.1.0
+      micromark-util-sanitize-uri: 2.0.1
+      trim-lines: 3.0.1
+      unist-util-position: 5.0.0
+      unist-util-visit: 5.1.0
+      vfile: 6.0.3
+
+  mdbox@0.1.1:
+    dependencies:
+      md4w: 0.2.7
+
+  mdn-data@2.0.28: {}
+
+  mdn-data@2.12.2: {}
+
+  merge-anything@5.1.7:
+    dependencies:
+      is-what: 4.1.16
+
+  merge-stream@2.0.0: {}
+
+  merge2@1.4.1: {}
+
+  micromark-util-character@2.1.1:
+    dependencies:
+      micromark-util-symbol: 2.0.1
+      micromark-util-types: 2.0.2
+
+  micromark-util-encode@2.0.1: {}
+
+  micromark-util-sanitize-uri@2.0.1:
+    dependencies:
+      micromark-util-character: 2.1.1
+      micromark-util-encode: 2.0.1
+      micromark-util-symbol: 2.0.1
+
+  micromark-util-symbol@2.0.1: {}
+
+  micromark-util-types@2.0.2: {}
+
+  micromatch@4.0.8:
+    dependencies:
+      braces: 3.0.3
+      picomatch: 2.3.1
+
+  mime-db@1.54.0: {}
+
+  mime-types@3.0.2:
+    dependencies:
+      mime-db: 1.54.0
+
+  mime@1.6.0: {}
+
+  mime@3.0.0: {}
+
+  mime@4.1.0: {}
+
+  mimic-fn@4.0.0: {}
+
+  minimatch@10.2.1:
+    dependencies:
+      brace-expansion: 5.0.2
+
+  minimatch@3.1.2:
+    dependencies:
+      brace-expansion: 1.1.12
+
+  minimatch@5.1.6:
+    dependencies:
+      brace-expansion: 2.0.2
+
+  minimatch@9.0.5:
+    dependencies:
+      brace-expansion: 2.0.2
+
+  minimist@1.2.8: {}
+
+  minipass@7.1.3: {}
+
+  minizlib@3.1.0:
+    dependencies:
+      minipass: 7.1.3
+
+  mitt@3.0.1: {}
+
+  mlly@1.8.0:
+    dependencies:
+      acorn: 8.15.0
+      pathe: 2.0.3
+      pkg-types: 1.3.1
+      ufo: 1.6.3
+
+  mocked-exports@0.1.1: {}
+
+  mri@1.2.0: {}
+
+  mrmime@2.0.1: {}
+
+  ms@2.0.0: {}
+
+  ms@2.1.3: {}
+
+  muggle-string@0.4.1: {}
+
+  mz@2.7.0:
+    dependencies:
+      any-promise: 1.3.0
+      object-assign: 4.1.1
+      thenify-all: 1.6.0
+
+  nanoid@3.3.11: {}
+
+  nanoid@5.1.6: {}
+
+  nanotar@0.2.1: {}
+
+  napi-postinstall@0.3.4: {}
+
+  natural-compare@1.4.0: {}
+
+  next@16.1.6(@playwright/test@1.58.2)(react-dom@19.2.4(react@19.2.4))(react@19.2.4):
+    dependencies:
+      '@next/env': 16.1.6
+      '@swc/helpers': 0.5.15
+      baseline-browser-mapping: 2.10.0
+      caniuse-lite: 1.0.30001770
+      postcss: 8.4.31
+      react: 19.2.4
+      react-dom: 19.2.4(react@19.2.4)
+      styled-jsx: 5.1.6(react@19.2.4)
+    optionalDependencies:
+      '@next/swc-darwin-arm64': 16.1.6
+      '@next/swc-darwin-x64': 16.1.6
+      '@next/swc-linux-arm64-gnu': 16.1.6
+      '@next/swc-linux-arm64-musl': 16.1.6
+      '@next/swc-linux-x64-gnu': 16.1.6
+      '@next/swc-linux-x64-musl': 16.1.6
+      '@next/swc-win32-arm64-msvc': 16.1.6
+      '@next/swc-win32-x64-msvc': 16.1.6
+      '@playwright/test': 1.58.2
+      sharp: 0.34.5
+    transitivePeerDependencies:
+      - '@babel/core'
+      - babel-plugin-macros
+
+  nitropack@2.13.1:
+    dependencies:
+      '@cloudflare/kv-asset-handler': 0.4.2
+      '@rollup/plugin-alias': 6.0.0(rollup@4.57.1)
+      '@rollup/plugin-commonjs': 29.0.0(rollup@4.57.1)
+      '@rollup/plugin-inject': 5.0.5(rollup@4.57.1)
+      '@rollup/plugin-json': 6.1.0(rollup@4.57.1)
+      '@rollup/plugin-node-resolve': 16.0.3(rollup@4.57.1)
+      '@rollup/plugin-replace': 6.0.3(rollup@4.57.1)
+      '@rollup/plugin-terser': 0.4.4(rollup@4.57.1)
+      '@vercel/nft': 1.3.1(rollup@4.57.1)
+      archiver: 7.0.1
+      c12: 3.3.3(magicast@0.5.2)
+      chokidar: 5.0.0
+      citty: 0.1.6
+      compatx: 0.2.0
+      confbox: 0.2.4
+      consola: 3.4.2
+      cookie-es: 2.0.0
+      croner: 9.1.0
+      crossws: 0.3.5
+      db0: 0.3.4
+      defu: 6.1.4
+      destr: 2.0.5
+      dot-prop: 10.1.0
+      esbuild: 0.27.3
+      escape-string-regexp: 5.0.0
+      etag: 1.8.1
+      exsolve: 1.0.8
+      globby: 16.1.1
+      gzip-size: 7.0.0
+      h3: 1.15.5
+      hookable: 5.5.3
+      httpxy: 0.1.7
+      ioredis: 5.9.3
+      jiti: 2.6.1
+      klona: 2.0.6
+      knitwork: 1.3.0
+      listhen: 1.9.0
+      magic-string: 0.30.21
+      magicast: 0.5.2
+      mime: 4.1.0
+      mlly: 1.8.0
+      node-fetch-native: 1.6.7
+      node-mock-http: 1.0.4
+      ofetch: 1.5.1
+      ohash: 2.0.11
+      pathe: 2.0.3
+      perfect-debounce: 2.1.0
+      pkg-types: 2.3.0
+      pretty-bytes: 7.1.0
+      radix3: 1.1.2
+      rollup: 4.57.1
+      rollup-plugin-visualizer: 6.0.5(rollup@4.57.1)
+      scule: 1.3.0
+      semver: 7.7.4
+      serve-placeholder: 2.0.2
+      serve-static: 2.2.1
+      source-map: 0.7.6
+      std-env: 3.10.0
+      ufo: 1.6.3
+      ultrahtml: 1.6.0
+      uncrypto: 0.1.3
+      unctx: 2.5.0
+      unenv: 2.0.0-rc.24
+      unimport: 5.6.0
+      unplugin-utils: 0.3.1
+      unstorage: 1.17.4(db0@0.3.4)(ioredis@5.9.3)
+      untyped: 2.0.0
+      unwasm: 0.5.3
+      youch: 4.1.0-beta.14
+      youch-core: 0.3.3
+    transitivePeerDependencies:
+      - '@azure/app-configuration'
+      - '@azure/cosmos'
+      - '@azure/data-tables'
+      - '@azure/identity'
+      - '@azure/keyvault-secrets'
+      - '@azure/storage-blob'
+      - '@capacitor/preferences'
+      - '@deno/kv'
+      - '@electric-sql/pglite'
+      - '@libsql/client'
+      - '@netlify/blobs'
+      - '@planetscale/database'
+      - '@upstash/redis'
+      - '@vercel/blob'
+      - '@vercel/functions'
+      - '@vercel/kv'
+      - aws4fetch
+      - bare-abort-controller
+      - better-sqlite3
+      - drizzle-orm
+      - encoding
+      - idb-keyval
+      - mysql2
+      - react-native-b4a
+      - rolldown
+      - sqlite3
+      - supports-color
+      - uploadthing
+
+  node-addon-api@7.1.1: {}
+
+  node-exports-info@1.6.0:
+    dependencies:
+      array.prototype.flatmap: 1.3.3
+      es-errors: 1.3.0
+      object.entries: 1.1.9
+      semver: 6.3.1
+
+  node-fetch-native@1.6.7: {}
+
+  node-fetch@2.7.0:
+    dependencies:
+      whatwg-url: 5.0.0
+
+  node-forge@1.3.3: {}
+
+  node-gyp-build@4.8.4: {}
+
+  node-mock-http@1.0.4: {}
+
+  node-releases@2.0.27: {}
+
+  nopt@8.1.0:
+    dependencies:
+      abbrev: 3.0.1
+
+  normalize-path@3.0.0: {}
+
+  npm-run-path@5.3.0:
+    dependencies:
+      path-key: 4.0.0
+
+  npm-run-path@6.0.0:
+    dependencies:
+      path-key: 4.0.0
+      unicorn-magic: 0.3.0
+
+  nth-check@2.1.1:
+    dependencies:
+      boolbase: 1.0.0
+
+  nuxt@4.3.1(@biomejs/biome@2.4.2)(@parcel/watcher@2.5.6)(@types/node@24.10.13)(@vue/compiler-sfc@3.5.28)(cac@6.7.14)(db0@0.3.4)(eslint@9.39.2(jiti@2.6.1))(ioredis@5.9.3)(lightningcss@1.31.1)(magicast@0.5.2)(optionator@0.9.4)(rollup@4.57.1)(terser@5.46.0)(tsx@4.20.6)(typescript@5.9.3)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue-tsc@3.2.4(typescript@5.9.3))(yaml@2.8.2):
+    dependencies:
+      '@dxup/nuxt': 0.3.2(magicast@0.5.2)
+      '@nuxt/cli': 3.33.1(@nuxt/schema@4.3.1)(cac@6.7.14)(magicast@0.5.2)
+      '@nuxt/devtools': 3.2.1(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue@3.5.28(typescript@5.9.3))
+      '@nuxt/kit': 4.3.1(magicast@0.5.2)
+      '@nuxt/nitro-server': 4.3.1(db0@0.3.4)(ioredis@5.9.3)(magicast@0.5.2)(nuxt@4.3.1(@biomejs/biome@2.4.2)(@parcel/watcher@2.5.6)(@types/node@24.10.13)(@vue/compiler-sfc@3.5.28)(cac@6.7.14)(db0@0.3.4)(eslint@9.39.2(jiti@2.6.1))(ioredis@5.9.3)(lightningcss@1.31.1)(magicast@0.5.2)(optionator@0.9.4)(rollup@4.57.1)(terser@5.46.0)(tsx@4.20.6)(typescript@5.9.3)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue-tsc@3.2.4(typescript@5.9.3))(yaml@2.8.2))(typescript@5.9.3)
+      '@nuxt/schema': 4.3.1
+      '@nuxt/telemetry': 2.7.0(@nuxt/kit@4.3.1(magicast@0.5.2))
+      '@nuxt/vite-builder': 4.3.1(@biomejs/biome@2.4.2)(@types/node@24.10.13)(eslint@9.39.2(jiti@2.6.1))(lightningcss@1.31.1)(magicast@0.5.2)(nuxt@4.3.1(@biomejs/biome@2.4.2)(@parcel/watcher@2.5.6)(@types/node@24.10.13)(@vue/compiler-sfc@3.5.28)(cac@6.7.14)(db0@0.3.4)(eslint@9.39.2(jiti@2.6.1))(ioredis@5.9.3)(lightningcss@1.31.1)(magicast@0.5.2)(optionator@0.9.4)(rollup@4.57.1)(terser@5.46.0)(tsx@4.20.6)(typescript@5.9.3)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue-tsc@3.2.4(typescript@5.9.3))(yaml@2.8.2))(optionator@0.9.4)(rollup@4.57.1)(terser@5.46.0)(tsx@4.20.6)(typescript@5.9.3)(vue-tsc@3.2.4(typescript@5.9.3))(vue@3.5.28(typescript@5.9.3))(yaml@2.8.2)
+      '@unhead/vue': 2.1.4(vue@3.5.28(typescript@5.9.3))
+      '@vue/shared': 3.5.28
+      c12: 3.3.3(magicast@0.5.2)
+      chokidar: 5.0.0
+      compatx: 0.2.0
+      consola: 3.4.2
+      cookie-es: 2.0.0
+      defu: 6.1.4
+      destr: 2.0.5
+      devalue: 5.6.3
+      errx: 0.1.0
+      escape-string-regexp: 5.0.0
+      exsolve: 1.0.8
+      h3: 1.15.5
+      hookable: 5.5.3
+      ignore: 7.0.5
+      impound: 1.0.0
+      jiti: 2.6.1
+      klona: 2.0.6
+      knitwork: 1.3.0
+      magic-string: 0.30.21
+      mlly: 1.8.0
+      nanotar: 0.2.1
+      nypm: 0.6.5
+      ofetch: 1.5.1
+      ohash: 2.0.11
+      on-change: 6.0.2
+      oxc-minify: 0.112.0
+      oxc-parser: 0.112.0
+      oxc-transform: 0.112.0
+      oxc-walker: 0.7.0(oxc-parser@0.112.0)
+      pathe: 2.0.3
+      perfect-debounce: 2.1.0
+      pkg-types: 2.3.0
+      rou3: 0.7.12
+      scule: 1.3.0
+      semver: 7.7.4
+      std-env: 3.10.0
+      tinyglobby: 0.2.15
+      ufo: 1.6.3
+      ultrahtml: 1.6.0
+      uncrypto: 0.1.3
+      unctx: 2.5.0
+      unimport: 5.6.0
+      unplugin: 3.0.0
+      unplugin-vue-router: 0.19.2(@vue/compiler-sfc@3.5.28)(vue-router@4.6.4(vue@3.5.28(typescript@5.9.3)))(vue@3.5.28(typescript@5.9.3))
+      untyped: 2.0.0
+      vue: 3.5.28(typescript@5.9.3)
+      vue-router: 4.6.4(vue@3.5.28(typescript@5.9.3))
+    optionalDependencies:
+      '@parcel/watcher': 2.5.6
+      '@types/node': 24.10.13
+    transitivePeerDependencies:
+      - '@azure/app-configuration'
+      - '@azure/cosmos'
+      - '@azure/data-tables'
+      - '@azure/identity'
+      - '@azure/keyvault-secrets'
+      - '@azure/storage-blob'
+      - '@biomejs/biome'
+      - '@capacitor/preferences'
+      - '@deno/kv'
+      - '@electric-sql/pglite'
+      - '@libsql/client'
+      - '@netlify/blobs'
+      - '@planetscale/database'
+      - '@upstash/redis'
+      - '@vercel/blob'
+      - '@vercel/functions'
+      - '@vercel/kv'
+      - '@vitejs/devtools'
+      - '@vue/compiler-sfc'
+      - aws4fetch
+      - bare-abort-controller
+      - better-sqlite3
+      - bufferutil
+      - cac
+      - commander
+      - db0
+      - drizzle-orm
+      - encoding
+      - eslint
+      - idb-keyval
+      - ioredis
+      - less
+      - lightningcss
+      - magicast
+      - meow
+      - mysql2
+      - optionator
+      - oxlint
+      - react-native-b4a
+      - rolldown
+      - rollup
+      - sass
+      - sass-embedded
+      - sqlite3
+      - stylelint
+      - stylus
+      - sugarss
+      - supports-color
+      - terser
+      - tsx
+      - typescript
+      - uploadthing
+      - utf-8-validate
+      - vite
+      - vls
+      - vti
+      - vue-tsc
+      - xml2js
+      - yaml
+
+  nypm@0.6.5:
+    dependencies:
+      citty: 0.2.1
+      pathe: 2.0.3
+      tinyexec: 1.0.2
+
+  object-assign@4.1.1: {}
+
+  object-inspect@1.13.4: {}
+
+  object-keys@1.1.1: {}
+
+  object.assign@4.1.7:
+    dependencies:
+      call-bind: 1.0.8
+      call-bound: 1.0.4
+      define-properties: 1.2.1
+      es-object-atoms: 1.1.1
+      has-symbols: 1.1.0
+      object-keys: 1.1.1
+
+  object.entries@1.1.9:
+    dependencies:
+      call-bind: 1.0.8
+      call-bound: 1.0.4
+      define-properties: 1.2.1
+      es-object-atoms: 1.1.1
+
+  object.fromentries@2.0.8:
+    dependencies:
+      call-bind: 1.0.8
+      define-properties: 1.2.1
+      es-abstract: 1.24.1
+      es-object-atoms: 1.1.1
+
+  object.groupby@1.0.3:
+    dependencies:
+      call-bind: 1.0.8
+      define-properties: 1.2.1
+      es-abstract: 1.24.1
+
+  object.values@1.2.1:
+    dependencies:
+      call-bind: 1.0.8
+      call-bound: 1.0.4
+      define-properties: 1.2.1
+      es-object-atoms: 1.1.1
+
+  obug@2.1.1: {}
+
+  ofetch@1.5.1:
+    dependencies:
+      destr: 2.0.5
+      node-fetch-native: 1.6.7
+      ufo: 1.6.3
+
+  ofetch@2.0.0-alpha.3: {}
+
+  ohash@2.0.11: {}
+
+  on-change@6.0.2: {}
+
+  on-finished@2.4.1:
+    dependencies:
+      ee-first: 1.1.1
+
+  onetime@6.0.0:
+    dependencies:
+      mimic-fn: 4.0.0
+
+  oniguruma-to-es@2.3.0:
+    dependencies:
+      emoji-regex-xs: 1.0.0
+      regex: 5.1.1
+      regex-recursion: 5.1.1
+
+  open@10.2.0:
+    dependencies:
+      default-browser: 5.5.0
+      define-lazy-prop: 3.0.0
+      is-inside-container: 1.0.0
+      wsl-utils: 0.1.0
+
+  open@8.4.2:
+    dependencies:
+      define-lazy-prop: 2.0.0
+      is-docker: 2.2.1
+      is-wsl: 2.2.0
+
+  optionator@0.9.4:
+    dependencies:
+      deep-is: 0.1.4
+      fast-levenshtein: 2.0.6
+      levn: 0.4.1
+      prelude-ls: 1.2.1
+      type-check: 0.4.0
+      word-wrap: 1.2.5
+
+  outdent@0.5.0: {}
+
+  own-keys@1.0.1:
+    dependencies:
+      get-intrinsic: 1.3.0
+      object-keys: 1.1.1
+      safe-push-apply: 1.0.0
+
+  oxc-minify@0.112.0:
+    optionalDependencies:
+      '@oxc-minify/binding-android-arm-eabi': 0.112.0
+      '@oxc-minify/binding-android-arm64': 0.112.0
+      '@oxc-minify/binding-darwin-arm64': 0.112.0
+      '@oxc-minify/binding-darwin-x64': 0.112.0
+      '@oxc-minify/binding-freebsd-x64': 0.112.0
+      '@oxc-minify/binding-linux-arm-gnueabihf': 0.112.0
+      '@oxc-minify/binding-linux-arm-musleabihf': 0.112.0
+      '@oxc-minify/binding-linux-arm64-gnu': 0.112.0
+      '@oxc-minify/binding-linux-arm64-musl': 0.112.0
+      '@oxc-minify/binding-linux-ppc64-gnu': 0.112.0
+      '@oxc-minify/binding-linux-riscv64-gnu': 0.112.0
+      '@oxc-minify/binding-linux-riscv64-musl': 0.112.0
+      '@oxc-minify/binding-linux-s390x-gnu': 0.112.0
+      '@oxc-minify/binding-linux-x64-gnu': 0.112.0
+      '@oxc-minify/binding-linux-x64-musl': 0.112.0
+      '@oxc-minify/binding-openharmony-arm64': 0.112.0
+      '@oxc-minify/binding-wasm32-wasi': 0.112.0
+      '@oxc-minify/binding-win32-arm64-msvc': 0.112.0
+      '@oxc-minify/binding-win32-ia32-msvc': 0.112.0
+      '@oxc-minify/binding-win32-x64-msvc': 0.112.0
+
+  oxc-parser@0.112.0:
+    dependencies:
+      '@oxc-project/types': 0.112.0
+    optionalDependencies:
+      '@oxc-parser/binding-android-arm-eabi': 0.112.0
+      '@oxc-parser/binding-android-arm64': 0.112.0
+      '@oxc-parser/binding-darwin-arm64': 0.112.0
+      '@oxc-parser/binding-darwin-x64': 0.112.0
+      '@oxc-parser/binding-freebsd-x64': 0.112.0
+      '@oxc-parser/binding-linux-arm-gnueabihf': 0.112.0
+      '@oxc-parser/binding-linux-arm-musleabihf': 0.112.0
+      '@oxc-parser/binding-linux-arm64-gnu': 0.112.0
+      '@oxc-parser/binding-linux-arm64-musl': 0.112.0
+      '@oxc-parser/binding-linux-ppc64-gnu': 0.112.0
+      '@oxc-parser/binding-linux-riscv64-gnu': 0.112.0
+      '@oxc-parser/binding-linux-riscv64-musl': 0.112.0
+      '@oxc-parser/binding-linux-s390x-gnu': 0.112.0
+      '@oxc-parser/binding-linux-x64-gnu': 0.112.0
+      '@oxc-parser/binding-linux-x64-musl': 0.112.0
+      '@oxc-parser/binding-openharmony-arm64': 0.112.0
+      '@oxc-parser/binding-wasm32-wasi': 0.112.0
+      '@oxc-parser/binding-win32-arm64-msvc': 0.112.0
+      '@oxc-parser/binding-win32-ia32-msvc': 0.112.0
+      '@oxc-parser/binding-win32-x64-msvc': 0.112.0
+
+  oxc-transform@0.112.0:
+    optionalDependencies:
+      '@oxc-transform/binding-android-arm-eabi': 0.112.0
+      '@oxc-transform/binding-android-arm64': 0.112.0
+      '@oxc-transform/binding-darwin-arm64': 0.112.0
+      '@oxc-transform/binding-darwin-x64': 0.112.0
+      '@oxc-transform/binding-freebsd-x64': 0.112.0
+      '@oxc-transform/binding-linux-arm-gnueabihf': 0.112.0
+      '@oxc-transform/binding-linux-arm-musleabihf': 0.112.0
+      '@oxc-transform/binding-linux-arm64-gnu': 0.112.0
+      '@oxc-transform/binding-linux-arm64-musl': 0.112.0
+      '@oxc-transform/binding-linux-ppc64-gnu': 0.112.0
+      '@oxc-transform/binding-linux-riscv64-gnu': 0.112.0
+      '@oxc-transform/binding-linux-riscv64-musl': 0.112.0
+      '@oxc-transform/binding-linux-s390x-gnu': 0.112.0
+      '@oxc-transform/binding-linux-x64-gnu': 0.112.0
+      '@oxc-transform/binding-linux-x64-musl': 0.112.0
+      '@oxc-transform/binding-openharmony-arm64': 0.112.0
+      '@oxc-transform/binding-wasm32-wasi': 0.112.0
+      '@oxc-transform/binding-win32-arm64-msvc': 0.112.0
+      '@oxc-transform/binding-win32-ia32-msvc': 0.112.0
+      '@oxc-transform/binding-win32-x64-msvc': 0.112.0
+
+  oxc-walker@0.7.0(oxc-parser@0.112.0):
+    dependencies:
+      magic-regexp: 0.10.0
+      oxc-parser: 0.112.0
+
+  p-filter@2.1.0:
+    dependencies:
+      p-map: 2.1.0
+
+  p-limit@2.3.0:
+    dependencies:
+      p-try: 2.2.0
+
+  p-limit@3.1.0:
+    dependencies:
+      yocto-queue: 0.1.0
+
+  p-locate@4.1.0:
+    dependencies:
+      p-limit: 2.3.0
+
+  p-locate@5.0.0:
+    dependencies:
+      p-limit: 3.1.0
+
+  p-map@2.1.0: {}
+
+  p-try@2.2.0: {}
+
+  package-json-from-dist@1.0.1: {}
+
+  package-manager-detector@0.2.11:
+    dependencies:
+      quansync: 0.2.11
+
+  parent-module@1.0.1:
+    dependencies:
+      callsites: 3.1.0
+
+  parse5@7.3.0:
+    dependencies:
+      entities: 6.0.1
+
+  parseurl@1.3.3: {}
+
+  path-browserify@1.0.1: {}
+
+  path-exists@4.0.0: {}
+
+  path-key@3.1.1: {}
+
+  path-key@4.0.0: {}
+
+  path-parse@1.0.7: {}
+
+  path-scurry@1.11.1:
+    dependencies:
+      lru-cache: 10.4.3
+      minipass: 7.1.3
+
+  path-scurry@2.0.1:
+    dependencies:
+      lru-cache: 11.2.6
+      minipass: 7.1.3
+
+  path-to-regexp@6.3.0: {}
+
+  path-type@4.0.0: {}
+
+  pathe@1.1.2: {}
+
+  pathe@2.0.3: {}
+
+  perfect-debounce@2.1.0: {}
+
+  picocolors@1.1.1: {}
+
+  picomatch@2.3.1: {}
+
+  picomatch@4.0.3: {}
+
+  pify@4.0.1: {}
+
+  pirates@4.0.7: {}
+
+  pkg-types@1.3.1:
+    dependencies:
+      confbox: 0.1.8
+      mlly: 1.8.0
+      pathe: 2.0.3
+
+  pkg-types@2.3.0:
+    dependencies:
+      confbox: 0.2.4
+      exsolve: 1.0.8
+      pathe: 2.0.3
+
+  playwright-core@1.58.2: {}
+
+  playwright@1.58.2:
+    dependencies:
+      playwright-core: 1.58.2
+    optionalDependencies:
+      fsevents: 2.3.2
+
+  possible-typed-array-names@1.1.0: {}
+
+  postcss-calc@10.1.1(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+      postcss-selector-parser: 7.1.1
+      postcss-value-parser: 4.2.0
+
+  postcss-colormin@7.0.5(postcss@8.5.6):
+    dependencies:
+      browserslist: 4.28.1
+      caniuse-api: 3.0.0
+      colord: 2.9.3
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+
+  postcss-convert-values@7.0.8(postcss@8.5.6):
+    dependencies:
+      browserslist: 4.28.1
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+
+  postcss-discard-comments@7.0.5(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+      postcss-selector-parser: 7.1.1
+
+  postcss-discard-duplicates@7.0.2(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+
+  postcss-discard-empty@7.0.1(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+
+  postcss-discard-overridden@7.0.1(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+
+  postcss-load-config@6.0.1(jiti@2.6.1)(postcss@8.5.6)(tsx@4.20.6)(yaml@2.8.2):
+    dependencies:
+      lilconfig: 3.1.3
+    optionalDependencies:
+      jiti: 2.6.1
+      postcss: 8.5.6
+      tsx: 4.20.6
+      yaml: 2.8.2
+
+  postcss-merge-longhand@7.0.5(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+      stylehacks: 7.0.7(postcss@8.5.6)
+
+  postcss-merge-rules@7.0.7(postcss@8.5.6):
+    dependencies:
+      browserslist: 4.28.1
+      caniuse-api: 3.0.0
+      cssnano-utils: 5.0.1(postcss@8.5.6)
+      postcss: 8.5.6
+      postcss-selector-parser: 7.1.1
+
+  postcss-minify-font-values@7.0.1(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+
+  postcss-minify-gradients@7.0.1(postcss@8.5.6):
+    dependencies:
+      colord: 2.9.3
+      cssnano-utils: 5.0.1(postcss@8.5.6)
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+
+  postcss-minify-params@7.0.5(postcss@8.5.6):
+    dependencies:
+      browserslist: 4.28.1
+      cssnano-utils: 5.0.1(postcss@8.5.6)
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+
+  postcss-minify-selectors@7.0.5(postcss@8.5.6):
+    dependencies:
+      cssesc: 3.0.0
+      postcss: 8.5.6
+      postcss-selector-parser: 7.1.1
+
+  postcss-normalize-charset@7.0.1(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+
+  postcss-normalize-display-values@7.0.1(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+
+  postcss-normalize-positions@7.0.1(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+
+  postcss-normalize-repeat-style@7.0.1(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+
+  postcss-normalize-string@7.0.1(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+
+  postcss-normalize-timing-functions@7.0.1(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+
+  postcss-normalize-unicode@7.0.5(postcss@8.5.6):
+    dependencies:
+      browserslist: 4.28.1
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+
+  postcss-normalize-url@7.0.1(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+
+  postcss-normalize-whitespace@7.0.1(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+
+  postcss-ordered-values@7.0.2(postcss@8.5.6):
+    dependencies:
+      cssnano-utils: 5.0.1(postcss@8.5.6)
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+
+  postcss-reduce-initial@7.0.5(postcss@8.5.6):
+    dependencies:
+      browserslist: 4.28.1
+      caniuse-api: 3.0.0
+      postcss: 8.5.6
+
+  postcss-reduce-transforms@7.0.1(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+
+  postcss-selector-parser@7.1.1:
+    dependencies:
+      cssesc: 3.0.0
+      util-deprecate: 1.0.2
+
+  postcss-svgo@7.1.0(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+      postcss-value-parser: 4.2.0
+      svgo: 4.0.0
+
+  postcss-unique-selectors@7.0.4(postcss@8.5.6):
+    dependencies:
+      postcss: 8.5.6
+      postcss-selector-parser: 7.1.1
+
+  postcss-value-parser@4.2.0: {}
+
+  postcss@8.4.31:
+    dependencies:
+      nanoid: 3.3.11
+      picocolors: 1.1.1
+      source-map-js: 1.2.1
+
+  postcss@8.5.6:
+    dependencies:
+      nanoid: 3.3.11
+      picocolors: 1.1.1
+      source-map-js: 1.2.1
+
+  prelude-ls@1.2.1: {}
+
+  prettier@2.8.8: {}
+
+  pretty-bytes@7.1.0: {}
+
+  process-nextick-args@2.0.1: {}
+
+  process@0.11.10: {}
+
+  prompts@2.4.2:
+    dependencies:
+      kleur: 3.0.3
+      sisteransi: 1.0.5
+
+  prop-types@15.8.1:
+    dependencies:
+      loose-envify: 1.4.0
+      object-assign: 4.1.1
+      react-is: 16.13.1
+
+  property-information@7.1.0: {}
+
+  punycode@2.3.1: {}
+
+  quansync@0.2.11: {}
+
+  queue-microtask@1.2.3: {}
+
+  radix3@1.1.2: {}
+
+  randombytes@2.1.0:
+    dependencies:
+      safe-buffer: 5.2.1
+
+  range-parser@1.2.1: {}
+
+  rc9@2.1.2:
+    dependencies:
+      defu: 6.1.4
+      destr: 2.0.5
+
+  rc9@3.0.0:
+    dependencies:
+      defu: 6.1.4
+      destr: 2.0.5
+
+  react-dom@19.2.4(react@19.2.4):
+    dependencies:
+      react: 19.2.4
+      scheduler: 0.27.0
+
+  react-is@16.13.1: {}
+
+  react-refresh@0.18.0: {}
+
+  react@19.2.4: {}
+
+  read-yaml-file@1.1.0:
+    dependencies:
+      graceful-fs: 4.2.11
+      js-yaml: 3.14.2
+      pify: 4.0.1
+      strip-bom: 3.0.0
+
+  readable-stream@2.3.8:
+    dependencies:
+      core-util-is: 1.0.3
+      inherits: 2.0.4
+      isarray: 1.0.0
+      process-nextick-args: 2.0.1
+      safe-buffer: 5.1.2
+      string_decoder: 1.1.1
+      util-deprecate: 1.0.2
+
+  readable-stream@4.7.0:
+    dependencies:
+      abort-controller: 3.0.0
+      buffer: 6.0.3
+      events: 3.3.0
+      process: 0.11.10
+      string_decoder: 1.3.0
+
+  readdir-glob@1.1.3:
+    dependencies:
+      minimatch: 5.1.6
+
+  readdirp@4.1.2: {}
+
+  readdirp@5.0.0: {}
+
+  recast@0.23.11:
+    dependencies:
+      ast-types: 0.16.1
+      esprima: 4.0.1
+      source-map: 0.6.1
+      tiny-invariant: 1.3.3
+      tslib: 2.8.1
+
+  redis-errors@1.2.0: {}
+
+  redis-parser@3.0.0:
+    dependencies:
+      redis-errors: 1.2.0
+
+  reflect.getprototypeof@1.0.10:
+    dependencies:
+      call-bind: 1.0.8
+      define-properties: 1.2.1
+      es-abstract: 1.24.1
+      es-errors: 1.3.0
+      es-object-atoms: 1.1.1
+      get-intrinsic: 1.3.0
+      get-proto: 1.0.1
+      which-builtin-type: 1.2.1
+
+  regex-recursion@5.1.1:
+    dependencies:
+      regex: 5.1.1
+      regex-utilities: 2.3.0
+
+  regex-utilities@2.3.0: {}
+
+  regex@5.1.1:
+    dependencies:
+      regex-utilities: 2.3.0
+
+  regexp-tree@0.1.27: {}
+
+  regexp.prototype.flags@1.5.4:
+    dependencies:
+      call-bind: 1.0.8
+      define-properties: 1.2.1
+      es-errors: 1.3.0
+      get-proto: 1.0.1
+      gopd: 1.2.0
+      set-function-name: 2.0.2
+
+  require-directory@2.1.1: {}
+
+  requires-port@1.0.0: {}
+
+  resolve-from@4.0.0: {}
+
+  resolve-from@5.0.0: {}
+
+  resolve-pkg-maps@1.0.0: {}
+
+  resolve@1.22.11:
+    dependencies:
+      is-core-module: 2.16.1
+      path-parse: 1.0.7
+      supports-preserve-symlinks-flag: 1.0.0
+
+  resolve@2.0.0-next.6:
+    dependencies:
+      es-errors: 1.3.0
+      is-core-module: 2.16.1
+      node-exports-info: 1.6.0
+      object-keys: 1.1.1
+      path-parse: 1.0.7
+      supports-preserve-symlinks-flag: 1.0.0
+
+  reusify@1.1.0: {}
+
+  rfdc@1.4.1: {}
+
+  rollup-plugin-visualizer@6.0.5(rollup@4.57.1):
+    dependencies:
+      open: 8.4.2
+      picomatch: 4.0.3
+      source-map: 0.7.6
+      yargs: 17.7.2
+    optionalDependencies:
+      rollup: 4.57.1
+
+  rollup@4.57.1:
+    dependencies:
+      '@types/estree': 1.0.8
+    optionalDependencies:
+      '@rollup/rollup-android-arm-eabi': 4.57.1
+      '@rollup/rollup-android-arm64': 4.57.1
+      '@rollup/rollup-darwin-arm64': 4.57.1
+      '@rollup/rollup-darwin-x64': 4.57.1
+      '@rollup/rollup-freebsd-arm64': 4.57.1
+      '@rollup/rollup-freebsd-x64': 4.57.1
+      '@rollup/rollup-linux-arm-gnueabihf': 4.57.1
+      '@rollup/rollup-linux-arm-musleabihf': 4.57.1
+      '@rollup/rollup-linux-arm64-gnu': 4.57.1
+      '@rollup/rollup-linux-arm64-musl': 4.57.1
+      '@rollup/rollup-linux-loong64-gnu': 4.57.1
+      '@rollup/rollup-linux-loong64-musl': 4.57.1
+      '@rollup/rollup-linux-ppc64-gnu': 4.57.1
+      '@rollup/rollup-linux-ppc64-musl': 4.57.1
+      '@rollup/rollup-linux-riscv64-gnu': 4.57.1
+      '@rollup/rollup-linux-riscv64-musl': 4.57.1
+      '@rollup/rollup-linux-s390x-gnu': 4.57.1
+      '@rollup/rollup-linux-x64-gnu': 4.57.1
+      '@rollup/rollup-linux-x64-musl': 4.57.1
+      '@rollup/rollup-openbsd-x64': 4.57.1
+      '@rollup/rollup-openharmony-arm64': 4.57.1
+      '@rollup/rollup-win32-arm64-msvc': 4.57.1
+      '@rollup/rollup-win32-ia32-msvc': 4.57.1
+      '@rollup/rollup-win32-x64-gnu': 4.57.1
+      '@rollup/rollup-win32-x64-msvc': 4.57.1
+      fsevents: 2.3.3
+
+  rou3@0.7.12: {}
+
+  run-applescript@7.1.0: {}
+
+  run-parallel@1.2.0:
+    dependencies:
+      queue-microtask: 1.2.3
+
+  sade@1.8.1:
+    dependencies:
+      mri: 1.2.0
+
+  safe-array-concat@1.1.3:
+    dependencies:
+      call-bind: 1.0.8
+      call-bound: 1.0.4
+      get-intrinsic: 1.3.0
+      has-symbols: 1.1.0
+      isarray: 2.0.5
+
+  safe-buffer@5.1.2: {}
+
+  safe-buffer@5.2.1: {}
+
+  safe-push-apply@1.0.0:
+    dependencies:
+      es-errors: 1.3.0
+      isarray: 2.0.5
+
+  safe-regex-test@1.1.0:
+    dependencies:
+      call-bound: 1.0.4
+      es-errors: 1.3.0
+      is-regex: 1.2.1
+
+  safer-buffer@2.1.2: {}
+
+  sax@1.4.4: {}
+
+  scheduler@0.27.0: {}
+
+  scule@1.3.0: {}
+
+  semver@6.3.1: {}
+
+  semver@7.7.4: {}
+
+  send@0.19.2:
+    dependencies:
+      debug: 2.6.9
+      depd: 2.0.0
+      destroy: 1.2.0
+      encodeurl: 2.0.0
+      escape-html: 1.0.3
+      etag: 1.8.1
+      fresh: 0.5.2
+      http-errors: 2.0.1
+      mime: 1.6.0
+      ms: 2.1.3
+      on-finished: 2.4.1
+      range-parser: 1.2.1
+      statuses: 2.0.2
+    transitivePeerDependencies:
+      - supports-color
+
+  send@1.2.1:
+    dependencies:
+      debug: 4.4.3
+      encodeurl: 2.0.0
+      escape-html: 1.0.3
+      etag: 1.8.1
+      fresh: 2.0.0
+      http-errors: 2.0.1
+      mime-types: 3.0.2
+      ms: 2.1.3
+      on-finished: 2.4.1
+      range-parser: 1.2.1
+      statuses: 2.0.2
+    transitivePeerDependencies:
+      - supports-color
+
+  serialize-javascript@6.0.2:
+    dependencies:
+      randombytes: 2.1.0
+
+  seroval-plugins@1.5.0(seroval@1.5.0):
+    dependencies:
+      seroval: 1.5.0
+
+  seroval@1.5.0: {}
+
+  serve-placeholder@2.0.2:
+    dependencies:
+      defu: 6.1.4
+
+  serve-static@1.16.3:
+    dependencies:
+      encodeurl: 2.0.0
+      escape-html: 1.0.3
+      parseurl: 1.3.3
+      send: 0.19.2
+    transitivePeerDependencies:
+      - supports-color
+
+  serve-static@2.2.1:
+    dependencies:
+      encodeurl: 2.0.0
+      escape-html: 1.0.3
+      parseurl: 1.3.3
+      send: 1.2.1
+    transitivePeerDependencies:
+      - supports-color
+
+  set-cookie-parser@3.0.1: {}
+
+  set-function-length@1.2.2:
+    dependencies:
+      define-data-property: 1.1.4
+      es-errors: 1.3.0
+      function-bind: 1.1.2
+      get-intrinsic: 1.3.0
+      gopd: 1.2.0
+      has-property-descriptors: 1.0.2
+
+  set-function-name@2.0.2:
+    dependencies:
+      define-data-property: 1.1.4
+      es-errors: 1.3.0
+      functions-have-names: 1.2.3
+      has-property-descriptors: 1.0.2
+
+  set-proto@1.0.0:
+    dependencies:
+      dunder-proto: 1.0.1
+      es-errors: 1.3.0
+      es-object-atoms: 1.1.1
+
+  setprototypeof@1.2.0: {}
+
+  sharp@0.34.5:
+    dependencies:
+      '@img/colour': 1.0.0
+      detect-libc: 2.1.2
+      semver: 7.7.4
+    optionalDependencies:
+      '@img/sharp-darwin-arm64': 0.34.5
+      '@img/sharp-darwin-x64': 0.34.5
+      '@img/sharp-libvips-darwin-arm64': 1.2.4
+      '@img/sharp-libvips-darwin-x64': 1.2.4
+      '@img/sharp-libvips-linux-arm': 1.2.4
+      '@img/sharp-libvips-linux-arm64': 1.2.4
+      '@img/sharp-libvips-linux-ppc64': 1.2.4
+      '@img/sharp-libvips-linux-riscv64': 1.2.4
+      '@img/sharp-libvips-linux-s390x': 1.2.4
+      '@img/sharp-libvips-linux-x64': 1.2.4
+      '@img/sharp-libvips-linuxmusl-arm64': 1.2.4
+      '@img/sharp-libvips-linuxmusl-x64': 1.2.4
+      '@img/sharp-linux-arm': 0.34.5
+      '@img/sharp-linux-arm64': 0.34.5
+      '@img/sharp-linux-ppc64': 0.34.5
+      '@img/sharp-linux-riscv64': 0.34.5
+      '@img/sharp-linux-s390x': 0.34.5
+      '@img/sharp-linux-x64': 0.34.5
+      '@img/sharp-linuxmusl-arm64': 0.34.5
+      '@img/sharp-linuxmusl-x64': 0.34.5
+      '@img/sharp-wasm32': 0.34.5
+      '@img/sharp-win32-arm64': 0.34.5
+      '@img/sharp-win32-ia32': 0.34.5
+      '@img/sharp-win32-x64': 0.34.5
+    optional: true
+
+  shebang-command@2.0.0:
+    dependencies:
+      shebang-regex: 3.0.0
+
+  shebang-regex@3.0.0: {}
+
+  shell-quote@1.8.3: {}
+
+  shiki@1.29.2:
+    dependencies:
+      '@shikijs/core': 1.29.2
+      '@shikijs/engine-javascript': 1.29.2
+      '@shikijs/engine-oniguruma': 1.29.2
+      '@shikijs/langs': 1.29.2
+      '@shikijs/themes': 1.29.2
+      '@shikijs/types': 1.29.2
+      '@shikijs/vscode-textmate': 10.0.2
+      '@types/hast': 3.0.4
+
+  side-channel-list@1.0.0:
+    dependencies:
+      es-errors: 1.3.0
+      object-inspect: 1.13.4
+
+  side-channel-map@1.0.1:
+    dependencies:
+      call-bound: 1.0.4
+      es-errors: 1.3.0
+      get-intrinsic: 1.3.0
+      object-inspect: 1.13.4
+
+  side-channel-weakmap@1.0.2:
+    dependencies:
+      call-bound: 1.0.4
+      es-errors: 1.3.0
+      get-intrinsic: 1.3.0
+      object-inspect: 1.13.4
+      side-channel-map: 1.0.1
+
+  side-channel@1.1.0:
+    dependencies:
+      es-errors: 1.3.0
+      object-inspect: 1.13.4
+      side-channel-list: 1.0.0
+      side-channel-map: 1.0.1
+      side-channel-weakmap: 1.0.2
+
+  siginfo@2.0.0: {}
+
+  signal-exit@4.1.0: {}
+
+  simple-git@3.31.1:
+    dependencies:
+      '@kwsites/file-exists': 1.1.1
+      '@kwsites/promise-deferred': 1.1.1
+      debug: 4.4.3
+    transitivePeerDependencies:
+      - supports-color
+
+  sirv@3.0.2:
+    dependencies:
+      '@polka/url': 1.0.0-next.29
+      mrmime: 2.0.1
+      totalist: 3.0.1
+
+  sisteransi@1.0.5: {}
+
+  slash@3.0.0: {}
+
+  slash@5.1.0: {}
+
+  smob@1.6.1: {}
+
+  solid-js@1.9.11:
+    dependencies:
+      csstype: 3.2.3
+      seroval: 1.5.0
+      seroval-plugins: 1.5.0(seroval@1.5.0)
+
+  solid-refresh@0.6.3(solid-js@1.9.11):
+    dependencies:
+      '@babel/generator': 7.29.1
+      '@babel/helper-module-imports': 7.28.6
+      '@babel/types': 7.29.0
+      solid-js: 1.9.11
+    transitivePeerDependencies:
+      - supports-color
+
+  solid-use@0.9.1(solid-js@1.9.11):
+    dependencies:
+      solid-js: 1.9.11
+
+  source-map-js@1.2.1: {}
+
+  source-map-support@0.5.21:
+    dependencies:
+      buffer-from: 1.1.2
+      source-map: 0.6.1
+
+  source-map@0.6.1: {}
+
+  source-map@0.7.6: {}
+
+  source-map@0.8.0-beta.0:
+    dependencies:
+      whatwg-url: 7.1.0
+
+  space-separated-tokens@2.0.2: {}
+
+  spawndamnit@3.0.1:
+    dependencies:
+      cross-spawn: 7.0.6
+      signal-exit: 4.1.0
+
+  speakingurl@14.0.1: {}
+
+  sprintf-js@1.0.3: {}
+
+  srvx@0.11.7: {}
+
+  stable-hash@0.0.5: {}
+
+  stackback@0.0.2: {}
+
+  stackframe@1.3.4: {}
+
+  standard-as-callback@2.1.0: {}
+
+  statuses@2.0.2: {}
+
+  std-env@3.10.0: {}
+
+  stop-iteration-iterator@1.1.0:
+    dependencies:
+      es-errors: 1.3.0
+      internal-slot: 1.1.0
+
+  streamx@2.23.0:
+    dependencies:
+      events-universal: 1.0.1
+      fast-fifo: 1.3.2
+      text-decoder: 1.2.7
+    transitivePeerDependencies:
+      - bare-abort-controller
+      - react-native-b4a
+
+  string-width@4.2.3:
+    dependencies:
+      emoji-regex: 8.0.0
+      is-fullwidth-code-point: 3.0.0
+      strip-ansi: 6.0.1
+
+  string-width@5.1.2:
+    dependencies:
+      eastasianwidth: 0.2.0
+      emoji-regex: 9.2.2
+      strip-ansi: 7.1.2
+
+  string-width@7.2.0:
+    dependencies:
+      emoji-regex: 10.6.0
+      get-east-asian-width: 1.5.0
+      strip-ansi: 7.1.2
+
+  string.prototype.includes@2.0.1:
+    dependencies:
+      call-bind: 1.0.8
+      define-properties: 1.2.1
+      es-abstract: 1.24.1
+
+  string.prototype.matchall@4.0.12:
+    dependencies:
+      call-bind: 1.0.8
+      call-bound: 1.0.4
+      define-properties: 1.2.1
+      es-abstract: 1.24.1
+      es-errors: 1.3.0
+      es-object-atoms: 1.1.1
+      get-intrinsic: 1.3.0
+      gopd: 1.2.0
+      has-symbols: 1.1.0
+      internal-slot: 1.1.0
+      regexp.prototype.flags: 1.5.4
+      set-function-name: 2.0.2
+      side-channel: 1.1.0
+
+  string.prototype.repeat@1.0.0:
+    dependencies:
+      define-properties: 1.2.1
+      es-abstract: 1.24.1
+
+  string.prototype.trim@1.2.10:
+    dependencies:
+      call-bind: 1.0.8
+      call-bound: 1.0.4
+      define-data-property: 1.1.4
+      define-properties: 1.2.1
+      es-abstract: 1.24.1
+      es-object-atoms: 1.1.1
+      has-property-descriptors: 1.0.2
+
+  string.prototype.trimend@1.0.9:
+    dependencies:
+      call-bind: 1.0.8
+      call-bound: 1.0.4
+      define-properties: 1.2.1
+      es-object-atoms: 1.1.1
+
+  string.prototype.trimstart@1.0.8:
+    dependencies:
+      call-bind: 1.0.8
+      define-properties: 1.2.1
+      es-object-atoms: 1.1.1
+
+  string_decoder@1.1.1:
+    dependencies:
+      safe-buffer: 5.1.2
+
+  string_decoder@1.3.0:
+    dependencies:
+      safe-buffer: 5.2.1
+
+  stringify-entities@4.0.4:
+    dependencies:
+      character-entities-html4: 2.1.0
+      character-entities-legacy: 3.0.0
+
+  strip-ansi@6.0.1:
+    dependencies:
+      ansi-regex: 5.0.1
+
+  strip-ansi@7.1.2:
+    dependencies:
+      ansi-regex: 6.2.2
+
+  strip-bom@3.0.0: {}
+
+  strip-final-newline@3.0.0: {}
+
+  strip-json-comments@3.1.1: {}
+
+  strip-literal@3.1.0:
+    dependencies:
+      js-tokens: 9.0.1
+
+  structured-clone-es@1.0.0: {}
+
+  styled-jsx@5.1.6(react@19.2.4):
+    dependencies:
+      client-only: 0.0.1
+      react: 19.2.4
+
+  stylehacks@7.0.7(postcss@8.5.6):
+    dependencies:
+      browserslist: 4.28.1
+      postcss: 8.5.6
+      postcss-selector-parser: 7.1.1
+
+  sucrase@3.35.1:
+    dependencies:
+      '@jridgewell/gen-mapping': 0.3.13
+      commander: 4.1.1
+      lines-and-columns: 1.2.4
+      mz: 2.7.0
+      pirates: 4.0.7
+      tinyglobby: 0.2.15
+      ts-interface-checker: 0.1.13
+
+  superjson@2.2.6:
+    dependencies:
+      copy-anything: 4.0.5
+
+  supports-color@10.2.2: {}
+
+  supports-color@7.2.0:
+    dependencies:
+      has-flag: 4.0.0
+
+  supports-preserve-symlinks-flag@1.0.0: {}
+
+  svelte-check@4.3.6(picomatch@4.0.3)(svelte@5.53.0)(typescript@5.9.3):
+    dependencies:
+      '@jridgewell/trace-mapping': 0.3.31
+      chokidar: 4.0.3
+      fdir: 6.5.0(picomatch@4.0.3)
+      picocolors: 1.1.1
+      sade: 1.8.1
+      svelte: 5.53.0
+      typescript: 5.9.3
+    transitivePeerDependencies:
+      - picomatch
+
+  svelte@5.53.0:
+    dependencies:
+      '@jridgewell/remapping': 2.3.5
+      '@jridgewell/sourcemap-codec': 1.5.5
+      '@sveltejs/acorn-typescript': 1.0.9(acorn@8.15.0)
+      '@types/estree': 1.0.8
+      '@types/trusted-types': 2.0.7
+      acorn: 8.15.0
+      aria-query: 5.3.2
+      axobject-query: 4.1.0
+      clsx: 2.1.1
+      devalue: 5.6.3
+      esm-env: 1.2.2
+      esrap: 2.2.3
+      is-reference: 3.0.3
+      locate-character: 3.0.0
+      magic-string: 0.30.21
+      zimmerframe: 1.1.4
+
+  svgo@4.0.0:
+    dependencies:
+      commander: 11.1.0
+      css-select: 5.2.2
+      css-tree: 3.1.0
+      css-what: 6.2.2
+      csso: 5.0.5
+      picocolors: 1.1.1
+      sax: 1.4.4
+
+  system-architecture@0.1.0: {}
+
+  tagged-tag@1.0.0: {}
+
+  tailwindcss@4.2.0: {}
+
+  tapable@2.3.0: {}
+
+  tar-stream@3.1.7:
+    dependencies:
+      b4a: 1.7.5
+      fast-fifo: 1.3.2
+      streamx: 2.23.0
+    transitivePeerDependencies:
+      - bare-abort-controller
+      - react-native-b4a
+
+  tar@7.5.9:
+    dependencies:
+      '@isaacs/fs-minipass': 4.0.1
+      chownr: 3.0.0
+      minipass: 7.1.3
+      minizlib: 3.1.0
+      yallist: 5.0.0
+
+  term-size@2.2.1: {}
+
+  terracotta@1.1.0(solid-js@1.9.11):
+    dependencies:
+      solid-js: 1.9.11
+      solid-use: 0.9.1(solid-js@1.9.11)
+
+  terser@5.46.0:
+    dependencies:
+      '@jridgewell/source-map': 0.3.11
+      acorn: 8.15.0
+      commander: 2.20.3
+      source-map-support: 0.5.21
+
+  text-decoder@1.2.7:
+    dependencies:
+      b4a: 1.7.5
+    transitivePeerDependencies:
+      - react-native-b4a
+
+  thenify-all@1.6.0:
+    dependencies:
+      thenify: 3.3.1
+
+  thenify@3.3.1:
+    dependencies:
+      any-promise: 1.3.0
+
+  tiny-invariant@1.3.3: {}
+
+  tinybench@2.9.0: {}
+
+  tinyexec@0.3.2: {}
+
+  tinyexec@1.0.2: {}
+
+  tinyglobby@0.2.15:
+    dependencies:
+      fdir: 6.5.0(picomatch@4.0.3)
+      picomatch: 4.0.3
+
+  tinyrainbow@3.0.3: {}
+
+  to-regex-range@5.0.1:
+    dependencies:
+      is-number: 7.0.0
+
+  toidentifier@1.0.1: {}
+
+  totalist@3.0.1: {}
+
+  tr46@0.0.3: {}
+
+  tr46@1.0.1:
+    dependencies:
+      punycode: 2.3.1
+
+  tree-kill@1.2.2: {}
+
+  trim-lines@3.0.1: {}
+
+  ts-api-utils@2.4.0(typescript@5.9.3):
+    dependencies:
+      typescript: 5.9.3
+
+  ts-interface-checker@0.1.13: {}
+
+  tsconfig-paths@3.15.0:
+    dependencies:
+      '@types/json5': 0.0.29
+      json5: 1.0.2
+      minimist: 1.2.8
+      strip-bom: 3.0.0
+
+  tslib@2.8.1: {}
+
+  tsup@8.5.0(jiti@2.6.1)(postcss@8.5.6)(tsx@4.20.6)(typescript@5.9.3)(yaml@2.8.2):
+    dependencies:
+      bundle-require: 5.1.0(esbuild@0.25.12)
+      cac: 6.7.14
+      chokidar: 4.0.3
+      consola: 3.4.2
+      debug: 4.4.3
+      esbuild: 0.25.12
+      fix-dts-default-cjs-exports: 1.0.1
+      joycon: 3.1.1
+      picocolors: 1.1.1
+      postcss-load-config: 6.0.1(jiti@2.6.1)(postcss@8.5.6)(tsx@4.20.6)(yaml@2.8.2)
+      resolve-from: 5.0.0
+      rollup: 4.57.1
+      source-map: 0.8.0-beta.0
+      sucrase: 3.35.1
+      tinyexec: 0.3.2
+      tinyglobby: 0.2.15
+      tree-kill: 1.2.2
+    optionalDependencies:
+      postcss: 8.5.6
+      typescript: 5.9.3
+    transitivePeerDependencies:
+      - jiti
+      - supports-color
+      - tsx
+      - yaml
+
+  tsx@4.20.6:
+    dependencies:
+      esbuild: 0.25.12
+      get-tsconfig: 4.13.6
+    optionalDependencies:
+      fsevents: 2.3.3
+
+  type-check@0.4.0:
+    dependencies:
+      prelude-ls: 1.2.1
+
+  type-fest@4.41.0: {}
+
+  type-fest@5.4.4:
+    dependencies:
+      tagged-tag: 1.0.0
+
+  type-level-regexp@0.1.17: {}
+
+  typed-array-buffer@1.0.3:
+    dependencies:
+      call-bound: 1.0.4
+      es-errors: 1.3.0
+      is-typed-array: 1.1.15
+
+  typed-array-byte-length@1.0.3:
+    dependencies:
+      call-bind: 1.0.8
+      for-each: 0.3.5
+      gopd: 1.2.0
+      has-proto: 1.2.0
+      is-typed-array: 1.1.15
+
+  typed-array-byte-offset@1.0.4:
+    dependencies:
+      available-typed-arrays: 1.0.7
+      call-bind: 1.0.8
+      for-each: 0.3.5
+      gopd: 1.2.0
+      has-proto: 1.2.0
+      is-typed-array: 1.1.15
+      reflect.getprototypeof: 1.0.10
+
+  typed-array-length@1.0.7:
+    dependencies:
+      call-bind: 1.0.8
+      for-each: 0.3.5
+      gopd: 1.2.0
+      is-typed-array: 1.1.15
+      possible-typed-array-names: 1.1.0
+      reflect.getprototypeof: 1.0.10
+
+  typescript-eslint@8.56.0(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3):
+    dependencies:
+      '@typescript-eslint/eslint-plugin': 8.56.0(@typescript-eslint/parser@8.56.0(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3))(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3)
+      '@typescript-eslint/parser': 8.56.0(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3)
+      '@typescript-eslint/typescript-estree': 8.56.0(typescript@5.9.3)
+      '@typescript-eslint/utils': 8.56.0(eslint@9.39.2(jiti@2.6.1))(typescript@5.9.3)
+      eslint: 9.39.2(jiti@2.6.1)
+      typescript: 5.9.3
+    transitivePeerDependencies:
+      - supports-color
+
+  typescript@5.9.3: {}
+
+  ufo@1.6.3: {}
+
+  ultrahtml@1.6.0: {}
+
+  unbox-primitive@1.1.0:
+    dependencies:
+      call-bound: 1.0.4
+      has-bigints: 1.1.0
+      has-symbols: 1.1.0
+      which-boxed-primitive: 1.1.1
+
+  uncrypto@0.1.3: {}
+
+  unctx@2.5.0:
+    dependencies:
+      acorn: 8.15.0
+      estree-walker: 3.0.3
+      magic-string: 0.30.21
+      unplugin: 2.3.11
+
+  undici-types@5.28.4: {}
+
+  undici-types@6.21.0: {}
+
+  undici-types@7.10.0: {}
+
+  undici-types@7.16.0: {}
+
+  unenv@1.10.0:
+    dependencies:
+      consola: 3.4.2
+      defu: 6.1.4
+      mime: 3.0.0
+      node-fetch-native: 1.6.7
+      pathe: 1.1.2
+
+  unenv@2.0.0-rc.24:
+    dependencies:
+      pathe: 2.0.3
+
+  unhead@2.1.4:
+    dependencies:
+      hookable: 6.0.1
+
+  unicorn-magic@0.3.0: {}
+
+  unicorn-magic@0.4.0: {}
+
+  unimport@5.6.0:
+    dependencies:
+      acorn: 8.15.0
+      escape-string-regexp: 5.0.0
+      estree-walker: 3.0.3
+      local-pkg: 1.1.2
+      magic-string: 0.30.21
+      mlly: 1.8.0
+      pathe: 2.0.3
+      picomatch: 4.0.3
+      pkg-types: 2.3.0
+      scule: 1.3.0
+      strip-literal: 3.1.0
+      tinyglobby: 0.2.15
+      unplugin: 2.3.11
+      unplugin-utils: 0.3.1
+
+  unist-util-is@6.0.1:
+    dependencies:
+      '@types/unist': 3.0.3
+
+  unist-util-position@5.0.0:
+    dependencies:
+      '@types/unist': 3.0.3
+
+  unist-util-stringify-position@4.0.0:
+    dependencies:
+      '@types/unist': 3.0.3
+
+  unist-util-visit-parents@6.0.2:
+    dependencies:
+      '@types/unist': 3.0.3
+      unist-util-is: 6.0.1
+
+  unist-util-visit@5.1.0:
+    dependencies:
+      '@types/unist': 3.0.3
+      unist-util-is: 6.0.1
+      unist-util-visit-parents: 6.0.2
+
+  universalify@0.1.2: {}
+
+  unplugin-utils@0.2.5:
+    dependencies:
+      pathe: 2.0.3
+      picomatch: 4.0.3
+
+  unplugin-utils@0.3.1:
+    dependencies:
+      pathe: 2.0.3
+      picomatch: 4.0.3
+
+  unplugin-vue-router@0.19.2(@vue/compiler-sfc@3.5.28)(vue-router@4.6.4(vue@3.5.28(typescript@5.9.3)))(vue@3.5.28(typescript@5.9.3)):
+    dependencies:
+      '@babel/generator': 7.29.1
+      '@vue-macros/common': 3.1.2(vue@3.5.28(typescript@5.9.3))
+      '@vue/compiler-sfc': 3.5.28
+      '@vue/language-core': 3.2.4
+      ast-walker-scope: 0.8.3
+      chokidar: 5.0.0
+      json5: 2.2.3
+      local-pkg: 1.1.2
+      magic-string: 0.30.21
+      mlly: 1.8.0
+      muggle-string: 0.4.1
+      pathe: 2.0.3
+      picomatch: 4.0.3
+      scule: 1.3.0
+      tinyglobby: 0.2.15
+      unplugin: 2.3.11
+      unplugin-utils: 0.3.1
+      yaml: 2.8.2
+    optionalDependencies:
+      vue-router: 4.6.4(vue@3.5.28(typescript@5.9.3))
+    transitivePeerDependencies:
+      - vue
+
+  unplugin@2.3.11:
+    dependencies:
+      '@jridgewell/remapping': 2.3.5
+      acorn: 8.15.0
+      picomatch: 4.0.3
+      webpack-virtual-modules: 0.6.2
+
+  unplugin@3.0.0:
+    dependencies:
+      '@jridgewell/remapping': 2.3.5
+      picomatch: 4.0.3
+      webpack-virtual-modules: 0.6.2
+
+  unrs-resolver@1.11.1:
+    dependencies:
+      napi-postinstall: 0.3.4
+    optionalDependencies:
+      '@unrs/resolver-binding-android-arm-eabi': 1.11.1
+      '@unrs/resolver-binding-android-arm64': 1.11.1
+      '@unrs/resolver-binding-darwin-arm64': 1.11.1
+      '@unrs/resolver-binding-darwin-x64': 1.11.1
+      '@unrs/resolver-binding-freebsd-x64': 1.11.1
+      '@unrs/resolver-binding-linux-arm-gnueabihf': 1.11.1
+      '@unrs/resolver-binding-linux-arm-musleabihf': 1.11.1
+      '@unrs/resolver-binding-linux-arm64-gnu': 1.11.1
+      '@unrs/resolver-binding-linux-arm64-musl': 1.11.1
+      '@unrs/resolver-binding-linux-ppc64-gnu': 1.11.1
+      '@unrs/resolver-binding-linux-riscv64-gnu': 1.11.1
+      '@unrs/resolver-binding-linux-riscv64-musl': 1.11.1
+      '@unrs/resolver-binding-linux-s390x-gnu': 1.11.1
+      '@unrs/resolver-binding-linux-x64-gnu': 1.11.1
+      '@unrs/resolver-binding-linux-x64-musl': 1.11.1
+      '@unrs/resolver-binding-wasm32-wasi': 1.11.1
+      '@unrs/resolver-binding-win32-arm64-msvc': 1.11.1
+      '@unrs/resolver-binding-win32-ia32-msvc': 1.11.1
+      '@unrs/resolver-binding-win32-x64-msvc': 1.11.1
+
+  unstorage@1.17.4(db0@0.3.4)(ioredis@5.9.3):
+    dependencies:
+      anymatch: 3.1.3
+      chokidar: 5.0.0
+      destr: 2.0.5
+      h3: 1.15.5
+      lru-cache: 11.2.6
+      node-fetch-native: 1.6.7
+      ofetch: 1.5.1
+      ufo: 1.6.3
+    optionalDependencies:
+      db0: 0.3.4
+      ioredis: 5.9.3
+
+  untun@0.1.3:
+    dependencies:
+      citty: 0.1.6
+      consola: 3.4.2
+      pathe: 1.1.2
+
+  untyped@2.0.0:
+    dependencies:
+      citty: 0.1.6
+      defu: 6.1.4
+      jiti: 2.6.1
+      knitwork: 1.3.0
+      scule: 1.3.0
+
+  unwasm@0.5.3:
+    dependencies:
+      exsolve: 1.0.8
+      knitwork: 1.3.0
+      magic-string: 0.30.21
+      mlly: 1.8.0
+      pathe: 2.0.3
+      pkg-types: 2.3.0
+
+  update-browserslist-db@1.2.3(browserslist@4.28.1):
+    dependencies:
+      browserslist: 4.28.1
+      escalade: 3.2.0
+      picocolors: 1.1.1
+
+  uqr@0.1.2: {}
+
+  uri-js@4.4.1:
+    dependencies:
+      punycode: 2.3.1
+
+  util-deprecate@1.0.2: {}
+
+  utopia-core@1.6.0: {}
+
+  vfile-message@4.0.3:
+    dependencies:
+      '@types/unist': 3.0.3
+      unist-util-stringify-position: 4.0.0
+
+  vfile@6.0.3:
+    dependencies:
+      '@types/unist': 3.0.3
+      vfile-message: 4.0.3
+
+  vinxi@0.5.11(@types/node@24.10.13)(db0@0.3.4)(ioredis@5.9.3)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2):
+    dependencies:
+      '@babel/core': 7.29.0
+      '@babel/plugin-syntax-jsx': 7.28.6(@babel/core@7.29.0)
+      '@babel/plugin-syntax-typescript': 7.28.6(@babel/core@7.29.0)
+      '@types/micromatch': 4.0.10
+      '@vinxi/listhen': 1.5.6
+      boxen: 8.0.1
+      chokidar: 4.0.3
+      citty: 0.1.6
+      consola: 3.4.2
+      crossws: 0.3.5
+      dax-sh: 0.43.2
+      defu: 6.1.4
+      es-module-lexer: 1.7.0
+      esbuild: 0.25.12
+      get-port-please: 3.2.0
+      h3: 1.15.3
+      hookable: 5.5.3
+      http-proxy: 1.18.1
+      micromatch: 4.0.8
+      nitropack: 2.13.1
+      node-fetch-native: 1.6.7
+      path-to-regexp: 6.3.0
+      pathe: 1.1.2
+      radix3: 1.1.2
+      resolve: 1.22.11
+      serve-placeholder: 2.0.2
+      serve-static: 1.16.3
+      tinyglobby: 0.2.15
+      ufo: 1.6.3
+      unctx: 2.5.0
+      unenv: 1.10.0
+      unstorage: 1.17.4(db0@0.3.4)(ioredis@5.9.3)
+      vite: 6.4.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+      zod: 4.3.6
+    transitivePeerDependencies:
+      - '@azure/app-configuration'
+      - '@azure/cosmos'
+      - '@azure/data-tables'
+      - '@azure/identity'
+      - '@azure/keyvault-secrets'
+      - '@azure/storage-blob'
+      - '@capacitor/preferences'
+      - '@deno/kv'
+      - '@electric-sql/pglite'
+      - '@libsql/client'
+      - '@netlify/blobs'
+      - '@planetscale/database'
+      - '@types/node'
+      - '@upstash/redis'
+      - '@vercel/blob'
+      - '@vercel/functions'
+      - '@vercel/kv'
+      - aws4fetch
+      - bare-abort-controller
+      - better-sqlite3
+      - db0
+      - debug
+      - drizzle-orm
+      - encoding
+      - idb-keyval
+      - ioredis
+      - jiti
+      - less
+      - lightningcss
+      - mysql2
+      - react-native-b4a
+      - rolldown
+      - sass
+      - sass-embedded
+      - sqlite3
+      - stylus
+      - sugarss
+      - supports-color
+      - terser
+      - tsx
+      - uploadthing
+      - xml2js
+      - yaml
+
+  vite-dev-rpc@1.1.0(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)):
+    dependencies:
+      birpc: 2.9.0
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+      vite-hot-client: 2.1.0(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+
+  vite-hot-client@2.1.0(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)):
+    dependencies:
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+
+  vite-node@5.3.0(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2):
+    dependencies:
+      cac: 6.7.14
+      es-module-lexer: 2.0.0
+      obug: 2.1.1
+      pathe: 2.0.3
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+    transitivePeerDependencies:
+      - '@types/node'
+      - jiti
+      - less
+      - lightningcss
+      - sass
+      - sass-embedded
+      - stylus
+      - sugarss
+      - terser
+      - tsx
+      - yaml
+
+  vite-plugin-checker@0.12.0(@biomejs/biome@2.4.2)(eslint@9.39.2(jiti@2.6.1))(optionator@0.9.4)(typescript@5.9.3)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue-tsc@3.2.4(typescript@5.9.3)):
+    dependencies:
+      '@babel/code-frame': 7.29.0
+      chokidar: 4.0.3
+      npm-run-path: 6.0.0
+      picocolors: 1.1.1
+      picomatch: 4.0.3
+      tiny-invariant: 1.3.3
+      tinyglobby: 0.2.15
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+      vscode-uri: 3.1.0
+    optionalDependencies:
+      '@biomejs/biome': 2.4.2
+      eslint: 9.39.2(jiti@2.6.1)
+      optionator: 0.9.4
+      typescript: 5.9.3
+      vue-tsc: 3.2.4(typescript@5.9.3)
+
+  vite-plugin-inspect@11.3.3(@nuxt/kit@4.3.1(magicast@0.5.2))(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)):
+    dependencies:
+      ansis: 4.2.0
+      debug: 4.4.3
+      error-stack-parser-es: 1.0.5
+      ohash: 2.0.11
+      open: 10.2.0
+      perfect-debounce: 2.1.0
+      sirv: 3.0.2
+      unplugin-utils: 0.3.1
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+      vite-dev-rpc: 1.1.0(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+    optionalDependencies:
+      '@nuxt/kit': 4.3.1(magicast@0.5.2)
+    transitivePeerDependencies:
+      - supports-color
+
+  vite-plugin-solid@2.11.10(solid-js@1.9.11)(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)):
+    dependencies:
+      '@babel/core': 7.29.0
+      '@types/babel__core': 7.20.5
+      babel-preset-solid: 1.9.10(@babel/core@7.29.0)(solid-js@1.9.11)
+      merge-anything: 5.1.7
+      solid-js: 1.9.11
+      solid-refresh: 0.6.3(solid-js@1.9.11)
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+      vitefu: 1.1.1(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+    transitivePeerDependencies:
+      - supports-color
+
+  vite-plugin-vue-tracer@1.2.0(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))(vue@3.5.28(typescript@5.9.3)):
+    dependencies:
+      estree-walker: 3.0.3
+      exsolve: 1.0.8
+      magic-string: 0.30.21
+      pathe: 2.0.3
+      source-map-js: 1.2.1
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+      vue: 3.5.28(typescript@5.9.3)
+
+  vite@6.4.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2):
+    dependencies:
+      esbuild: 0.25.12
+      fdir: 6.5.0(picomatch@4.0.3)
+      picomatch: 4.0.3
+      postcss: 8.5.6
+      rollup: 4.57.1
+      tinyglobby: 0.2.15
+    optionalDependencies:
+      '@types/node': 24.10.13
+      fsevents: 2.3.3
+      jiti: 2.6.1
+      lightningcss: 1.31.1
+      terser: 5.46.0
+      tsx: 4.20.6
+      yaml: 2.8.2
+
+  vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2):
+    dependencies:
+      esbuild: 0.27.3
+      fdir: 6.5.0(picomatch@4.0.3)
+      picomatch: 4.0.3
+      postcss: 8.5.6
+      rollup: 4.57.1
+      tinyglobby: 0.2.15
+    optionalDependencies:
+      '@types/node': 24.10.13
+      fsevents: 2.3.3
+      jiti: 2.6.1
+      lightningcss: 1.31.1
+      terser: 5.46.0
+      tsx: 4.20.6
+      yaml: 2.8.2
+
+  vite@7.3.1(@types/node@24.3.0)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2):
+    dependencies:
+      esbuild: 0.27.3
+      fdir: 6.5.0(picomatch@4.0.3)
+      picomatch: 4.0.3
+      postcss: 8.5.6
+      rollup: 4.57.1
+      tinyglobby: 0.2.15
+    optionalDependencies:
+      '@types/node': 24.3.0
+      fsevents: 2.3.3
+      jiti: 2.6.1
+      lightningcss: 1.31.1
+      terser: 5.46.0
+      tsx: 4.20.6
+      yaml: 2.8.2
+
+  vitefu@1.1.1(vite@7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)):
+    optionalDependencies:
+      vite: 7.3.1(@types/node@24.10.13)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+
+  vitest@4.0.18(@types/node@24.3.0)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2):
+    dependencies:
+      '@vitest/expect': 4.0.18
+      '@vitest/mocker': 4.0.18(vite@7.3.1(@types/node@24.3.0)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2))
+      '@vitest/pretty-format': 4.0.18
+      '@vitest/runner': 4.0.18
+      '@vitest/snapshot': 4.0.18
+      '@vitest/spy': 4.0.18
+      '@vitest/utils': 4.0.18
+      es-module-lexer: 1.7.0
+      expect-type: 1.3.0
+      magic-string: 0.30.21
+      obug: 2.1.1
+      pathe: 2.0.3
+      picomatch: 4.0.3
+      std-env: 3.10.0
+      tinybench: 2.9.0
+      tinyexec: 1.0.2
+      tinyglobby: 0.2.15
+      tinyrainbow: 3.0.3
+      vite: 7.3.1(@types/node@24.3.0)(jiti@2.6.1)(lightningcss@1.31.1)(terser@5.46.0)(tsx@4.20.6)(yaml@2.8.2)
+      why-is-node-running: 2.3.0
+    optionalDependencies:
+      '@types/node': 24.3.0
+    transitivePeerDependencies:
+      - jiti
+      - less
+      - lightningcss
+      - msw
+      - sass
+      - sass-embedded
+      - stylus
+      - sugarss
+      - terser
+      - tsx
+      - yaml
+
+  vscode-uri@3.1.0: {}
+
+  vue-bundle-renderer@2.2.0:
+    dependencies:
+      ufo: 1.6.3
+
+  vue-devtools-stub@0.1.0: {}
+
+  vue-router@4.6.4(vue@3.5.28(typescript@5.9.3)):
+    dependencies:
+      '@vue/devtools-api': 6.6.4
+      vue: 3.5.28(typescript@5.9.3)
+
+  vue-tsc@3.2.4(typescript@5.9.3):
+    dependencies:
+      '@volar/typescript': 2.4.27
+      '@vue/language-core': 3.2.4
+      typescript: 5.9.3
+
+  vue@3.5.28(typescript@5.9.3):
+    dependencies:
+      '@vue/compiler-dom': 3.5.28
+      '@vue/compiler-sfc': 3.5.28
+      '@vue/runtime-dom': 3.5.28
+      '@vue/server-renderer': 3.5.28(vue@3.5.28(typescript@5.9.3))
+      '@vue/shared': 3.5.28
+    optionalDependencies:
+      typescript: 5.9.3
+
+  webidl-conversions@3.0.1: {}
+
+  webidl-conversions@4.0.2: {}
+
+  webpack-virtual-modules@0.6.2: {}
+
+  whatwg-url@5.0.0:
+    dependencies:
+      tr46: 0.0.3
+      webidl-conversions: 3.0.1
+
+  whatwg-url@7.1.0:
+    dependencies:
+      lodash.sortby: 4.7.0
+      tr46: 1.0.1
+      webidl-conversions: 4.0.2
+
+  which-boxed-primitive@1.1.1:
+    dependencies:
+      is-bigint: 1.1.0
+      is-boolean-object: 1.2.2
+      is-number-object: 1.1.1
+      is-string: 1.1.1
+      is-symbol: 1.1.1
+
+  which-builtin-type@1.2.1:
+    dependencies:
+      call-bound: 1.0.4
+      function.prototype.name: 1.1.8
+      has-tostringtag: 1.0.2
+      is-async-function: 2.1.1
+      is-date-object: 1.1.0
+      is-finalizationregistry: 1.1.1
+      is-generator-function: 1.1.2
+      is-regex: 1.2.1
+      is-weakref: 1.1.1
+      isarray: 2.0.5
+      which-boxed-primitive: 1.1.1
+      which-collection: 1.0.2
+      which-typed-array: 1.1.20
+
+  which-collection@1.0.2:
+    dependencies:
+      is-map: 2.0.3
+      is-set: 2.0.3
+      is-weakmap: 2.0.2
+      is-weakset: 2.0.4
+
+  which-typed-array@1.1.20:
+    dependencies:
+      available-typed-arrays: 1.0.7
+      call-bind: 1.0.8
+      call-bound: 1.0.4
+      for-each: 0.3.5
+      get-proto: 1.0.1
+      gopd: 1.2.0
+      has-tostringtag: 1.0.2
+
+  which@2.0.2:
+    dependencies:
+      isexe: 2.0.0
+
+  which@4.0.0:
+    dependencies:
+      isexe: 3.1.5
+
+  which@5.0.0:
+    dependencies:
+      isexe: 3.1.5
+
+  why-is-node-running@2.3.0:
+    dependencies:
+      siginfo: 2.0.0
+      stackback: 0.0.2
+
+  widest-line@5.0.0:
+    dependencies:
+      string-width: 7.2.0
+
+  word-wrap@1.2.5: {}
+
+  wrap-ansi@7.0.0:
+    dependencies:
+      ansi-styles: 4.3.0
+      string-width: 4.2.3
+      strip-ansi: 6.0.1
+
+  wrap-ansi@8.1.0:
+    dependencies:
+      ansi-styles: 6.2.3
+      string-width: 5.1.2
+      strip-ansi: 7.1.2
+
+  wrap-ansi@9.0.2:
+    dependencies:
+      ansi-styles: 6.2.3
+      string-width: 7.2.0
+      strip-ansi: 7.1.2
+
+  ws@8.19.0: {}
+
+  wsl-utils@0.1.0:
+    dependencies:
+      is-wsl: 3.1.1
+
+  y18n@5.0.8: {}
+
+  yallist@3.1.1: {}
+
+  yallist@5.0.0: {}
+
+  yaml@2.8.2: {}
+
+  yargs-parser@21.1.1: {}
+
+  yargs@17.7.2:
+    dependencies:
+      cliui: 8.0.1
+      escalade: 3.2.0
+      get-caller-file: 2.0.5
+      require-directory: 2.1.1
+      string-width: 4.2.3
+      y18n: 5.0.8
+      yargs-parser: 21.1.1
+
+  yocto-queue@0.1.0: {}
+
+  youch-core@0.3.3:
+    dependencies:
+      '@poppinss/exception': 1.2.3
+      error-stack-parser-es: 1.0.5
+
+  youch@4.1.0-beta.14:
+    dependencies:
+      '@poppinss/colors': 4.1.6
+      '@poppinss/dumper': 0.6.5
+      '@speed-highlight/core': 1.2.14
+      cookie-es: 2.0.0
+      youch-core: 0.3.3
+
+  zimmerframe@1.1.4: {}
+
+  zip-stream@6.0.1:
+    dependencies:
+      archiver-utils: 5.0.2
+      compress-commons: 6.0.2
+      readable-stream: 4.7.0
+
+  zod-validation-error@4.0.2(zod@4.3.6):
+    dependencies:
+      zod: 4.3.6
+
+  zod@4.3.6: {}
+
+  zwitch@2.0.4: {}
diff --git a/pnpm-workspace.yaml b/pnpm-workspace.yaml
new file mode 100644
index 0000000..b2deb25
--- /dev/null
+++ b/pnpm-workspace.yaml
@@ -0,0 +1,3 @@
+packages:
+  - "packages/*"
+  - "example/*"
diff --git a/scripts/sync-version.js b/scripts/sync-version.js
deleted file mode 100644
index 0bf2757..0000000
--- a/scripts/sync-version.js
+++ /dev/null
@@ -1,15 +0,0 @@
-import fs from "node:fs";
-
-// Read and parse package.json to get the new version
-const packageJsonFile = fs.readFileSync("package.json", "utf8");
-const packageJson = JSON.parse(packageJsonFile);
-const newVersion = packageJson.version;
-
-// Read the deno.json file as a string
-const denoJsonContent = fs.readFileSync("deno.json", "utf8");
-
-// Write the modified string back to deno.json
-fs.writeFileSync(
-  "deno.json",
-  denoJsonContent.replace(/"version":\s*"[^"]*"/, `"version": "${newVersion}"`),
-);
diff --git a/scripts/update-readme.ts b/scripts/update-readme.ts
deleted file mode 100644
index 6ac4d32..0000000
--- a/scripts/update-readme.ts
+++ /dev/null
@@ -1,193 +0,0 @@
-/**
- * Script to parse README.md and generate documentation within delimiters.
- *
- * Delimiters:
- *  startDefinition: <!-- md:generate defineConfig
- *  startCode: -->
- *  end: <!-- /md:generate -->
- */
-
-import { join } from "node:path";
-import { pathToFileURL } from "node:url";
-import { md } from "mdbox";
-
-const README_PATH = join(Deno.cwd(), "README.md");
-
-const START_DEFINITION = "<!-- md:generate defineConfig"; // begins the TS snippet line
-const START_CODE = "-->"; // marks end of TS header section
-const END_BLOCK = "<!-- /md:generate -->"; // marks end of whole block
-
-// Template generator
-function buildReplacement(tsSource: string, css: string): string {
-  const tsBlock = md.codeBlock(tsSource.trim(), "typescript");
-  const cssBlock = md.codeBlock(css.trim(), "css");
-  // Only return the inner content to place between START_CODE and END_BLOCK
-  return [
-    "",
-    tsBlock,
-    "",
-    "This will generate the following CSS :",
-    "",
-    cssBlock,
-    "",
-  ].join("\n");
-}
-
-function wrapSource(tsSource: string): string {
-  const hasDefaultExport = /export\s+default\s+/m.test(tsSource);
-  const hasDefineConfigCall = /defineConfig\s*\(/m.test(tsSource);
-  const hasConfigVar = /\bconst\s+config\b|\blet\s+config\b|\bvar\s+config\b/m.test(
-    tsSource,
-  );
-  const srcModUrl = pathToFileURL(join(Deno.cwd(), "src", "mod.ts")).href;
-  const importLine = `import { defineConfig } from "${srcModUrl}";\n`;
-
-  // Normalize to create a default export expression
-  let normalized = tsSource.trim();
-  if (!hasDefaultExport) {
-    if (hasConfigVar) {
-      normalized = `${normalized}\nexport default config;`;
-    } else if (hasDefineConfigCall) {
-      // The snippet likely ends with defineConfig({...}) without export; wrap by assigning to config
-      normalized = `const config = (${
-        normalized.replace(/;?\s*$/, "")
-      });\nexport default config;`;
-    } else {
-      // As a last resort, try to wrap the whole snippet into defineConfig
-      normalized = `const config = defineConfig(${normalized});\nexport default config;`;
-    }
-  }
-
-  return `${importLine}${normalized}\n`;
-}
-
-// Parse all blocks functionally
-async function processReadme(): Promise<boolean> {
-  const original = await Deno.readTextFile(README_PATH);
-  const lines = original.split(/\r?\n/);
-
-  type Block = { startIdx: number; codeIdx: number; endIdx: number };
-  const blocks: Block[] = [];
-
-  // Single pass to collect indices
-  for (let i = 0; i < lines.length; i++) {
-    if (lines[i].startsWith(START_DEFINITION)) {
-      let codeIdx = -1;
-      let endIdx = -1;
-      for (let j = i + 1; j < lines.length; j++) {
-        if (lines[j].trim() === START_CODE) {
-          codeIdx = j;
-        } else if (lines[j].trim() === END_BLOCK) {
-          endIdx = j;
-          break;
-        }
-      }
-      if (codeIdx !== -1 && endIdx !== -1) {
-        blocks.push({ startIdx: i, codeIdx, endIdx });
-        i = endIdx; // jump forward
-      }
-    }
-  }
-
-  if (blocks.length === 0) {
-    console.log("No md:generate blocks found.");
-    return false;
-  }
-
-  // We'll rebuild the README with replacements
-  const resultLines: string[] = [];
-  let cursor = 0;
-
-  // Prepare temp dir
-  const tempRoot = await Deno.makeTempDir({ prefix: "cssforge-readme-" });
-  // temp dir already created by makeTempDir
-
-  for (const block of blocks) {
-    // Push lines before the block untouched
-    while (cursor < block.startIdx) {
-      resultLines.push(lines[cursor++]);
-    }
-
-    // Extract TS between startDefinition (exclusive) and START_CODE (exclusive)
-    const tsPreLines = lines.slice(block.startIdx + 1, block.codeIdx);
-    const tsSource = tsPreLines.filter((l) => !l.trim().startsWith("```")).join("\n")
-      .trim();
-
-    // Create a temporary config file containing the snippet and an import for defineConfig.
-    const tempConfigPath = join(tempRoot, `config-${crypto.randomUUID()}.ts`);
-
-    const wrappedSource = wrapSource(tsSource);
-
-    await Deno.writeTextFile(tempConfigPath, wrappedSource);
-
-    // Run CLI to generate CSS output into a temp file
-    const tempCssPath = join(tempRoot, `output-${crypto.randomUUID()}.css`);
-    const cliPath = join(Deno.cwd(), "src", "cli.ts");
-    const cmd = new Deno.Command("deno", {
-      args: [
-        "run",
-        "-A",
-        cliPath,
-        "--config",
-        tempConfigPath,
-        "--mode",
-        "css",
-        "--css",
-        tempCssPath,
-      ],
-      stdout: "piped",
-      stderr: "piped",
-    });
-    const res = await cmd.output();
-    if (!res.success) {
-      const stdErr = new TextDecoder().decode(res.stderr);
-      console.error("CLI error:\n", stdErr);
-      throw new Error("CLI execution failed");
-    }
-    const css = await Deno.readTextFile(tempCssPath);
-
-    // Build newly generated content (to be placed between START_CODE and END_BLOCK)
-    const replacement = buildReplacement(tsSource, css);
-
-    // Keep startDefinition line
-    resultLines.push(lines[block.startIdx]);
-    // Preserve original snippet as source of truth
-    for (let k = block.startIdx + 1; k < block.codeIdx; k++) {
-      resultLines.push(lines[k]);
-    }
-    // Keep START_CODE line
-    resultLines.push(lines[block.codeIdx]);
-    // Insert fresh generated content (replace anything previously between START_CODE and END_BLOCK)
-    if (replacement.length) {
-      resultLines.push(replacement);
-    }
-    // Keep END_BLOCK line
-    resultLines.push(lines[block.endIdx]);
-
-    cursor = block.endIdx + 1; // Skip past the entire old block
-  }
-
-  // Append any trailing lines
-  while (cursor < lines.length) {
-    resultLines.push(lines[cursor++]);
-  }
-
-  // Cleanup temp dir
-  try {
-    await Deno.remove(tempRoot, { recursive: true });
-  } catch (e) {
-    console.warn("Failed to remove temp directory", e);
-  }
-
-  const updated = resultLines.join("\n");
-  if (updated !== original) {
-    await Deno.writeTextFile(README_PATH, updated);
-    console.log("README.md updated successfully.");
-    return true;
-  } else {
-    console.log("README.md had no changes.");
-    return false;
-  }
-}
-
-await processReadme();
diff --git a/skills/cssforge/SKILL.md b/skills/cssforge/SKILL.md
new file mode 100644
index 0000000..c829bec
--- /dev/null
+++ b/skills/cssforge/SKILL.md
@@ -0,0 +1,52 @@
+---
+name: cssforge
+description: Use CSS Forge documentation and source schema to create, update, and troubleshoot cssforge.config.ts files, then generate CSS/JSON/TS outputs correctly.
+---
+
+# CSS Forge Skill
+
+Use this skill when a user wants to use CSS Forge itself: author token configs, generate
+artifacts, resolve variable references, or debug generation issues.
+
+## Source of truth
+
+Always prioritize official project docs and source types:
+
+1. `references/docs-index.md`
+2. `README.md` (project root)
+3. `references/source-schema-map.md`
+4. `references/cli-reference.md`
+5. `references/troubleshooting.md`
+
+Do not invent schema fields that are not present in docs or source types.
+
+## Workflow
+
+1. Confirm the user goal
+- New config from scratch
+- Extend existing config (colors, spacing, typography, primitives)
+- Fix references / generation errors
+- Wire CLI scripts and output paths
+
+2. Author config from docs
+- Start from `assets/config-templates/*.ts`.
+- Use package import in config:
+  - `import { defineConfig } from "@hebilicious/cssforge";`
+- Mirror patterns from README configuration sections.
+
+3. Configure generation commands
+- For local repo examples, link the package in deps:
+  - `"@hebilicious/cssforge": "file:../.."`
+- Add local package dry-run build script when working in this repo examples:
+  - `cssforge-build-local`: `moon run cssforge:jsr-dry-run`
+- Add generation script:
+  - `cssforge-generate`: `tsx ../../packages/cssforge/src/cli.ts --prefix . --config ./cssforge.config.ts --mode css --css ./.cssforge/output.css`
+
+4. Validate outputs
+- Run `moon run <project>:cssforge-build-local` then `moon run <project>:cssforge-generate`.
+- Verify `./.cssforge/output.css` exists and contains expected custom properties.
+
+5. Troubleshoot with docs
+- Use `references/troubleshooting.md` and relevant README sections.
+- For schema uncertainty, check `packages/cssforge/src/config.ts` and module types listed in
+  `references/source-schema-map.md`.
diff --git a/skills/cssforge/assets/config-templates/minimal.ts b/skills/cssforge/assets/config-templates/minimal.ts
new file mode 100644
index 0000000..320521f
--- /dev/null
+++ b/skills/cssforge/assets/config-templates/minimal.ts
@@ -0,0 +1,29 @@
+import { defineConfig } from "@hebilicious/cssforge";
+
+export default defineConfig({
+  colors: {
+    palette: {
+      value: {
+        brand: {
+          value: {
+            primary: "#1d4ed8",
+            accent: "#f97316",
+            surface: "#0f172a",
+          },
+        },
+      },
+    },
+  },
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          1: "4px",
+          2: "8px",
+          3: "12px",
+          4: "16px",
+        },
+      },
+    },
+  },
+});
diff --git a/skills/cssforge/assets/config-templates/tailwind.ts b/skills/cssforge/assets/config-templates/tailwind.ts
new file mode 100644
index 0000000..b8dc5cb
--- /dev/null
+++ b/skills/cssforge/assets/config-templates/tailwind.ts
@@ -0,0 +1,46 @@
+import { defineConfig } from "@hebilicious/cssforge";
+
+export default defineConfig({
+  colors: {
+    palette: {
+      value: {
+        brand: {
+          value: {
+            primary: "#1d4ed8",
+            accent: "#f97316",
+            surface: "#0f172a",
+          },
+        },
+      },
+    },
+  },
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          1: "4px",
+          2: "8px",
+          3: "12px",
+          4: "16px",
+        },
+      },
+    },
+  },
+  typography: {
+    fluid: {
+      base: {
+        value: {
+          minWidth: 320,
+          minFontSize: 16,
+          minTypeScale: 1.2,
+          maxWidth: 1280,
+          maxFontSize: 18,
+          maxTypeScale: 1.25,
+          negativeSteps: 1,
+          positiveSteps: 2,
+          prefix: "text",
+        },
+      },
+    },
+  },
+});
diff --git a/skills/cssforge/assets/config-templates/vanilla-css.ts b/skills/cssforge/assets/config-templates/vanilla-css.ts
new file mode 100644
index 0000000..b8744c2
--- /dev/null
+++ b/skills/cssforge/assets/config-templates/vanilla-css.ts
@@ -0,0 +1,26 @@
+import { defineConfig } from "@hebilicious/cssforge";
+
+export default defineConfig({
+  colors: {
+    palette: {
+      value: {
+        brand: {
+          value: {
+            primary: "#1d4ed8",
+            surface: "#0f172a",
+          },
+        },
+      },
+    },
+  },
+  spacing: {
+    custom: {
+      size: {
+        value: {
+          2: "8px",
+          4: "16px",
+        },
+      },
+    },
+  },
+});
diff --git a/skills/cssforge/assets/snippets/css-import-tailwind.css b/skills/cssforge/assets/snippets/css-import-tailwind.css
new file mode 100644
index 0000000..64652bd
--- /dev/null
+++ b/skills/cssforge/assets/snippets/css-import-tailwind.css
@@ -0,0 +1,2 @@
+@import "../.cssforge/output.css" layer(cssforge);
+@import "tailwindcss";
diff --git a/skills/cssforge/assets/snippets/css-import-vanilla.css b/skills/cssforge/assets/snippets/css-import-vanilla.css
new file mode 100644
index 0000000..ca6930a
--- /dev/null
+++ b/skills/cssforge/assets/snippets/css-import-vanilla.css
@@ -0,0 +1 @@
+@import "../.cssforge/output.css" layer(cssforge);
diff --git a/skills/cssforge/references/cli-reference.md b/skills/cssforge/references/cli-reference.md
new file mode 100644
index 0000000..5647ae0
--- /dev/null
+++ b/skills/cssforge/references/cli-reference.md
@@ -0,0 +1,27 @@
+# CLI Reference
+
+CLI implementation: `packages/cssforge/src/cli.ts`
+
+## Supported args
+
+- `--watch`, `-w`: watch config file for changes
+- `--config`: config path (default `./cssforge.config.ts`)
+- `--mode`, `-m`: `css | json | ts | all` (default `all`)
+- `--prefix`: prefix prepended to all paths
+- `--css`: css output path (default `./.cssforge/output.css`)
+- `--json`: json output path (default `./.cssforge/output.json`)
+- `--ts`: ts output path (default `./.cssforge/output.ts`)
+
+## Typical commands from docs
+
+- Basic: `tsx ./node_modules/@hebilicious/cssforge/src/cli.ts`
+- Watch: `tsx ./node_modules/@hebilicious/cssforge/src/cli.ts --watch`
+- Custom paths:
+  - `tsx ./node_modules/@hebilicious/cssforge/src/cli.ts --config ./path/cssforge.config.ts --css ./dist/tokens.css --ts ./dist/tokens.ts --json ./dist/tokens.json --mode all`
+
+## Programmatic API
+
+From `README.md`:
+
+- `import { generateCSS } from "@hebilicious/cssforge";`
+- `const css = generateCSS(config);`
diff --git a/skills/cssforge/references/docs-index.md b/skills/cssforge/references/docs-index.md
new file mode 100644
index 0000000..ebbf92f
--- /dev/null
+++ b/skills/cssforge/references/docs-index.md
@@ -0,0 +1,31 @@
+# CSS Forge Docs Index
+
+This file maps user requests to official CSS Forge documentation.
+
+## Primary documentation
+
+- Local docs: `README.md`
+- Remote docs: `https://raw.githubusercontent.com/Hebilicious/cssforge/refs/heads/main/README.md`
+
+## What to read for each task
+
+- Installation and setup:
+  - `README.md` -> `## Installation`, `## Quick Start`
+- Token schema and examples:
+  - `README.md` -> `## Configuration`
+  - `### Colors`
+  - `### Spacing`
+  - `### Typography`
+  - `### Primitives`
+- Variable references inside config:
+  - `README.md` -> `## Referencing Variables`
+- CLI options and outputs:
+  - `README.md` -> `## CLI Usage`
+  - `references/cli-reference.md`
+- Programmatic usage:
+  - `README.md` -> `## Programmatic Usage`
+
+## Important rule from docs
+
+README `md:generate` comment blocks are source-of-truth examples. Keep their structure
+when adapting configs.
diff --git a/skills/cssforge/references/source-schema-map.md b/skills/cssforge/references/source-schema-map.md
new file mode 100644
index 0000000..e61fb9c
--- /dev/null
+++ b/skills/cssforge/references/source-schema-map.md
@@ -0,0 +1,28 @@
+# Source Schema Map
+
+When README examples are not enough, use source types.
+
+## Core config type
+
+- `packages/cssforge/src/config.ts`
+- `CSSForgeConfig` fields:
+  - `colors: ColorConfig`
+  - `typography: TypographyConfig`
+  - `spacing: SpacingConfig`
+  - `primitives: PrimitiveConfig`
+
+## Module type sources
+
+- Colors schema: `packages/cssforge/src/modules/colors.ts`
+- Spacing schema: `packages/cssforge/src/modules/spacing.ts`
+- Typography schema: `packages/cssforge/src/modules/typography.ts`
+- Primitives schema: `packages/cssforge/src/modules/primitive.ts`
+
+## Exposed API entrypoint
+
+- `packages/cssforge/src/mod.ts` exports `defineConfig`, `generateCSS`, and processing helpers.
+
+## Guidance
+
+If a user asks for a field not represented in docs or these types, do not fabricate it.
+Offer the nearest supported pattern from README + types.
diff --git a/skills/cssforge/references/token-patterns.md b/skills/cssforge/references/token-patterns.md
new file mode 100644
index 0000000..ff817f4
--- /dev/null
+++ b/skills/cssforge/references/token-patterns.md
@@ -0,0 +1,31 @@
+# Token Patterns From Official Docs
+
+All patterns below are derived from README configuration examples.
+
+## Colors
+
+- Palette tokens under `colors.palette.value`.
+- Supports color formats like hex/rgb/hsl/oklch and string values.
+- Themes and gradients can reference palette entries with `variables` maps.
+
+## Spacing
+
+- Static spacing under `spacing.custom`.
+- Fluid spacing under `spacing.fluid` using Utopia inputs.
+
+## Typography
+
+- Weights under `typography.weight`.
+- Fluid type scales under `typography.fluid` with optional custom labels/prefix.
+
+## Primitives
+
+- Use `primitives.<group>.value.<variant>`.
+- Compose from other tokens via `variables` references.
+
+## Reference syntax
+
+- Use dot notation without `.value` segments.
+- Fluid references use `@`, for example:
+  - spacing: `spacing_fluid.base@xs`
+  - typography: `typography_fluid.comicsans@a`
diff --git a/skills/cssforge/references/troubleshooting.md b/skills/cssforge/references/troubleshooting.md
new file mode 100644
index 0000000..0b4fa85
--- /dev/null
+++ b/skills/cssforge/references/troubleshooting.md
@@ -0,0 +1,29 @@
+# Troubleshooting (Docs-Driven)
+
+## Config import fails
+
+- Use package import in config:
+  - `import { defineConfig } from "@hebilicious/cssforge";`
+- If using local repo examples, run local package dry-run first:
+  - `moon run <project>:cssforge-build-local`
+
+## Generated output missing
+
+- Confirm CLI config path and output flags from `references/cli-reference.md`.
+- Run generation directly and inspect CLI error output.
+
+## Variables do not resolve
+
+- Verify reference syntax from README `## Referencing Variables`:
+  - No `.value` in references
+  - Fluid scales require `@label`
+
+## Unexpected variable names
+
+- Check README notes on naming behavior, including theme options such as
+  `variantNameOnly`.
+
+## Need authoritative schema answer
+
+- Check `references/source-schema-map.md` and referenced module type files before
+  changing config shape.
diff --git a/skills/moon b/skills/moon
new file mode 120000
index 0000000..5cab2f2
--- /dev/null
+++ b/skills/moon
@@ -0,0 +1 @@
+../.agents/skills/moon
\ No newline at end of file
diff --git a/skills/proto b/skills/proto
new file mode 120000
index 0000000..d3d42da
--- /dev/null
+++ b/skills/proto
@@ -0,0 +1 @@
+../.agents/skills/proto
\ No newline at end of file
diff --git a/src/cli.ts b/src/cli.ts
deleted file mode 100644
index fc5cf4e..0000000
--- a/src/cli.ts
+++ /dev/null
@@ -1,202 +0,0 @@
-/**
- * This module provides the command-line interface (CLI) for CSSForge.
- * It allows generating CSS variables from a configuration file, with options
- * to watch for changes and specify output formats.
- *
- * @module
- */
-import { defineCommand, runMain } from "citty";
-import chokidar from "chokidar";
-import fs from "node:fs/promises";
-import { resolve } from "node:path";
-import { generateCSS, generateJSON, generateTS } from "./generator.ts";
-import process from "node:process";
-import type { CSSForgeConfig } from "./config.ts";
-import type { CommandDef } from "citty";
-
-const writeFileRecursive = (path: string, data: string) =>
-  fs.mkdir(path.replace(/\/[^/]*$/, ""), { recursive: true }).then(() =>
-    fs.writeFile(path, data)
-  );
-
-/**
- * Defines the options for the build command.
- */
-export interface BuildOptions {
-  /** Path to the configuration file. */
-  config: string;
-  /** The output mode. */
-  mode: "css" | "json" | "ts" | "all";
-  /** Path for the CSS output file. */
-  cssOutput: string;
-  /** Path for the JSON output file. */
-  jsonOutput: string;
-  /** Path for the TypeScript output file. */
-  tsOutput: string;
-}
-
-/**
- * Builds the CSS, JSON, and/or TypeScript files based on the configuration.
- * @param options The build options.
- * @returns A promise that resolves to an object indicating success or failure.
- */
-export async function build(
-  { config, tsOutput, cssOutput, jsonOutput, mode }: BuildOptions,
-): Promise<{ success: boolean; error?: unknown }> {
-  try {
-    console.log({ config, tsOutput, cssOutput, jsonOutput, mode });
-    const absoluteconfig = resolve(process.cwd(), config);
-    const absoluteCssOutput = resolve(process.cwd(), cssOutput);
-    const absoluteJsonOutput = resolve(process.cwd(), jsonOutput);
-    const absoluteTsOutput = resolve(process.cwd(), tsOutput);
-
-    // Import config with cache busting
-    const userConfig = await import(`${absoluteconfig}?t=${Date.now()}`);
-
-    if (mode === "css" || mode === "all") {
-      await writeFileRecursive(
-        absoluteCssOutput,
-        generateCSS(userConfig.default as CSSForgeConfig),
-      );
-      console.log(`✔ Generated CSS written to ${cssOutput}`);
-    }
-
-    if (mode === "json" || mode === "all") {
-      await writeFileRecursive(
-        absoluteJsonOutput,
-        generateJSON(userConfig.default as CSSForgeConfig),
-      );
-      console.log(`✔ Generated JSON written to ${jsonOutput}`);
-    }
-
-    if (mode === "ts" || mode === "all") {
-      await writeFileRecursive(
-        absoluteTsOutput,
-        generateTS(userConfig.default as CSSForgeConfig),
-      );
-      console.log(`✔ Generated TypeScript written to ${tsOutput}`);
-    }
-
-    return { success: true };
-  } catch (error) {
-    console.error(`Error during build:`, error);
-    return { success: false, error };
-  }
-}
-
-/**
- * Defines the options for the watch command.
- */
-export interface WatchOptions extends BuildOptions {
-  /** A callback function to execute on rebuild. */
-  onRebuild?: () => void;
-}
-
-/**
- * Watches the configuration file for changes and rebuilds on modification.
- * @param options The watch options.
- * @returns A promise that resolves to a function to stop watching.
- */
-export async function watch(
-  { onRebuild, ...buildOptions }: WatchOptions,
-): Promise<() => void> {
-  console.log(`👀 Watching ${buildOptions.config} for changes...`);
-
-  // Initial build
-  await build(buildOptions);
-
-  // Watch for changes
-  const watcher = chokidar.watch(buildOptions.config, {
-    persistent: true,
-    ignoreInitial: true,
-  });
-
-  watcher.on("change", async () => {
-    console.log(`🔄 Config changed, regenerating...`);
-    await build(buildOptions);
-    onRebuild?.();
-  });
-
-  // Return cleanup function
-  return () => watcher.close();
-}
-
-const mainCommand = defineCommand({
-  meta: {
-    name: "cssforge",
-    version: "0.1.0",
-    description: "Generate CSS variables from a configuration file",
-  },
-  args: {
-    watch: {
-      type: "boolean",
-      description: "Watch for changes in the config file",
-      alias: "w",
-    },
-    config: {
-      type: "string",
-      description: "Path to the config file",
-      default: "./cssforge.config.ts",
-    },
-    mode: {
-      type: "string",
-      description: "Output mode (css, json, all)",
-      alias: "m",
-      default: "all",
-    },
-    "prefix": {
-      type: "string",
-      description: "A prefix applied before all path",
-      default: "",
-    },
-    "json": {
-      type: "string",
-      description: "Optional path for an output JSON file",
-      default: "./.cssforge/output.json",
-    },
-    "css": {
-      type: "string",
-      description: "Path for the output CSS file",
-      default: "./.cssforge/output.css",
-    },
-    "ts": {
-      type: "string",
-      description: "Path for the output TypeScript file",
-      default: "./.cssforge/output.ts",
-    },
-  },
-  async run({ args }) {
-    const { watch: shouldWatch, config, css, json, ts, mode, prefix } = args;
-    const realPath = (p: string) => resolve(prefix, p);
-    const settings = {
-      mode,
-      config: realPath(config),
-      cssOutput: realPath(css),
-      tsOutput: realPath(ts),
-      jsonOutput: realPath(json),
-    } as BuildOptions;
-    if (shouldWatch) {
-      const cleanup = await watch(settings);
-
-      // Handle process termination
-      process.on("SIGINT", () => {
-        cleanup();
-        console.log("\n🛑 Stopped watching");
-        process.exit(0);
-      });
-    } else {
-      const { success } = await build(settings);
-      process.exit(success ? 0 : 1);
-    }
-  },
-});
-
-// Run if called directly
-if (import.meta.main) {
-  runMain(mainCommand);
-}
-
-/**
- * The main command definition for the CSSForge CLI.
- */
-export default mainCommand as CommandDef;
diff --git a/src/generator.ts b/src/generator.ts
deleted file mode 100644
index 131ed9a..0000000
--- a/src/generator.ts
+++ /dev/null
@@ -1,218 +0,0 @@
-import {
-  type CSSForgeConfig,
-  processColors,
-  processPrimitives,
-  processSpacing,
-  processTypography,
-} from "./mod.ts";
-
-import { deepMerge } from "@std/collections";
-import type { ResolveMap } from "./lib.ts";
-
-type CssValue = {
-  value: string;
-  key: string;
-  variable: string;
-};
-
-type ForgeValue = {
-  [key: string]: ForgeValue | CssValue;
-};
-
-/**
- * Creates a nested object structure of design tokens from a configuration.
- * @param config The CSSForge configuration.
- * @returns A nested object representing the design tokens.
- */
-export function createForgeValues(config: Partial<CSSForgeConfig>) {
-  type Input = readonly [string, CssValue];
-
-  /**
-   * Creates a nested object structure from a path string and a value.
-   * @example
-   * ```ts
-   * const path = ["a", "b", "c"];
-   * const value = { key: "--a-b-c", value: "1rem", variable: "--a-b-c: 1rem;" };
-   * const result = createNestedObject(path, value);
-   * // result: { a: { b: { c: { key: "--a-b-c", value: "1rem", variable: "--a-b-c: 1rem;" } } } }
-   * ```
-   */
-  function createNestedObject(path: string[], value: CssValue | ForgeValue): ForgeValue {
-    if (path.length === 0) {
-      return value as ForgeValue;
-    }
-    // Take the first segment of the path
-    const [currentKey, ...remainingPath] = path;
-
-    // Recursively build the nested object
-    return {
-      [currentKey]: createNestedObject(remainingPath, value),
-    };
-  }
-
-  /**
-   * Creates a deeply nested object from an array of path-value pairs.
-   * @example
-   * ```ts
-   * const input = [
-   *  ["a.b.c", { key: "--a-b-c", value: "1rem", variable: "--a-b-c: 1rem;" }],
-   *  ["a.b.d", { key: "--a-b-d", value: "2rem", variable: "--a-b-d: 2rem;" }]
-   * ];
-   * const result = createForgeValuesFromKeys(input);
-   * // result: { a: { b: { c: { key: "--a-b-c", value: "1rem", variable: "--a-b-c: 1rem;" }, d: { key: "--a-b-d", value: "2rem", variable: "--a-b-d: 2rem;" } } } }
-   * ```
-   */
-  function createForgeValuesFromKeys(input: Input[]): ForgeValue {
-    // Reduce the input array into a single merged object
-    return input.reduce((acc, [pathString, cssValues]) => {
-      // Split the path string into segments
-      const pathSegments = pathString.split(".");
-
-      // Create a nested object for this input
-      const nestedObject = createNestedObject(pathSegments, cssValues);
-
-      // Deep merge the new object with the accumulator
-      return deepMerge(acc, nestedObject);
-    }, {} as ForgeValue);
-  }
-
-  const forge = {
-    colors: config.colors ? processColors(config.colors) : undefined,
-    spacing: config.spacing ? processSpacing(config.spacing) : undefined,
-    typography: config.typography ? processTypography(config.typography) : undefined,
-    primitives: config.primitives
-      ? processPrimitives({
-        primitives: config.primitives,
-        colors: config.colors,
-        typography: config.typography,
-        spacing: config.spacing,
-      })
-      : undefined,
-  };
-  const jsonKeys = [];
-  for (const [_, value] of Object.entries(forge)) {
-    if (value) {
-      const mapArray = [...value.resolveMap.entries()];
-      jsonKeys.push(...mapArray);
-    }
-  }
-  const forgeValues = createForgeValuesFromKeys(jsonKeys);
-  return forgeValues;
-}
-
-/**
- * Generates a JSON string from the CSSForge configuration.
- * This can be used to create a JSON file with all the design tokens.
- * @example
- * ```ts
- * const config = defineConfig({ colors: { palette: { value: { red: { 100: { hex: "#ff0000" } } } } });
- * const json = generateJSON(config);
- * // json: "{\n  \"colors\": {\n    \"palette\": {\n      \"value\": {\n        \"red\": {\n          \"100\": {\n            \"key\": \"--color-red-100\",\n            \"value\": \"oklch(62.796% 0.25768 29.23388)\",\n            \"variable\": \"--color-red-100: oklch(62.796% 0.25768 29.23388);\"\n          }\n        }\n      }\n    }\n  }\n}"
- * ```
- */
-export function generateJSON(config: Partial<CSSForgeConfig>): string {
-  const forgeValues = createForgeValues(config);
-  return JSON.stringify(forgeValues, null, 2);
-}
-
-/**
- * Generates a TypeScript module from the CSSForge configuration.
- * This can be used to create a TypeScript file with all the design tokens, providing full type safety.
- * @example
- * ```ts
- * const config = defineConfig({ colors: { palette: { value: { red: { 100: { hex: "#ff0000" } } } } });
- * const ts = generateTS(config);
- * // ts: "export const cssForge = {\n  \"colors\": {\n    \"palette\": {\n      \"value\": {\n        \"red\": {\n          \"100\": {\n            \"key\": \"--color-red-100\",\n            \"value\": \"oklch(62.796% 0.25768 29.23388)\",\n            \"variable\": \"--color-red-100: oklch(62.796% 0.25768 29.23388);\"\n          }\n        }\n      }\n    }\n  }\n} as const;"
- * ```
- */
-export function generateTS(config: Partial<CSSForgeConfig>): string {
-  const forgeValues = createForgeValues(config);
-  const forgeValuesString = JSON.stringify(forgeValues, null, 2);
-  return `export const cssForge = ${forgeValuesString} as const;`;
-}
-
-/**
- * Generates a CSS string from the CSSForge configuration.
- * This is the main function to generate the CSS variables.
- * @example
- * ```ts
- * const config = defineConfig({ colors: { palette: { value: { red: { 100: { hex: "#ff0000" } } } } });
- * const css = generateCSS(config);
- * // css: "/*____ CSSForge ____*&#47;\n:root {\n/*____ Colors ____*&#47;\n/* Palette *&#47;\n--color-red-100: oklch(62.796% 0.25768 29.23388);\n}"
- * ```
- */
-export function generateCSS(config: Partial<CSSForgeConfig>): string {
-  const chunks: string[] = ["/*____ CSSForge ____*/", ":root {"];
-  const outsideChunks: string[] = [];
-  const processedConfig: {
-    [key: string]:
-      | { css: { root?: string; outside?: string }; resolveMap: ResolveMap }
-      | undefined;
-  } = {};
-
-  // Process colors if present
-  if (config.colors) {
-    processedConfig.colors = processColors(config.colors);
-    if (processedConfig.colors) {
-      if (processedConfig.colors.css.root) {
-        chunks.push("/*____ Colors ____*/");
-        chunks.push(processedConfig.colors.css.root);
-      }
-      if (processedConfig.colors.css.outside) {
-        outsideChunks.push(processedConfig.colors.css.outside);
-      }
-    }
-  }
-
-  // Process spacing if present
-  if (config.spacing) {
-    processedConfig.spacing = processSpacing(config.spacing);
-    if (processedConfig.spacing) {
-      if (processedConfig.spacing.css.root) {
-        chunks.push("/*____ Spacing ____*/");
-        chunks.push(processedConfig.spacing.css.root);
-      }
-      if (processedConfig.spacing.css.outside) {
-        outsideChunks.push(processedConfig.spacing.css.outside);
-      }
-    }
-  }
-
-  // Process Typography if present
-  if (config.typography) {
-    processedConfig.typography = processTypography(config.typography);
-    if (processedConfig.typography) {
-      if (processedConfig.typography.css.root) {
-        chunks.push("/*____ Typography ____*/");
-        chunks.push(processedConfig.typography.css.root);
-      }
-      if (processedConfig.typography.css.outside) {
-        outsideChunks.push(processedConfig.typography.css.outside);
-      }
-    }
-  }
-
-  if (config.primitives) {
-    const primitiveVars = processPrimitives({
-      primitives: config.primitives,
-      colors: config.colors,
-      typography: config.typography,
-      spacing: config.spacing,
-    });
-    if (primitiveVars) {
-      if (primitiveVars.css.root) {
-        chunks.push("/*____ Primitives ____*/");
-        chunks.push(primitiveVars.css.root);
-      }
-      if (primitiveVars.css.outside) {
-        outsideChunks.push(primitiveVars.css.outside);
-      }
-    }
-  }
-
-  chunks.push("}");
-
-  if (outsideChunks.length > 0) chunks.push(outsideChunks.join("\n"));
-
-  return chunks.join("\n");
-}
diff --git a/src/helpers.ts b/src/helpers.ts
deleted file mode 100644
index 2a8e7c7..0000000
--- a/src/helpers.ts
+++ /dev/null
@@ -1,55 +0,0 @@
-const reservedKeyWords = [
-  "spacing",
-  "spacing_fluid",
-  "typography",
-  "typography_fluid",
-  "theme",
-  "gradients",
-  "palette",
-];
-/**
- * Validates a name to ensure it doesn't contain invalid characters.
- * Throws an error if the name is invalid.
- * @example
- * ```ts
- * validateName("valid-name"); // returns true
- * validateName("invalid.name"); // throws error
- * ```
- */
-export function validateName(name: string): boolean {
-  if (
-    name.length === 0 || name.includes(".") || name === "value"
-  ) {
-    throw new Error(
-      `Invalid name: ${name}. Names must be non-empty strings that do not contain periods.`,
-    );
-  }
-  if (reservedKeyWords.includes(name)) {
-    throw new Error(
-      `Invalid name: ${name}. Names cannot be one of the reserved keywords: ${
-        reservedKeyWords.join(", ")
-      }`,
-    );
-  }
-  return true;
-}
-
-/**
- * Converts a pixel value to a rem value.
- * If the value is not in pixels, it returns the original value.
- * @example
- * ```ts
- * pxToRem({ value: "16px" }); // "1rem"
- * pxToRem({ value: "1rem" }); // "1rem"
- * pxToRem({ value: "32px", rem: 16 }); // "2rem"
- * ```
- */
-export function pxToRem({ value, rem = 16 }: { value: string; rem?: number }): string {
-  const pxMatch = value.endsWith("px");
-  if (pxMatch) {
-    const pxValue = parseFloat(value.slice(0, -2));
-    const remValue = pxValue / rem;
-    return `${remValue}rem`;
-  }
-  return value;
-}
diff --git a/src/lib.ts b/src/lib.ts
deleted file mode 100644
index 6812bc4..0000000
--- a/src/lib.ts
+++ /dev/null
@@ -1,144 +0,0 @@
-/**
- * A map where keys are dot-separated paths and values are objects
- * containing the CSS variable key, its value, and the full variable declaration.
- */
-export type ResolveMap = Map<
-  string,
-  { key: string; value: string; variable: string }
->;
-
-/**
- * Represents the output of a processing function, containing the generated
- * CSS and a resolve map.
- */
-export interface Output {
-  /** The generated CSS strings. */
-  css: { root?: string; outside?: string };
-  /** A map for resolving variable paths. */
-  resolveMap: ResolveMap;
-}
-
-export interface Variables {
-  [key: string]: string;
-}
-
-interface Modules {
-  colors?: Output | null;
-  typography?: Output | null;
-  spacing?: Output | null;
-}
-
-interface ResolveVariableParams extends Modules {
-  varPath: string;
-}
-
-interface GetResolvedVariablesMapParams extends Modules {
-  variables: Variables | undefined;
-}
-/**
- * Resolves a variable path to its corresponding CSS variable name.
- * This function is used to resolve references to other design tokens.
- * @example
- * ```ts
- * const colors = {
- *  css: "--color-red-100: oklch(62.796% 0.25768 29.23388);",
- *  resolveMap: new Map([["colors.palette.value.red.100", { key: "--color-red-100", value: "oklch(62.796% 0.25768 29.23388)", variable: "--color-red-100: oklch(62.796% 0.25768 29.23388);" }]])
- * };
- * const varPath = "colors.palette.value.red.100";
- * const resolved = resolveVariable({ varPath, colors });
- * // resolved: "--color-red-100"
- * ```
- */
-function resolveVariable(
-  { varPath, colors, typography, spacing }: ResolveVariableParams,
-) {
-  const path = varPath.split(".");
-  const module = path[0];
-  //TODO: Make this configurable
-  const keyMap = {
-    palette: "palette",
-    gradients: "gradients",
-    theme: "theme",
-    typography: "typography",
-    typography_fluid: "typography_fluid",
-    spacing: "spacing",
-    spacing_fluid: "spacing_fluid",
-  };
-  switch (module) {
-    case keyMap.palette:
-    case keyMap.gradients:
-    case keyMap.theme: {
-      if (!colors) throw new Error("The colors object must be passed.");
-      const result = colors.resolveMap.get(varPath);
-      if (!result) {
-        throw new Error(
-          `The color path ${varPath} could not be resolved. Map contains ${
-            Array.from(colors.resolveMap.keys()).map((key) => `\n${key}`)
-          }`,
-        );
-      }
-      return result.key;
-    }
-    case keyMap.typography_fluid:
-    case keyMap.typography: {
-      if (!typography) throw new Error("The typography object must be passed.");
-      const result = typography.resolveMap.get(varPath);
-      if (!result) {
-        throw new Error(
-          `The typography path ${varPath} could not be resolved. Map contains ${
-            Array.from(typography.resolveMap.keys()).map((key) => `\n${key}`)
-          }`,
-        );
-      }
-      return result.key;
-    }
-    case keyMap.spacing:
-    case keyMap.spacing_fluid: {
-      if (!spacing) throw new Error("The spacing object must be passed.");
-      const result = spacing.resolveMap.get(varPath);
-      if (!result) {
-        throw new Error(
-          `The spacing path ${varPath} could not be resolved.  Map contains ${
-            Array.from(spacing.resolveMap.keys()).map((key) => `\n${key}`)
-          }`,
-        );
-      }
-      return result.key;
-    }
-    default:
-      throw new Error(`${module} is not implemented and can't be resolved.`);
-  }
-}
-
-/**
- * Generates a map of resolved CSS variable names from a variables object.
- * It uses the provided modules (colors, typography, spacing) to resolve the paths.
- */
-export const getResolvedVariablesMap = (
-  { variables, ...params }: GetResolvedVariablesMapParams,
-): Map<`--${string}`, string> => {
-  const resolvedVariables = variables
-    ? Object.entries(variables).map(
-      ([varKey, varPath]) => {
-        const resolved = resolveVariable({ varPath, ...params });
-        return [`--${varKey}`, resolved] as const;
-      },
-    )
-    : [];
-
-  const resolvedMap = new Map(resolvedVariables);
-  return resolvedMap;
-};
-
-/**
- * Resolves a CSS variable value using a map of variable paths.
- * It replaces occurrences of `var(--key)` in the value with the corresponding
- * CSS variable from the map.
- */
-export const resolveValue = (
-  { map, value }: { map: Map<string, string>; value: string },
-) =>
-  value.replace(
-    /var\(--(\w+)\)/g,
-    (_, key: string) => `var(${map.get(`--${key}`) ?? `--${key}`})`,
-  );
diff --git a/src/mod.ts b/src/mod.ts
deleted file mode 100644
index 6053b91..0000000
--- a/src/mod.ts
+++ /dev/null
@@ -1,59 +0,0 @@
-/**
- * This module provides the core functionalities of CSSForge, a tool for generating
- * CSS variables from a configuration file. It exports functions for processing
- * different aspects of a design system, such as colors, typography, and spacing,
- * as well as the main function to generate the final CSS.
- *
- * @module
- */
-import { generateCSS } from "./generator.ts";
-import { defineConfig } from "./config.ts";
-import { processColors } from "./modules/colors.ts";
-import { processTypography } from "./modules/typography.ts";
-import { processPrimitives } from "./modules/primitive.ts";
-import { processSpacing } from "./modules/spacing.ts";
-
-import type { CSSForgeConfig } from "./config.ts";
-/**
- * The main configuration object for CSSForge.
- */
-export type { CSSForgeConfig };
-
-export {
-  /**
-   * A helper function to define the CSSForge configuration with type inference.
-   * @param config The CSSForge configuration.
-   * @returns The configuration object.
-   */
-  defineConfig,
-  /**
-   * Generates the CSS string from a CSSForge configuration.
-   * @param config The CSSForge configuration.
-   * @returns The generated CSS string.
-   */
-  generateCSS,
-  /**
-   * Processes the colors section of the configuration.
-   * @param colors The colors configuration.
-   * @returns A map of CSS variables for colors.
-   */
-  processColors,
-  /**
-   * Processes the primitives section of the configuration.
-   * @param primitives The primitives configuration.
-   * @returns A map of CSS variables for primitives.
-   */
-  processPrimitives,
-  /**
-   * Processes the spacing section of the configuration.
-   * @param spacing The spacing configuration.
-   * @returns A map of CSS variables for spacing.
-   */
-  processSpacing,
-  /**
-   * Processes the typography section of the configuration.
-   * @param typography The typography configuration.
-   * @returns A map of CSS variables for typography.
-   */
-  processTypography,
-};
diff --git a/src/modules/colors.ts b/src/modules/colors.ts
deleted file mode 100644
index 4dfa24e..0000000
--- a/src/modules/colors.ts
+++ /dev/null
@@ -1,429 +0,0 @@
-import Color from "colorjs.io";
-import { type Output, type ResolveMap, resolveValue } from "../lib.ts";
-import { validateName } from "../helpers.ts";
-import { getResolvedVariablesMap } from "../lib.ts";
-import type { Variables } from "../lib.ts";
-
-type ExactlyOne<T> = {
-  [K in keyof T]:
-    & {
-      [P in K]: T[P];
-    }
-    & {
-      [P in Exclude<keyof T, K>]?: never;
-    };
-}[keyof T];
-
-interface PossibleColorValues {
-  hex: string;
-  rgb: readonly [number, number, number] | string;
-  hsl: readonly [number, number, number] | string;
-  oklch: readonly [number, number, number] | string;
-}
-
-type ColorValue = ExactlyOne<PossibleColorValues>;
-
-type ColorValueOrString = ColorValue | string;
-
-interface ColorVariants {
-  [key: string]: ColorValueOrString;
-}
-
-export interface WithCondition {
-  /**
-   * CSS selector to wrap variables in (e.g., ".MyClass"). This will be extracted out of the root.
-   */
-  selector?: string;
-  /**
-   * CSS at-rule to wrap variables in (e.g., "@supports (display: grid)")
-   */
-  atRule?: string;
-}
-/**
- * Settings for palette colors, including optional conditions like media queries.
- */
-export interface PaletteColorSettings extends WithCondition {}
-
-/**
- * Settings for gradients, including optional conditions like media queries.
- */
-export interface GradientSettings extends WithCondition {}
-
-/**
- * Settings for themes, including optional conditions like media queries.
- */
-export interface ThemeSettings extends WithCondition {}
-
-/**
- * A single palette color configuration with its values and optional settings.
- */
-export interface PaletteColorConfig {
-  value: ColorVariants;
-  settings?: PaletteColorSettings;
-}
-
-/**
- * A palette of colors, organized by name and variants.
- */
-export interface ColorPalette {
-  [key: string]: PaletteColorConfig;
-}
-
-interface GradientDefinition {
-  value: string;
-  variables?: Variables;
-  settings?: unknown;
-}
-
-interface GradientValue {
-  [key: string]: GradientDefinition;
-}
-
-/**
- * A single gradient definition.
- */
-export interface Gradient {
-  value: GradientValue;
-  settings?: GradientSettings;
-}
-
-/**
- * A collection of gradients.
- */
-export interface GradientConfig {
-  [key: string]: Gradient;
-}
-
-interface ColorInThemeValues {
-  [key: string]: string;
-}
-
-interface ColorInTheme {
-  value: ColorInThemeValues;
-  variables?: Variables;
-  settings?: {
-    /**
-     * Only include the variant name in the CSS variable name.
-     * --theme-light-colors-primaryBackground => --primaryBackground
-     */
-    variantNameOnly?: boolean;
-  };
-}
-
-export interface ThemeConfig {
-  value: {
-    [colorName: string]: ColorInTheme;
-  };
-  settings?: ThemeSettings;
-}
-
-export interface ColorTheme {
-  [themeName: string]: ThemeConfig;
-}
-
-/**
- * The main color configuration object.
- */
-export interface ColorConfig {
-  /**
-   * The color palette.
-   */
-  palette: {
-    value: ColorPalette;
-    settings?: unknown;
-  };
-  /**
-   * A collection of gradients.
-   */
-  gradients?: {
-    value: GradientConfig;
-    settings?: unknown;
-  };
-  /**
-   * A collection of themes.
-   */
-  theme?: {
-    [themeName: string]: ThemeConfig;
-  };
-}
-
-/**
- * Gets the color string from a color value object.
- * @example
- * ```ts
- * getColorString({ hex: "#ff0000" }); // "#ff0000"
- * getColorString({ rgb: [255, 0, 0] }); // "rgb(255,0,0)"
- * ```
- */
-function getColorString(value: ColorValue): string {
-  if ("hex" in value) {
-    return value.hex as string;
-  }
-
-  if ("rgb" in value) {
-    return Array.isArray(value.rgb)
-      ? `rgb(${(value.rgb as number[]).join(",")})`
-      : value.rgb as string;
-  }
-
-  if ("hsl" in value) {
-    return Array.isArray(value.hsl)
-      ? `hsl(${value.hsl[0]}deg ${value.hsl[1]}% ${value.hsl[2]}%)`
-      : value.hsl as string;
-  }
-
-  if ("oklch" in value) {
-    return Array.isArray(value.oklch)
-      ? `oklch(${(value.oklch as number[]).join(" ")})`
-      : value.oklch as string;
-  }
-
-  throw new Error("Invalid color value");
-}
-
-/**
- * Converts a color value to the OKLCH color space.
- * @example
- * ```ts
- * colorValueToOklch({ hex: "#ff0000" }); // "oklch(62.796% 0.25768 29.23388)"
- * colorValueToOklch("blue"); // "oklch(45.201% 0.31321 264.05202)"
- * ```
- */
-function colorValueToOklch(value: ColorValueOrString): string {
-  const colorString = typeof value === "string" ? value : getColorString(value);
-  const color = new Color(colorString);
-  const oklchColor = color.to("oklch");
-
-  const parsedCoords = oklchColor.coords.map((coord) => isNaN(coord) ? 0 : coord);
-  const l = Number(parsedCoords[0].toFixed(5));
-  const c = Number(parsedCoords[1].toFixed(5));
-  const h = Number(parsedCoords[2].toFixed(5));
-  const alpha = oklchColor.alpha === 1
-    ? ""
-    : ` / ${Number(oklchColor.alpha.toFixed(3)) * 100}%`;
-  return `oklch(${Number((l * 100).toFixed(3))}% ${c} ${h}${alpha})`;
-}
-
-/**
- * Processes the color configuration to generate CSS variables.
- * This includes palettes, gradients, and themes.
- * @example
- * ```ts
- * const colors = {
- *  palette: {
- *    value: {
- *      red: {
- *        100: { hex: "#ff0000" }
- *      }
- *    }
- *  }
- * };
- * const output = processColors(colors);
- * // output.css: "/* Palette * /;\n--color-red-100: oklch(62.796% 0.25768 29.23388);"
- * ```
- */
-export function processColors(colors: ColorConfig): Output {
-  const rootOutput: string[] = [];
-  const outsideOutput: string[] = [];
-  const resolveMap: ResolveMap = new Map();
-  rootOutput.push(`/* Palette */`);
-  const moduleKey = "palette";
-
-  function conditionalBuilder(
-    settings: WithCondition | undefined,
-    initialComment: string,
-  ) {
-    const innerComments: string[] = [];
-    const vars: string[] = [];
-
-    const hasSelector = Boolean(settings?.selector);
-    const hasAtRule = Boolean(settings?.atRule);
-
-    // If no settings provided, emit comment immediately into root output
-    if (!hasSelector && !hasAtRule) rootOutput.push(initialComment);
-
-    return {
-      addComment(c: string) {
-        if (hasSelector || hasAtRule) innerComments.push(c);
-        else rootOutput.push(c);
-      },
-      pushVariable(v: string) {
-        if (hasSelector || hasAtRule) vars.push(v);
-        else rootOutput.push(v);
-      },
-      finalize() {
-        if (!hasSelector && !hasAtRule) return;
-        if (vars.length === 0 && innerComments.length === 0) return;
-        if (!settings) return;
-        if (hasSelector && hasAtRule) {
-          outsideOutput.push(initialComment);
-          outsideOutput.push(`${settings.atRule} {`);
-          outsideOutput.push(`  ${settings.selector} {`);
-          outsideOutput.push(...innerComments.map((c) => `    ${c}`));
-          outsideOutput.push(...vars.map((v) => `    ${v}`));
-          outsideOutput.push(`  }`);
-          outsideOutput.push(`}`);
-          return;
-        }
-
-        if (hasSelector) {
-          outsideOutput.push(initialComment);
-          outsideOutput.push(`${settings.selector} {`);
-          outsideOutput.push(...innerComments.map((c) => `  ${c}`));
-          outsideOutput.push(...vars.map((v) => `  ${v}`));
-          outsideOutput.push(`}`);
-          return;
-        }
-
-        if (hasAtRule) {
-          rootOutput.push(initialComment);
-          rootOutput.push(`${settings.atRule} {`);
-          rootOutput.push(...innerComments.map((c) => `  ${c}`));
-          rootOutput.push(...vars.map((v) => `  ${v}`));
-          rootOutput.push(`}`);
-          return;
-        }
-      },
-    };
-  }
-
-  for (const [colorName, colorConfig] of Object.entries(colors.palette.value)) {
-    validateName(colorName);
-
-    try {
-      const handler = conditionalBuilder(
-        colorConfig.settings,
-        `/* ${colorName} */`,
-      );
-
-      for (const [variantId, colorValue] of Object.entries(colorConfig.value)) {
-        validateName(variantId);
-        const key = `--${moduleKey}-${colorName}-${variantId}`;
-        const value = colorValueToOklch(colorValue);
-        const variable = `${key}: ${value};`;
-
-        handler.pushVariable(variable);
-
-        resolveMap.set(
-          `${moduleKey}.${colorName}.${variantId}`,
-          { key, value, variable },
-        );
-      }
-
-      handler.finalize();
-    } catch (error) {
-      console.error(`Error processing color ${colorName}:`, error);
-    }
-  }
-
-  if (colors.gradients) {
-    rootOutput.push(`/* Gradients */`);
-    const moduleKey = "gradients";
-    const palette = {
-      css: { root: rootOutput.join("\n"), outside: outsideOutput.join("\n") },
-      resolveMap,
-    };
-
-    for (const [gradientName, gradient] of Object.entries(colors.gradients.value)) {
-      validateName(gradientName);
-      const handler = conditionalBuilder(gradient.settings, `/* ${gradientName} */`);
-
-      for (
-        const [variantName, { value, variables }] of Object.entries(
-          gradient.value,
-        )
-      ) {
-        validateName(variantName);
-        try {
-          const resolvedMapForGradient = getResolvedVariablesMap({
-            variables,
-            colors: palette,
-          });
-
-          const gradientValue = resolveValue({ map: resolvedMapForGradient, value });
-
-          const key = `--${moduleKey}-${gradientName}-${variantName}`;
-          const variable = `${key}: ${gradientValue};`;
-
-          handler.pushVariable(variable);
-
-          resolveMap.set(`${moduleKey}.${gradientName}.${variantName}`, {
-            variable,
-            key,
-            value: gradientValue,
-          });
-        } catch (error) {
-          console.error(
-            `Error processing gradient ${gradientName}-${variantName}:`,
-            error,
-          );
-          throw error;
-        }
-      }
-
-      handler.finalize();
-    }
-  }
-
-  if (colors.theme) {
-    rootOutput.push(`/* Themes */`);
-    const moduleKey = "theme";
-    const palette = {
-      css: { root: rootOutput.join("\n"), outside: outsideOutput.join("\n") },
-      resolveMap,
-    };
-
-    for (const [themeName, themeConfig] of Object.entries(colors.theme)) {
-      validateName(themeName);
-      const handler = conditionalBuilder(
-        themeConfig.settings,
-        `/* Theme: ${themeName} */`,
-      );
-
-      try {
-        for (const [colorName, colorInTheme] of Object.entries(themeConfig.value)) {
-          validateName(colorName);
-          const colorComment = `/* ${colorName} */`;
-          handler.addComment(colorComment);
-
-          const resolvedMap = getResolvedVariablesMap({
-            variables: colorInTheme.variables,
-            colors: palette,
-          });
-
-          const variantNameOnly = colorInTheme.settings?.variantNameOnly ?? false;
-          for (const [variantName, variantValue] of Object.entries(colorInTheme.value)) {
-            validateName(variantName);
-            const resolvedValue = resolveValue({
-              map: resolvedMap,
-              value: variantValue,
-            });
-
-            const key = variantNameOnly
-              ? `--${variantName}`
-              : `--${moduleKey}-${themeName}-${colorName}-${variantName}`;
-
-            const variable = `${key}: ${resolvedValue};`;
-
-            handler.pushVariable(variable);
-
-            resolveMap.set(
-              `${moduleKey}.${themeName}.${colorName}.${variantName}`,
-              { key, value: resolvedValue, variable },
-            );
-          }
-        }
-
-        handler.finalize();
-      } catch (error) {
-        console.error(`Error processing theme ${themeName}:`, error);
-      }
-    }
-  }
-
-  const output = {
-    css: { root: rootOutput.join("\n"), outside: outsideOutput.join("\n") },
-    resolveMap,
-  };
-  return output;
-}
diff --git a/src/modules/primitive.ts b/src/modules/primitive.ts
deleted file mode 100644
index b8965e7..0000000
--- a/src/modules/primitive.ts
+++ /dev/null
@@ -1,147 +0,0 @@
-import type { ColorConfig } from "./colors.ts";
-import { processColors } from "./colors.ts";
-import type { TypographyConfig } from "./typography.ts";
-import { processTypography } from "./typography.ts";
-import type { PixelSettings, SpacingConfig } from "./spacing.ts";
-import { processSpacing } from "./spacing.ts";
-import {
-  getResolvedVariablesMap,
-  type Output,
-  resolveValue,
-  type Variables,
-} from "../lib.ts";
-import { validateName } from "../helpers.ts";
-import { pxToRem } from "../helpers.ts";
-
-interface PrimitiveProperties {
-  [key: string]: string;
-}
-
-interface PrimitiveDefinition {
-  value: PrimitiveProperties;
-  variables?: Variables;
-  settings?: PixelSettings;
-}
-
-interface PrimitiveValue {
-  [key: string]: PrimitiveDefinition;
-}
-
-/**
- * A single primitive definition.
- */
-export interface Primitive {
-  value: PrimitiveValue;
-  settings?: unknown;
-}
-
-/**
- * A collection of primitives.
- */
-export interface PrimitiveConfig {
-  [key: string]: Primitive;
-}
-
-/**
- * Processes the primitive configuration to generate CSS variables.
- * Primitives can reference other design tokens from colors, typography, and spacing.
- * @example
- * ```ts
- * const config = {
- *  primitives: {
- *    button: {
- *      value: {
- *        default: {
- *          value: {
- *            "background-color": "var(--bg)",
- *          },
- *          variables: {
- *            "bg": "colors.palette.value.red.100",
- *          },
- *        },
- *      },
- *    },
- *  },
- *  colors: {
- *    palette: {
- *      value: {
- *        red: {
- *          100: { hex: "#ff0000" },
- *        },
- *      },
- *    },
- *  },
- * };
- * const output = processPrimitives(config);
- * // output.css: "/* button * / ;\n--button-default-background-color: var(--color-red-100);"
- * ```
- */
-export function processPrimitives(
-  config: {
-    primitives: PrimitiveConfig;
-    colors?: ColorConfig;
-    typography?: TypographyConfig;
-    spacing?: SpacingConfig;
-  },
-): Output {
-  const cssOutput: string[] = [];
-  const resolveMap = new Map();
-  const moduleKey = "primitives";
-  const colorVariables = config.colors ? processColors(config.colors) : null;
-  const typographyVariables = config.typography
-    ? processTypography(config.typography)
-    : null;
-  const spacingVariables = config.spacing ? processSpacing(config.spacing) : null;
-  for (const [primitiveName, primitive] of Object.entries(config.primitives)) {
-    validateName(primitiveName);
-    cssOutput.push(`/* ${primitiveName} */`);
-    for (
-      const [
-        variantName,
-        { value: properties, variables, settings = { pxToRem: true, rem: 16 } },
-      ] of Object.entries(
-        primitive.value,
-      )
-    ) {
-      validateName(variantName);
-      try {
-        const resolvedMap = getResolvedVariablesMap({
-          variables,
-          colors: colorVariables,
-          typography: typographyVariables,
-          spacing: spacingVariables,
-        });
-
-        for (const [propName, propValue] of Object.entries(properties)) {
-          validateName(propName);
-
-          const convertedValue = settings.pxToRem
-            ? pxToRem({ value: propValue, rem: settings.rem })
-            : propValue;
-
-          const resolvedValue = resolveValue({ map: resolvedMap, value: convertedValue });
-
-          const key = `--${primitiveName}-${variantName}-${propName}`;
-          const variable = `${key}: ${resolvedValue};`;
-          cssOutput.push(variable);
-          resolveMap.set(
-            `${moduleKey}.${primitiveName}.${variantName}.${propName}`,
-            {
-              key,
-              value: resolvedValue,
-              variable,
-            },
-          );
-        }
-      } catch (error) {
-        console.error(
-          `Error processing primitive ${primitiveName}-${variantName}:`,
-          error,
-        );
-        throw error;
-      }
-    }
-  }
-
-  return { css: { root: cssOutput.join("\n") }, resolveMap };
-}
diff --git a/src/modules/spacing.ts b/src/modules/spacing.ts
deleted file mode 100644
index 57bfe33..0000000
--- a/src/modules/spacing.ts
+++ /dev/null
@@ -1,128 +0,0 @@
-import type { UtopiaSpaceConfig } from "utopia-core";
-import { calculateSpaceScale } from "utopia-core";
-import { pxToRem, validateName } from "../helpers.ts";
-import type { Output, ResolveMap } from "../lib.ts";
-
-export interface FluidSpaceConfig {
-  value: UtopiaSpaceConfig & {
-    /**
-     * An optional prefix for the generated CSS variables.
-     */
-    prefix?: string;
-  };
-}
-
-type SpacingValue = string;
-
-interface SpacingScale {
-  [key: string]: SpacingValue;
-}
-
-/**
- * Settings for pixel to rem conversion.
- */
-export interface PixelSettings {
-  /**
-   * Whether to convert pixel values to rems.
-   * @default true
-   */
-  pxToRem?: boolean;
-  /**
-   * The base rem value to use for conversion.
-   * @default 16
-   */
-  rem?: number;
-}
-
-/**
- * The spacing configuration object.
- */
-export interface SpacingConfig {
-  /**
-   * Fluid spacing scales powered by utopia `calculateSpaceScale`.
-   * Each key defines one scale. Tokens are derived from the returned sizes' labels.
-   */
-  fluid?: {
-    [key: string]: FluidSpaceConfig;
-  };
-  /**
-   * Static spacing scales defined under the `custom` key.
-   * Each scale's `value` map contains token -> size (string) pairs.
-   */
-  custom?: {
-    [key: string]: { value: SpacingScale; settings?: PixelSettings };
-  };
-}
-
-/**
- * Convert spacing configuration into CSS custom properties.
- *
- * Generated variable naming:
- * - Custom scale: `--spacing-{scale}-{token}` (renamed from --space-)
- * - Fluid scale:  `--spacing_fluid-{prefixOrScale}-{token}` (renamed from --fluidspace-)
-
- *
- * @example
- * // Static + fluid combined
- * const { css } = processSpacing({
- *   fluid: {
- *     base: { value: { minSize: 4, maxSize: 24, minWidth: 320, maxWidth: 1280, negativeSteps: 0, positiveSteps: 2, prefix: "space" } }
- *   },
- *   custom: {
- *     gap: { value: { 1: "4px", 2: "8px" } }
- *   }
- * });
- */
-export function processSpacing(spacing: SpacingConfig): Output {
-  const cssOutput: string[] = [];
-  const resolveMap: ResolveMap = new Map();
-
-  if (spacing.fluid) {
-    const moduleKey = "spacing_fluid";
-    for (const [scaleName, { value }] of Object.entries(spacing.fluid)) {
-      validateName(scaleName);
-      const { prefix, ...utopiaConfig } = value;
-      if (prefix) validateName(prefix);
-
-      const { sizes, customPairs, oneUpPairs } = calculateSpaceScale(utopiaConfig);
-
-      const resolvedPrefix = prefix ? `${scaleName}-${prefix}` : scaleName;
-      for (const { label, clamp } of [sizes, customPairs, oneUpPairs].flat()) {
-        const variableName = `--${moduleKey}-${resolvedPrefix}-${label}`;
-        const cssVar = `${variableName}: ${clamp};`;
-        cssOutput.push(cssVar);
-        resolveMap.set(`${moduleKey}.${scaleName}@${label}`, {
-          variable: cssVar,
-          key: variableName,
-          value: clamp,
-        });
-      }
-    }
-  }
-
-  if (spacing.custom) {
-    const moduleKey = "spacing";
-    for (
-      const [scaleName, { value, settings = { pxToRem: true, rem: 16 } }] of Object
-        .entries(spacing.custom)
-    ) {
-      validateName(scaleName);
-      for (const [scaleKey, scaleValue] of Object.entries(value)) {
-        validateName(scaleKey);
-        const convertedValue = settings.pxToRem
-          ? pxToRem({ value: scaleValue, rem: settings.rem })
-          : scaleValue;
-        const varName = `--${moduleKey}-${scaleName}-${scaleKey}`;
-        const variable = `${varName}: ${convertedValue};`;
-        cssOutput.push(variable);
-        resolveMap.set(`${moduleKey}.custom.${scaleName}.${scaleKey}`, {
-          variable,
-          key: varName,
-          value: convertedValue,
-        });
-      }
-    }
-  }
-
-  return { css: { root: cssOutput.join("\n") }, resolveMap };
-}
diff --git a/src/modules/typography.ts b/src/modules/typography.ts
deleted file mode 100644
index 8b52ca8..0000000
--- a/src/modules/typography.ts
+++ /dev/null
@@ -1,123 +0,0 @@
-import { calculateTypeScale, type UtopiaTypeConfig } from "utopia-core";
-import type { Output, ResolveMap } from "../lib.ts";
-import { validateName } from "../helpers.ts";
-
-export interface FluidTypeScaleDefinition {
-  /**
-   * The configuration for the type scale generation.
-   */
-  value: Omit<UtopiaTypeConfig, "labelStyle"> & {
-    /**
-     * An optional prefix for the generated CSS variables.
-     */
-    prefix?: string;
-  };
-  /**
-   * Optional settings for the type scale.
-   */
-  settings?: {
-    /**
-     * Custom labels for the type scale steps.
-     */
-    customLabel?: Record<string, string>;
-  };
-}
-
-interface TypographyWeight {
-  value: {
-    [key: string]: string;
-  };
-}
-
-export interface TypographyConfig {
-  /**
-   * A fluid typescale definition.
-   */
-  fluid?: { [scaleName: string]: FluidTypeScaleDefinition };
-  /**
-   * A collection of font weights.
-   */
-  weight?: { [groupName: string]: TypographyWeight };
-}
-
-/**
- * Generate CSS Custom Properties for typography.
- *
- * @example
- * ```ts
- * const typography: TypographyConfig = {
- *   fluid: {
- *     base: {
- *       value: {
- *         minWidth: 320,
- *         minFontSize: 14,
- *         minTypeScale: 1.25,
- *         maxWidth: 1435,
- *         maxFontSize: 16,
- *         maxTypeScale: 1.25,
- *         positiveSteps: 2,
- *         negativeSteps: 1,
- *         prefix: "text",
- *       },
- *     },
- *   },
- *   weight: { arial: { value: { regular: "400", bold: "700" } } },
- * };
- * const { css } = processTypography(typography);
- * ```
- */
-export function processTypography(config: TypographyConfig): Output {
-  const cssOutput: string[] = [];
-  const resolveMap: ResolveMap = new Map();
-
-  if (config.fluid) {
-    const moduleKey = "typography_fluid";
-    for (const [scaleName, definition] of Object.entries(config.fluid)) {
-      validateName(scaleName);
-      const { value, settings } = definition;
-      const { prefix, ...utopiaConfig } = value;
-      if (prefix) validateName(prefix);
-
-      const scale = calculateTypeScale({
-        labelStyle: settings?.customLabel ? "utopia" : "tshirt",
-        ...utopiaConfig,
-      });
-
-      const resolvedPrefix = prefix ? `${scaleName}-${prefix}` : scaleName;
-      for (const { label, clamp } of scale) {
-        const resolvedLabel = settings?.customLabel
-          ? settings.customLabel[label] ?? label
-          : label;
-        const key = `--${moduleKey}-${resolvedPrefix}-${resolvedLabel}`;
-        const variable = `${key}: ${clamp};`;
-        cssOutput.push(variable);
-        resolveMap.set(`${moduleKey}.${scaleName}@${resolvedLabel}`, {
-          variable,
-          key,
-          value: clamp,
-        });
-      }
-    }
-  }
-
-  // Weights
-  if (config.weight) {
-    const moduleKey = "typography";
-    for (const [weightName, { value }] of Object.entries(config.weight)) {
-      validateName(weightName);
-      for (const [token, weightValue] of Object.entries(value)) {
-        validateName(token);
-        const key = `--${moduleKey}-weight-${weightName}-${token}`;
-        const variable = `${key}: ${weightValue};`;
-        cssOutput.push(variable);
-        resolveMap.set(`${moduleKey}.weight.${weightName}.${token}`, {
-          variable,
-          key,
-          value: weightValue,
-        });
-      }
-    }
-  }
-
-  return { css: { root: cssOutput.join("\n") }, resolveMap };
-}
diff --git a/tests/__snapshots__/colors.test.ts.snap b/tests/__snapshots__/colors.test.ts.snap
deleted file mode 100644
index 25a561f..0000000
--- a/tests/__snapshots__/colors.test.ts.snap
+++ /dev/null
@@ -1,460 +0,0 @@
-export const snapshot = {};
-
-snapshot[`processColors - converts hex to oklch 1`] = `
-"/* Palette */
-/* coral */
---palette-coral-100: oklch(73.511% 0.16799 40.24666);
---palette-coral-200: oklch(69.622% 0.19552 32.32143);"
-`;
-
-snapshot[`processColors - converts hex to oklch 2`] = `
-[
-  [
-    "palette.coral.100",
-    {
-      key: "--palette-coral-100",
-      value: "oklch(73.511% 0.16799 40.24666)",
-      variable: "--palette-coral-100: oklch(73.511% 0.16799 40.24666);",
-    },
-  ],
-  [
-    "palette.coral.200",
-    {
-      key: "--palette-coral-200",
-      value: "oklch(69.622% 0.19552 32.32143)",
-      variable: "--palette-coral-200: oklch(69.622% 0.19552 32.32143);",
-    },
-  ],
-]
-`;
-
-snapshot[`processColors - handles different color formats 1`] = `
-"/* Palette */
-/* brand */
---palette-brand-200: oklch(86.644% 0.29483 142.49535);
---palette-brand-300: oklch(45.201% 0.31321 264.05202);
---palette-brand-400: oklch(70% 0.2 270);
---palette-brand-default: oklch(62.796% 0.25768 29.23388);"
-`;
-
-snapshot[`processColors - handles different color formats 2`] = `
-[
-  [
-    "palette.brand.200",
-    {
-      key: "--palette-brand-200",
-      value: "oklch(86.644% 0.29483 142.49535)",
-      variable: "--palette-brand-200: oklch(86.644% 0.29483 142.49535);",
-    },
-  ],
-  [
-    "palette.brand.300",
-    {
-      key: "--palette-brand-300",
-      value: "oklch(45.201% 0.31321 264.05202)",
-      variable: "--palette-brand-300: oklch(45.201% 0.31321 264.05202);",
-    },
-  ],
-  [
-    "palette.brand.400",
-    {
-      key: "--palette-brand-400",
-      value: "oklch(70% 0.2 270)",
-      variable: "--palette-brand-400: oklch(70% 0.2 270);",
-    },
-  ],
-  [
-    "palette.brand.default",
-    {
-      key: "--palette-brand-default",
-      value: "oklch(62.796% 0.25768 29.23388)",
-      variable: "--palette-brand-default: oklch(62.796% 0.25768 29.23388);",
-    },
-  ],
-]
-`;
-
-snapshot[`processColors - handles string values 1`] = `
-"/* Palette */
-/* simple */
---palette-simple-white: oklch(100% 0 0);
---palette-simple-black: oklch(0% 0 0);"
-`;
-
-snapshot[`processColors - handles string values 2`] = `
-[
-  [
-    "palette.simple.white",
-    {
-      key: "--palette-simple-white",
-      value: "oklch(100% 0 0)",
-      variable: "--palette-simple-white: oklch(100% 0 0);",
-    },
-  ],
-  [
-    "palette.simple.black",
-    {
-      key: "--palette-simple-black",
-      value: "oklch(0% 0 0)",
-      variable: "--palette-simple-black: oklch(0% 0 0);",
-    },
-  ],
-]
-`;
-
-snapshot[`processColors - handles themes 1`] = `
-"/* Palette */
-/* simple */
---palette-simple-white: oklch(100% 0 0);
---palette-simple-black: oklch(0% 0 0);
-/* Themes */
-/* Theme: light */
-/* background */
---theme-light-background-primary: var(--palette-simple-white);
---theme-light-background-secondary: var(--palette-simple-black);"
-`;
-
-snapshot[`processColors - handles themes 2`] = `
-[
-  [
-    "palette.simple.white",
-    {
-      key: "--palette-simple-white",
-      value: "oklch(100% 0 0)",
-      variable: "--palette-simple-white: oklch(100% 0 0);",
-    },
-  ],
-  [
-    "palette.simple.black",
-    {
-      key: "--palette-simple-black",
-      value: "oklch(0% 0 0)",
-      variable: "--palette-simple-black: oklch(0% 0 0);",
-    },
-  ],
-  [
-    "theme.light.background.primary",
-    {
-      key: "--theme-light-background-primary",
-      value: "var(--palette-simple-white)",
-      variable: "--theme-light-background-primary: var(--palette-simple-white);",
-    },
-  ],
-  [
-    "theme.light.background.secondary",
-    {
-      key: "--theme-light-background-secondary",
-      value: "var(--palette-simple-black)",
-      variable: "--theme-light-background-secondary: var(--palette-simple-black);",
-    },
-  ],
-]
-`;
-
-snapshot[`processColors - handles transparency 1`] = `
-"/* Palette */
-/* alpha */
---palette-alpha-softGray1: oklch(14.48% 0 0 / 12%);
---palette-alpha-softGray2: oklch(14.48% 0 0 / 24%);"
-`;
-
-snapshot[`processColors - handles transparency 2`] = `
-[
-  [
-    "palette.alpha.softGray1",
-    {
-      key: "--palette-alpha-softGray1",
-      value: "oklch(14.48% 0 0 / 12%)",
-      variable: "--palette-alpha-softGray1: oklch(14.48% 0 0 / 12%);",
-    },
-  ],
-  [
-    "palette.alpha.softGray2",
-    {
-      key: "--palette-alpha-softGray2",
-      value: "oklch(14.48% 0 0 / 24%)",
-      variable: "--palette-alpha-softGray2: oklch(14.48% 0 0 / 24%);",
-    },
-  ],
-]
-`;
-
-snapshot[`processColors - generates gradient with color variables 1`] = `
-"/* Palette */
-/* coral */
---palette-coral-50: oklch(73.58% 0.16378 34.33822);
---palette-coral-90: oklch(73.341% 0.17338 44.64289);
---palette-coral-100: oklch(69.622% 0.19552 32.32143);
-/* indigo */
---palette-indigo-100: oklch(51.057% 0.23005 276.96564);
-/* Gradients */
-/* orangeGradient */
---gradients-orangeGradient-primary: linear-gradient(261.78deg, var(--palette-coral-50) 33.1%, var(--palette-coral-90) 56.3%, var(--palette-coral-100) 65.78%, var(--palette-indigo-100) 84.23%);"
-`;
-
-snapshot[`processColors - generates gradient with color variables 2`] = `
-[
-  [
-    "palette.coral.50",
-    {
-      key: "--palette-coral-50",
-      value: "oklch(73.58% 0.16378 34.33822)",
-      variable: "--palette-coral-50: oklch(73.58% 0.16378 34.33822);",
-    },
-  ],
-  [
-    "palette.coral.90",
-    {
-      key: "--palette-coral-90",
-      value: "oklch(73.341% 0.17338 44.64289)",
-      variable: "--palette-coral-90: oklch(73.341% 0.17338 44.64289);",
-    },
-  ],
-  [
-    "palette.coral.100",
-    {
-      key: "--palette-coral-100",
-      value: "oklch(69.622% 0.19552 32.32143)",
-      variable: "--palette-coral-100: oklch(69.622% 0.19552 32.32143);",
-    },
-  ],
-  [
-    "palette.indigo.100",
-    {
-      key: "--palette-indigo-100",
-      value: "oklch(51.057% 0.23005 276.96564)",
-      variable: "--palette-indigo-100: oklch(51.057% 0.23005 276.96564);",
-    },
-  ],
-  [
-    "gradients.orangeGradient.primary",
-    {
-      key: "--gradients-orangeGradient-primary",
-      value: "linear-gradient(261.78deg, var(--palette-coral-50) 33.1%, var(--palette-coral-90) 56.3%, var(--palette-coral-100) 65.78%, var(--palette-indigo-100) 84.23%)",
-      variable: "--gradients-orangeGradient-primary: linear-gradient(261.78deg, var(--palette-coral-50) 33.1%, var(--palette-coral-90) 56.3%, var(--palette-coral-100) 65.78%, var(--palette-indigo-100) 84.23%);",
-    },
-  ],
-]
-`;
-
-snapshot[`processColors - handles themes referencing gradients 1`] = `
-"/* Palette */
-/* coral */
---palette-coral-50: oklch(73.58% 0.16378 34.33822);
-/* Gradients */
-/* orangeGradient */
---gradients-orangeGradient-primary: linear-gradient(to right, var(--palette-coral-50), var(--palette-coral-50));
-/* Themes */
-/* Theme: light */
-/* background */
---theme-light-background-primary: var(--gradients-orangeGradient-primary);"
-`;
-
-snapshot[`processColors - handles themes referencing gradients 2`] = `
-[
-  [
-    "palette.coral.50",
-    {
-      key: "--palette-coral-50",
-      value: "oklch(73.58% 0.16378 34.33822)",
-      variable: "--palette-coral-50: oklch(73.58% 0.16378 34.33822);",
-    },
-  ],
-  [
-    "gradients.orangeGradient.primary",
-    {
-      key: "--gradients-orangeGradient-primary",
-      value: "linear-gradient(to right, var(--palette-coral-50), var(--palette-coral-50))",
-      variable: "--gradients-orangeGradient-primary: linear-gradient(to right, var(--palette-coral-50), var(--palette-coral-50));",
-    },
-  ],
-  [
-    "theme.light.background.primary",
-    {
-      key: "--theme-light-background-primary",
-      value: "var(--gradients-orangeGradient-primary)",
-      variable: "--theme-light-background-primary: var(--gradients-orangeGradient-primary);",
-    },
-  ],
-]
-`;
-
-snapshot[`processColors - handles gradients with atRule 1`] = `
-"/* Palette */
-/* coral */
---palette-coral-50: oklch(73.58% 0.16378 34.33822);
-/* Gradients */
-/* orangeGradient */
-@media (prefers-color-scheme: dark) {
-  --gradients-orangeGradient-primary: linear-gradient(to right, var(--palette-coral-50), var(--palette-coral-50));
-}"
-`;
-
-snapshot[`processColors - handles gradients with atRule 2`] = `
-[
-  [
-    "palette.coral.50",
-    {
-      key: "--palette-coral-50",
-      value: "oklch(73.58% 0.16378 34.33822)",
-      variable: "--palette-coral-50: oklch(73.58% 0.16378 34.33822);",
-    },
-  ],
-  [
-    "gradients.orangeGradient.primary",
-    {
-      key: "--gradients-orangeGradient-primary",
-      value: "linear-gradient(to right, var(--palette-coral-50), var(--palette-coral-50))",
-      variable: "--gradients-orangeGradient-primary: linear-gradient(to right, var(--palette-coral-50), var(--palette-coral-50));",
-    },
-  ],
-]
-`;
-
-snapshot[`processColors - handles palette colors with atRule 1`] = `
-"/* Palette */
-/* background */
---palette-background-light: oklch(100% 0 0);
-/* backgroundDark */
-@media (prefers-color-scheme: dark) {
-  --palette-backgroundDark-dark: oklch(0% 0 0);
-}"
-`;
-
-snapshot[`processColors - handles palette colors with atRule 2`] = `
-[
-  [
-    "palette.background.light",
-    {
-      key: "--palette-background-light",
-      value: "oklch(100% 0 0)",
-      variable: "--palette-background-light: oklch(100% 0 0);",
-    },
-  ],
-  [
-    "palette.backgroundDark.dark",
-    {
-      key: "--palette-backgroundDark-dark",
-      value: "oklch(0% 0 0)",
-      variable: "--palette-backgroundDark-dark: oklch(0% 0 0);",
-    },
-  ],
-]
-`;
-
-snapshot[`processColors - handles themes with selector 1`] = `
-"/* Palette */
-/* base */
---palette-base-primary: oklch(73.511% 0.16799 40.24666);
-/* Themes */
-/* Theme: dark */
-.dark-theme {
-  /* background */
-  --theme-dark-background-primary: var(--palette-base-primary);
-}"
-`;
-
-snapshot[`processColors - handles themes with selector 2`] = `
-[
-  [
-    "palette.base.primary",
-    {
-      key: "--palette-base-primary",
-      value: "oklch(73.511% 0.16799 40.24666)",
-      variable: "--palette-base-primary: oklch(73.511% 0.16799 40.24666);",
-    },
-  ],
-  [
-    "theme.dark.background.primary",
-    {
-      key: "--theme-dark-background-primary",
-      value: "var(--palette-base-primary)",
-      variable: "--theme-dark-background-primary: var(--palette-base-primary);",
-    },
-  ],
-]
-`;
-
-snapshot[`processColors - handles selector + atRule 1`] = `
-"/* Palette */
-/* base */
---palette-base-primary: oklch(73.511% 0.16799 40.24666);
-/* Themes */
-/* Theme: dark */
-@media (prefers-color-scheme: dark) {
-  .dark-theme {
-    /* background */
-    --theme-dark-background-primary: var(--palette-base-primary);
-  }
-}"
-`;
-
-snapshot[`processColors - handles selector + atRule 2`] = `
-[
-  [
-    "palette.base.primary",
-    {
-      key: "--palette-base-primary",
-      value: "oklch(73.511% 0.16799 40.24666)",
-      variable: "--palette-base-primary: oklch(73.511% 0.16799 40.24666);",
-    },
-  ],
-  [
-    "theme.dark.background.primary",
-    {
-      key: "--theme-dark-background-primary",
-      value: "var(--palette-base-primary)",
-      variable: "--theme-dark-background-primary: var(--palette-base-primary);",
-    },
-  ],
-]
-`;
-
-snapshot[`processColors - handles theme variantNameOnly 1`] = `
-"/* Palette */
-/* simple */
---palette-simple-white: oklch(100% 0 0);
---palette-simple-black: oklch(0% 0 0);
-/* Themes */
-/* Theme: light */
-/* background */
---primary: var(--palette-simple-white);
---secondary: var(--palette-simple-black);"
-`;
-
-snapshot[`processColors - handles theme variantNameOnly 2`] = `
-[
-  [
-    "palette.simple.white",
-    {
-      key: "--palette-simple-white",
-      value: "oklch(100% 0 0)",
-      variable: "--palette-simple-white: oklch(100% 0 0);",
-    },
-  ],
-  [
-    "palette.simple.black",
-    {
-      key: "--palette-simple-black",
-      value: "oklch(0% 0 0)",
-      variable: "--palette-simple-black: oklch(0% 0 0);",
-    },
-  ],
-  [
-    "theme.light.background.primary",
-    {
-      key: "--primary",
-      value: "var(--palette-simple-white)",
-      variable: "--primary: var(--palette-simple-white);",
-    },
-  ],
-  [
-    "theme.light.background.secondary",
-    {
-      key: "--secondary",
-      value: "var(--palette-simple-black)",
-      variable: "--secondary: var(--palette-simple-black);",
-    },
-  ],
-]
-`;
diff --git a/tests/__snapshots__/primitive.test.ts.snap b/tests/__snapshots__/primitive.test.ts.snap
deleted file mode 100644
index c6d0fcf..0000000
--- a/tests/__snapshots__/primitive.test.ts.snap
+++ /dev/null
@@ -1,180 +0,0 @@
-export const snapshot = {};
-
-snapshot[`processPrimitives - processes button with variables 1`] = `
-{
-  root: "/* button */
---button-small-width: 120px;
---button-small-height: 40px;
---button-small-fontSize: var(--typography_fluid-arial-foo-m);
---button-small-radius: 8px;
---button-small-padding: var(--spacing-size-2) var(--spacing-size-3);",
-}
-`;
-
-snapshot[`processPrimitives - processes button with variables 2`] = `
-[
-  [
-    "primitives.button.small.width",
-    {
-      key: "--button-small-width",
-      value: "120px",
-      variable: "--button-small-width: 120px;",
-    },
-  ],
-  [
-    "primitives.button.small.height",
-    {
-      key: "--button-small-height",
-      value: "40px",
-      variable: "--button-small-height: 40px;",
-    },
-  ],
-  [
-    "primitives.button.small.fontSize",
-    {
-      key: "--button-small-fontSize",
-      value: "var(--typography_fluid-arial-foo-m)",
-      variable: "--button-small-fontSize: var(--typography_fluid-arial-foo-m);",
-    },
-  ],
-  [
-    "primitives.button.small.radius",
-    {
-      key: "--button-small-radius",
-      value: "8px",
-      variable: "--button-small-radius: 8px;",
-    },
-  ],
-  [
-    "primitives.button.small.padding",
-    {
-      key: "--button-small-padding",
-      value: "var(--spacing-size-2) var(--spacing-size-3)",
-      variable: "--button-small-padding: var(--spacing-size-2) var(--spacing-size-3);",
-    },
-  ],
-]
-`;
-
-snapshot[`processPrimitives - processes buttons with settings 1`] = `
-{
-  root: "/* button */
---button-small-width: 120px;
---button-small-height: 40px;
---button-small-radius: 8px;
---button-big-width: 15rem;
---button-big-height: 5rem;
---button-big-radius: 1rem;",
-}
-`;
-
-snapshot[`processPrimitives - processes buttons with settings 2`] = `
-[
-  [
-    "primitives.button.small.width",
-    {
-      key: "--button-small-width",
-      value: "120px",
-      variable: "--button-small-width: 120px;",
-    },
-  ],
-  [
-    "primitives.button.small.height",
-    {
-      key: "--button-small-height",
-      value: "40px",
-      variable: "--button-small-height: 40px;",
-    },
-  ],
-  [
-    "primitives.button.small.radius",
-    {
-      key: "--button-small-radius",
-      value: "8px",
-      variable: "--button-small-radius: 8px;",
-    },
-  ],
-  [
-    "primitives.button.big.width",
-    {
-      key: "--button-big-width",
-      value: "15rem",
-      variable: "--button-big-width: 15rem;",
-    },
-  ],
-  [
-    "primitives.button.big.height",
-    {
-      key: "--button-big-height",
-      value: "5rem",
-      variable: "--button-big-height: 5rem;",
-    },
-  ],
-  [
-    "primitives.button.big.radius",
-    {
-      key: "--button-big-radius",
-      value: "1rem",
-      variable: "--button-big-radius: 1rem;",
-    },
-  ],
-]
-`;
-
-snapshot[`processPrimitives - references colors, gradients, and themes 1`] = `
-{
-  root: "/* card */
---card-default-background-color: var(--theme-light-background-primary);
---card-default-background-image: var(--gradients-orangeGradient-primary);
---card-default-border-color: var(--palette-coral-50);",
-}
-`;
-
-snapshot[`processPrimitives - references colors, gradients, and themes 2`] = `
-[
-  [
-    "primitives.card.default.background-color",
-    {
-      key: "--card-default-background-color",
-      value: "var(--theme-light-background-primary)",
-      variable: "--card-default-background-color: var(--theme-light-background-primary);",
-    },
-  ],
-  [
-    "primitives.card.default.background-image",
-    {
-      key: "--card-default-background-image",
-      value: "var(--gradients-orangeGradient-primary)",
-      variable: "--card-default-background-image: var(--gradients-orangeGradient-primary);",
-    },
-  ],
-  [
-    "primitives.card.default.border-color",
-    {
-      key: "--card-default-border-color",
-      value: "var(--palette-coral-50)",
-      variable: "--card-default-border-color: var(--palette-coral-50);",
-    },
-  ],
-]
-`;
-
-snapshot[`processPrimitives - uses fluid spacing references 1`] = `
-{
-  root: "/* box */
---box-default-padding: var(--spacing_fluid-gap-gs-s) var(--spacing_fluid-gap-gs-m);",
-}
-`;
-
-snapshot[`processPrimitives - uses fluid spacing references 2`] = `
-[
-  [
-    "primitives.box.default.padding",
-    {
-      key: "--box-default-padding",
-      value: "var(--spacing_fluid-gap-gs-s) var(--spacing_fluid-gap-gs-m)",
-      variable: "--box-default-padding: var(--spacing_fluid-gap-gs-s) var(--spacing_fluid-gap-gs-m);",
-    },
-  ],
-]
-`;
diff --git a/tests/__snapshots__/spacing.test.ts.snap b/tests/__snapshots__/spacing.test.ts.snap
deleted file mode 100644
index 5426fd0..0000000
--- a/tests/__snapshots__/spacing.test.ts.snap
+++ /dev/null
@@ -1,293 +0,0 @@
-export const snapshot = {};
-
-snapshot[`processSpacing - generates correct spacing scale 1`] = `
-"--spacing-size-1: 0.25rem;
---spacing-size-2: 0.5rem;
---spacing-size-3: 0.75rem;
---spacing-size-s: 1rem;"
-`;
-
-snapshot[`processSpacing - generates correct spacing scale 2`] = `
-[
-  [
-    "spacing.custom.size.1",
-    {
-      key: "--spacing-size-1",
-      value: "0.25rem",
-      variable: "--spacing-size-1: 0.25rem;",
-    },
-  ],
-  [
-    "spacing.custom.size.2",
-    {
-      key: "--spacing-size-2",
-      value: "0.5rem",
-      variable: "--spacing-size-2: 0.5rem;",
-    },
-  ],
-  [
-    "spacing.custom.size.3",
-    {
-      key: "--spacing-size-3",
-      value: "0.75rem",
-      variable: "--spacing-size-3: 0.75rem;",
-    },
-  ],
-  [
-    "spacing.custom.size.s",
-    {
-      key: "--spacing-size-s",
-      value: "1rem",
-      variable: "--spacing-size-s: 1rem;",
-    },
-  ],
-]
-`;
-
-snapshot[`processSpacing - handles settings 1`] = `
-"--spacing-size-1: 1rem;
---spacing-size-2: 0.5rem;
---spacing-scale-md: 8px;
---spacing-scale-lg: 0.75rem;"
-`;
-
-snapshot[`processSpacing - handles settings 2`] = `
-[
-  [
-    "spacing.custom.size.1",
-    {
-      key: "--spacing-size-1",
-      value: "1rem",
-      variable: "--spacing-size-1: 1rem;",
-    },
-  ],
-  [
-    "spacing.custom.size.2",
-    {
-      key: "--spacing-size-2",
-      value: "0.5rem",
-      variable: "--spacing-size-2: 0.5rem;",
-    },
-  ],
-  [
-    "spacing.custom.scale.md",
-    {
-      key: "--spacing-scale-md",
-      value: "8px",
-      variable: "--spacing-scale-md: 8px;",
-    },
-  ],
-  [
-    "spacing.custom.scale.lg",
-    {
-      key: "--spacing-scale-lg",
-      value: "0.75rem",
-      variable: "--spacing-scale-lg: 0.75rem;",
-    },
-  ],
-]
-`;
-
-snapshot[`processSpacing - generates fluid spacing (prefix) 1`] = `
-"--spacing_fluid-base-foo-xs: clamp(0rem, 0rem + 0vw, 0rem);
---spacing_fluid-base-foo-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
---spacing_fluid-base-foo-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
---spacing_fluid-base-foo-l: clamp(0.5rem, -0.3333rem + 4.1667vw, 3rem);
---spacing_fluid-base-foo-xs-l: clamp(0rem, -1rem + 5vw, 3rem);
---spacing_fluid-base-foo-xs-s: clamp(0rem, -0.5rem + 2.5vw, 1.5rem);
---spacing_fluid-base-foo-s-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
---spacing_fluid-base-foo-m-l: clamp(0.25rem, -0.6667rem + 4.5833vw, 3rem);"
-`;
-
-snapshot[`processSpacing - generates fluid spacing (prefix) 2`] = `
-[
-  [
-    "spacing_fluid.base@xs",
-    {
-      key: "--spacing_fluid-base-foo-xs",
-      value: "clamp(0rem, 0rem + 0vw, 0rem)",
-      variable: "--spacing_fluid-base-foo-xs: clamp(0rem, 0rem + 0vw, 0rem);",
-    },
-  ],
-  [
-    "spacing_fluid.base@s",
-    {
-      key: "--spacing_fluid-base-foo-s",
-      value: "clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem)",
-      variable: "--spacing_fluid-base-foo-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
-    },
-  ],
-  [
-    "spacing_fluid.base@m",
-    {
-      key: "--spacing_fluid-base-foo-m",
-      value: "clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem)",
-      variable: "--spacing_fluid-base-foo-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
-    },
-  ],
-  [
-    "spacing_fluid.base@l",
-    {
-      key: "--spacing_fluid-base-foo-l",
-      value: "clamp(0.5rem, -0.3333rem + 4.1667vw, 3rem)",
-      variable: "--spacing_fluid-base-foo-l: clamp(0.5rem, -0.3333rem + 4.1667vw, 3rem);",
-    },
-  ],
-  [
-    "spacing_fluid.base@xs-l",
-    {
-      key: "--spacing_fluid-base-foo-xs-l",
-      value: "clamp(0rem, -1rem + 5vw, 3rem)",
-      variable: "--spacing_fluid-base-foo-xs-l: clamp(0rem, -1rem + 5vw, 3rem);",
-    },
-  ],
-  [
-    "spacing_fluid.base@xs-s",
-    {
-      key: "--spacing_fluid-base-foo-xs-s",
-      value: "clamp(0rem, -0.5rem + 2.5vw, 1.5rem)",
-      variable: "--spacing_fluid-base-foo-xs-s: clamp(0rem, -0.5rem + 2.5vw, 1.5rem);",
-    },
-  ],
-  [
-    "spacing_fluid.base@s-m",
-    {
-      key: "--spacing_fluid-base-foo-s-m",
-      value: "clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem)",
-      variable: "--spacing_fluid-base-foo-s-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
-    },
-  ],
-  [
-    "spacing_fluid.base@m-l",
-    {
-      key: "--spacing_fluid-base-foo-m-l",
-      value: "clamp(0.25rem, -0.6667rem + 4.5833vw, 3rem)",
-      variable: "--spacing_fluid-base-foo-m-l: clamp(0.25rem, -0.6667rem + 4.5833vw, 3rem);",
-    },
-  ],
-]
-`;
-
-snapshot[`processSpacing - fluid without prefix falls back to scale name 1`] = `
-"--spacing_fluid-rhythm-xs: clamp(0rem, 0rem + 0vw, 0rem);
---spacing_fluid-rhythm-s: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);
---spacing_fluid-rhythm-m: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);
---spacing_fluid-rhythm-xs-s: clamp(0rem, -0.4167rem + 2.0833vw, 1.25rem);
---spacing_fluid-rhythm-s-m: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);"
-`;
-
-snapshot[`processSpacing - fluid without prefix falls back to scale name 2`] = `
-[
-  [
-    "spacing_fluid.rhythm@xs",
-    {
-      key: "--spacing_fluid-rhythm-xs",
-      value: "clamp(0rem, 0rem + 0vw, 0rem)",
-      variable: "--spacing_fluid-rhythm-xs: clamp(0rem, 0rem + 0vw, 0rem);",
-    },
-  ],
-  [
-    "spacing_fluid.rhythm@s",
-    {
-      key: "--spacing_fluid-rhythm-s",
-      value: "clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem)",
-      variable: "--spacing_fluid-rhythm-s: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);",
-    },
-  ],
-  [
-    "spacing_fluid.rhythm@m",
-    {
-      key: "--spacing_fluid-rhythm-m",
-      value: "clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem)",
-      variable: "--spacing_fluid-rhythm-m: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);",
-    },
-  ],
-  [
-    "spacing_fluid.rhythm@xs-s",
-    {
-      key: "--spacing_fluid-rhythm-xs-s",
-      value: "clamp(0rem, -0.4167rem + 2.0833vw, 1.25rem)",
-      variable: "--spacing_fluid-rhythm-xs-s: clamp(0rem, -0.4167rem + 2.0833vw, 1.25rem);",
-    },
-  ],
-  [
-    "spacing_fluid.rhythm@s-m",
-    {
-      key: "--spacing_fluid-rhythm-s-m",
-      value: "clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem)",
-      variable: "--spacing_fluid-rhythm-s-m: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);",
-    },
-  ],
-]
-`;
-
-snapshot[`processSpacing - combines fluid and custom spacing 1`] = `
-"--spacing_fluid-base-flux-xs: clamp(0rem, 0rem + 0vw, 0rem);
---spacing_fluid-base-flux-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
---spacing_fluid-base-flux-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
---spacing_fluid-base-flux-xs-s: clamp(0rem, -0.5rem + 2.5vw, 1.5rem);
---spacing_fluid-base-flux-s-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);
---spacing-gap-1: 4px;
---spacing-gap-2: 8px;"
-`;
-
-snapshot[`processSpacing - combines fluid and custom spacing 2`] = `
-[
-  [
-    "spacing_fluid.base@xs",
-    {
-      key: "--spacing_fluid-base-flux-xs",
-      value: "clamp(0rem, 0rem + 0vw, 0rem)",
-      variable: "--spacing_fluid-base-flux-xs: clamp(0rem, 0rem + 0vw, 0rem);",
-    },
-  ],
-  [
-    "spacing_fluid.base@s",
-    {
-      key: "--spacing_fluid-base-flux-s",
-      value: "clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem)",
-      variable: "--spacing_fluid-base-flux-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
-    },
-  ],
-  [
-    "spacing_fluid.base@m",
-    {
-      key: "--spacing_fluid-base-flux-m",
-      value: "clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem)",
-      variable: "--spacing_fluid-base-flux-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
-    },
-  ],
-  [
-    "spacing_fluid.base@xs-s",
-    {
-      key: "--spacing_fluid-base-flux-xs-s",
-      value: "clamp(0rem, -0.5rem + 2.5vw, 1.5rem)",
-      variable: "--spacing_fluid-base-flux-xs-s: clamp(0rem, -0.5rem + 2.5vw, 1.5rem);",
-    },
-  ],
-  [
-    "spacing_fluid.base@s-m",
-    {
-      key: "--spacing_fluid-base-flux-s-m",
-      value: "clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem)",
-      variable: "--spacing_fluid-base-flux-s-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
-    },
-  ],
-  [
-    "spacing.custom.gap.1",
-    {
-      key: "--spacing-gap-1",
-      value: "4px",
-      variable: "--spacing-gap-1: 4px;",
-    },
-  ],
-  [
-    "spacing.custom.gap.2",
-    {
-      key: "--spacing-gap-2",
-      value: "8px",
-      variable: "--spacing-gap-2: 8px;",
-    },
-  ],
-]
-`;
diff --git a/tests/__snapshots__/typography.test.ts.snap b/tests/__snapshots__/typography.test.ts.snap
deleted file mode 100644
index 1311895..0000000
--- a/tests/__snapshots__/typography.test.ts.snap
+++ /dev/null
@@ -1,274 +0,0 @@
-export const snapshot = {};
-
-snapshot[`processTypography - generates correct CSS variables 1`] = `
-{
-  root: "--typography_fluid-arial-4xl: clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem);
---typography_fluid-arial-3xl: clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem);
---typography_fluid-arial-2xl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);
---typography_fluid-arial-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);
---typography_fluid-arial-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);
---typography_fluid-arial-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);
---typography_fluid-arial-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);
---typography_fluid-arial-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);
---typography_fluid-arial-2xs: clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem);",
-}
-`;
-
-snapshot[`processTypography - generates correct CSS variables 2`] = `
-[
-  [
-    "typography_fluid.arial@4xl",
-    {
-      key: "--typography_fluid-arial-4xl",
-      value: "clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem)",
-      variable: "--typography_fluid-arial-4xl: clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@3xl",
-    {
-      key: "--typography_fluid-arial-3xl",
-      value: "clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem)",
-      variable: "--typography_fluid-arial-3xl: clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@2xl",
-    {
-      key: "--typography_fluid-arial-2xl",
-      value: "clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem)",
-      variable: "--typography_fluid-arial-2xl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@xl",
-    {
-      key: "--typography_fluid-arial-xl",
-      value: "clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem)",
-      variable: "--typography_fluid-arial-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@l",
-    {
-      key: "--typography_fluid-arial-l",
-      value: "clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem)",
-      variable: "--typography_fluid-arial-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@m",
-    {
-      key: "--typography_fluid-arial-m",
-      value: "clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem)",
-      variable: "--typography_fluid-arial-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@s",
-    {
-      key: "--typography_fluid-arial-s",
-      value: "clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem)",
-      variable: "--typography_fluid-arial-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@xs",
-    {
-      key: "--typography_fluid-arial-xs",
-      value: "clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem)",
-      variable: "--typography_fluid-arial-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@2xs",
-    {
-      key: "--typography_fluid-arial-2xs",
-      value: "clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem)",
-      variable: "--typography_fluid-arial-2xs: clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem);",
-    },
-  ],
-]
-`;
-
-snapshot[`typography - can handle custom labels and prefixes 1`] = `
-{
-  root: "--typography_fluid-arial-text-h1: clamp(4.1723rem, 4.0013rem + 0.8553vw, 4.7684rem);
---typography_fluid-arial-text-h2: clamp(3.3379rem, 3.201rem + 0.6843vw, 3.8147rem);
---typography_fluid-arial-text-h3: clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem);
---typography_fluid-arial-text-h4: clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem);
---typography_fluid-arial-text-xxl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);
---typography_fluid-arial-text-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);
---typography_fluid-arial-text-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);
---typography_fluid-arial-text-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);
---typography_fluid-arial-text-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);
---typography_fluid-arial-text-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);",
-}
-`;
-
-snapshot[`typography - can handle custom labels and prefixes 2`] = `
-[
-  [
-    "typography_fluid.arial@h1",
-    {
-      key: "--typography_fluid-arial-text-h1",
-      value: "clamp(4.1723rem, 4.0013rem + 0.8553vw, 4.7684rem)",
-      variable: "--typography_fluid-arial-text-h1: clamp(4.1723rem, 4.0013rem + 0.8553vw, 4.7684rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@h2",
-    {
-      key: "--typography_fluid-arial-text-h2",
-      value: "clamp(3.3379rem, 3.201rem + 0.6843vw, 3.8147rem)",
-      variable: "--typography_fluid-arial-text-h2: clamp(3.3379rem, 3.201rem + 0.6843vw, 3.8147rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@h3",
-    {
-      key: "--typography_fluid-arial-text-h3",
-      value: "clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem)",
-      variable: "--typography_fluid-arial-text-h3: clamp(2.6703rem, 2.5608rem + 0.5474vw, 3.0518rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@h4",
-    {
-      key: "--typography_fluid-arial-text-h4",
-      value: "clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem)",
-      variable: "--typography_fluid-arial-text-h4: clamp(2.1362rem, 2.0486rem + 0.4379vw, 2.4414rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@xxl",
-    {
-      key: "--typography_fluid-arial-text-xxl",
-      value: "clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem)",
-      variable: "--typography_fluid-arial-text-xxl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@xl",
-    {
-      key: "--typography_fluid-arial-text-xl",
-      value: "clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem)",
-      variable: "--typography_fluid-arial-text-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@l",
-    {
-      key: "--typography_fluid-arial-text-l",
-      value: "clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem)",
-      variable: "--typography_fluid-arial-text-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@m",
-    {
-      key: "--typography_fluid-arial-text-m",
-      value: "clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem)",
-      variable: "--typography_fluid-arial-text-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@s",
-    {
-      key: "--typography_fluid-arial-text-s",
-      value: "clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem)",
-      variable: "--typography_fluid-arial-text-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@xs",
-    {
-      key: "--typography_fluid-arial-text-xs",
-      value: "clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem)",
-      variable: "--typography_fluid-arial-text-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);",
-    },
-  ],
-]
-`;
-
-snapshot[`processTypography - can process weights 1`] = `
-{
-  root: "--typography_fluid-arial-2xl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);
---typography_fluid-arial-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);
---typography_fluid-arial-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);
---typography_fluid-arial-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);
---typography_fluid-arial-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);
---typography_fluid-arial-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);
---typography_fluid-arial-2xs: clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem);
---typography-weight-arial-regular: 500;",
-}
-`;
-
-snapshot[`processTypography - can process weights 2`] = `
-[
-  [
-    "typography_fluid.arial@2xl",
-    {
-      key: "--typography_fluid-arial-2xl",
-      value: "clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem)",
-      variable: "--typography_fluid-arial-2xl: clamp(1.709rem, 1.6389rem + 0.3503vw, 1.9531rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@xl",
-    {
-      key: "--typography_fluid-arial-xl",
-      value: "clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem)",
-      variable: "--typography_fluid-arial-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@l",
-    {
-      key: "--typography_fluid-arial-l",
-      value: "clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem)",
-      variable: "--typography_fluid-arial-l: clamp(1.0938rem, 1.0489rem + 0.2242vw, 1.25rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@m",
-    {
-      key: "--typography_fluid-arial-m",
-      value: "clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem)",
-      variable: "--typography_fluid-arial-m: clamp(0.875rem, 0.8391rem + 0.1794vw, 1rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@s",
-    {
-      key: "--typography_fluid-arial-s",
-      value: "clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem)",
-      variable: "--typography_fluid-arial-s: clamp(0.7rem, 0.6713rem + 0.1435vw, 0.8rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@xs",
-    {
-      key: "--typography_fluid-arial-xs",
-      value: "clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem)",
-      variable: "--typography_fluid-arial-xs: clamp(0.56rem, 0.537rem + 0.1148vw, 0.64rem);",
-    },
-  ],
-  [
-    "typography_fluid.arial@2xs",
-    {
-      key: "--typography_fluid-arial-2xs",
-      value: "clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem)",
-      variable: "--typography_fluid-arial-2xs: clamp(0.448rem, 0.4296rem + 0.0918vw, 0.512rem);",
-    },
-  ],
-  [
-    "typography.weight.arial.regular",
-    {
-      key: "--typography-weight-arial-regular",
-      value: "500",
-      variable: "--typography-weight-arial-regular: 500;",
-    },
-  ],
-]
-`;
diff --git a/tests/colors.test.ts b/tests/colors.test.ts
deleted file mode 100644
index 310ad7d..0000000
--- a/tests/colors.test.ts
+++ /dev/null
@@ -1,624 +0,0 @@
-import { assert, assertEquals } from "@std/assert";
-import { assertSnapshot } from "@std/testing/snapshot";
-import { defineConfig, processColors } from "../src/mod.ts";
-import { combine, getLines } from "./helpers.ts";
-
-Deno.test("processColors - converts hex to oklch", async (t) => {
-  const config = defineConfig({
-    colors: {
-      palette: {
-        value: {
-          coral: {
-            value: {
-              100: { hex: "#FF7F50" },
-              200: { hex: "#FF6347" },
-            },
-          },
-        },
-      },
-    },
-  });
-
-  const { css, resolveMap } = processColors(config.colors);
-  const combined = combine(css);
-  const lines = getLines(combined);
-  assertEquals(
-    lines[2].trim(),
-    "--palette-coral-100: oklch(73.511% 0.16799 40.24666);",
-  );
-  assertEquals(
-    lines[3].trim(),
-    "--palette-coral-200: oklch(69.622% 0.19552 32.32143);",
-  );
-  assertEquals(Array.from(resolveMap.keys()), [
-    "palette.coral.100",
-    "palette.coral.200",
-  ]);
-  await assertSnapshot(t, combined);
-  await assertSnapshot(t, Array.from(resolveMap.entries()));
-});
-
-Deno.test("processColors - handles different color formats", async (t) => {
-  const config = defineConfig(
-    {
-      colors: {
-        palette: {
-          value: {
-            brand: {
-              value: {
-                default: { hex: "#FF0000" },
-                200: { rgb: [0, 255, 0] },
-                300: { hsl: [240, 100, 50] },
-                400: { oklch: "oklch(0.7 0.2 270)" },
-              },
-            },
-          },
-        },
-      },
-    } as const,
-  );
-  const { css, resolveMap } = processColors(config.colors);
-  const combined = combine(css);
-  const lines = getLines(combined);
-
-  assertEquals(
-    lines[2].trim(),
-    "--palette-brand-200: oklch(86.644% 0.29483 142.49535);",
-  );
-  assertEquals(
-    lines[3].trim(),
-    "--palette-brand-300: oklch(45.201% 0.31321 264.05202);",
-  );
-  assertEquals(lines[4].trim(), "--palette-brand-400: oklch(70% 0.2 270);");
-  assertEquals(
-    lines[5].trim(),
-    "--palette-brand-default: oklch(62.796% 0.25768 29.23388);",
-  );
-
-  assertEquals(Array.from(resolveMap.keys()), [
-    "palette.brand.200",
-    "palette.brand.300",
-    "palette.brand.400",
-    "palette.brand.default",
-  ]);
-  await assertSnapshot(t, combined);
-  await assertSnapshot(t, Array.from(resolveMap.entries()));
-});
-
-Deno.test("processColors - handles string values", async (t) => {
-  const config = defineConfig({
-    colors: {
-      palette: {
-        value: {
-          simple: {
-            value: {
-              white: "oklch(100% 0 0)",
-              black: "#000",
-            },
-          },
-        },
-      },
-    },
-  });
-  const { css, resolveMap } = processColors(config.colors);
-  const combined = combine(css);
-  const lines = getLines(combined);
-  assertEquals(
-    lines[2].trim(),
-    "--palette-simple-white: oklch(100% 0 0);",
-  );
-  assertEquals(
-    lines[3].trim(),
-    "--palette-simple-black: oklch(0% 0 0);",
-  );
-  assertEquals(Array.from(resolveMap.keys()), [
-    "palette.simple.white",
-    "palette.simple.black",
-  ]);
-  await assertSnapshot(t, combined);
-  await assertSnapshot(t, Array.from(resolveMap.entries()));
-});
-
-Deno.test("processColors - handles themes", async (t) => {
-  const config = defineConfig({
-    colors: {
-      palette: {
-        value: {
-          simple: {
-            value: {
-              white: "oklch(100% 0 0)",
-              black: { hex: "#000" },
-            },
-          },
-        },
-      },
-      theme: {
-        light: {
-          value: {
-            background: {
-              value: {
-                primary: "var(--1)",
-                secondary: "var(--2)",
-              },
-              variables: {
-                1: "palette.simple.white",
-                2: "palette.simple.black",
-              },
-            },
-          },
-        },
-      },
-    },
-  });
-  const { css, resolveMap } = processColors(config.colors);
-  const combined = combine(css);
-  const lines = getLines(combined);
-  assertEquals(
-    lines[7].trim(),
-    "--theme-light-background-primary: var(--palette-simple-white);",
-  );
-  assertEquals(
-    lines[8].trim(),
-    "--theme-light-background-secondary: var(--palette-simple-black);",
-  );
-  assertEquals(Array.from(resolveMap.keys()), [
-    "palette.simple.white",
-    "palette.simple.black",
-    "theme.light.background.primary",
-    "theme.light.background.secondary",
-  ]);
-  await assertSnapshot(t, combined);
-  await assertSnapshot(t, Array.from(resolveMap.entries()));
-});
-
-Deno.test("processColors - handles transparency", async (t) => {
-  const config = defineConfig({
-    colors: {
-      palette: {
-        value: {
-          alpha: {
-            value: {
-              softGray1: "oklch(14.48% 0 0 / 12%)",
-              softGray2: "oklch(14.48% 0 0 / 24%)",
-            },
-          },
-        },
-      },
-    },
-  });
-  const { css, resolveMap } = processColors(config.colors);
-  const combined = combine(css);
-  const lines = getLines(combined);
-  assertEquals(
-    lines[2].trim(),
-    "--palette-alpha-softGray1: oklch(14.48% 0 0 / 12%);",
-  );
-  assertEquals(
-    lines[3].trim(),
-    "--palette-alpha-softGray2: oklch(14.48% 0 0 / 24%);",
-  );
-  assertEquals(Array.from(resolveMap.keys()), [
-    "palette.alpha.softGray1",
-    "palette.alpha.softGray2",
-  ]);
-  await assertSnapshot(t, combined);
-  await assertSnapshot(t, Array.from(resolveMap.entries()));
-});
-
-Deno.test("processColors - generates gradient with color variables", async (t) => {
-  const config = defineConfig({
-    colors: {
-      palette: {
-        value: {
-          coral: {
-            value: {
-              "50": { hex: "#FF7E60" },
-              "90": { hex: "#FF7F40" },
-              "100": { hex: "#FF6347" },
-            },
-          },
-          indigo: {
-            value: {
-              "100": { hex: "#4F46E5" },
-            },
-          },
-        },
-      },
-      gradients: {
-        value: {
-          orangeGradient: {
-            value: {
-              primary: {
-                value:
-                  "linear-gradient(261.78deg, var(--1) 33.1%, var(--2) 56.3%, var(--3) 65.78%, var(--4) 84.23%)",
-                variables: {
-                  "1": "palette.coral.50",
-                  "2": "palette.coral.90",
-                  "3": "palette.coral.100",
-                  "4": "palette.indigo.100",
-                },
-              },
-            },
-          },
-        },
-      },
-    },
-  });
-
-  const result = processColors(config.colors);
-  const combined = [result.css.root, result.css.outside].filter(Boolean).join("\n");
-  const lines = getLines(combined);
-  const expected = [
-    "--gradients-orangeGradient-primary: linear-gradient(261.78deg, var(--palette-coral-50) 33.1%, var(--palette-coral-90) 56.3%, var(--palette-coral-100) 65.78%, var(--palette-indigo-100) 84.23%);",
-  ].join("\n");
-
-  assertEquals(lines.at(-1), expected);
-  assertEquals(Array.from(result.resolveMap.keys()), [
-    "palette.coral.50",
-    "palette.coral.90",
-    "palette.coral.100",
-    "palette.indigo.100",
-    "gradients.orangeGradient.primary",
-  ]);
-  await assertSnapshot(t, combined);
-  await assertSnapshot(t, Array.from(result.resolveMap.entries()));
-});
-
-Deno.test("processColors - handles themes referencing gradients", async (t) => {
-  const config = defineConfig({
-    colors: {
-      palette: {
-        value: {
-          coral: {
-            value: {
-              "50": { hex: "#FF7E60" },
-            },
-          },
-        },
-      },
-      gradients: {
-        value: {
-          orangeGradient: {
-            value: {
-              primary: {
-                value: "linear-gradient(to right, var(--c1), var(--c2))",
-                variables: {
-                  "c1": "palette.coral.50",
-                  "c2": "palette.coral.50",
-                },
-              },
-            },
-          },
-        },
-      },
-      theme: {
-        light: {
-          value: {
-            background: {
-              value: {
-                primary: "var(--grad)",
-              },
-              variables: {
-                "grad": "gradients.orangeGradient.primary",
-              },
-            },
-          },
-        },
-      },
-    },
-  });
-
-  const { css, resolveMap } = processColors(config.colors);
-  const combined = combine(css);
-  const lines = getLines(combined);
-  const lastLine = lines.pop();
-  assertEquals(
-    lastLine,
-    "--theme-light-background-primary: var(--gradients-orangeGradient-primary);",
-  );
-  assertEquals(Array.from(resolveMap.keys()), [
-    "palette.coral.50",
-    "gradients.orangeGradient.primary",
-    "theme.light.background.primary",
-  ]);
-  await assertSnapshot(t, combined);
-  await assertSnapshot(t, Array.from(resolveMap.entries()));
-});
-
-Deno.test("processColors - handles gradients with atRule", async (t) => {
-  const config = defineConfig({
-    colors: {
-      palette: {
-        value: {
-          coral: {
-            value: {
-              "50": { hex: "#FF7E60" },
-            },
-          },
-        },
-      },
-      gradients: {
-        value: {
-          orangeGradient: {
-            value: {
-              primary: {
-                value: "linear-gradient(to right, var(--c1), var(--c2))",
-                variables: {
-                  "c1": "palette.coral.50",
-                  "c2": "palette.coral.50",
-                },
-              },
-            },
-            settings: {
-              atRule: "@media (prefers-color-scheme: dark)",
-            },
-          },
-        },
-      },
-    },
-  });
-
-  const { css, resolveMap } = processColors(config.colors);
-  const combined = combine(css);
-  const lines = getLines(combined);
-
-  const mediaQueryIndex = lines.findIndex((line) =>
-    line.includes("@media (prefers-color-scheme: dark)")
-  );
-
-  assertEquals(lines[mediaQueryIndex], "@media (prefers-color-scheme: dark) {");
-
-  const varIndex = lines.findIndex((line, idx) =>
-    idx > mediaQueryIndex && line.includes("--gradients-orangeGradient-primary:")
-  );
-
-  assert(
-    varIndex > mediaQueryIndex,
-    "Gradient variable should be inside the media query block",
-  );
-
-  assertEquals(
-    lines[varIndex].trim(),
-    "--gradients-orangeGradient-primary: linear-gradient(to right, var(--palette-coral-50), var(--palette-coral-50));",
-  );
-
-  assertEquals(Array.from(resolveMap.keys()), [
-    "palette.coral.50",
-    "gradients.orangeGradient.primary",
-  ]);
-  await assertSnapshot(t, combined);
-  await assertSnapshot(t, Array.from(resolveMap.entries()));
-});
-
-Deno.test("processColors - handles palette colors with atRule", async (t) => {
-  const config = defineConfig({
-    colors: {
-      palette: {
-        value: {
-          background: {
-            value: {
-              light: "oklch(100% 0 0)",
-            },
-          },
-          backgroundDark: {
-            value: {
-              dark: { hex: "#000" },
-            },
-            settings: {
-              atRule: "@media (prefers-color-scheme: dark)",
-            },
-          },
-        },
-      },
-    },
-  });
-  const { css, resolveMap } = processColors(config.colors);
-  const combined = combine(css);
-  const lines = getLines(combined);
-
-  assertEquals(
-    lines[2].trim(),
-    "--palette-background-light: oklch(100% 0 0);",
-  );
-
-  const mediaQueryIndex = lines.findIndex((line) =>
-    line.includes("@media (prefers-color-scheme: dark)")
-  );
-
-  assertEquals(lines[mediaQueryIndex], "@media (prefers-color-scheme: dark) {");
-
-  const darkVarIndex = lines.findIndex((line) =>
-    line.includes("--palette-backgroundDark-dark:")
-  );
-
-  assertEquals(
-    lines[darkVarIndex].trim(),
-    "--palette-backgroundDark-dark: oklch(0% 0 0);",
-  );
-
-  const closingBraceIndex = lines.findIndex((line, idx) =>
-    idx > mediaQueryIndex && line === "}"
-  );
-  assert(
-    closingBraceIndex > darkVarIndex,
-    "Closing brace should exist after variables",
-  );
-
-  assertEquals(Array.from(resolveMap.keys()), [
-    "palette.background.light",
-    "palette.backgroundDark.dark",
-  ]);
-  await assertSnapshot(t, combined);
-  await assertSnapshot(t, Array.from(resolveMap.entries()));
-});
-
-Deno.test("processColors - handles themes with selector", async (t) => {
-  const config = defineConfig({
-    colors: {
-      palette: {
-        value: {
-          base: {
-            value: {
-              primary: { hex: "#FF7F50" },
-            },
-          },
-        },
-      },
-      theme: {
-        dark: {
-          value: {
-            background: {
-              value: {
-                primary: "var(--1)",
-              },
-              variables: {
-                "1": "palette.base.primary",
-              },
-            },
-          },
-          settings: {
-            selector: ".dark-theme",
-          },
-        },
-      },
-    },
-  });
-
-  const { css, resolveMap } = processColors(config.colors);
-  const combined = combine(css);
-  const lines = getLines(combined);
-
-  const classIndex = lines.findIndex((l) => l.includes(".dark-theme"));
-  assertEquals(lines[classIndex], ".dark-theme {");
-
-  const varIndex = lines.findIndex((l) => l.includes("--theme-dark-background-primary:"));
-  assert(varIndex > classIndex, "theme variable should be inside the class block");
-
-  assertEquals(Array.from(resolveMap.keys()), [
-    "palette.base.primary",
-    "theme.dark.background.primary",
-  ]);
-  await assertSnapshot(t, combined);
-  await assertSnapshot(t, Array.from(resolveMap.entries()));
-});
-
-Deno.test("processColors - handles selector + atRule", async (t) => {
-  const config = defineConfig({
-    colors: {
-      palette: {
-        value: {
-          base: {
-            value: {
-              primary: { hex: "#FF7F50" },
-            },
-          },
-        },
-      },
-      theme: {
-        dark: {
-          value: {
-            background: {
-              value: {
-                primary: "var(--1)",
-              },
-              variables: {
-                "1": "palette.base.primary",
-              },
-            },
-          },
-          settings: {
-            selector: ".dark-theme",
-            atRule: "@media (prefers-color-scheme: dark)",
-          },
-        },
-      },
-    },
-  });
-
-  const { css, resolveMap } = processColors(config.colors);
-  const combined = combine(css);
-  const lines = getLines(combined);
-
-  const mediaIndex = lines.findIndex((l) =>
-    l.includes("@media (prefers-color-scheme: dark)")
-  );
-  assertEquals(lines[mediaIndex], "@media (prefers-color-scheme: dark) {");
-
-  const classIndex = lines.findIndex((l, idx) =>
-    idx > mediaIndex && l.includes(".dark-theme")
-  );
-  assert(classIndex > mediaIndex, "selector should be inside the media query block");
-  assertEquals(lines[classIndex].trim(), ".dark-theme {");
-
-  const varIndex = lines.findIndex((l, idx) =>
-    idx > classIndex && l.includes("--theme-dark-background-primary:")
-  );
-  assert(
-    varIndex > classIndex,
-    "theme variable should be inside the selector block within the media query",
-  );
-
-  assertEquals(Array.from(resolveMap.keys()), [
-    "palette.base.primary",
-    "theme.dark.background.primary",
-  ]);
-
-  await assertSnapshot(t, combined);
-  await assertSnapshot(t, Array.from(resolveMap.entries()));
-});
-
-Deno.test("processColors - handles theme variantNameOnly", async (t) => {
-  const config = defineConfig({
-    colors: {
-      palette: {
-        value: {
-          simple: {
-            value: {
-              white: "oklch(100% 0 0)",
-              black: { hex: "#000" },
-            },
-          },
-        },
-      },
-      theme: {
-        light: {
-          value: {
-            background: {
-              value: {
-                primary: "var(--1)",
-                secondary: "var(--2)",
-              },
-              variables: {
-                1: "palette.simple.white",
-                2: "palette.simple.black",
-              },
-              settings: {
-                variantNameOnly: true,
-              },
-            },
-          },
-        },
-      },
-    },
-  });
-
-  const { css, resolveMap } = processColors(config.colors);
-  const combined = combine(css);
-  const lines = getLines(combined);
-
-  const primaryLine = lines.find((l) => l.includes("--primary:"));
-  const secondaryLine = lines.find((l) => l.includes("--secondary:"));
-
-  assertEquals(primaryLine?.trim(), "--primary: var(--palette-simple-white);");
-  assertEquals(secondaryLine?.trim(), "--secondary: var(--palette-simple-black);");
-
-  assertEquals(Array.from(resolveMap.keys()), [
-    "palette.simple.white",
-    "palette.simple.black",
-    "theme.light.background.primary",
-    "theme.light.background.secondary",
-  ]);
-
-  await assertSnapshot(t, combined);
-  await assertSnapshot(t, Array.from(resolveMap.entries()));
-});
diff --git a/tests/primitive.test.ts b/tests/primitive.test.ts
deleted file mode 100644
index 06a68ad..0000000
--- a/tests/primitive.test.ts
+++ /dev/null
@@ -1,232 +0,0 @@
-import { assertEquals } from "@std/assert";
-import { assertSnapshot } from "@std/testing/snapshot";
-import { processPrimitives } from "../src/modules/primitive.ts";
-import { defineConfig } from "../src/mod.ts";
-
-Deno.test("processPrimitives - processes button with variables", async (t) => {
-  const config = defineConfig({
-    typography: {
-      fluid: {
-        arial: {
-          value: {
-            minWidth: 320,
-            minFontSize: 14,
-            minTypeScale: 1.25,
-            maxWidth: 1435,
-            maxFontSize: 16,
-            maxTypeScale: 1.25,
-            positiveSteps: 5,
-            negativeSteps: 3,
-            prefix: "foo",
-          },
-        },
-      },
-    },
-    spacing: {
-      custom: {
-        size: {
-          value: {
-            2: "0.5rem",
-            3: "0.75rem",
-          },
-        },
-      },
-    },
-    primitives: {
-      button: {
-        value: {
-          small: {
-            value: {
-              width: "120px",
-              height: "40px",
-              fontSize: "var(--base)",
-              radius: "8px",
-              padding: "var(--2) var(--3)",
-            },
-            variables: {
-              "base": "typography_fluid.arial@m",
-              "2": "spacing.custom.size.2",
-              "3": "spacing.custom.size.3",
-            },
-            settings: { pxToRem: false },
-          },
-        },
-      },
-    },
-  });
-
-  const result = processPrimitives(config);
-  const expected = [
-    "/* button */",
-    "--button-small-width: 120px;",
-    "--button-small-height: 40px;",
-    "--button-small-fontSize: var(--typography_fluid-arial-foo-m);",
-    "--button-small-radius: 8px;",
-    "--button-small-padding: var(--spacing-size-2) var(--spacing-size-3);",
-  ].join("\n");
-
-  assertEquals(result.css.root, expected);
-  await assertSnapshot(t, result.css);
-  await assertSnapshot(t, Array.from(result.resolveMap.entries()));
-});
-
-Deno.test("processPrimitives - processes buttons with settings", async (t) => {
-  const config = defineConfig({
-    primitives: {
-      button: {
-        value: {
-          small: {
-            value: {
-              width: "120px",
-              height: "40px",
-              radius: "8px",
-            },
-            settings: { pxToRem: false },
-          },
-          big: {
-            value: {
-              width: "240px",
-              height: "80px",
-              radius: "16px",
-            },
-            settings: { pxToRem: true },
-          },
-        },
-      },
-    },
-  });
-
-  const result = processPrimitives(config);
-  const expected = [
-    "/* button */",
-    "--button-small-width: 120px;",
-    "--button-small-height: 40px;",
-    "--button-small-radius: 8px;",
-    "--button-big-width: 15rem;",
-    "--button-big-height: 5rem;",
-    "--button-big-radius: 1rem;",
-  ].join("\n");
-
-  assertEquals(result.css.root, expected);
-  await assertSnapshot(t, result.css);
-  await assertSnapshot(t, Array.from(result.resolveMap.entries()));
-});
-
-Deno.test("processPrimitives - references colors, gradients, and themes", async (t) => {
-  const config = defineConfig({
-    colors: {
-      palette: {
-        value: {
-          coral: {
-            value: {
-              "50": { hex: "#FF7E60" },
-            },
-          },
-        },
-      },
-      gradients: {
-        value: {
-          orangeGradient: {
-            value: {
-              primary: {
-                value: "linear-gradient(to right, var(--c1), var(--c2))",
-                variables: {
-                  "c1": "palette.coral.50",
-                  "c2": "palette.coral.50",
-                },
-              },
-            },
-          },
-        },
-      },
-      theme: {
-        light: {
-          value: {
-            background: {
-              value: {
-                primary: "var(--grad)",
-              },
-              variables: {
-                "grad": "gradients.orangeGradient.primary",
-              },
-            },
-          },
-        },
-      },
-    },
-    primitives: {
-      card: {
-        value: {
-          default: {
-            value: {
-              "background-color": "var(--bg)",
-              "background-image": "var(--grad)",
-              "border-color": "var(--border)",
-            },
-            variables: {
-              "bg": "theme.light.background.primary",
-              "grad": "gradients.orangeGradient.primary",
-              "border": "palette.coral.50",
-            },
-          },
-        },
-      },
-    },
-  });
-
-  const result = processPrimitives(config);
-  const expected = [
-    "/* card */",
-    "--card-default-background-color: var(--theme-light-background-primary);",
-    "--card-default-background-image: var(--gradients-orangeGradient-primary);",
-    "--card-default-border-color: var(--palette-coral-50);",
-  ].join("\n");
-
-  assertEquals(result.css.root, expected);
-  await assertSnapshot(t, result.css);
-  await assertSnapshot(t, Array.from(result.resolveMap.entries()));
-});
-
-Deno.test("processPrimitives - uses fluid spacing references", async (t) => {
-  const config = defineConfig({
-    spacing: {
-      fluid: {
-        gap: {
-          value: {
-            minSize: 4,
-            maxSize: 24,
-            minWidth: 320,
-            maxWidth: 1280,
-            negativeSteps: [0],
-            positiveSteps: [1],
-            prefix: "gs",
-          },
-        },
-      },
-    },
-    primitives: {
-      box: {
-        value: {
-          default: {
-            value: {
-              padding: "var(--s) var(--m)",
-            },
-            variables: {
-              "s": "spacing_fluid.gap@s",
-              "m": "spacing_fluid.gap@m",
-            },
-            settings: { pxToRem: false },
-          },
-        },
-      },
-    },
-  });
-  const primitives = processPrimitives(config);
-  const expected = [
-    "/* box */",
-    "--box-default-padding: var(--spacing_fluid-gap-gs-s) var(--spacing_fluid-gap-gs-m);",
-  ].join("\n");
-  assertEquals(primitives.css.root, expected);
-  await assertSnapshot(t, primitives.css);
-  await assertSnapshot(t, Array.from(primitives.resolveMap.entries()));
-});
diff --git a/tests/spacing.test.ts b/tests/spacing.test.ts
deleted file mode 100644
index ca09609..0000000
--- a/tests/spacing.test.ts
+++ /dev/null
@@ -1,204 +0,0 @@
-import { assertEquals } from "@std/assert";
-import { assertSnapshot } from "@std/testing/snapshot";
-import { processSpacing } from "../src/modules/spacing.ts";
-import { defineConfig } from "../src/config.ts";
-
-Deno.test("processSpacing - generates correct spacing scale", async (t) => {
-  const config = defineConfig({
-    spacing: {
-      custom: {
-        size: {
-          value: { 1: "0.25rem", 2: "0.5rem", 3: "0.75rem", s: "16px" },
-        },
-      },
-    },
-  });
-
-  const result = processSpacing(config.spacing);
-  const expected = [
-    "--spacing-size-1: 0.25rem;",
-    "--spacing-size-2: 0.5rem;",
-    "--spacing-size-3: 0.75rem;",
-    "--spacing-size-s: 1rem;",
-  ].join("\n");
-  assertEquals(result.css.root, expected);
-
-  assertEquals(Array.from(result.resolveMap.keys()), [
-    "spacing.custom.size.1",
-    "spacing.custom.size.2",
-    "spacing.custom.size.3",
-    "spacing.custom.size.s",
-  ]);
-  await assertSnapshot(t, result.css.root);
-  await assertSnapshot(t, Array.from(result.resolveMap.entries()));
-});
-
-// Test with string keys
-Deno.test("processSpacing - handles settings", async (t) => {
-  const config = defineConfig({
-    spacing: {
-      custom: {
-        size: {
-          value: { 1: "16px", 2: "0.5rem" },
-          settings: { pxToRem: true },
-        },
-        scale: {
-          value: { "md": "8px", "lg": "0.75rem" },
-          settings: { pxToRem: false },
-        },
-      },
-    },
-  });
-
-  const result = processSpacing(config.spacing);
-  const expected = [
-    "--spacing-size-1: 1rem;",
-    "--spacing-size-2: 0.5rem;",
-    "--spacing-scale-md: 8px;",
-    "--spacing-scale-lg: 0.75rem;",
-  ].join("\n");
-
-  assertEquals(result.css.root, expected);
-
-  assertEquals(Array.from(result.resolveMap.keys()), [
-    "spacing.custom.size.1",
-    "spacing.custom.size.2",
-    "spacing.custom.scale.md",
-    "spacing.custom.scale.lg",
-  ]);
-  await assertSnapshot(t, result.css.root);
-  await assertSnapshot(t, Array.from(result.resolveMap.entries()));
-});
-
-Deno.test("processSpacing - generates fluid spacing (prefix)", async (t) => {
-  const config = defineConfig({
-    spacing: {
-      fluid: {
-        base: {
-          value: {
-            minSize: 4,
-            maxSize: 24,
-            minWidth: 320,
-            maxWidth: 1280,
-            negativeSteps: [0],
-            positiveSteps: [1, 2],
-            prefix: "foo",
-            customSizes: ["xs-l"],
-          },
-        },
-      },
-    },
-  });
-
-  const { css, resolveMap } = processSpacing(config.spacing);
-  const expected = [
-    "--spacing_fluid-base-foo-xs: clamp(0rem, 0rem + 0vw, 0rem);",
-    "--spacing_fluid-base-foo-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
-    "--spacing_fluid-base-foo-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
-    "--spacing_fluid-base-foo-l: clamp(0.5rem, -0.3333rem + 4.1667vw, 3rem);",
-    "--spacing_fluid-base-foo-xs-l: clamp(0rem, -1rem + 5vw, 3rem);",
-    "--spacing_fluid-base-foo-xs-s: clamp(0rem, -0.5rem + 2.5vw, 1.5rem);",
-    "--spacing_fluid-base-foo-s-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
-    "--spacing_fluid-base-foo-m-l: clamp(0.25rem, -0.6667rem + 4.5833vw, 3rem);",
-  ].join("\n");
-  assertEquals(css.root, expected);
-
-  assertEquals(Array.from(resolveMap.keys()), [
-    "spacing_fluid.base@xs",
-    "spacing_fluid.base@s",
-    "spacing_fluid.base@m",
-    "spacing_fluid.base@l",
-    "spacing_fluid.base@xs-l",
-    "spacing_fluid.base@xs-s",
-    "spacing_fluid.base@s-m",
-    "spacing_fluid.base@m-l",
-  ]);
-  await assertSnapshot(t, css.root);
-  await assertSnapshot(t, Array.from(resolveMap.entries()));
-});
-
-Deno.test("processSpacing - fluid without prefix falls back to scale name", async (t) => {
-  const config = defineConfig({
-    spacing: {
-      fluid: {
-        rhythm: {
-          value: {
-            minSize: 2,
-            maxSize: 20,
-            minWidth: 320,
-            maxWidth: 1280,
-            negativeSteps: [0],
-            positiveSteps: [1],
-          },
-        },
-      },
-    },
-  });
-  const { css, resolveMap } = processSpacing(config.spacing);
-  const expected = [
-    "--spacing_fluid-rhythm-xs: clamp(0rem, 0rem + 0vw, 0rem);",
-    "--spacing_fluid-rhythm-s: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);",
-    "--spacing_fluid-rhythm-m: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);",
-    "--spacing_fluid-rhythm-xs-s: clamp(0rem, -0.4167rem + 2.0833vw, 1.25rem);",
-    "--spacing_fluid-rhythm-s-m: clamp(0.125rem, -0.25rem + 1.875vw, 1.25rem);",
-  ].join("\n");
-  assertEquals(css.root, expected);
-
-  assertEquals(Array.from(resolveMap.keys()), [
-    "spacing_fluid.rhythm@xs",
-    "spacing_fluid.rhythm@s",
-    "spacing_fluid.rhythm@m",
-    "spacing_fluid.rhythm@xs-s",
-    "spacing_fluid.rhythm@s-m",
-  ]);
-  await assertSnapshot(t, css.root);
-  await assertSnapshot(t, Array.from(resolveMap.entries()));
-});
-
-Deno.test("processSpacing - combines fluid and custom spacing", async (t) => {
-  const config = defineConfig({
-    spacing: {
-      fluid: {
-        base: {
-          value: {
-            minSize: 4,
-            maxSize: 24,
-            minWidth: 320,
-            maxWidth: 1280,
-            negativeSteps: [0],
-            positiveSteps: [1],
-            prefix: "flux",
-          },
-        },
-      },
-      custom: {
-        gap: {
-          value: { 1: "4px", 2: "8px" },
-          settings: { pxToRem: false },
-        },
-      },
-    },
-  });
-  const { css, resolveMap } = processSpacing(config.spacing!);
-  const expected = [
-    "--spacing_fluid-base-flux-xs: clamp(0rem, 0rem + 0vw, 0rem);",
-    "--spacing_fluid-base-flux-s: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
-    "--spacing_fluid-base-flux-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
-    "--spacing_fluid-base-flux-xs-s: clamp(0rem, -0.5rem + 2.5vw, 1.5rem);",
-    "--spacing_fluid-base-flux-s-m: clamp(0.25rem, -0.1667rem + 2.0833vw, 1.5rem);",
-    "--spacing-gap-1: 4px;",
-    "--spacing-gap-2: 8px;",
-  ].join("\n");
-  assertEquals(css.root, expected);
-  assertEquals(Array.from(resolveMap.keys()), [
-    "spacing_fluid.base@xs",
-    "spacing_fluid.base@s",
-    "spacing_fluid.base@m",
-    "spacing_fluid.base@xs-s",
-    "spacing_fluid.base@s-m",
-    "spacing.custom.gap.1",
-    "spacing.custom.gap.2",
-  ]);
-  await assertSnapshot(t, css.root);
-  await assertSnapshot(t, Array.from(resolveMap.entries()));
-});
diff --git a/tests/typography.test.ts b/tests/typography.test.ts
deleted file mode 100644
index cd88e69..0000000
--- a/tests/typography.test.ts
+++ /dev/null
@@ -1,187 +0,0 @@
-import { assertEquals } from "@std/assert";
-import { assertSnapshot } from "@std/testing/snapshot";
-import { defineConfig, processTypography } from "../src/mod.ts";
-import { getLines } from "./helpers.ts";
-
-Deno.test("processTypography - generates correct CSS variables", async (t) => {
-  const config = defineConfig({
-    typography: {
-      fluid: {
-        arial: {
-          value: {
-            minWidth: 320,
-            minFontSize: 14,
-            minTypeScale: 1.25,
-            maxWidth: 1435,
-            maxFontSize: 16,
-            maxTypeScale: 1.25,
-            positiveSteps: 5,
-            negativeSteps: 3,
-          },
-        },
-      },
-    },
-  });
-
-  const expectedSizes = [
-    "4xl",
-    "3xl",
-    "2xl",
-    "xl",
-    "l",
-    "m",
-    "s",
-    "xs",
-    "2xs",
-  ];
-  const result = processTypography(config.typography);
-  const lines = getLines(result.css.root);
-  assertEquals(lines.length, expectedSizes.length);
-
-  // Test a specific value for precision
-  const xlLine = lines.find((line) => line.includes("--typography_fluid-arial-xl:"));
-  assertEquals(
-    xlLine,
-    "--typography_fluid-arial-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);",
-  );
-
-  assertEquals(
-    Array.from(result.resolveMap.keys()),
-    expectedSizes.map((size) => `typography_fluid.arial@${size}`),
-  );
-
-  // Test that we have all the expected size variables
-  expectedSizes.forEach((size) => {
-    const hasSize = lines.some((line) =>
-      line.includes(`--typography_fluid-arial-${size}:`)
-    );
-    assertEquals(hasSize, true, `Missing size ${size}`);
-  });
-  await assertSnapshot(t, result.css);
-  await assertSnapshot(t, Array.from(result.resolveMap.entries()));
-});
-
-Deno.test("typography - can handle custom labels and prefixes", async (t) => {
-  const config = defineConfig({
-    typography: {
-      fluid: {
-        arial: {
-          value: {
-            minWidth: 320,
-            minFontSize: 14,
-            minTypeScale: 1.25,
-            maxWidth: 1435,
-            maxFontSize: 16,
-            maxTypeScale: 1.25,
-            positiveSteps: 7,
-            negativeSteps: 2,
-            prefix: "text",
-          },
-          settings: {
-            customLabel: {
-              "-2": "xs",
-              "-1": "s",
-              "0": "m",
-              "1": "l",
-              "2": "xl",
-              "3": "xxl",
-              "4": "h4",
-              "5": "h3",
-              "6": "h2",
-              "7": "h1",
-            },
-          },
-        },
-      },
-    },
-  });
-
-  const expectedSizes = [
-    "xs",
-    "s",
-    "m",
-    "l",
-    "xl",
-    "xxl",
-    "h4",
-    "h3",
-    "h2",
-    "h1",
-  ];
-  const result = processTypography(config.typography);
-  const lines = getLines(result.css.root);
-  assertEquals(lines.length, expectedSizes.length);
-
-  // Test a specific value for precision
-  const xlLine = lines.find((line) => line.includes("--typography_fluid-arial-text-xl:"));
-  assertEquals(
-    xlLine,
-    "--typography_fluid-arial-text-xl: clamp(1.3672rem, 1.3111rem + 0.2803vw, 1.5625rem);",
-  );
-
-  assertEquals(
-    Array.from(result.resolveMap.keys()),
-    expectedSizes.toReversed().map((size) => `typography_fluid.arial@${size}`),
-  );
-
-  // Test that we have all the expected size variables
-  expectedSizes.forEach((size) => {
-    const hasSize = lines.some((line) =>
-      line.includes(`--typography_fluid-arial-text-${size}:`)
-    );
-    assertEquals(hasSize, true, `Missing size ${size}`);
-  });
-  await assertSnapshot(t, result.css);
-  await assertSnapshot(t, Array.from(result.resolveMap.entries()));
-});
-
-Deno.test("processTypography - can process weights", async (t) => {
-  const positiveSteps = 3;
-  const negativeSteps = 3;
-  const config = defineConfig({
-    typography: {
-      fluid: {
-        arial: {
-          value: {
-            minWidth: 320,
-            minFontSize: 14,
-            minTypeScale: 1.25,
-            maxWidth: 1435,
-            maxFontSize: 16,
-            maxTypeScale: 1.25,
-            positiveSteps,
-            negativeSteps,
-          },
-        },
-      },
-      weight: {
-        arial: { value: { regular: "500" } },
-      },
-    },
-  });
-
-  const result = processTypography(config.typography);
-  const lines = getLines(result.css.root);
-  assertEquals(lines.length, positiveSteps + negativeSteps + 1 + 1); // 1 for base size and 1 for weight
-
-  assertEquals(
-    Array.from(result.resolveMap.keys()),
-    [
-      "typography_fluid.arial@2xl",
-      "typography_fluid.arial@xl",
-      "typography_fluid.arial@l",
-      "typography_fluid.arial@m",
-      "typography_fluid.arial@s",
-      "typography_fluid.arial@xs",
-      "typography_fluid.arial@2xs",
-      "typography.weight.arial.regular",
-    ],
-  );
-  // Test that we have the weight variable
-  const xlLine = lines.find((line) =>
-    line.includes("--typography-weight-arial-regular:")
-  );
-  assertEquals(xlLine, "--typography-weight-arial-regular: 500;");
-  await assertSnapshot(t, result.css);
-  await assertSnapshot(t, Array.from(result.resolveMap.entries()));
-});
diff --git a/tsconfig.base.json b/tsconfig.base.json
new file mode 100644
index 0000000..99a9ccb
--- /dev/null
+++ b/tsconfig.base.json
@@ -0,0 +1,14 @@
+{
+  "compilerOptions": {
+    "target": "ES2023",
+    "lib": ["ES2023"],
+    "module": "NodeNext",
+    "moduleResolution": "NodeNext",
+    "strict": true,
+    "skipLibCheck": true,
+    "forceConsistentCasingInFileNames": true,
+    "allowImportingTsExtensions": true,
+    "resolveJsonModule": true,
+    "noEmit": true
+  }
+}

From 51d8314dc2cbb087122862684ebb689771d7ec11 Mon Sep 17 00:00:00 2001
From: Hebilicious <xsh4k3@gmail.com>
Date: Fri, 20 Feb 2026 02:39:15 +0700
Subject: [PATCH 2/4] ci: use setup-toolchain and moon ci

---
 .github/workflows/ci.yaml            | 27 ++++++++++-----------------
 .github/workflows/release.yaml       | 15 ++++++---------
 example/tailwind-nextjs/moon.yml     |  2 ++
 example/tailwind-nuxt/moon.yml       |  4 ++++
 example/tailwind-solidstart/moon.yml |  2 ++
 example/tailwind-sveltekit/moon.yml  |  4 ++++
 example/vanilla-react-css/moon.yml   |  2 ++
 example/vanilla-solid-css/moon.yml   |  2 ++
 example/vanilla-svelte-css/moon.yml  |  2 ++
 example/vanilla-vue-css/moon.yml     |  2 ++
 packages/cssforge/moon.yml           | 14 +++++++++++++-
 packages/repo-tools/moon.yml         |  1 +
 12 files changed, 50 insertions(+), 27 deletions(-)

diff --git a/.github/workflows/ci.yaml b/.github/workflows/ci.yaml
index 1b72840..4f25b90 100644
--- a/.github/workflows/ci.yaml
+++ b/.github/workflows/ci.yaml
@@ -14,24 +14,17 @@ jobs:
 
     steps:
       - uses: actions/checkout@v4
+        with:
+          fetch-depth: 0
 
-      - name: Install proto
-        run: curl -fsSL https://moonrepo.dev/install/proto.sh | bash -s -- 0.55.2 --yes
-
-      - name: Add proto to PATH
-        run: echo "$HOME/.proto/bin" >> "$GITHUB_PATH"
-
-      - name: Install toolchains from .prototools
-        run: proto install
+      - name: Setup toolchain
+        uses: moonrepo/setup-toolchain@v0
+        with:
+          moon-version: "2.0.0"
+          auto-install: true
 
       - name: Install dependencies
-        run: proto run pnpm -- install --frozen-lockfile
-
-      - name: Format
-        run: moon run :format
-
-      - name: Test
-        run: moon run :test
+        run: pnpm install --frozen-lockfile
 
-      - name: Typecheck
-        run: moon run :typecheck
+      - name: Run CI
+        run: moon ci
diff --git a/.github/workflows/release.yaml b/.github/workflows/release.yaml
index 760f932..1174231 100644
--- a/.github/workflows/release.yaml
+++ b/.github/workflows/release.yaml
@@ -21,17 +21,14 @@ jobs:
         with:
           fetch-depth: 0
 
-      - name: Install proto
-        run: curl -fsSL https://moonrepo.dev/install/proto.sh | bash -s -- 0.55.2 --yes
-
-      - name: Add proto to PATH
-        run: echo "$HOME/.proto/bin" >> "$GITHUB_PATH"
-
-      - name: Install toolchains from .prototools
-        run: proto install
+      - name: Setup toolchain
+        uses: moonrepo/setup-toolchain@v0
+        with:
+          moon-version: "2.0.0"
+          auto-install: true
 
       - name: Install dependencies
-        run: proto run pnpm -- install --frozen-lockfile
+        run: pnpm install --frozen-lockfile
 
       - name: Create Release Pull Request
         id: changesets
diff --git a/example/tailwind-nextjs/moon.yml b/example/tailwind-nextjs/moon.yml
index b7b2dde..99777b4 100644
--- a/example/tailwind-nextjs/moon.yml
+++ b/example/tailwind-nextjs/moon.yml
@@ -12,6 +12,8 @@ tasks:
     args: ["build"]
     deps:
       - "^:build"
+    options:
+      runInCI: false
   dev:
     command: "next"
     args: ["dev"]
diff --git a/example/tailwind-nuxt/moon.yml b/example/tailwind-nuxt/moon.yml
index 30ae9f2..4ba35ba 100644
--- a/example/tailwind-nuxt/moon.yml
+++ b/example/tailwind-nuxt/moon.yml
@@ -10,12 +10,16 @@ tasks:
   prepare:
     command: "nuxt"
     args: ["prepare"]
+    options:
+      runInCI: false
   build:
     command: "nuxt"
     args: ["build"]
     deps:
       - "^:build"
       - "~:prepare"
+    options:
+      runInCI: false
   dev:
     command: "nuxt"
     args: ["dev"]
diff --git a/example/tailwind-solidstart/moon.yml b/example/tailwind-solidstart/moon.yml
index 630af3e..9d363a7 100644
--- a/example/tailwind-solidstart/moon.yml
+++ b/example/tailwind-solidstart/moon.yml
@@ -12,6 +12,8 @@ tasks:
     args: ["build"]
     deps:
       - "^:build"
+    options:
+      runInCI: false
   dev:
     command: "vinxi"
     args: ["dev"]
diff --git a/example/tailwind-sveltekit/moon.yml b/example/tailwind-sveltekit/moon.yml
index 4816d05..463af58 100644
--- a/example/tailwind-sveltekit/moon.yml
+++ b/example/tailwind-sveltekit/moon.yml
@@ -9,12 +9,16 @@ dependsOn:
 tasks:
   prepare:
     script: "svelte-kit sync || echo ''"
+    options:
+      runInCI: false
   build:
     command: "vite"
     args: ["build"]
     deps:
       - "^:build"
       - "~:prepare"
+    options:
+      runInCI: false
   dev:
     command: "vite"
     args: ["dev"]
diff --git a/example/vanilla-react-css/moon.yml b/example/vanilla-react-css/moon.yml
index 31dd7ed..13ecb96 100644
--- a/example/vanilla-react-css/moon.yml
+++ b/example/vanilla-react-css/moon.yml
@@ -11,6 +11,8 @@ tasks:
     script: "tsc -b && vite build"
     deps:
       - "^:build"
+    options:
+      runInCI: false
   dev:
     command: "vite"
     deps:
diff --git a/example/vanilla-solid-css/moon.yml b/example/vanilla-solid-css/moon.yml
index a4d9b61..b30cdcb 100644
--- a/example/vanilla-solid-css/moon.yml
+++ b/example/vanilla-solid-css/moon.yml
@@ -11,6 +11,8 @@ tasks:
     script: "tsc -b && vite build"
     deps:
       - "^:build"
+    options:
+      runInCI: false
   dev:
     command: "vite"
     deps:
diff --git a/example/vanilla-svelte-css/moon.yml b/example/vanilla-svelte-css/moon.yml
index 6639055..87e4b9e 100644
--- a/example/vanilla-svelte-css/moon.yml
+++ b/example/vanilla-svelte-css/moon.yml
@@ -12,6 +12,8 @@ tasks:
     args: ["build"]
     deps:
       - "^:build"
+    options:
+      runInCI: false
   dev:
     command: "vite"
     deps:
diff --git a/example/vanilla-vue-css/moon.yml b/example/vanilla-vue-css/moon.yml
index 1663b0c..bafcaba 100644
--- a/example/vanilla-vue-css/moon.yml
+++ b/example/vanilla-vue-css/moon.yml
@@ -11,6 +11,8 @@ tasks:
     script: "vue-tsc -b && vite build"
     deps:
       - "^:build"
+    options:
+      runInCI: false
   dev:
     command: "vite"
     deps:
diff --git a/packages/cssforge/moon.yml b/packages/cssforge/moon.yml
index 90bb276..a466b6d 100644
--- a/packages/cssforge/moon.yml
+++ b/packages/cssforge/moon.yml
@@ -29,6 +29,8 @@ tasks:
       - "tsup.config.ts"
       - "deno.json"
       - "/biome.json"
+    options:
+      runInCI: "always"
   format-write:
     command: "biome"
     args:
@@ -52,6 +54,8 @@ tasks:
       - "tests/**/*"
       - "scripts/**/*"
       - "/biome.json"
+    options:
+      runInCI: false
   typecheck:
     command: "tsc"
     args: ["--project", "tsconfig.json", "--noEmit"]
@@ -61,6 +65,8 @@ tasks:
       - "scripts/**/*"
       - "tsconfig.json"
       - "/tsconfig.base.json"
+    options:
+      runInCI: "always"
   test:
     command: "vitest"
     args: ["run"]
@@ -68,6 +74,8 @@ tasks:
       - "src/**/*"
       - "tests/**/*"
       - "vitest.config.ts"
+    options:
+      runInCI: "always"
   test-watch:
     command: "vitest"
     options:
@@ -83,6 +91,8 @@ tasks:
       - "tsconfig.json"
     outputs:
       - "dist"
+    options:
+      runInCI: false
   jsr-dry-run:
     command: "npx"
     args: ["jsr", "publish", "--dry-run", "--allow-dirty"]
@@ -93,6 +103,8 @@ tasks:
       - "deno.json"
       - "README.md"
       - "CHANGELOG.md"
+    options:
+      runInCI: false
   jsr-publish:
     command: "npx"
     args: ["jsr", "publish"]
@@ -104,7 +116,7 @@ tasks:
       - "README.md"
       - "CHANGELOG.md"
     options:
-      runInCI: "only"
+      runInCI: false
   readme-update:
     command: "tsx"
     args: ["./scripts/update-readme.ts"]
diff --git a/packages/repo-tools/moon.yml b/packages/repo-tools/moon.yml
index 7280eeb..f91ec26 100644
--- a/packages/repo-tools/moon.yml
+++ b/packages/repo-tools/moon.yml
@@ -13,3 +13,4 @@ tasks:
     script: "npx changeset version && node packages/cssforge/scripts/sync-version.js"
     options:
       runFromWorkspaceRoot: true
+      runInCI: false

From 555502845ac4822a8d1a0c633d04fe2f61784b15 Mon Sep 17 00:00:00 2001
From: Hebilicious <xsh4k3@gmail.com>
Date: Fri, 20 Feb 2026 02:52:03 +0700
Subject: [PATCH 3/4] ci: remove explicit pnpm install steps

---
 .github/workflows/ci.yaml      | 3 ---
 .github/workflows/release.yaml | 3 ---
 2 files changed, 6 deletions(-)

diff --git a/.github/workflows/ci.yaml b/.github/workflows/ci.yaml
index 4f25b90..2a123af 100644
--- a/.github/workflows/ci.yaml
+++ b/.github/workflows/ci.yaml
@@ -23,8 +23,5 @@ jobs:
           moon-version: "2.0.0"
           auto-install: true
 
-      - name: Install dependencies
-        run: pnpm install --frozen-lockfile
-
       - name: Run CI
         run: moon ci
diff --git a/.github/workflows/release.yaml b/.github/workflows/release.yaml
index 1174231..af6887a 100644
--- a/.github/workflows/release.yaml
+++ b/.github/workflows/release.yaml
@@ -27,9 +27,6 @@ jobs:
           moon-version: "2.0.0"
           auto-install: true
 
-      - name: Install dependencies
-        run: pnpm install --frozen-lockfile
-
       - name: Create Release Pull Request
         id: changesets
         uses: changesets/action@v1

From ccef01bd35431f73e6913523bbaba66c85afb367 Mon Sep 17 00:00:00 2001
From: Hebilicious <xsh4k3@gmail.com>
Date: Sat, 21 Feb 2026 15:07:29 +0700
Subject: [PATCH 4/4] chore: finalize node/moon migration changes

---
 .github/workflows/release.yaml              |   2 +-
 .moon/workspace.yml                         |   9 +-
 biome.json                                  |   7 ++
 docs/migration-plan-node-moon-proto.md      | 102 --------------------
 packages/repo-tools/moon.yml => moon.yml    |   3 +-
 packages/cssforge/{deno.json => jsr.json}   |   1 +
 packages/cssforge/moon.yml                  |  40 +++++---
 packages/cssforge/package.json              |   2 +-
 packages/cssforge/scripts/sync-version.js   |   8 +-
 packages/cssforge/scripts/update-readme.ts  |   4 +-
 packages/cssforge/src/cli.ts                |  14 +--
 packages/cssforge/src/generator.ts          |   2 +-
 packages/cssforge/src/mod.ts                |   8 +-
 packages/cssforge/src/modules/colors.ts     |   8 +-
 packages/cssforge/src/modules/primitive.ts  |  15 ++-
 packages/cssforge/src/modules/typography.ts |   2 +-
 packages/cssforge/tests/colors.test.ts      |   2 +-
 packages/cssforge/tests/primitive.test.ts   |   4 +-
 packages/cssforge/tests/spacing.test.ts     |   4 +-
 packages/cssforge/tests/typography.test.ts  |   2 +-
 packages/cssforge/tests/vitest-compat.ts    |   2 +-
 21 files changed, 85 insertions(+), 156 deletions(-)
 delete mode 100644 docs/migration-plan-node-moon-proto.md
 rename packages/repo-tools/moon.yml => moon.yml (81%)
 rename packages/cssforge/{deno.json => jsr.json} (87%)

diff --git a/.github/workflows/release.yaml b/.github/workflows/release.yaml
index af6887a..c017a0b 100644
--- a/.github/workflows/release.yaml
+++ b/.github/workflows/release.yaml
@@ -33,7 +33,7 @@ jobs:
         with:
           commit: "chore(release): update release metadata"
           title: "release: update packages"
-          version: moon run repo-tools:version
+          version: moon run root:version
           publish: echo "No npm publish step"
         env:
           GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
diff --git a/.moon/workspace.yml b/.moon/workspace.yml
index 0352ecd..7205d99 100644
--- a/.moon/workspace.yml
+++ b/.moon/workspace.yml
@@ -3,9 +3,12 @@ $schema: "https://moonrepo.dev/schemas/workspace.json"
 defaultProject: "cssforge"
 
 projects:
-  - "packages/*"
-  - "example/*"
-  - "!example/basic"
+  sources:
+    root: "."
+  globs:
+    - "packages/*"
+    - "example/*"
+    - "!example/basic"
 
 vcs:
   client: "git"
diff --git a/biome.json b/biome.json
index a6c4bc2..6294fb1 100644
--- a/biome.json
+++ b/biome.json
@@ -1,5 +1,12 @@
 {
   "$schema": "https://biomejs.dev/schemas/2.4.2/schema.json",
+  "assist": {
+    "actions": {
+      "source": {
+        "organizeImports": "on"
+      }
+    }
+  },
   "formatter": {
     "lineWidth": 90
   },
diff --git a/docs/migration-plan-node-moon-proto.md b/docs/migration-plan-node-moon-proto.md
deleted file mode 100644
index 3522655..0000000
--- a/docs/migration-plan-node-moon-proto.md
+++ /dev/null
@@ -1,102 +0,0 @@
-# Migration Plan: Deno -> Node + pnpm Workspace + moon v2 + proto (JSR retained)
-
-## Summary
-
-Refactor to a Node-first monorepo with `pnpm` workspaces + `moon v2` + `proto`, keep JSR publishing for `@hebilicious/cssforge`, move the publishable package to `packages/cssforge`, and keep Deno only where required for JSR publishing.
-
-## Locked decisions
-
-- Full repo migration.
-- Keep Deno only for JSR publishing.
-- Move library to `packages/cssforge`.
-- Moon-first CI.
-- Install moon/proto skills from `hyperb1iss/moonrepo-skill` via the skills CLI and
-  commit installed files.
-- pnpm-only examples/docs.
-- Vitest for tests.
-- Biome (latest) for formatting/linting.
-- Do not run example tests on CI.
-
-## Pinned versions
-
-- Node `24.13.1`
-- pnpm `10.30.0`
-- moon `2.0.0`
-- proto `0.55.2`
-- Biome `2.4.2`
-- Vitest `4.0.18`
-
-## Repo structure
-
-- Add `pnpm-workspace.yaml` with:
-  - `packages/*`
-  - `example/*`
-- Move library from root to `packages/cssforge`.
-- Keep examples under `example/*` as workspace packages.
-- Root `package.json` becomes private orchestration package.
-
-## Skills
-
-- Install:
-  - `npx skills add https://github.com/hyperb1iss/moonrepo-skill --skill moon`
-  - `npx skills add https://github.com/hyperb1iss/moonrepo-skill --skill proto`
-- Commit:
-  - `.agents/skills/moon`
-  - `.agents/skills/proto`
-
-## Tooling
-
-- Add `.prototools` with exact pins.
-- Add moon v2 config:
-  - `.moon/workspace.yml`
-  - `.moon/toolchains.yml`
-  - `.moon/tasks/*.yml`
-  - `moon.yml` per project (package + examples)
-
-## Tasks
-
-- Standard moon targets:
-  - `:format`, `:lint`, `:typecheck`, `:test`, `:build`
-- Package targets:
-  - `cssforge:jsr-dry-run`
-  - `cssforge:jsr-publish`
-- Example e2e tasks enabled locally, disabled in CI.
-
-## Package/API expectations
-
-- Preserve exports:
-  - `@hebilicious/cssforge`
-  - `@hebilicious/cssforge/cli`
-- Keep config schema/API behavior unchanged.
-- Change developer workflow from Deno tasks to moon+pnpm.
-
-## Test migration
-
-- Convert Deno tests to Vitest.
-- Port snapshots and assertions with behavior parity.
-- Keep example Playwright tests runnable locally via moon targets.
-
-## CI/release
-
-- CI runs moon targets only (`format`, `test`, `typecheck`).
-- No example e2e in CI.
-- Release keeps changesets flow and publishes to JSR from `packages/cssforge`.
-- Deno setup allowed only in JSR publish step if required.
-
-## Docs updates
-
-- Update root README to pnpm+moon-first workflow.
-- Remove Deno usage from normal contributor paths.
-- Update example READMEs to pnpm-only.
-- Update AGENTS/skills references to repo-local skills.
-
-## Acceptance criteria
-
-1. `pnpm install` produces one root `pnpm-lock.yaml`.
-2. No `package-lock.json` in repo.
-3. `moon run cssforge:test` passes Vitest suite.
-4. CLI generate tasks work from workspace.
-5. Example e2e runs locally; not run in CI.
-6. `moon run cssforge:jsr-dry-run` passes.
-7. JSR publish remains functional.
-8. Skills installed via the CLI in `.agents/skills`.
diff --git a/packages/repo-tools/moon.yml b/moon.yml
similarity index 81%
rename from packages/repo-tools/moon.yml
rename to moon.yml
index f91ec26..f862162 100644
--- a/packages/repo-tools/moon.yml
+++ b/moon.yml
@@ -1,5 +1,6 @@
 $schema: "https://moonrepo.dev/schemas/project.json"
 
+language: "bash"
 layer: "tool"
 
 tasks:
@@ -7,10 +8,8 @@ tasks:
     command: "npx"
     args: ["changeset"]
     options:
-      runFromWorkspaceRoot: true
       runInCI: false
   version:
     script: "npx changeset version && node packages/cssforge/scripts/sync-version.js"
     options:
-      runFromWorkspaceRoot: true
       runInCI: false
diff --git a/packages/cssforge/deno.json b/packages/cssforge/jsr.json
similarity index 87%
rename from packages/cssforge/deno.json
rename to packages/cssforge/jsr.json
index 7f891e1..41af1e7 100644
--- a/packages/cssforge/deno.json
+++ b/packages/cssforge/jsr.json
@@ -1,4 +1,5 @@
 {
+	"$schema": "https://jsr.io/schema/config-file.v1.json",
 	"name": "@hebilicious/cssforge",
 	"version": "0.4.0",
 	"license": "MIT",
diff --git a/packages/cssforge/moon.yml b/packages/cssforge/moon.yml
index a466b6d..ad324ec 100644
--- a/packages/cssforge/moon.yml
+++ b/packages/cssforge/moon.yml
@@ -1,4 +1,4 @@
-$schema: "https://moonrepo.dev/schemas/project.json"
+$schema: "https://moonrepo.dev/schemas/v2/project.json"
 
 language: "typescript"
 layer: "library"
@@ -10,7 +10,7 @@ tasks:
   format:
     command: "biome"
     args:
-      - "format"
+      - "check"
       - "src"
       - "tests"
       - "scripts"
@@ -18,7 +18,10 @@ tasks:
       - "tsconfig.json"
       - "vitest.config.ts"
       - "tsup.config.ts"
-      - "deno.json"
+      - "jsr.json"
+      - "--linter-enabled=false"
+      - "--assist-enabled=true"
+      - "--enforce-assist=true"
     inputs:
       - "src/**/*"
       - "tests/**/*"
@@ -27,14 +30,14 @@ tasks:
       - "tsconfig.json"
       - "vitest.config.ts"
       - "tsup.config.ts"
-      - "deno.json"
+      - "jsr.json"
       - "/biome.json"
     options:
       runInCI: "always"
   format-write:
     command: "biome"
     args:
-      - "format"
+      - "check"
       - "src"
       - "tests"
       - "scripts"
@@ -42,13 +45,23 @@ tasks:
       - "tsconfig.json"
       - "vitest.config.ts"
       - "tsup.config.ts"
-      - "deno.json"
+      - "jsr.json"
+      - "--linter-enabled=false"
+      - "--assist-enabled=true"
+      - "--enforce-assist=true"
       - "--write"
     options:
       runInCI: false
   lint:
     command: "biome"
-    args: ["lint", "src", "tests", "scripts"]
+    args:
+      - "check"
+      - "src"
+      - "tests"
+      - "scripts"
+      - "--formatter-enabled=false"
+      - "--assist-enabled=true"
+      - "--enforce-assist=true"
     inputs:
       - "src/**/*"
       - "tests/**/*"
@@ -57,8 +70,13 @@ tasks:
     options:
       runInCI: false
   typecheck:
-    command: "tsc"
-    args: ["--project", "tsconfig.json", "--noEmit"]
+    command: "npx"
+    args:
+      - "-y"
+      - "@typescript/native-preview"
+      - "--project"
+      - "tsconfig.json"
+      - "--noEmit"
     inputs:
       - "src/**/*"
       - "tests/**/*"
@@ -100,7 +118,7 @@ tasks:
       - "~:build"
     inputs:
       - "src/**/*"
-      - "deno.json"
+      - "jsr.json"
       - "README.md"
       - "CHANGELOG.md"
     options:
@@ -112,7 +130,7 @@ tasks:
       - "~:build"
     inputs:
       - "src/**/*"
-      - "deno.json"
+      - "jsr.json"
       - "README.md"
       - "CHANGELOG.md"
     options:
diff --git a/packages/cssforge/package.json b/packages/cssforge/package.json
index 758c9a2..3d47d3e 100644
--- a/packages/cssforge/package.json
+++ b/packages/cssforge/package.json
@@ -19,7 +19,7 @@
 		"src",
 		"README.md",
 		"CHANGELOG.md",
-		"deno.json"
+		"jsr.json"
 	],
 	"dependencies": {
 		"chokidar": "4.0.3",
diff --git a/packages/cssforge/scripts/sync-version.js b/packages/cssforge/scripts/sync-version.js
index 51ee669..f85bfaa 100644
--- a/packages/cssforge/scripts/sync-version.js
+++ b/packages/cssforge/scripts/sync-version.js
@@ -6,11 +6,11 @@ const scriptDir = path.dirname(fileURLToPath(import.meta.url));
 const packageRoot = path.resolve(scriptDir, "..");
 
 const packageJsonPath = path.join(packageRoot, "package.json");
-const denoJsonPath = path.join(packageRoot, "deno.json");
+const jsrJsonPath = path.join(packageRoot, "jsr.json");
 
 const packageJson = JSON.parse(fs.readFileSync(packageJsonPath, "utf8"));
-const denoJson = JSON.parse(fs.readFileSync(denoJsonPath, "utf8"));
+const jsrJson = JSON.parse(fs.readFileSync(jsrJsonPath, "utf8"));
 
-denoJson.version = packageJson.version;
+jsrJson.version = packageJson.version;
 
-fs.writeFileSync(denoJsonPath, `${JSON.stringify(denoJson, null, 2)}\n`);
+fs.writeFileSync(jsrJsonPath, `${JSON.stringify(jsrJson, null, 2)}\n`);
diff --git a/packages/cssforge/scripts/update-readme.ts b/packages/cssforge/scripts/update-readme.ts
index 78679b6..47067fe 100644
--- a/packages/cssforge/scripts/update-readme.ts
+++ b/packages/cssforge/scripts/update-readme.ts
@@ -11,11 +11,11 @@ import { randomUUID } from "node:crypto";
 import { mkdtemp, readFile, rm, writeFile } from "node:fs/promises";
 import { tmpdir } from "node:os";
 import { join, resolve } from "node:path";
+import process from "node:process";
 import { pathToFileURL } from "node:url";
 import { md } from "mdbox";
-import process from "node:process";
-import { generateCSS } from "../src/generator.ts";
 import type { CSSForgeConfig } from "../src/config.ts";
+import { generateCSS } from "../src/generator.ts";
 
 const PACKAGE_ROOT = process.cwd();
 const README_PATH = resolve(PACKAGE_ROOT, "../../README.md");
diff --git a/packages/cssforge/src/cli.ts b/packages/cssforge/src/cli.ts
index b91289d..bb57706 100644
--- a/packages/cssforge/src/cli.ts
+++ b/packages/cssforge/src/cli.ts
@@ -1,4 +1,10 @@
 #!/usr/bin/env node
+import fs from "node:fs/promises";
+import { resolve } from "node:path";
+import process from "node:process";
+import { pathToFileURL } from "node:url";
+import chokidar from "chokidar";
+import type { CommandDef } from "citty";
 /**
  * This module provides the command-line interface (CLI) for CSSForge.
  * It allows generating CSS variables from a configuration file, with options
@@ -7,14 +13,8 @@
  * @module
  */
 import { defineCommand, runMain } from "citty";
-import chokidar from "chokidar";
-import fs from "node:fs/promises";
-import { resolve } from "node:path";
-import { pathToFileURL } from "node:url";
-import { generateCSS, generateJSON, generateTS } from "./generator.ts";
-import process from "node:process";
 import type { CSSForgeConfig } from "./config.ts";
-import type { CommandDef } from "citty";
+import { generateCSS, generateJSON, generateTS } from "./generator.ts";
 
 const writeFileRecursive = (path: string, data: string) =>
 	fs
diff --git a/packages/cssforge/src/generator.ts b/packages/cssforge/src/generator.ts
index fc00b4f..e7a934e 100644
--- a/packages/cssforge/src/generator.ts
+++ b/packages/cssforge/src/generator.ts
@@ -1,5 +1,5 @@
-import type { ResolveMap } from "./lib.ts";
 import type { CSSForgeConfig } from "./config.ts";
+import type { ResolveMap } from "./lib.ts";
 import { processColors } from "./modules/colors.ts";
 import { processPrimitives } from "./modules/primitive.ts";
 import { processSpacing } from "./modules/spacing.ts";
diff --git a/packages/cssforge/src/mod.ts b/packages/cssforge/src/mod.ts
index 2705e67..d60f73e 100644
--- a/packages/cssforge/src/mod.ts
+++ b/packages/cssforge/src/mod.ts
@@ -6,14 +6,14 @@
  *
  * @module
  */
-import { generateCSS } from "./generator.ts";
+
+import type { CSSForgeConfig } from "./config.ts";
 import { defineConfig } from "./config.ts";
+import { generateCSS } from "./generator.ts";
 import { processColors } from "./modules/colors.ts";
-import { processTypography } from "./modules/typography.ts";
 import { processPrimitives } from "./modules/primitive.ts";
 import { processSpacing } from "./modules/spacing.ts";
-
-import type { CSSForgeConfig } from "./config.ts";
+import { processTypography } from "./modules/typography.ts";
 /**
  * The main configuration object for CSSForge.
  */
diff --git a/packages/cssforge/src/modules/colors.ts b/packages/cssforge/src/modules/colors.ts
index 77503d7..06fbb70 100644
--- a/packages/cssforge/src/modules/colors.ts
+++ b/packages/cssforge/src/modules/colors.ts
@@ -1,8 +1,12 @@
 import Color from "colorjs.io";
-import { type Output, type ResolveMap, resolveValue } from "../lib.ts";
 import { validateName } from "../helpers.ts";
-import { getResolvedVariablesMap } from "../lib.ts";
 import type { Variables } from "../lib.ts";
+import {
+	getResolvedVariablesMap,
+	type Output,
+	type ResolveMap,
+	resolveValue,
+} from "../lib.ts";
 
 type ExactlyOne<T> = {
 	[K in keyof T]: {
diff --git a/packages/cssforge/src/modules/primitive.ts b/packages/cssforge/src/modules/primitive.ts
index b221eed..03338a8 100644
--- a/packages/cssforge/src/modules/primitive.ts
+++ b/packages/cssforge/src/modules/primitive.ts
@@ -1,17 +1,16 @@
-import type { ColorConfig } from "./colors.ts";
-import { processColors } from "./colors.ts";
-import type { TypographyConfig } from "./typography.ts";
-import { processTypography } from "./typography.ts";
-import type { PixelSettings, SpacingConfig } from "./spacing.ts";
-import { processSpacing } from "./spacing.ts";
+import { pxToRem, validateName } from "../helpers.ts";
 import {
 	getResolvedVariablesMap,
 	type Output,
 	resolveValue,
 	type Variables,
 } from "../lib.ts";
-import { validateName } from "../helpers.ts";
-import { pxToRem } from "../helpers.ts";
+import type { ColorConfig } from "./colors.ts";
+import { processColors } from "./colors.ts";
+import type { PixelSettings, SpacingConfig } from "./spacing.ts";
+import { processSpacing } from "./spacing.ts";
+import type { TypographyConfig } from "./typography.ts";
+import { processTypography } from "./typography.ts";
 
 interface PrimitiveProperties {
 	[key: string]: string;
diff --git a/packages/cssforge/src/modules/typography.ts b/packages/cssforge/src/modules/typography.ts
index 5b43a0c..6c44b1f 100644
--- a/packages/cssforge/src/modules/typography.ts
+++ b/packages/cssforge/src/modules/typography.ts
@@ -1,6 +1,6 @@
 import { calculateTypeScale, type UtopiaTypeConfig } from "utopia-core";
-import type { Output, ResolveMap } from "../lib.ts";
 import { validateName } from "../helpers.ts";
+import type { Output, ResolveMap } from "../lib.ts";
 
 export interface FluidTypeScaleDefinition {
 	/**
diff --git a/packages/cssforge/tests/colors.test.ts b/packages/cssforge/tests/colors.test.ts
index 64700c2..6083779 100644
--- a/packages/cssforge/tests/colors.test.ts
+++ b/packages/cssforge/tests/colors.test.ts
@@ -1,6 +1,6 @@
-import { Deno, assert, assertEquals, assertSnapshot } from "./vitest-compat.ts";
 import { defineConfig, processColors } from "../src/mod.ts";
 import { combine, getLines } from "./helpers.ts";
+import { assert, assertEquals, assertSnapshot, Deno } from "./vitest-compat.ts";
 
 Deno.test("processColors - converts hex to oklch", async (t) => {
 	const config = defineConfig({
diff --git a/packages/cssforge/tests/primitive.test.ts b/packages/cssforge/tests/primitive.test.ts
index 8799871..ef0ed2c 100644
--- a/packages/cssforge/tests/primitive.test.ts
+++ b/packages/cssforge/tests/primitive.test.ts
@@ -1,6 +1,6 @@
-import { Deno, assertEquals, assertSnapshot } from "./vitest-compat.ts";
-import { processPrimitives } from "../src/modules/primitive.ts";
 import { defineConfig } from "../src/mod.ts";
+import { processPrimitives } from "../src/modules/primitive.ts";
+import { assertEquals, assertSnapshot, Deno } from "./vitest-compat.ts";
 
 Deno.test("processPrimitives - processes button with variables", async (t) => {
 	const config = defineConfig({
diff --git a/packages/cssforge/tests/spacing.test.ts b/packages/cssforge/tests/spacing.test.ts
index 30eb5c0..7b0bd58 100644
--- a/packages/cssforge/tests/spacing.test.ts
+++ b/packages/cssforge/tests/spacing.test.ts
@@ -1,6 +1,6 @@
-import { Deno, assertEquals, assertSnapshot } from "./vitest-compat.ts";
-import { processSpacing } from "../src/modules/spacing.ts";
 import { defineConfig } from "../src/config.ts";
+import { processSpacing } from "../src/modules/spacing.ts";
+import { assertEquals, assertSnapshot, Deno } from "./vitest-compat.ts";
 
 Deno.test("processSpacing - generates correct spacing scale", async (t) => {
 	const config = defineConfig({
diff --git a/packages/cssforge/tests/typography.test.ts b/packages/cssforge/tests/typography.test.ts
index 2e83d7d..a7b8f12 100644
--- a/packages/cssforge/tests/typography.test.ts
+++ b/packages/cssforge/tests/typography.test.ts
@@ -1,6 +1,6 @@
-import { Deno, assertEquals, assertSnapshot } from "./vitest-compat.ts";
 import { defineConfig, processTypography } from "../src/mod.ts";
 import { getLines } from "./helpers.ts";
+import { assertEquals, assertSnapshot, Deno } from "./vitest-compat.ts";
 
 Deno.test("processTypography - generates correct CSS variables", async (t) => {
 	const config = defineConfig({
diff --git a/packages/cssforge/tests/vitest-compat.ts b/packages/cssforge/tests/vitest-compat.ts
index 774813c..086af7c 100644
--- a/packages/cssforge/tests/vitest-compat.ts
+++ b/packages/cssforge/tests/vitest-compat.ts
@@ -1,5 +1,5 @@
-import { expect, test } from "vitest";
 import type { TestContext } from "vitest";
+import { expect, test } from "vitest";
 
 export const Deno = {
 	test,